|
@@ -0,0 +1,10021 @@
|
|
|
|
+/*!
|
|
|
|
+ * Materialize v0.100.2 (http://materializecss.com)
|
|
|
|
+ * Copyright 2014-2017 Materialize
|
|
|
|
+ * MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE)
|
|
|
|
+ */
|
|
|
|
+var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }();
|
|
|
|
+
|
|
|
|
+function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } }
|
|
|
|
+
|
|
|
|
+// Check for jQuery.
|
|
|
|
+if (typeof jQuery === 'undefined') {
|
|
|
|
+ // Check if require is a defined function.
|
|
|
|
+ if (typeof require === 'function') {
|
|
|
|
+ jQuery = $ = require('jquery');
|
|
|
|
+ // Else use the dollar sign alias.
|
|
|
|
+ } else {
|
|
|
|
+ jQuery = $;
|
|
|
|
+ }
|
|
|
|
+}
|
|
|
|
+; /*
|
|
|
|
+ * jQuery Easing v1.4.0 - http://gsgd.co.uk/sandbox/jquery/easing/
|
|
|
|
+ * Open source under the BSD License.
|
|
|
|
+ * Copyright © 2008 George McGinley Smith
|
|
|
|
+ * All rights reserved.
|
|
|
|
+ * https://raw.github.com/gdsmith/jquery-easing/master/LICENSE
|
|
|
|
+ */
|
|
|
|
+
|
|
|
|
+(function (factory) {
|
|
|
|
+ if (typeof define === "function" && define.amd) {
|
|
|
|
+ define(['jquery'], function ($) {
|
|
|
|
+ return factory($);
|
|
|
|
+ });
|
|
|
|
+ } else if (typeof module === "object" && typeof module.exports === "object") {
|
|
|
|
+ exports = factory(require('jquery'));
|
|
|
|
+ } else {
|
|
|
|
+ factory(jQuery);
|
|
|
|
+ }
|
|
|
|
+})(function ($) {
|
|
|
|
+
|
|
|
|
+ // Preserve the original jQuery "swing" easing as "jswing"
|
|
|
|
+ $.easing['jswing'] = $.easing['swing'];
|
|
|
|
+
|
|
|
|
+ var pow = Math.pow,
|
|
|
|
+ sqrt = Math.sqrt,
|
|
|
|
+ sin = Math.sin,
|
|
|
|
+ cos = Math.cos,
|
|
|
|
+ PI = Math.PI,
|
|
|
|
+ c1 = 1.70158,
|
|
|
|
+ c2 = c1 * 1.525,
|
|
|
|
+ c3 = c1 + 1,
|
|
|
|
+ c4 = 2 * PI / 3,
|
|
|
|
+ c5 = 2 * PI / 4.5;
|
|
|
|
+
|
|
|
|
+ // x is the fraction of animation progress, in the range 0..1
|
|
|
|
+ function bounceOut(x) {
|
|
|
|
+ var n1 = 7.5625,
|
|
|
|
+ d1 = 2.75;
|
|
|
|
+ if (x < 1 / d1) {
|
|
|
|
+ return n1 * x * x;
|
|
|
|
+ } else if (x < 2 / d1) {
|
|
|
|
+ return n1 * (x -= 1.5 / d1) * x + .75;
|
|
|
|
+ } else if (x < 2.5 / d1) {
|
|
|
|
+ return n1 * (x -= 2.25 / d1) * x + .9375;
|
|
|
|
+ } else {
|
|
|
|
+ return n1 * (x -= 2.625 / d1) * x + .984375;
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ $.extend($.easing, {
|
|
|
|
+ def: 'easeOutQuad',
|
|
|
|
+ swing: function (x) {
|
|
|
|
+ return $.easing[$.easing.def](x);
|
|
|
|
+ },
|
|
|
|
+ easeInQuad: function (x) {
|
|
|
|
+ return x * x;
|
|
|
|
+ },
|
|
|
|
+ easeOutQuad: function (x) {
|
|
|
|
+ return 1 - (1 - x) * (1 - x);
|
|
|
|
+ },
|
|
|
|
+ easeInOutQuad: function (x) {
|
|
|
|
+ return x < 0.5 ? 2 * x * x : 1 - pow(-2 * x + 2, 2) / 2;
|
|
|
|
+ },
|
|
|
|
+ easeInCubic: function (x) {
|
|
|
|
+ return x * x * x;
|
|
|
|
+ },
|
|
|
|
+ easeOutCubic: function (x) {
|
|
|
|
+ return 1 - pow(1 - x, 3);
|
|
|
|
+ },
|
|
|
|
+ easeInOutCubic: function (x) {
|
|
|
|
+ return x < 0.5 ? 4 * x * x * x : 1 - pow(-2 * x + 2, 3) / 2;
|
|
|
|
+ },
|
|
|
|
+ easeInQuart: function (x) {
|
|
|
|
+ return x * x * x * x;
|
|
|
|
+ },
|
|
|
|
+ easeOutQuart: function (x) {
|
|
|
|
+ return 1 - pow(1 - x, 4);
|
|
|
|
+ },
|
|
|
|
+ easeInOutQuart: function (x) {
|
|
|
|
+ return x < 0.5 ? 8 * x * x * x * x : 1 - pow(-2 * x + 2, 4) / 2;
|
|
|
|
+ },
|
|
|
|
+ easeInQuint: function (x) {
|
|
|
|
+ return x * x * x * x * x;
|
|
|
|
+ },
|
|
|
|
+ easeOutQuint: function (x) {
|
|
|
|
+ return 1 - pow(1 - x, 5);
|
|
|
|
+ },
|
|
|
|
+ easeInOutQuint: function (x) {
|
|
|
|
+ return x < 0.5 ? 16 * x * x * x * x * x : 1 - pow(-2 * x + 2, 5) / 2;
|
|
|
|
+ },
|
|
|
|
+ easeInSine: function (x) {
|
|
|
|
+ return 1 - cos(x * PI / 2);
|
|
|
|
+ },
|
|
|
|
+ easeOutSine: function (x) {
|
|
|
|
+ return sin(x * PI / 2);
|
|
|
|
+ },
|
|
|
|
+ easeInOutSine: function (x) {
|
|
|
|
+ return -(cos(PI * x) - 1) / 2;
|
|
|
|
+ },
|
|
|
|
+ easeInExpo: function (x) {
|
|
|
|
+ return x === 0 ? 0 : pow(2, 10 * x - 10);
|
|
|
|
+ },
|
|
|
|
+ easeOutExpo: function (x) {
|
|
|
|
+ return x === 1 ? 1 : 1 - pow(2, -10 * x);
|
|
|
|
+ },
|
|
|
|
+ easeInOutExpo: function (x) {
|
|
|
|
+ return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ? pow(2, 20 * x - 10) / 2 : (2 - pow(2, -20 * x + 10)) / 2;
|
|
|
|
+ },
|
|
|
|
+ easeInCirc: function (x) {
|
|
|
|
+ return 1 - sqrt(1 - pow(x, 2));
|
|
|
|
+ },
|
|
|
|
+ easeOutCirc: function (x) {
|
|
|
|
+ return sqrt(1 - pow(x - 1, 2));
|
|
|
|
+ },
|
|
|
|
+ easeInOutCirc: function (x) {
|
|
|
|
+ return x < 0.5 ? (1 - sqrt(1 - pow(2 * x, 2))) / 2 : (sqrt(1 - pow(-2 * x + 2, 2)) + 1) / 2;
|
|
|
|
+ },
|
|
|
|
+ easeInElastic: function (x) {
|
|
|
|
+ return x === 0 ? 0 : x === 1 ? 1 : -pow(2, 10 * x - 10) * sin((x * 10 - 10.75) * c4);
|
|
|
|
+ },
|
|
|
|
+ easeOutElastic: function (x) {
|
|
|
|
+ return x === 0 ? 0 : x === 1 ? 1 : pow(2, -10 * x) * sin((x * 10 - 0.75) * c4) + 1;
|
|
|
|
+ },
|
|
|
|
+ easeInOutElastic: function (x) {
|
|
|
|
+ return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ? -(pow(2, 20 * x - 10) * sin((20 * x - 11.125) * c5)) / 2 : pow(2, -20 * x + 10) * sin((20 * x - 11.125) * c5) / 2 + 1;
|
|
|
|
+ },
|
|
|
|
+ easeInBack: function (x) {
|
|
|
|
+ return c3 * x * x * x - c1 * x * x;
|
|
|
|
+ },
|
|
|
|
+ easeOutBack: function (x) {
|
|
|
|
+ return 1 + c3 * pow(x - 1, 3) + c1 * pow(x - 1, 2);
|
|
|
|
+ },
|
|
|
|
+ easeInOutBack: function (x) {
|
|
|
|
+ return x < 0.5 ? pow(2 * x, 2) * ((c2 + 1) * 2 * x - c2) / 2 : (pow(2 * x - 2, 2) * ((c2 + 1) * (x * 2 - 2) + c2) + 2) / 2;
|
|
|
|
+ },
|
|
|
|
+ easeInBounce: function (x) {
|
|
|
|
+ return 1 - bounceOut(1 - x);
|
|
|
|
+ },
|
|
|
|
+ easeOutBounce: bounceOut,
|
|
|
|
+ easeInOutBounce: function (x) {
|
|
|
|
+ return x < 0.5 ? (1 - bounceOut(1 - 2 * x)) / 2 : (1 + bounceOut(2 * x - 1)) / 2;
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+});; // Custom Easing
|
|
|
|
+jQuery.extend(jQuery.easing, {
|
|
|
|
+ easeInOutMaterial: function (x, t, b, c, d) {
|
|
|
|
+ if ((t /= d / 2) < 1) return c / 2 * t * t + b;
|
|
|
|
+ return c / 4 * ((t -= 2) * t * t + 2) + b;
|
|
|
|
+ }
|
|
|
|
+});; /*! VelocityJS.org (1.2.3). (C) 2014 Julian Shapiro. MIT @license: en.wikipedia.org/wiki/MIT_License */
|
|
|
|
+/*! VelocityJS.org jQuery Shim (1.0.1). (C) 2014 The jQuery Foundation. MIT @license: en.wikipedia.org/wiki/MIT_License. */
|
|
|
|
+/*! Note that this has been modified by Materialize to confirm that Velocity is not already being imported. */
|
|
|
|
+jQuery.Velocity ? console.log("Velocity is already loaded. You may be needlessly importing Velocity again; note that Materialize includes Velocity.") : (!function (e) {
|
|
|
|
+ function t(e) {
|
|
|
|
+ var t = e.length,
|
|
|
|
+ a = r.type(e);return "function" === a || r.isWindow(e) ? !1 : 1 === e.nodeType && t ? !0 : "array" === a || 0 === t || "number" == typeof t && t > 0 && t - 1 in e;
|
|
|
|
+ }if (!e.jQuery) {
|
|
|
|
+ var r = function (e, t) {
|
|
|
|
+ return new r.fn.init(e, t);
|
|
|
|
+ };r.isWindow = function (e) {
|
|
|
|
+ return null != e && e == e.window;
|
|
|
|
+ }, r.type = function (e) {
|
|
|
|
+ return null == e ? e + "" : "object" == typeof e || "function" == typeof e ? n[i.call(e)] || "object" : typeof e;
|
|
|
|
+ }, r.isArray = Array.isArray || function (e) {
|
|
|
|
+ return "array" === r.type(e);
|
|
|
|
+ }, r.isPlainObject = function (e) {
|
|
|
|
+ var t;if (!e || "object" !== r.type(e) || e.nodeType || r.isWindow(e)) return !1;try {
|
|
|
|
+ if (e.constructor && !o.call(e, "constructor") && !o.call(e.constructor.prototype, "isPrototypeOf")) return !1;
|
|
|
|
+ } catch (a) {
|
|
|
|
+ return !1;
|
|
|
|
+ }for (t in e) {}return void 0 === t || o.call(e, t);
|
|
|
|
+ }, r.each = function (e, r, a) {
|
|
|
|
+ var n,
|
|
|
|
+ o = 0,
|
|
|
|
+ i = e.length,
|
|
|
|
+ s = t(e);if (a) {
|
|
|
|
+ if (s) for (; i > o && (n = r.apply(e[o], a), n !== !1); o++) {} else for (o in e) {
|
|
|
|
+ if (n = r.apply(e[o], a), n === !1) break;
|
|
|
|
+ }
|
|
|
|
+ } else if (s) for (; i > o && (n = r.call(e[o], o, e[o]), n !== !1); o++) {} else for (o in e) {
|
|
|
|
+ if (n = r.call(e[o], o, e[o]), n === !1) break;
|
|
|
|
+ }return e;
|
|
|
|
+ }, r.data = function (e, t, n) {
|
|
|
|
+ if (void 0 === n) {
|
|
|
|
+ var o = e[r.expando],
|
|
|
|
+ i = o && a[o];if (void 0 === t) return i;if (i && t in i) return i[t];
|
|
|
|
+ } else if (void 0 !== t) {
|
|
|
|
+ var o = e[r.expando] || (e[r.expando] = ++r.uuid);return a[o] = a[o] || {}, a[o][t] = n, n;
|
|
|
|
+ }
|
|
|
|
+ }, r.removeData = function (e, t) {
|
|
|
|
+ var n = e[r.expando],
|
|
|
|
+ o = n && a[n];o && r.each(t, function (e, t) {
|
|
|
|
+ delete o[t];
|
|
|
|
+ });
|
|
|
|
+ }, r.extend = function () {
|
|
|
|
+ var e,
|
|
|
|
+ t,
|
|
|
|
+ a,
|
|
|
|
+ n,
|
|
|
|
+ o,
|
|
|
|
+ i,
|
|
|
|
+ s = arguments[0] || {},
|
|
|
|
+ l = 1,
|
|
|
|
+ u = arguments.length,
|
|
|
|
+ c = !1;for ("boolean" == typeof s && (c = s, s = arguments[l] || {}, l++), "object" != typeof s && "function" !== r.type(s) && (s = {}), l === u && (s = this, l--); u > l; l++) {
|
|
|
|
+ if (null != (o = arguments[l])) for (n in o) {
|
|
|
|
+ e = s[n], a = o[n], s !== a && (c && a && (r.isPlainObject(a) || (t = r.isArray(a))) ? (t ? (t = !1, i = e && r.isArray(e) ? e : []) : i = e && r.isPlainObject(e) ? e : {}, s[n] = r.extend(c, i, a)) : void 0 !== a && (s[n] = a));
|
|
|
|
+ }
|
|
|
|
+ }return s;
|
|
|
|
+ }, r.queue = function (e, a, n) {
|
|
|
|
+ function o(e, r) {
|
|
|
|
+ var a = r || [];return null != e && (t(Object(e)) ? !function (e, t) {
|
|
|
|
+ for (var r = +t.length, a = 0, n = e.length; r > a;) {
|
|
|
|
+ e[n++] = t[a++];
|
|
|
|
+ }if (r !== r) for (; void 0 !== t[a];) {
|
|
|
|
+ e[n++] = t[a++];
|
|
|
|
+ }return e.length = n, e;
|
|
|
|
+ }(a, "string" == typeof e ? [e] : e) : [].push.call(a, e)), a;
|
|
|
|
+ }if (e) {
|
|
|
|
+ a = (a || "fx") + "queue";var i = r.data(e, a);return n ? (!i || r.isArray(n) ? i = r.data(e, a, o(n)) : i.push(n), i) : i || [];
|
|
|
|
+ }
|
|
|
|
+ }, r.dequeue = function (e, t) {
|
|
|
|
+ r.each(e.nodeType ? [e] : e, function (e, a) {
|
|
|
|
+ t = t || "fx";var n = r.queue(a, t),
|
|
|
|
+ o = n.shift();"inprogress" === o && (o = n.shift()), o && ("fx" === t && n.unshift("inprogress"), o.call(a, function () {
|
|
|
|
+ r.dequeue(a, t);
|
|
|
|
+ }));
|
|
|
|
+ });
|
|
|
|
+ }, r.fn = r.prototype = { init: function (e) {
|
|
|
|
+ if (e.nodeType) return this[0] = e, this;throw new Error("Not a DOM node.");
|
|
|
|
+ }, offset: function () {
|
|
|
|
+ var t = this[0].getBoundingClientRect ? this[0].getBoundingClientRect() : { top: 0, left: 0 };return { top: t.top + (e.pageYOffset || document.scrollTop || 0) - (document.clientTop || 0), left: t.left + (e.pageXOffset || document.scrollLeft || 0) - (document.clientLeft || 0) };
|
|
|
|
+ }, position: function () {
|
|
|
|
+ function e() {
|
|
|
|
+ for (var e = this.offsetParent || document; e && "html" === !e.nodeType.toLowerCase && "static" === e.style.position;) {
|
|
|
|
+ e = e.offsetParent;
|
|
|
|
+ }return e || document;
|
|
|
|
+ }var t = this[0],
|
|
|
|
+ e = e.apply(t),
|
|
|
|
+ a = this.offset(),
|
|
|
|
+ n = /^(?:body|html)$/i.test(e.nodeName) ? { top: 0, left: 0 } : r(e).offset();return a.top -= parseFloat(t.style.marginTop) || 0, a.left -= parseFloat(t.style.marginLeft) || 0, e.style && (n.top += parseFloat(e.style.borderTopWidth) || 0, n.left += parseFloat(e.style.borderLeftWidth) || 0), { top: a.top - n.top, left: a.left - n.left };
|
|
|
|
+ } };var a = {};r.expando = "velocity" + new Date().getTime(), r.uuid = 0;for (var n = {}, o = n.hasOwnProperty, i = n.toString, s = "Boolean Number String Function Array Date RegExp Object Error".split(" "), l = 0; l < s.length; l++) {
|
|
|
|
+ n["[object " + s[l] + "]"] = s[l].toLowerCase();
|
|
|
|
+ }r.fn.init.prototype = r.fn, e.Velocity = { Utilities: r };
|
|
|
|
+ }
|
|
|
|
+}(window), function (e) {
|
|
|
|
+ "object" == typeof module && "object" == typeof module.exports ? module.exports = e() : "function" == typeof define && define.amd ? define(e) : e();
|
|
|
|
+}(function () {
|
|
|
|
+ return function (e, t, r, a) {
|
|
|
|
+ function n(e) {
|
|
|
|
+ for (var t = -1, r = e ? e.length : 0, a = []; ++t < r;) {
|
|
|
|
+ var n = e[t];n && a.push(n);
|
|
|
|
+ }return a;
|
|
|
|
+ }function o(e) {
|
|
|
|
+ return m.isWrapped(e) ? e = [].slice.call(e) : m.isNode(e) && (e = [e]), e;
|
|
|
|
+ }function i(e) {
|
|
|
|
+ var t = f.data(e, "velocity");return null === t ? a : t;
|
|
|
|
+ }function s(e) {
|
|
|
|
+ return function (t) {
|
|
|
|
+ return Math.round(t * e) * (1 / e);
|
|
|
|
+ };
|
|
|
|
+ }function l(e, r, a, n) {
|
|
|
|
+ function o(e, t) {
|
|
|
|
+ return 1 - 3 * t + 3 * e;
|
|
|
|
+ }function i(e, t) {
|
|
|
|
+ return 3 * t - 6 * e;
|
|
|
|
+ }function s(e) {
|
|
|
|
+ return 3 * e;
|
|
|
|
+ }function l(e, t, r) {
|
|
|
|
+ return ((o(t, r) * e + i(t, r)) * e + s(t)) * e;
|
|
|
|
+ }function u(e, t, r) {
|
|
|
|
+ return 3 * o(t, r) * e * e + 2 * i(t, r) * e + s(t);
|
|
|
|
+ }function c(t, r) {
|
|
|
|
+ for (var n = 0; m > n; ++n) {
|
|
|
|
+ var o = u(r, e, a);if (0 === o) return r;var i = l(r, e, a) - t;r -= i / o;
|
|
|
|
+ }return r;
|
|
|
|
+ }function p() {
|
|
|
|
+ for (var t = 0; b > t; ++t) {
|
|
|
|
+ w[t] = l(t * x, e, a);
|
|
|
|
+ }
|
|
|
|
+ }function f(t, r, n) {
|
|
|
|
+ var o,
|
|
|
|
+ i,
|
|
|
|
+ s = 0;do {
|
|
|
|
+ i = r + (n - r) / 2, o = l(i, e, a) - t, o > 0 ? n = i : r = i;
|
|
|
|
+ } while (Math.abs(o) > h && ++s < v);return i;
|
|
|
|
+ }function d(t) {
|
|
|
|
+ for (var r = 0, n = 1, o = b - 1; n != o && w[n] <= t; ++n) {
|
|
|
|
+ r += x;
|
|
|
|
+ }--n;var i = (t - w[n]) / (w[n + 1] - w[n]),
|
|
|
|
+ s = r + i * x,
|
|
|
|
+ l = u(s, e, a);return l >= y ? c(t, s) : 0 == l ? s : f(t, r, r + x);
|
|
|
|
+ }function g() {
|
|
|
|
+ V = !0, (e != r || a != n) && p();
|
|
|
|
+ }var m = 4,
|
|
|
|
+ y = .001,
|
|
|
|
+ h = 1e-7,
|
|
|
|
+ v = 10,
|
|
|
|
+ b = 11,
|
|
|
|
+ x = 1 / (b - 1),
|
|
|
|
+ S = "Float32Array" in t;if (4 !== arguments.length) return !1;for (var P = 0; 4 > P; ++P) {
|
|
|
|
+ if ("number" != typeof arguments[P] || isNaN(arguments[P]) || !isFinite(arguments[P])) return !1;
|
|
|
|
+ }e = Math.min(e, 1), a = Math.min(a, 1), e = Math.max(e, 0), a = Math.max(a, 0);var w = S ? new Float32Array(b) : new Array(b),
|
|
|
|
+ V = !1,
|
|
|
|
+ C = function (t) {
|
|
|
|
+ return V || g(), e === r && a === n ? t : 0 === t ? 0 : 1 === t ? 1 : l(d(t), r, n);
|
|
|
|
+ };C.getControlPoints = function () {
|
|
|
|
+ return [{ x: e, y: r }, { x: a, y: n }];
|
|
|
|
+ };var T = "generateBezier(" + [e, r, a, n] + ")";return C.toString = function () {
|
|
|
|
+ return T;
|
|
|
|
+ }, C;
|
|
|
|
+ }function u(e, t) {
|
|
|
|
+ var r = e;return m.isString(e) ? b.Easings[e] || (r = !1) : r = m.isArray(e) && 1 === e.length ? s.apply(null, e) : m.isArray(e) && 2 === e.length ? x.apply(null, e.concat([t])) : m.isArray(e) && 4 === e.length ? l.apply(null, e) : !1, r === !1 && (r = b.Easings[b.defaults.easing] ? b.defaults.easing : v), r;
|
|
|
|
+ }function c(e) {
|
|
|
|
+ if (e) {
|
|
|
|
+ var t = new Date().getTime(),
|
|
|
|
+ r = b.State.calls.length;r > 1e4 && (b.State.calls = n(b.State.calls));for (var o = 0; r > o; o++) {
|
|
|
|
+ if (b.State.calls[o]) {
|
|
|
|
+ var s = b.State.calls[o],
|
|
|
|
+ l = s[0],
|
|
|
|
+ u = s[2],
|
|
|
|
+ d = s[3],
|
|
|
|
+ g = !!d,
|
|
|
|
+ y = null;d || (d = b.State.calls[o][3] = t - 16);for (var h = Math.min((t - d) / u.duration, 1), v = 0, x = l.length; x > v; v++) {
|
|
|
|
+ var P = l[v],
|
|
|
|
+ V = P.element;if (i(V)) {
|
|
|
|
+ var C = !1;if (u.display !== a && null !== u.display && "none" !== u.display) {
|
|
|
|
+ if ("flex" === u.display) {
|
|
|
|
+ var T = ["-webkit-box", "-moz-box", "-ms-flexbox", "-webkit-flex"];f.each(T, function (e, t) {
|
|
|
|
+ S.setPropertyValue(V, "display", t);
|
|
|
|
+ });
|
|
|
|
+ }S.setPropertyValue(V, "display", u.display);
|
|
|
|
+ }u.visibility !== a && "hidden" !== u.visibility && S.setPropertyValue(V, "visibility", u.visibility);for (var k in P) {
|
|
|
|
+ if ("element" !== k) {
|
|
|
|
+ var A,
|
|
|
|
+ F = P[k],
|
|
|
|
+ j = m.isString(F.easing) ? b.Easings[F.easing] : F.easing;if (1 === h) A = F.endValue;else {
|
|
|
|
+ var E = F.endValue - F.startValue;if (A = F.startValue + E * j(h, u, E), !g && A === F.currentValue) continue;
|
|
|
|
+ }if (F.currentValue = A, "tween" === k) y = A;else {
|
|
|
|
+ if (S.Hooks.registered[k]) {
|
|
|
|
+ var H = S.Hooks.getRoot(k),
|
|
|
|
+ N = i(V).rootPropertyValueCache[H];N && (F.rootPropertyValue = N);
|
|
|
|
+ }var L = S.setPropertyValue(V, k, F.currentValue + (0 === parseFloat(A) ? "" : F.unitType), F.rootPropertyValue, F.scrollData);S.Hooks.registered[k] && (i(V).rootPropertyValueCache[H] = S.Normalizations.registered[H] ? S.Normalizations.registered[H]("extract", null, L[1]) : L[1]), "transform" === L[0] && (C = !0);
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ }u.mobileHA && i(V).transformCache.translate3d === a && (i(V).transformCache.translate3d = "(0px, 0px, 0px)", C = !0), C && S.flushTransformCache(V);
|
|
|
|
+ }
|
|
|
|
+ }u.display !== a && "none" !== u.display && (b.State.calls[o][2].display = !1), u.visibility !== a && "hidden" !== u.visibility && (b.State.calls[o][2].visibility = !1), u.progress && u.progress.call(s[1], s[1], h, Math.max(0, d + u.duration - t), d, y), 1 === h && p(o);
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ }b.State.isTicking && w(c);
|
|
|
|
+ }function p(e, t) {
|
|
|
|
+ if (!b.State.calls[e]) return !1;for (var r = b.State.calls[e][0], n = b.State.calls[e][1], o = b.State.calls[e][2], s = b.State.calls[e][4], l = !1, u = 0, c = r.length; c > u; u++) {
|
|
|
|
+ var p = r[u].element;if (t || o.loop || ("none" === o.display && S.setPropertyValue(p, "display", o.display), "hidden" === o.visibility && S.setPropertyValue(p, "visibility", o.visibility)), o.loop !== !0 && (f.queue(p)[1] === a || !/\.velocityQueueEntryFlag/i.test(f.queue(p)[1])) && i(p)) {
|
|
|
|
+ i(p).isAnimating = !1, i(p).rootPropertyValueCache = {};var d = !1;f.each(S.Lists.transforms3D, function (e, t) {
|
|
|
|
+ var r = /^scale/.test(t) ? 1 : 0,
|
|
|
|
+ n = i(p).transformCache[t];i(p).transformCache[t] !== a && new RegExp("^\\(" + r + "[^.]").test(n) && (d = !0, delete i(p).transformCache[t]);
|
|
|
|
+ }), o.mobileHA && (d = !0, delete i(p).transformCache.translate3d), d && S.flushTransformCache(p), S.Values.removeClass(p, "velocity-animating");
|
|
|
|
+ }if (!t && o.complete && !o.loop && u === c - 1) try {
|
|
|
|
+ o.complete.call(n, n);
|
|
|
|
+ } catch (g) {
|
|
|
|
+ setTimeout(function () {
|
|
|
|
+ throw g;
|
|
|
|
+ }, 1);
|
|
|
|
+ }s && o.loop !== !0 && s(n), i(p) && o.loop === !0 && !t && (f.each(i(p).tweensContainer, function (e, t) {
|
|
|
|
+ /^rotate/.test(e) && 360 === parseFloat(t.endValue) && (t.endValue = 0, t.startValue = 360), /^backgroundPosition/.test(e) && 100 === parseFloat(t.endValue) && "%" === t.unitType && (t.endValue = 0, t.startValue = 100);
|
|
|
|
+ }), b(p, "reverse", { loop: !0, delay: o.delay })), o.queue !== !1 && f.dequeue(p, o.queue);
|
|
|
|
+ }b.State.calls[e] = !1;for (var m = 0, y = b.State.calls.length; y > m; m++) {
|
|
|
|
+ if (b.State.calls[m] !== !1) {
|
|
|
|
+ l = !0;break;
|
|
|
|
+ }
|
|
|
|
+ }l === !1 && (b.State.isTicking = !1, delete b.State.calls, b.State.calls = []);
|
|
|
|
+ }var f,
|
|
|
|
+ d = function () {
|
|
|
|
+ if (r.documentMode) return r.documentMode;for (var e = 7; e > 4; e--) {
|
|
|
|
+ var t = r.createElement("div");if (t.innerHTML = "<!--[if IE " + e + "]><span></span><![endif]-->", t.getElementsByTagName("span").length) return t = null, e;
|
|
|
|
+ }return a;
|
|
|
|
+ }(),
|
|
|
|
+ g = function () {
|
|
|
|
+ var e = 0;return t.webkitRequestAnimationFrame || t.mozRequestAnimationFrame || function (t) {
|
|
|
|
+ var r,
|
|
|
|
+ a = new Date().getTime();return r = Math.max(0, 16 - (a - e)), e = a + r, setTimeout(function () {
|
|
|
|
+ t(a + r);
|
|
|
|
+ }, r);
|
|
|
|
+ };
|
|
|
|
+ }(),
|
|
|
|
+ m = { isString: function (e) {
|
|
|
|
+ return "string" == typeof e;
|
|
|
|
+ }, isArray: Array.isArray || function (e) {
|
|
|
|
+ return "[object Array]" === Object.prototype.toString.call(e);
|
|
|
|
+ }, isFunction: function (e) {
|
|
|
|
+ return "[object Function]" === Object.prototype.toString.call(e);
|
|
|
|
+ }, isNode: function (e) {
|
|
|
|
+ return e && e.nodeType;
|
|
|
|
+ }, isNodeList: function (e) {
|
|
|
|
+ return "object" == typeof e && /^\[object (HTMLCollection|NodeList|Object)\]$/.test(Object.prototype.toString.call(e)) && e.length !== a && (0 === e.length || "object" == typeof e[0] && e[0].nodeType > 0);
|
|
|
|
+ }, isWrapped: function (e) {
|
|
|
|
+ return e && (e.jquery || t.Zepto && t.Zepto.zepto.isZ(e));
|
|
|
|
+ }, isSVG: function (e) {
|
|
|
|
+ return t.SVGElement && e instanceof t.SVGElement;
|
|
|
|
+ }, isEmptyObject: function (e) {
|
|
|
|
+ for (var t in e) {
|
|
|
|
+ return !1;
|
|
|
|
+ }return !0;
|
|
|
|
+ } },
|
|
|
|
+ y = !1;if (e.fn && e.fn.jquery ? (f = e, y = !0) : f = t.Velocity.Utilities, 8 >= d && !y) throw new Error("Velocity: IE8 and below require jQuery to be loaded before Velocity.");if (7 >= d) return void (jQuery.fn.velocity = jQuery.fn.animate);var h = 400,
|
|
|
|
+ v = "swing",
|
|
|
|
+ b = { State: { isMobile: /Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent), isAndroid: /Android/i.test(navigator.userAgent), isGingerbread: /Android 2\.3\.[3-7]/i.test(navigator.userAgent), isChrome: t.chrome, isFirefox: /Firefox/i.test(navigator.userAgent), prefixElement: r.createElement("div"), prefixMatches: {}, scrollAnchor: null, scrollPropertyLeft: null, scrollPropertyTop: null, isTicking: !1, calls: [] }, CSS: {}, Utilities: f, Redirects: {}, Easings: {}, Promise: t.Promise, defaults: { queue: "", duration: h, easing: v, begin: a, complete: a, progress: a, display: a, visibility: a, loop: !1, delay: !1, mobileHA: !0, _cacheValues: !0 }, init: function (e) {
|
|
|
|
+ f.data(e, "velocity", { isSVG: m.isSVG(e), isAnimating: !1, computedStyle: null, tweensContainer: null, rootPropertyValueCache: {}, transformCache: {} });
|
|
|
|
+ }, hook: null, mock: !1, version: { major: 1, minor: 2, patch: 2 }, debug: !1 };t.pageYOffset !== a ? (b.State.scrollAnchor = t, b.State.scrollPropertyLeft = "pageXOffset", b.State.scrollPropertyTop = "pageYOffset") : (b.State.scrollAnchor = r.documentElement || r.body.parentNode || r.body, b.State.scrollPropertyLeft = "scrollLeft", b.State.scrollPropertyTop = "scrollTop");var x = function () {
|
|
|
|
+ function e(e) {
|
|
|
|
+ return -e.tension * e.x - e.friction * e.v;
|
|
|
|
+ }function t(t, r, a) {
|
|
|
|
+ var n = { x: t.x + a.dx * r, v: t.v + a.dv * r, tension: t.tension, friction: t.friction };return { dx: n.v, dv: e(n) };
|
|
|
|
+ }function r(r, a) {
|
|
|
|
+ var n = { dx: r.v, dv: e(r) },
|
|
|
|
+ o = t(r, .5 * a, n),
|
|
|
|
+ i = t(r, .5 * a, o),
|
|
|
|
+ s = t(r, a, i),
|
|
|
|
+ l = 1 / 6 * (n.dx + 2 * (o.dx + i.dx) + s.dx),
|
|
|
|
+ u = 1 / 6 * (n.dv + 2 * (o.dv + i.dv) + s.dv);return r.x = r.x + l * a, r.v = r.v + u * a, r;
|
|
|
|
+ }return function a(e, t, n) {
|
|
|
|
+ var o,
|
|
|
|
+ i,
|
|
|
|
+ s,
|
|
|
|
+ l = { x: -1, v: 0, tension: null, friction: null },
|
|
|
|
+ u = [0],
|
|
|
|
+ c = 0,
|
|
|
|
+ p = 1e-4,
|
|
|
|
+ f = .016;for (e = parseFloat(e) || 500, t = parseFloat(t) || 20, n = n || null, l.tension = e, l.friction = t, o = null !== n, o ? (c = a(e, t), i = c / n * f) : i = f; s = r(s || l, i), u.push(1 + s.x), c += 16, Math.abs(s.x) > p && Math.abs(s.v) > p;) {}return o ? function (e) {
|
|
|
|
+ return u[e * (u.length - 1) | 0];
|
|
|
|
+ } : c;
|
|
|
|
+ };
|
|
|
|
+ }();b.Easings = { linear: function (e) {
|
|
|
|
+ return e;
|
|
|
|
+ }, swing: function (e) {
|
|
|
|
+ return .5 - Math.cos(e * Math.PI) / 2;
|
|
|
|
+ }, spring: function (e) {
|
|
|
|
+ return 1 - Math.cos(4.5 * e * Math.PI) * Math.exp(6 * -e);
|
|
|
|
+ } }, f.each([["ease", [.25, .1, .25, 1]], ["ease-in", [.42, 0, 1, 1]], ["ease-out", [0, 0, .58, 1]], ["ease-in-out", [.42, 0, .58, 1]], ["easeInSine", [.47, 0, .745, .715]], ["easeOutSine", [.39, .575, .565, 1]], ["easeInOutSine", [.445, .05, .55, .95]], ["easeInQuad", [.55, .085, .68, .53]], ["easeOutQuad", [.25, .46, .45, .94]], ["easeInOutQuad", [.455, .03, .515, .955]], ["easeInCubic", [.55, .055, .675, .19]], ["easeOutCubic", [.215, .61, .355, 1]], ["easeInOutCubic", [.645, .045, .355, 1]], ["easeInQuart", [.895, .03, .685, .22]], ["easeOutQuart", [.165, .84, .44, 1]], ["easeInOutQuart", [.77, 0, .175, 1]], ["easeInQuint", [.755, .05, .855, .06]], ["easeOutQuint", [.23, 1, .32, 1]], ["easeInOutQuint", [.86, 0, .07, 1]], ["easeInExpo", [.95, .05, .795, .035]], ["easeOutExpo", [.19, 1, .22, 1]], ["easeInOutExpo", [1, 0, 0, 1]], ["easeInCirc", [.6, .04, .98, .335]], ["easeOutCirc", [.075, .82, .165, 1]], ["easeInOutCirc", [.785, .135, .15, .86]]], function (e, t) {
|
|
|
|
+ b.Easings[t[0]] = l.apply(null, t[1]);
|
|
|
|
+ });var S = b.CSS = { RegEx: { isHex: /^#([A-f\d]{3}){1,2}$/i, valueUnwrap: /^[A-z]+\((.*)\)$/i, wrappedValueAlreadyExtracted: /[0-9.]+ [0-9.]+ [0-9.]+( [0-9.]+)?/, valueSplit: /([A-z]+\(.+\))|(([A-z0-9#-.]+?)(?=\s|$))/gi }, Lists: { colors: ["fill", "stroke", "stopColor", "color", "backgroundColor", "borderColor", "borderTopColor", "borderRightColor", "borderBottomColor", "borderLeftColor", "outlineColor"], transformsBase: ["translateX", "translateY", "scale", "scaleX", "scaleY", "skewX", "skewY", "rotateZ"], transforms3D: ["transformPerspective", "translateZ", "scaleZ", "rotateX", "rotateY"] }, Hooks: { templates: { textShadow: ["Color X Y Blur", "black 0px 0px 0px"], boxShadow: ["Color X Y Blur Spread", "black 0px 0px 0px 0px"], clip: ["Top Right Bottom Left", "0px 0px 0px 0px"], backgroundPosition: ["X Y", "0% 0%"], transformOrigin: ["X Y Z", "50% 50% 0px"], perspectiveOrigin: ["X Y", "50% 50%"] }, registered: {}, register: function () {
|
|
|
|
+ for (var e = 0; e < S.Lists.colors.length; e++) {
|
|
|
|
+ var t = "color" === S.Lists.colors[e] ? "0 0 0 1" : "255 255 255 1";S.Hooks.templates[S.Lists.colors[e]] = ["Red Green Blue Alpha", t];
|
|
|
|
+ }var r, a, n;if (d) for (r in S.Hooks.templates) {
|
|
|
|
+ a = S.Hooks.templates[r], n = a[0].split(" ");var o = a[1].match(S.RegEx.valueSplit);"Color" === n[0] && (n.push(n.shift()), o.push(o.shift()), S.Hooks.templates[r] = [n.join(" "), o.join(" ")]);
|
|
|
|
+ }for (r in S.Hooks.templates) {
|
|
|
|
+ a = S.Hooks.templates[r], n = a[0].split(" ");for (var e in n) {
|
|
|
|
+ var i = r + n[e],
|
|
|
|
+ s = e;S.Hooks.registered[i] = [r, s];
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ }, getRoot: function (e) {
|
|
|
|
+ var t = S.Hooks.registered[e];return t ? t[0] : e;
|
|
|
|
+ }, cleanRootPropertyValue: function (e, t) {
|
|
|
|
+ return S.RegEx.valueUnwrap.test(t) && (t = t.match(S.RegEx.valueUnwrap)[1]), S.Values.isCSSNullValue(t) && (t = S.Hooks.templates[e][1]), t;
|
|
|
|
+ }, extractValue: function (e, t) {
|
|
|
|
+ var r = S.Hooks.registered[e];if (r) {
|
|
|
|
+ var a = r[0],
|
|
|
|
+ n = r[1];return t = S.Hooks.cleanRootPropertyValue(a, t), t.toString().match(S.RegEx.valueSplit)[n];
|
|
|
|
+ }return t;
|
|
|
|
+ }, injectValue: function (e, t, r) {
|
|
|
|
+ var a = S.Hooks.registered[e];if (a) {
|
|
|
|
+ var n,
|
|
|
|
+ o,
|
|
|
|
+ i = a[0],
|
|
|
|
+ s = a[1];return r = S.Hooks.cleanRootPropertyValue(i, r), n = r.toString().match(S.RegEx.valueSplit), n[s] = t, o = n.join(" ");
|
|
|
|
+ }return r;
|
|
|
|
+ } }, Normalizations: { registered: { clip: function (e, t, r) {
|
|
|
|
+ switch (e) {case "name":
|
|
|
|
+ return "clip";case "extract":
|
|
|
|
+ var a;return S.RegEx.wrappedValueAlreadyExtracted.test(r) ? a = r : (a = r.toString().match(S.RegEx.valueUnwrap), a = a ? a[1].replace(/,(\s+)?/g, " ") : r), a;case "inject":
|
|
|
|
+ return "rect(" + r + ")";}
|
|
|
|
+ }, blur: function (e, t, r) {
|
|
|
|
+ switch (e) {case "name":
|
|
|
|
+ return b.State.isFirefox ? "filter" : "-webkit-filter";case "extract":
|
|
|
|
+ var a = parseFloat(r);if (!a && 0 !== a) {
|
|
|
|
+ var n = r.toString().match(/blur\(([0-9]+[A-z]+)\)/i);a = n ? n[1] : 0;
|
|
|
|
+ }return a;case "inject":
|
|
|
|
+ return parseFloat(r) ? "blur(" + r + ")" : "none";}
|
|
|
|
+ }, opacity: function (e, t, r) {
|
|
|
|
+ if (8 >= d) switch (e) {case "name":
|
|
|
|
+ return "filter";case "extract":
|
|
|
|
+ var a = r.toString().match(/alpha\(opacity=(.*)\)/i);return r = a ? a[1] / 100 : 1;case "inject":
|
|
|
|
+ return t.style.zoom = 1, parseFloat(r) >= 1 ? "" : "alpha(opacity=" + parseInt(100 * parseFloat(r), 10) + ")";} else switch (e) {case "name":
|
|
|
|
+ return "opacity";case "extract":
|
|
|
|
+ return r;case "inject":
|
|
|
|
+ return r;}
|
|
|
|
+ } }, register: function () {
|
|
|
|
+ 9 >= d || b.State.isGingerbread || (S.Lists.transformsBase = S.Lists.transformsBase.concat(S.Lists.transforms3D));for (var e = 0; e < S.Lists.transformsBase.length; e++) {
|
|
|
|
+ !function () {
|
|
|
|
+ var t = S.Lists.transformsBase[e];S.Normalizations.registered[t] = function (e, r, n) {
|
|
|
|
+ switch (e) {case "name":
|
|
|
|
+ return "transform";case "extract":
|
|
|
|
+ return i(r) === a || i(r).transformCache[t] === a ? /^scale/i.test(t) ? 1 : 0 : i(r).transformCache[t].replace(/[()]/g, "");case "inject":
|
|
|
|
+ var o = !1;switch (t.substr(0, t.length - 1)) {case "translate":
|
|
|
|
+ o = !/(%|px|em|rem|vw|vh|\d)$/i.test(n);break;case "scal":case "scale":
|
|
|
|
+ b.State.isAndroid && i(r).transformCache[t] === a && 1 > n && (n = 1), o = !/(\d)$/i.test(n);break;case "skew":
|
|
|
|
+ o = !/(deg|\d)$/i.test(n);break;case "rotate":
|
|
|
|
+ o = !/(deg|\d)$/i.test(n);}return o || (i(r).transformCache[t] = "(" + n + ")"), i(r).transformCache[t];}
|
|
|
|
+ };
|
|
|
|
+ }();
|
|
|
|
+ }for (var e = 0; e < S.Lists.colors.length; e++) {
|
|
|
|
+ !function () {
|
|
|
|
+ var t = S.Lists.colors[e];S.Normalizations.registered[t] = function (e, r, n) {
|
|
|
|
+ switch (e) {case "name":
|
|
|
|
+ return t;case "extract":
|
|
|
|
+ var o;if (S.RegEx.wrappedValueAlreadyExtracted.test(n)) o = n;else {
|
|
|
|
+ var i,
|
|
|
|
+ s = { black: "rgb(0, 0, 0)", blue: "rgb(0, 0, 255)", gray: "rgb(128, 128, 128)", green: "rgb(0, 128, 0)", red: "rgb(255, 0, 0)", white: "rgb(255, 255, 255)" };/^[A-z]+$/i.test(n) ? i = s[n] !== a ? s[n] : s.black : S.RegEx.isHex.test(n) ? i = "rgb(" + S.Values.hexToRgb(n).join(" ") + ")" : /^rgba?\(/i.test(n) || (i = s.black), o = (i || n).toString().match(S.RegEx.valueUnwrap)[1].replace(/,(\s+)?/g, " ");
|
|
|
|
+ }return 8 >= d || 3 !== o.split(" ").length || (o += " 1"), o;case "inject":
|
|
|
|
+ return 8 >= d ? 4 === n.split(" ").length && (n = n.split(/\s+/).slice(0, 3).join(" ")) : 3 === n.split(" ").length && (n += " 1"), (8 >= d ? "rgb" : "rgba") + "(" + n.replace(/\s+/g, ",").replace(/\.(\d)+(?=,)/g, "") + ")";}
|
|
|
|
+ };
|
|
|
|
+ }();
|
|
|
|
+ }
|
|
|
|
+ } }, Names: { camelCase: function (e) {
|
|
|
|
+ return e.replace(/-(\w)/g, function (e, t) {
|
|
|
|
+ return t.toUpperCase();
|
|
|
|
+ });
|
|
|
|
+ }, SVGAttribute: function (e) {
|
|
|
|
+ var t = "width|height|x|y|cx|cy|r|rx|ry|x1|x2|y1|y2";return (d || b.State.isAndroid && !b.State.isChrome) && (t += "|transform"), new RegExp("^(" + t + ")$", "i").test(e);
|
|
|
|
+ }, prefixCheck: function (e) {
|
|
|
|
+ if (b.State.prefixMatches[e]) return [b.State.prefixMatches[e], !0];for (var t = ["", "Webkit", "Moz", "ms", "O"], r = 0, a = t.length; a > r; r++) {
|
|
|
|
+ var n;if (n = 0 === r ? e : t[r] + e.replace(/^\w/, function (e) {
|
|
|
|
+ return e.toUpperCase();
|
|
|
|
+ }), m.isString(b.State.prefixElement.style[n])) return b.State.prefixMatches[e] = n, [n, !0];
|
|
|
|
+ }return [e, !1];
|
|
|
|
+ } }, Values: { hexToRgb: function (e) {
|
|
|
|
+ var t,
|
|
|
|
+ r = /^#?([a-f\d])([a-f\d])([a-f\d])$/i,
|
|
|
|
+ a = /^#?([a-f\d]{2})([a-f\d]{2})([a-f\d]{2})$/i;return e = e.replace(r, function (e, t, r, a) {
|
|
|
|
+ return t + t + r + r + a + a;
|
|
|
|
+ }), t = a.exec(e), t ? [parseInt(t[1], 16), parseInt(t[2], 16), parseInt(t[3], 16)] : [0, 0, 0];
|
|
|
|
+ }, isCSSNullValue: function (e) {
|
|
|
|
+ return 0 == e || /^(none|auto|transparent|(rgba\(0, ?0, ?0, ?0\)))$/i.test(e);
|
|
|
|
+ }, getUnitType: function (e) {
|
|
|
|
+ return (/^(rotate|skew)/i.test(e) ? "deg" : /(^(scale|scaleX|scaleY|scaleZ|alpha|flexGrow|flexHeight|zIndex|fontWeight)$)|((opacity|red|green|blue|alpha)$)/i.test(e) ? "" : "px"
|
|
|
|
+ );
|
|
|
|
+ }, getDisplayType: function (e) {
|
|
|
|
+ var t = e && e.tagName.toString().toLowerCase();return (/^(b|big|i|small|tt|abbr|acronym|cite|code|dfn|em|kbd|strong|samp|var|a|bdo|br|img|map|object|q|script|span|sub|sup|button|input|label|select|textarea)$/i.test(t) ? "inline" : /^(li)$/i.test(t) ? "list-item" : /^(tr)$/i.test(t) ? "table-row" : /^(table)$/i.test(t) ? "table" : /^(tbody)$/i.test(t) ? "table-row-group" : "block"
|
|
|
|
+ );
|
|
|
|
+ }, addClass: function (e, t) {
|
|
|
|
+ e.classList ? e.classList.add(t) : e.className += (e.className.length ? " " : "") + t;
|
|
|
|
+ }, removeClass: function (e, t) {
|
|
|
|
+ e.classList ? e.classList.remove(t) : e.className = e.className.toString().replace(new RegExp("(^|\\s)" + t.split(" ").join("|") + "(\\s|$)", "gi"), " ");
|
|
|
|
+ } }, getPropertyValue: function (e, r, n, o) {
|
|
|
|
+ function s(e, r) {
|
|
|
|
+ function n() {
|
|
|
|
+ u && S.setPropertyValue(e, "display", "none");
|
|
|
|
+ }var l = 0;if (8 >= d) l = f.css(e, r);else {
|
|
|
|
+ var u = !1;if (/^(width|height)$/.test(r) && 0 === S.getPropertyValue(e, "display") && (u = !0, S.setPropertyValue(e, "display", S.Values.getDisplayType(e))), !o) {
|
|
|
|
+ if ("height" === r && "border-box" !== S.getPropertyValue(e, "boxSizing").toString().toLowerCase()) {
|
|
|
|
+ var c = e.offsetHeight - (parseFloat(S.getPropertyValue(e, "borderTopWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "borderBottomWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingTop")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingBottom")) || 0);return n(), c;
|
|
|
|
+ }if ("width" === r && "border-box" !== S.getPropertyValue(e, "boxSizing").toString().toLowerCase()) {
|
|
|
|
+ var p = e.offsetWidth - (parseFloat(S.getPropertyValue(e, "borderLeftWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "borderRightWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingLeft")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingRight")) || 0);return n(), p;
|
|
|
|
+ }
|
|
|
|
+ }var g;g = i(e) === a ? t.getComputedStyle(e, null) : i(e).computedStyle ? i(e).computedStyle : i(e).computedStyle = t.getComputedStyle(e, null), "borderColor" === r && (r = "borderTopColor"), l = 9 === d && "filter" === r ? g.getPropertyValue(r) : g[r], ("" === l || null === l) && (l = e.style[r]), n();
|
|
|
|
+ }if ("auto" === l && /^(top|right|bottom|left)$/i.test(r)) {
|
|
|
|
+ var m = s(e, "position");("fixed" === m || "absolute" === m && /top|left/i.test(r)) && (l = f(e).position()[r] + "px");
|
|
|
|
+ }return l;
|
|
|
|
+ }var l;if (S.Hooks.registered[r]) {
|
|
|
|
+ var u = r,
|
|
|
|
+ c = S.Hooks.getRoot(u);n === a && (n = S.getPropertyValue(e, S.Names.prefixCheck(c)[0])), S.Normalizations.registered[c] && (n = S.Normalizations.registered[c]("extract", e, n)), l = S.Hooks.extractValue(u, n);
|
|
|
|
+ } else if (S.Normalizations.registered[r]) {
|
|
|
|
+ var p, g;p = S.Normalizations.registered[r]("name", e), "transform" !== p && (g = s(e, S.Names.prefixCheck(p)[0]), S.Values.isCSSNullValue(g) && S.Hooks.templates[r] && (g = S.Hooks.templates[r][1])), l = S.Normalizations.registered[r]("extract", e, g);
|
|
|
|
+ }if (!/^[\d-]/.test(l)) if (i(e) && i(e).isSVG && S.Names.SVGAttribute(r)) {
|
|
|
|
+ if (/^(height|width)$/i.test(r)) try {
|
|
|
|
+ l = e.getBBox()[r];
|
|
|
|
+ } catch (m) {
|
|
|
|
+ l = 0;
|
|
|
|
+ } else l = e.getAttribute(r);
|
|
|
|
+ } else l = s(e, S.Names.prefixCheck(r)[0]);return S.Values.isCSSNullValue(l) && (l = 0), b.debug >= 2 && console.log("Get " + r + ": " + l), l;
|
|
|
|
+ }, setPropertyValue: function (e, r, a, n, o) {
|
|
|
|
+ var s = r;if ("scroll" === r) o.container ? o.container["scroll" + o.direction] = a : "Left" === o.direction ? t.scrollTo(a, o.alternateValue) : t.scrollTo(o.alternateValue, a);else if (S.Normalizations.registered[r] && "transform" === S.Normalizations.registered[r]("name", e)) S.Normalizations.registered[r]("inject", e, a), s = "transform", a = i(e).transformCache[r];else {
|
|
|
|
+ if (S.Hooks.registered[r]) {
|
|
|
|
+ var l = r,
|
|
|
|
+ u = S.Hooks.getRoot(r);n = n || S.getPropertyValue(e, u), a = S.Hooks.injectValue(l, a, n), r = u;
|
|
|
|
+ }if (S.Normalizations.registered[r] && (a = S.Normalizations.registered[r]("inject", e, a), r = S.Normalizations.registered[r]("name", e)), s = S.Names.prefixCheck(r)[0], 8 >= d) try {
|
|
|
|
+ e.style[s] = a;
|
|
|
|
+ } catch (c) {
|
|
|
|
+ b.debug && console.log("Browser does not support [" + a + "] for [" + s + "]");
|
|
|
|
+ } else i(e) && i(e).isSVG && S.Names.SVGAttribute(r) ? e.setAttribute(r, a) : e.style[s] = a;b.debug >= 2 && console.log("Set " + r + " (" + s + "): " + a);
|
|
|
|
+ }return [s, a];
|
|
|
|
+ }, flushTransformCache: function (e) {
|
|
|
|
+ function t(t) {
|
|
|
|
+ return parseFloat(S.getPropertyValue(e, t));
|
|
|
|
+ }var r = "";if ((d || b.State.isAndroid && !b.State.isChrome) && i(e).isSVG) {
|
|
|
|
+ var a = { translate: [t("translateX"), t("translateY")], skewX: [t("skewX")], skewY: [t("skewY")], scale: 1 !== t("scale") ? [t("scale"), t("scale")] : [t("scaleX"), t("scaleY")], rotate: [t("rotateZ"), 0, 0] };f.each(i(e).transformCache, function (e) {
|
|
|
|
+ /^translate/i.test(e) ? e = "translate" : /^scale/i.test(e) ? e = "scale" : /^rotate/i.test(e) && (e = "rotate"), a[e] && (r += e + "(" + a[e].join(" ") + ") ", delete a[e]);
|
|
|
|
+ });
|
|
|
|
+ } else {
|
|
|
|
+ var n, o;f.each(i(e).transformCache, function (t) {
|
|
|
|
+ return n = i(e).transformCache[t], "transformPerspective" === t ? (o = n, !0) : (9 === d && "rotateZ" === t && (t = "rotate"), void (r += t + n + " "));
|
|
|
|
+ }), o && (r = "perspective" + o + " " + r);
|
|
|
|
+ }S.setPropertyValue(e, "transform", r);
|
|
|
|
+ } };S.Hooks.register(), S.Normalizations.register(), b.hook = function (e, t, r) {
|
|
|
|
+ var n = a;return e = o(e), f.each(e, function (e, o) {
|
|
|
|
+ if (i(o) === a && b.init(o), r === a) n === a && (n = b.CSS.getPropertyValue(o, t));else {
|
|
|
|
+ var s = b.CSS.setPropertyValue(o, t, r);"transform" === s[0] && b.CSS.flushTransformCache(o), n = s;
|
|
|
|
+ }
|
|
|
|
+ }), n;
|
|
|
|
+ };var P = function () {
|
|
|
|
+ function e() {
|
|
|
|
+ return s ? k.promise || null : l;
|
|
|
|
+ }function n() {
|
|
|
|
+ function e(e) {
|
|
|
|
+ function p(e, t) {
|
|
|
|
+ var r = a,
|
|
|
|
+ n = a,
|
|
|
|
+ i = a;return m.isArray(e) ? (r = e[0], !m.isArray(e[1]) && /^[\d-]/.test(e[1]) || m.isFunction(e[1]) || S.RegEx.isHex.test(e[1]) ? i = e[1] : (m.isString(e[1]) && !S.RegEx.isHex.test(e[1]) || m.isArray(e[1])) && (n = t ? e[1] : u(e[1], s.duration), e[2] !== a && (i = e[2]))) : r = e, t || (n = n || s.easing), m.isFunction(r) && (r = r.call(o, V, w)), m.isFunction(i) && (i = i.call(o, V, w)), [r || 0, n, i];
|
|
|
|
+ }function d(e, t) {
|
|
|
|
+ var r, a;return a = (t || "0").toString().toLowerCase().replace(/[%A-z]+$/, function (e) {
|
|
|
|
+ return r = e, "";
|
|
|
|
+ }), r || (r = S.Values.getUnitType(e)), [a, r];
|
|
|
|
+ }function h() {
|
|
|
|
+ var e = { myParent: o.parentNode || r.body, position: S.getPropertyValue(o, "position"), fontSize: S.getPropertyValue(o, "fontSize") },
|
|
|
|
+ a = e.position === L.lastPosition && e.myParent === L.lastParent,
|
|
|
|
+ n = e.fontSize === L.lastFontSize;L.lastParent = e.myParent, L.lastPosition = e.position, L.lastFontSize = e.fontSize;var s = 100,
|
|
|
|
+ l = {};if (n && a) l.emToPx = L.lastEmToPx, l.percentToPxWidth = L.lastPercentToPxWidth, l.percentToPxHeight = L.lastPercentToPxHeight;else {
|
|
|
|
+ var u = i(o).isSVG ? r.createElementNS("http://www.w3.org/2000/svg", "rect") : r.createElement("div");b.init(u), e.myParent.appendChild(u), f.each(["overflow", "overflowX", "overflowY"], function (e, t) {
|
|
|
|
+ b.CSS.setPropertyValue(u, t, "hidden");
|
|
|
|
+ }), b.CSS.setPropertyValue(u, "position", e.position), b.CSS.setPropertyValue(u, "fontSize", e.fontSize), b.CSS.setPropertyValue(u, "boxSizing", "content-box"), f.each(["minWidth", "maxWidth", "width", "minHeight", "maxHeight", "height"], function (e, t) {
|
|
|
|
+ b.CSS.setPropertyValue(u, t, s + "%");
|
|
|
|
+ }), b.CSS.setPropertyValue(u, "paddingLeft", s + "em"), l.percentToPxWidth = L.lastPercentToPxWidth = (parseFloat(S.getPropertyValue(u, "width", null, !0)) || 1) / s, l.percentToPxHeight = L.lastPercentToPxHeight = (parseFloat(S.getPropertyValue(u, "height", null, !0)) || 1) / s, l.emToPx = L.lastEmToPx = (parseFloat(S.getPropertyValue(u, "paddingLeft")) || 1) / s, e.myParent.removeChild(u);
|
|
|
|
+ }return null === L.remToPx && (L.remToPx = parseFloat(S.getPropertyValue(r.body, "fontSize")) || 16), null === L.vwToPx && (L.vwToPx = parseFloat(t.innerWidth) / 100, L.vhToPx = parseFloat(t.innerHeight) / 100), l.remToPx = L.remToPx, l.vwToPx = L.vwToPx, l.vhToPx = L.vhToPx, b.debug >= 1 && console.log("Unit ratios: " + JSON.stringify(l), o), l;
|
|
|
|
+ }if (s.begin && 0 === V) try {
|
|
|
|
+ s.begin.call(g, g);
|
|
|
|
+ } catch (x) {
|
|
|
|
+ setTimeout(function () {
|
|
|
|
+ throw x;
|
|
|
|
+ }, 1);
|
|
|
|
+ }if ("scroll" === A) {
|
|
|
|
+ var P,
|
|
|
|
+ C,
|
|
|
|
+ T,
|
|
|
|
+ F = /^x$/i.test(s.axis) ? "Left" : "Top",
|
|
|
|
+ j = parseFloat(s.offset) || 0;s.container ? m.isWrapped(s.container) || m.isNode(s.container) ? (s.container = s.container[0] || s.container, P = s.container["scroll" + F], T = P + f(o).position()[F.toLowerCase()] + j) : s.container = null : (P = b.State.scrollAnchor[b.State["scrollProperty" + F]], C = b.State.scrollAnchor[b.State["scrollProperty" + ("Left" === F ? "Top" : "Left")]], T = f(o).offset()[F.toLowerCase()] + j), l = { scroll: { rootPropertyValue: !1, startValue: P, currentValue: P, endValue: T, unitType: "", easing: s.easing, scrollData: { container: s.container, direction: F, alternateValue: C } }, element: o }, b.debug && console.log("tweensContainer (scroll): ", l.scroll, o);
|
|
|
|
+ } else if ("reverse" === A) {
|
|
|
|
+ if (!i(o).tweensContainer) return void f.dequeue(o, s.queue);"none" === i(o).opts.display && (i(o).opts.display = "auto"), "hidden" === i(o).opts.visibility && (i(o).opts.visibility = "visible"), i(o).opts.loop = !1, i(o).opts.begin = null, i(o).opts.complete = null, v.easing || delete s.easing, v.duration || delete s.duration, s = f.extend({}, i(o).opts, s);var E = f.extend(!0, {}, i(o).tweensContainer);for (var H in E) {
|
|
|
|
+ if ("element" !== H) {
|
|
|
|
+ var N = E[H].startValue;E[H].startValue = E[H].currentValue = E[H].endValue, E[H].endValue = N, m.isEmptyObject(v) || (E[H].easing = s.easing), b.debug && console.log("reverse tweensContainer (" + H + "): " + JSON.stringify(E[H]), o);
|
|
|
|
+ }
|
|
|
|
+ }l = E;
|
|
|
|
+ } else if ("start" === A) {
|
|
|
|
+ var E;i(o).tweensContainer && i(o).isAnimating === !0 && (E = i(o).tweensContainer), f.each(y, function (e, t) {
|
|
|
|
+ if (RegExp("^" + S.Lists.colors.join("$|^") + "$").test(e)) {
|
|
|
|
+ var r = p(t, !0),
|
|
|
|
+ n = r[0],
|
|
|
|
+ o = r[1],
|
|
|
|
+ i = r[2];if (S.RegEx.isHex.test(n)) {
|
|
|
|
+ for (var s = ["Red", "Green", "Blue"], l = S.Values.hexToRgb(n), u = i ? S.Values.hexToRgb(i) : a, c = 0; c < s.length; c++) {
|
|
|
|
+ var f = [l[c]];o && f.push(o), u !== a && f.push(u[c]), y[e + s[c]] = f;
|
|
|
|
+ }delete y[e];
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ });for (var z in y) {
|
|
|
|
+ var O = p(y[z]),
|
|
|
|
+ q = O[0],
|
|
|
|
+ $ = O[1],
|
|
|
|
+ M = O[2];z = S.Names.camelCase(z);var I = S.Hooks.getRoot(z),
|
|
|
|
+ B = !1;if (i(o).isSVG || "tween" === I || S.Names.prefixCheck(I)[1] !== !1 || S.Normalizations.registered[I] !== a) {
|
|
|
|
+ (s.display !== a && null !== s.display && "none" !== s.display || s.visibility !== a && "hidden" !== s.visibility) && /opacity|filter/.test(z) && !M && 0 !== q && (M = 0), s._cacheValues && E && E[z] ? (M === a && (M = E[z].endValue + E[z].unitType), B = i(o).rootPropertyValueCache[I]) : S.Hooks.registered[z] ? M === a ? (B = S.getPropertyValue(o, I), M = S.getPropertyValue(o, z, B)) : B = S.Hooks.templates[I][1] : M === a && (M = S.getPropertyValue(o, z));var W,
|
|
|
|
+ G,
|
|
|
|
+ Y,
|
|
|
|
+ D = !1;if (W = d(z, M), M = W[0], Y = W[1], W = d(z, q), q = W[0].replace(/^([+-\/*])=/, function (e, t) {
|
|
|
|
+ return D = t, "";
|
|
|
|
+ }), G = W[1], M = parseFloat(M) || 0, q = parseFloat(q) || 0, "%" === G && (/^(fontSize|lineHeight)$/.test(z) ? (q /= 100, G = "em") : /^scale/.test(z) ? (q /= 100, G = "") : /(Red|Green|Blue)$/i.test(z) && (q = q / 100 * 255, G = "")), /[\/*]/.test(D)) G = Y;else if (Y !== G && 0 !== M) if (0 === q) G = Y;else {
|
|
|
|
+ n = n || h();var Q = /margin|padding|left|right|width|text|word|letter/i.test(z) || /X$/.test(z) || "x" === z ? "x" : "y";switch (Y) {case "%":
|
|
|
|
+ M *= "x" === Q ? n.percentToPxWidth : n.percentToPxHeight;break;case "px":
|
|
|
|
+ break;default:
|
|
|
|
+ M *= n[Y + "ToPx"];}switch (G) {case "%":
|
|
|
|
+ M *= 1 / ("x" === Q ? n.percentToPxWidth : n.percentToPxHeight);break;case "px":
|
|
|
|
+ break;default:
|
|
|
|
+ M *= 1 / n[G + "ToPx"];}
|
|
|
|
+ }switch (D) {case "+":
|
|
|
|
+ q = M + q;break;case "-":
|
|
|
|
+ q = M - q;break;case "*":
|
|
|
|
+ q = M * q;break;case "/":
|
|
|
|
+ q = M / q;}l[z] = { rootPropertyValue: B, startValue: M, currentValue: M, endValue: q, unitType: G, easing: $ }, b.debug && console.log("tweensContainer (" + z + "): " + JSON.stringify(l[z]), o);
|
|
|
|
+ } else b.debug && console.log("Skipping [" + I + "] due to a lack of browser support.");
|
|
|
|
+ }l.element = o;
|
|
|
|
+ }l.element && (S.Values.addClass(o, "velocity-animating"), R.push(l), "" === s.queue && (i(o).tweensContainer = l, i(o).opts = s), i(o).isAnimating = !0, V === w - 1 ? (b.State.calls.push([R, g, s, null, k.resolver]), b.State.isTicking === !1 && (b.State.isTicking = !0, c())) : V++);
|
|
|
|
+ }var n,
|
|
|
|
+ o = this,
|
|
|
|
+ s = f.extend({}, b.defaults, v),
|
|
|
|
+ l = {};switch (i(o) === a && b.init(o), parseFloat(s.delay) && s.queue !== !1 && f.queue(o, s.queue, function (e) {
|
|
|
|
+ b.velocityQueueEntryFlag = !0, i(o).delayTimer = { setTimeout: setTimeout(e, parseFloat(s.delay)), next: e };
|
|
|
|
+ }), s.duration.toString().toLowerCase()) {case "fast":
|
|
|
|
+ s.duration = 200;break;case "normal":
|
|
|
|
+ s.duration = h;break;case "slow":
|
|
|
|
+ s.duration = 600;break;default:
|
|
|
|
+ s.duration = parseFloat(s.duration) || 1;}b.mock !== !1 && (b.mock === !0 ? s.duration = s.delay = 1 : (s.duration *= parseFloat(b.mock) || 1, s.delay *= parseFloat(b.mock) || 1)), s.easing = u(s.easing, s.duration), s.begin && !m.isFunction(s.begin) && (s.begin = null), s.progress && !m.isFunction(s.progress) && (s.progress = null), s.complete && !m.isFunction(s.complete) && (s.complete = null), s.display !== a && null !== s.display && (s.display = s.display.toString().toLowerCase(), "auto" === s.display && (s.display = b.CSS.Values.getDisplayType(o))), s.visibility !== a && null !== s.visibility && (s.visibility = s.visibility.toString().toLowerCase()), s.mobileHA = s.mobileHA && b.State.isMobile && !b.State.isGingerbread, s.queue === !1 ? s.delay ? setTimeout(e, s.delay) : e() : f.queue(o, s.queue, function (t, r) {
|
|
|
|
+ return r === !0 ? (k.promise && k.resolver(g), !0) : (b.velocityQueueEntryFlag = !0, void e(t));
|
|
|
|
+ }), "" !== s.queue && "fx" !== s.queue || "inprogress" === f.queue(o)[0] || f.dequeue(o);
|
|
|
|
+ }var s,
|
|
|
|
+ l,
|
|
|
|
+ d,
|
|
|
|
+ g,
|
|
|
|
+ y,
|
|
|
|
+ v,
|
|
|
|
+ x = arguments[0] && (arguments[0].p || f.isPlainObject(arguments[0].properties) && !arguments[0].properties.names || m.isString(arguments[0].properties));if (m.isWrapped(this) ? (s = !1, d = 0, g = this, l = this) : (s = !0, d = 1, g = x ? arguments[0].elements || arguments[0].e : arguments[0]), g = o(g)) {
|
|
|
|
+ x ? (y = arguments[0].properties || arguments[0].p, v = arguments[0].options || arguments[0].o) : (y = arguments[d], v = arguments[d + 1]);var w = g.length,
|
|
|
|
+ V = 0;if (!/^(stop|finish)$/i.test(y) && !f.isPlainObject(v)) {
|
|
|
|
+ var C = d + 1;v = {};for (var T = C; T < arguments.length; T++) {
|
|
|
|
+ m.isArray(arguments[T]) || !/^(fast|normal|slow)$/i.test(arguments[T]) && !/^\d/.test(arguments[T]) ? m.isString(arguments[T]) || m.isArray(arguments[T]) ? v.easing = arguments[T] : m.isFunction(arguments[T]) && (v.complete = arguments[T]) : v.duration = arguments[T];
|
|
|
|
+ }
|
|
|
|
+ }var k = { promise: null, resolver: null, rejecter: null };s && b.Promise && (k.promise = new b.Promise(function (e, t) {
|
|
|
|
+ k.resolver = e, k.rejecter = t;
|
|
|
|
+ }));var A;switch (y) {case "scroll":
|
|
|
|
+ A = "scroll";break;case "reverse":
|
|
|
|
+ A = "reverse";break;case "finish":case "stop":
|
|
|
|
+ f.each(g, function (e, t) {
|
|
|
|
+ i(t) && i(t).delayTimer && (clearTimeout(i(t).delayTimer.setTimeout), i(t).delayTimer.next && i(t).delayTimer.next(), delete i(t).delayTimer);
|
|
|
|
+ });var F = [];return f.each(b.State.calls, function (e, t) {
|
|
|
|
+ t && f.each(t[1], function (r, n) {
|
|
|
|
+ var o = v === a ? "" : v;return o === !0 || t[2].queue === o || v === a && t[2].queue === !1 ? void f.each(g, function (r, a) {
|
|
|
|
+ a === n && ((v === !0 || m.isString(v)) && (f.each(f.queue(a, m.isString(v) ? v : ""), function (e, t) {
|
|
|
|
+ m.isFunction(t) && t(null, !0);
|
|
|
|
+ }), f.queue(a, m.isString(v) ? v : "", [])), "stop" === y ? (i(a) && i(a).tweensContainer && o !== !1 && f.each(i(a).tweensContainer, function (e, t) {
|
|
|
|
+ t.endValue = t.currentValue;
|
|
|
|
+ }), F.push(e)) : "finish" === y && (t[2].duration = 1));
|
|
|
|
+ }) : !0;
|
|
|
|
+ });
|
|
|
|
+ }), "stop" === y && (f.each(F, function (e, t) {
|
|
|
|
+ p(t, !0);
|
|
|
|
+ }), k.promise && k.resolver(g)), e();default:
|
|
|
|
+ if (!f.isPlainObject(y) || m.isEmptyObject(y)) {
|
|
|
|
+ if (m.isString(y) && b.Redirects[y]) {
|
|
|
|
+ var j = f.extend({}, v),
|
|
|
|
+ E = j.duration,
|
|
|
|
+ H = j.delay || 0;return j.backwards === !0 && (g = f.extend(!0, [], g).reverse()), f.each(g, function (e, t) {
|
|
|
|
+ parseFloat(j.stagger) ? j.delay = H + parseFloat(j.stagger) * e : m.isFunction(j.stagger) && (j.delay = H + j.stagger.call(t, e, w)), j.drag && (j.duration = parseFloat(E) || (/^(callout|transition)/.test(y) ? 1e3 : h), j.duration = Math.max(j.duration * (j.backwards ? 1 - e / w : (e + 1) / w), .75 * j.duration, 200)), b.Redirects[y].call(t, t, j || {}, e, w, g, k.promise ? k : a);
|
|
|
|
+ }), e();
|
|
|
|
+ }var N = "Velocity: First argument (" + y + ") was not a property map, a known action, or a registered redirect. Aborting.";return k.promise ? k.rejecter(new Error(N)) : console.log(N), e();
|
|
|
|
+ }A = "start";}var L = { lastParent: null, lastPosition: null, lastFontSize: null, lastPercentToPxWidth: null, lastPercentToPxHeight: null, lastEmToPx: null, remToPx: null, vwToPx: null, vhToPx: null },
|
|
|
|
+ R = [];f.each(g, function (e, t) {
|
|
|
|
+ m.isNode(t) && n.call(t);
|
|
|
|
+ });var z,
|
|
|
|
+ j = f.extend({}, b.defaults, v);if (j.loop = parseInt(j.loop), z = 2 * j.loop - 1, j.loop) for (var O = 0; z > O; O++) {
|
|
|
|
+ var q = { delay: j.delay, progress: j.progress };O === z - 1 && (q.display = j.display, q.visibility = j.visibility, q.complete = j.complete), P(g, "reverse", q);
|
|
|
|
+ }return e();
|
|
|
|
+ }
|
|
|
|
+ };b = f.extend(P, b), b.animate = P;var w = t.requestAnimationFrame || g;return b.State.isMobile || r.hidden === a || r.addEventListener("visibilitychange", function () {
|
|
|
|
+ r.hidden ? (w = function (e) {
|
|
|
|
+ return setTimeout(function () {
|
|
|
|
+ e(!0);
|
|
|
|
+ }, 16);
|
|
|
|
+ }, c()) : w = t.requestAnimationFrame || g;
|
|
|
|
+ }), e.Velocity = b, e !== t && (e.fn.velocity = P, e.fn.velocity.defaults = b.defaults), f.each(["Down", "Up"], function (e, t) {
|
|
|
|
+ b.Redirects["slide" + t] = function (e, r, n, o, i, s) {
|
|
|
|
+ var l = f.extend({}, r),
|
|
|
|
+ u = l.begin,
|
|
|
|
+ c = l.complete,
|
|
|
|
+ p = { height: "", marginTop: "", marginBottom: "", paddingTop: "", paddingBottom: "" },
|
|
|
|
+ d = {};l.display === a && (l.display = "Down" === t ? "inline" === b.CSS.Values.getDisplayType(e) ? "inline-block" : "block" : "none"), l.begin = function () {
|
|
|
|
+ u && u.call(i, i);for (var r in p) {
|
|
|
|
+ d[r] = e.style[r];var a = b.CSS.getPropertyValue(e, r);p[r] = "Down" === t ? [a, 0] : [0, a];
|
|
|
|
+ }d.overflow = e.style.overflow, e.style.overflow = "hidden";
|
|
|
|
+ }, l.complete = function () {
|
|
|
|
+ for (var t in d) {
|
|
|
|
+ e.style[t] = d[t];
|
|
|
|
+ }c && c.call(i, i), s && s.resolver(i);
|
|
|
|
+ }, b(e, p, l);
|
|
|
|
+ };
|
|
|
|
+ }), f.each(["In", "Out"], function (e, t) {
|
|
|
|
+ b.Redirects["fade" + t] = function (e, r, n, o, i, s) {
|
|
|
|
+ var l = f.extend({}, r),
|
|
|
|
+ u = { opacity: "In" === t ? 1 : 0 },
|
|
|
|
+ c = l.complete;l.complete = n !== o - 1 ? l.begin = null : function () {
|
|
|
|
+ c && c.call(i, i), s && s.resolver(i);
|
|
|
|
+ }, l.display === a && (l.display = "In" === t ? "auto" : "none"), b(this, u, l);
|
|
|
|
+ };
|
|
|
|
+ }), b;
|
|
|
|
+ }(window.jQuery || window.Zepto || window, window, document);
|
|
|
|
+}));
|
|
|
|
+;!function (a, b, c, d) {
|
|
|
|
+ "use strict";
|
|
|
|
+ function k(a, b, c) {
|
|
|
|
+ return setTimeout(q(a, c), b);
|
|
|
|
+ }function l(a, b, c) {
|
|
|
|
+ return Array.isArray(a) ? (m(a, c[b], c), !0) : !1;
|
|
|
|
+ }function m(a, b, c) {
|
|
|
|
+ var e;if (a) if (a.forEach) a.forEach(b, c);else if (a.length !== d) for (e = 0; e < a.length;) {
|
|
|
|
+ b.call(c, a[e], e, a), e++;
|
|
|
|
+ } else for (e in a) {
|
|
|
|
+ a.hasOwnProperty(e) && b.call(c, a[e], e, a);
|
|
|
|
+ }
|
|
|
|
+ }function n(a, b, c) {
|
|
|
|
+ for (var e = Object.keys(b), f = 0; f < e.length;) {
|
|
|
|
+ (!c || c && a[e[f]] === d) && (a[e[f]] = b[e[f]]), f++;
|
|
|
|
+ }return a;
|
|
|
|
+ }function o(a, b) {
|
|
|
|
+ return n(a, b, !0);
|
|
|
|
+ }function p(a, b, c) {
|
|
|
|
+ var e,
|
|
|
|
+ d = b.prototype;e = a.prototype = Object.create(d), e.constructor = a, e._super = d, c && n(e, c);
|
|
|
|
+ }function q(a, b) {
|
|
|
|
+ return function () {
|
|
|
|
+ return a.apply(b, arguments);
|
|
|
|
+ };
|
|
|
|
+ }function r(a, b) {
|
|
|
|
+ return typeof a == g ? a.apply(b ? b[0] || d : d, b) : a;
|
|
|
|
+ }function s(a, b) {
|
|
|
|
+ return a === d ? b : a;
|
|
|
|
+ }function t(a, b, c) {
|
|
|
|
+ m(x(b), function (b) {
|
|
|
|
+ a.addEventListener(b, c, !1);
|
|
|
|
+ });
|
|
|
|
+ }function u(a, b, c) {
|
|
|
|
+ m(x(b), function (b) {
|
|
|
|
+ a.removeEventListener(b, c, !1);
|
|
|
|
+ });
|
|
|
|
+ }function v(a, b) {
|
|
|
|
+ for (; a;) {
|
|
|
|
+ if (a == b) return !0;a = a.parentNode;
|
|
|
|
+ }return !1;
|
|
|
|
+ }function w(a, b) {
|
|
|
|
+ return a.indexOf(b) > -1;
|
|
|
|
+ }function x(a) {
|
|
|
|
+ return a.trim().split(/\s+/g);
|
|
|
|
+ }function y(a, b, c) {
|
|
|
|
+ if (a.indexOf && !c) return a.indexOf(b);for (var d = 0; d < a.length;) {
|
|
|
|
+ if (c && a[d][c] == b || !c && a[d] === b) return d;d++;
|
|
|
|
+ }return -1;
|
|
|
|
+ }function z(a) {
|
|
|
|
+ return Array.prototype.slice.call(a, 0);
|
|
|
|
+ }function A(a, b, c) {
|
|
|
|
+ for (var d = [], e = [], f = 0; f < a.length;) {
|
|
|
|
+ var g = b ? a[f][b] : a[f];y(e, g) < 0 && d.push(a[f]), e[f] = g, f++;
|
|
|
|
+ }return c && (d = b ? d.sort(function (a, c) {
|
|
|
|
+ return a[b] > c[b];
|
|
|
|
+ }) : d.sort()), d;
|
|
|
|
+ }function B(a, b) {
|
|
|
|
+ for (var c, f, g = b[0].toUpperCase() + b.slice(1), h = 0; h < e.length;) {
|
|
|
|
+ if (c = e[h], f = c ? c + g : b, f in a) return f;h++;
|
|
|
|
+ }return d;
|
|
|
|
+ }function D() {
|
|
|
|
+ return C++;
|
|
|
|
+ }function E(a) {
|
|
|
|
+ var b = a.ownerDocument;return b.defaultView || b.parentWindow;
|
|
|
|
+ }function ab(a, b) {
|
|
|
|
+ var c = this;this.manager = a, this.callback = b, this.element = a.element, this.target = a.options.inputTarget, this.domHandler = function (b) {
|
|
|
|
+ r(a.options.enable, [a]) && c.handler(b);
|
|
|
|
+ }, this.init();
|
|
|
|
+ }function bb(a) {
|
|
|
|
+ var b,
|
|
|
|
+ c = a.options.inputClass;return b = c ? c : H ? wb : I ? Eb : G ? Gb : rb, new b(a, cb);
|
|
|
|
+ }function cb(a, b, c) {
|
|
|
|
+ var d = c.pointers.length,
|
|
|
|
+ e = c.changedPointers.length,
|
|
|
|
+ f = b & O && 0 === d - e,
|
|
|
|
+ g = b & (Q | R) && 0 === d - e;c.isFirst = !!f, c.isFinal = !!g, f && (a.session = {}), c.eventType = b, db(a, c), a.emit("hammer.input", c), a.recognize(c), a.session.prevInput = c;
|
|
|
|
+ }function db(a, b) {
|
|
|
|
+ var c = a.session,
|
|
|
|
+ d = b.pointers,
|
|
|
|
+ e = d.length;c.firstInput || (c.firstInput = gb(b)), e > 1 && !c.firstMultiple ? c.firstMultiple = gb(b) : 1 === e && (c.firstMultiple = !1);var f = c.firstInput,
|
|
|
|
+ g = c.firstMultiple,
|
|
|
|
+ h = g ? g.center : f.center,
|
|
|
|
+ i = b.center = hb(d);b.timeStamp = j(), b.deltaTime = b.timeStamp - f.timeStamp, b.angle = lb(h, i), b.distance = kb(h, i), eb(c, b), b.offsetDirection = jb(b.deltaX, b.deltaY), b.scale = g ? nb(g.pointers, d) : 1, b.rotation = g ? mb(g.pointers, d) : 0, fb(c, b);var k = a.element;v(b.srcEvent.target, k) && (k = b.srcEvent.target), b.target = k;
|
|
|
|
+ }function eb(a, b) {
|
|
|
|
+ var c = b.center,
|
|
|
|
+ d = a.offsetDelta || {},
|
|
|
|
+ e = a.prevDelta || {},
|
|
|
|
+ f = a.prevInput || {};(b.eventType === O || f.eventType === Q) && (e = a.prevDelta = { x: f.deltaX || 0, y: f.deltaY || 0 }, d = a.offsetDelta = { x: c.x, y: c.y }), b.deltaX = e.x + (c.x - d.x), b.deltaY = e.y + (c.y - d.y);
|
|
|
|
+ }function fb(a, b) {
|
|
|
|
+ var f,
|
|
|
|
+ g,
|
|
|
|
+ h,
|
|
|
|
+ j,
|
|
|
|
+ c = a.lastInterval || b,
|
|
|
|
+ e = b.timeStamp - c.timeStamp;if (b.eventType != R && (e > N || c.velocity === d)) {
|
|
|
|
+ var k = c.deltaX - b.deltaX,
|
|
|
|
+ l = c.deltaY - b.deltaY,
|
|
|
|
+ m = ib(e, k, l);g = m.x, h = m.y, f = i(m.x) > i(m.y) ? m.x : m.y, j = jb(k, l), a.lastInterval = b;
|
|
|
|
+ } else f = c.velocity, g = c.velocityX, h = c.velocityY, j = c.direction;b.velocity = f, b.velocityX = g, b.velocityY = h, b.direction = j;
|
|
|
|
+ }function gb(a) {
|
|
|
|
+ for (var b = [], c = 0; c < a.pointers.length;) {
|
|
|
|
+ b[c] = { clientX: h(a.pointers[c].clientX), clientY: h(a.pointers[c].clientY) }, c++;
|
|
|
|
+ }return { timeStamp: j(), pointers: b, center: hb(b), deltaX: a.deltaX, deltaY: a.deltaY };
|
|
|
|
+ }function hb(a) {
|
|
|
|
+ var b = a.length;if (1 === b) return { x: h(a[0].clientX), y: h(a[0].clientY) };for (var c = 0, d = 0, e = 0; b > e;) {
|
|
|
|
+ c += a[e].clientX, d += a[e].clientY, e++;
|
|
|
|
+ }return { x: h(c / b), y: h(d / b) };
|
|
|
|
+ }function ib(a, b, c) {
|
|
|
|
+ return { x: b / a || 0, y: c / a || 0 };
|
|
|
|
+ }function jb(a, b) {
|
|
|
|
+ return a === b ? S : i(a) >= i(b) ? a > 0 ? T : U : b > 0 ? V : W;
|
|
|
|
+ }function kb(a, b, c) {
|
|
|
|
+ c || (c = $);var d = b[c[0]] - a[c[0]],
|
|
|
|
+ e = b[c[1]] - a[c[1]];return Math.sqrt(d * d + e * e);
|
|
|
|
+ }function lb(a, b, c) {
|
|
|
|
+ c || (c = $);var d = b[c[0]] - a[c[0]],
|
|
|
|
+ e = b[c[1]] - a[c[1]];return 180 * Math.atan2(e, d) / Math.PI;
|
|
|
|
+ }function mb(a, b) {
|
|
|
|
+ return lb(b[1], b[0], _) - lb(a[1], a[0], _);
|
|
|
|
+ }function nb(a, b) {
|
|
|
|
+ return kb(b[0], b[1], _) / kb(a[0], a[1], _);
|
|
|
|
+ }function rb() {
|
|
|
|
+ this.evEl = pb, this.evWin = qb, this.allow = !0, this.pressed = !1, ab.apply(this, arguments);
|
|
|
|
+ }function wb() {
|
|
|
|
+ this.evEl = ub, this.evWin = vb, ab.apply(this, arguments), this.store = this.manager.session.pointerEvents = [];
|
|
|
|
+ }function Ab() {
|
|
|
|
+ this.evTarget = yb, this.evWin = zb, this.started = !1, ab.apply(this, arguments);
|
|
|
|
+ }function Bb(a, b) {
|
|
|
|
+ var c = z(a.touches),
|
|
|
|
+ d = z(a.changedTouches);return b & (Q | R) && (c = A(c.concat(d), "identifier", !0)), [c, d];
|
|
|
|
+ }function Eb() {
|
|
|
|
+ this.evTarget = Db, this.targetIds = {}, ab.apply(this, arguments);
|
|
|
|
+ }function Fb(a, b) {
|
|
|
|
+ var c = z(a.touches),
|
|
|
|
+ d = this.targetIds;if (b & (O | P) && 1 === c.length) return d[c[0].identifier] = !0, [c, c];var e,
|
|
|
|
+ f,
|
|
|
|
+ g = z(a.changedTouches),
|
|
|
|
+ h = [],
|
|
|
|
+ i = this.target;if (f = c.filter(function (a) {
|
|
|
|
+ return v(a.target, i);
|
|
|
|
+ }), b === O) for (e = 0; e < f.length;) {
|
|
|
|
+ d[f[e].identifier] = !0, e++;
|
|
|
|
+ }for (e = 0; e < g.length;) {
|
|
|
|
+ d[g[e].identifier] && h.push(g[e]), b & (Q | R) && delete d[g[e].identifier], e++;
|
|
|
|
+ }return h.length ? [A(f.concat(h), "identifier", !0), h] : void 0;
|
|
|
|
+ }function Gb() {
|
|
|
|
+ ab.apply(this, arguments);var a = q(this.handler, this);this.touch = new Eb(this.manager, a), this.mouse = new rb(this.manager, a);
|
|
|
|
+ }function Pb(a, b) {
|
|
|
|
+ this.manager = a, this.set(b);
|
|
|
|
+ }function Qb(a) {
|
|
|
|
+ if (w(a, Mb)) return Mb;var b = w(a, Nb),
|
|
|
|
+ c = w(a, Ob);return b && c ? Nb + " " + Ob : b || c ? b ? Nb : Ob : w(a, Lb) ? Lb : Kb;
|
|
|
|
+ }function Yb(a) {
|
|
|
|
+ this.id = D(), this.manager = null, this.options = o(a || {}, this.defaults), this.options.enable = s(this.options.enable, !0), this.state = Rb, this.simultaneous = {}, this.requireFail = [];
|
|
|
|
+ }function Zb(a) {
|
|
|
|
+ return a & Wb ? "cancel" : a & Ub ? "end" : a & Tb ? "move" : a & Sb ? "start" : "";
|
|
|
|
+ }function $b(a) {
|
|
|
|
+ return a == W ? "down" : a == V ? "up" : a == T ? "left" : a == U ? "right" : "";
|
|
|
|
+ }function _b(a, b) {
|
|
|
|
+ var c = b.manager;return c ? c.get(a) : a;
|
|
|
|
+ }function ac() {
|
|
|
|
+ Yb.apply(this, arguments);
|
|
|
|
+ }function bc() {
|
|
|
|
+ ac.apply(this, arguments), this.pX = null, this.pY = null;
|
|
|
|
+ }function cc() {
|
|
|
|
+ ac.apply(this, arguments);
|
|
|
|
+ }function dc() {
|
|
|
|
+ Yb.apply(this, arguments), this._timer = null, this._input = null;
|
|
|
|
+ }function ec() {
|
|
|
|
+ ac.apply(this, arguments);
|
|
|
|
+ }function fc() {
|
|
|
|
+ ac.apply(this, arguments);
|
|
|
|
+ }function gc() {
|
|
|
|
+ Yb.apply(this, arguments), this.pTime = !1, this.pCenter = !1, this._timer = null, this._input = null, this.count = 0;
|
|
|
|
+ }function hc(a, b) {
|
|
|
|
+ return b = b || {}, b.recognizers = s(b.recognizers, hc.defaults.preset), new kc(a, b);
|
|
|
|
+ }function kc(a, b) {
|
|
|
|
+ b = b || {}, this.options = o(b, hc.defaults), this.options.inputTarget = this.options.inputTarget || a, this.handlers = {}, this.session = {}, this.recognizers = [], this.element = a, this.input = bb(this), this.touchAction = new Pb(this, this.options.touchAction), lc(this, !0), m(b.recognizers, function (a) {
|
|
|
|
+ var b = this.add(new a[0](a[1]));a[2] && b.recognizeWith(a[2]), a[3] && b.requireFailure(a[3]);
|
|
|
|
+ }, this);
|
|
|
|
+ }function lc(a, b) {
|
|
|
|
+ var c = a.element;m(a.options.cssProps, function (a, d) {
|
|
|
|
+ c.style[B(c.style, d)] = b ? a : "";
|
|
|
|
+ });
|
|
|
|
+ }function mc(a, c) {
|
|
|
|
+ var d = b.createEvent("Event");d.initEvent(a, !0, !0), d.gesture = c, c.target.dispatchEvent(d);
|
|
|
|
+ }var e = ["", "webkit", "moz", "MS", "ms", "o"],
|
|
|
|
+ f = b.createElement("div"),
|
|
|
|
+ g = "function",
|
|
|
|
+ h = Math.round,
|
|
|
|
+ i = Math.abs,
|
|
|
|
+ j = Date.now,
|
|
|
|
+ C = 1,
|
|
|
|
+ F = /mobile|tablet|ip(ad|hone|od)|android/i,
|
|
|
|
+ G = "ontouchstart" in a,
|
|
|
|
+ H = B(a, "PointerEvent") !== d,
|
|
|
|
+ I = G && F.test(navigator.userAgent),
|
|
|
|
+ J = "touch",
|
|
|
|
+ K = "pen",
|
|
|
|
+ L = "mouse",
|
|
|
|
+ M = "kinect",
|
|
|
|
+ N = 25,
|
|
|
|
+ O = 1,
|
|
|
|
+ P = 2,
|
|
|
|
+ Q = 4,
|
|
|
|
+ R = 8,
|
|
|
|
+ S = 1,
|
|
|
|
+ T = 2,
|
|
|
|
+ U = 4,
|
|
|
|
+ V = 8,
|
|
|
|
+ W = 16,
|
|
|
|
+ X = T | U,
|
|
|
|
+ Y = V | W,
|
|
|
|
+ Z = X | Y,
|
|
|
|
+ $ = ["x", "y"],
|
|
|
|
+ _ = ["clientX", "clientY"];ab.prototype = { handler: function () {}, init: function () {
|
|
|
|
+ this.evEl && t(this.element, this.evEl, this.domHandler), this.evTarget && t(this.target, this.evTarget, this.domHandler), this.evWin && t(E(this.element), this.evWin, this.domHandler);
|
|
|
|
+ }, destroy: function () {
|
|
|
|
+ this.evEl && u(this.element, this.evEl, this.domHandler), this.evTarget && u(this.target, this.evTarget, this.domHandler), this.evWin && u(E(this.element), this.evWin, this.domHandler);
|
|
|
|
+ } };var ob = { mousedown: O, mousemove: P, mouseup: Q },
|
|
|
|
+ pb = "mousedown",
|
|
|
|
+ qb = "mousemove mouseup";p(rb, ab, { handler: function (a) {
|
|
|
|
+ var b = ob[a.type];b & O && 0 === a.button && (this.pressed = !0), b & P && 1 !== a.which && (b = Q), this.pressed && this.allow && (b & Q && (this.pressed = !1), this.callback(this.manager, b, { pointers: [a], changedPointers: [a], pointerType: L, srcEvent: a }));
|
|
|
|
+ } });var sb = { pointerdown: O, pointermove: P, pointerup: Q, pointercancel: R, pointerout: R },
|
|
|
|
+ tb = { 2: J, 3: K, 4: L, 5: M },
|
|
|
|
+ ub = "pointerdown",
|
|
|
|
+ vb = "pointermove pointerup pointercancel";a.MSPointerEvent && (ub = "MSPointerDown", vb = "MSPointerMove MSPointerUp MSPointerCancel"), p(wb, ab, { handler: function (a) {
|
|
|
|
+ var b = this.store,
|
|
|
|
+ c = !1,
|
|
|
|
+ d = a.type.toLowerCase().replace("ms", ""),
|
|
|
|
+ e = sb[d],
|
|
|
|
+ f = tb[a.pointerType] || a.pointerType,
|
|
|
|
+ g = f == J,
|
|
|
|
+ h = y(b, a.pointerId, "pointerId");e & O && (0 === a.button || g) ? 0 > h && (b.push(a), h = b.length - 1) : e & (Q | R) && (c = !0), 0 > h || (b[h] = a, this.callback(this.manager, e, { pointers: b, changedPointers: [a], pointerType: f, srcEvent: a }), c && b.splice(h, 1));
|
|
|
|
+ } });var xb = { touchstart: O, touchmove: P, touchend: Q, touchcancel: R },
|
|
|
|
+ yb = "touchstart",
|
|
|
|
+ zb = "touchstart touchmove touchend touchcancel";p(Ab, ab, { handler: function (a) {
|
|
|
|
+ var b = xb[a.type];if (b === O && (this.started = !0), this.started) {
|
|
|
|
+ var c = Bb.call(this, a, b);b & (Q | R) && 0 === c[0].length - c[1].length && (this.started = !1), this.callback(this.manager, b, { pointers: c[0], changedPointers: c[1], pointerType: J, srcEvent: a });
|
|
|
|
+ }
|
|
|
|
+ } });var Cb = { touchstart: O, touchmove: P, touchend: Q, touchcancel: R },
|
|
|
|
+ Db = "touchstart touchmove touchend touchcancel";p(Eb, ab, { handler: function (a) {
|
|
|
|
+ var b = Cb[a.type],
|
|
|
|
+ c = Fb.call(this, a, b);c && this.callback(this.manager, b, { pointers: c[0], changedPointers: c[1], pointerType: J, srcEvent: a });
|
|
|
|
+ } }), p(Gb, ab, { handler: function (a, b, c) {
|
|
|
|
+ var d = c.pointerType == J,
|
|
|
|
+ e = c.pointerType == L;if (d) this.mouse.allow = !1;else if (e && !this.mouse.allow) return;b & (Q | R) && (this.mouse.allow = !0), this.callback(a, b, c);
|
|
|
|
+ }, destroy: function () {
|
|
|
|
+ this.touch.destroy(), this.mouse.destroy();
|
|
|
|
+ } });var Hb = B(f.style, "touchAction"),
|
|
|
|
+ Ib = Hb !== d,
|
|
|
|
+ Jb = "compute",
|
|
|
|
+ Kb = "auto",
|
|
|
|
+ Lb = "manipulation",
|
|
|
|
+ Mb = "none",
|
|
|
|
+ Nb = "pan-x",
|
|
|
|
+ Ob = "pan-y";Pb.prototype = { set: function (a) {
|
|
|
|
+ a == Jb && (a = this.compute()), Ib && (this.manager.element.style[Hb] = a), this.actions = a.toLowerCase().trim();
|
|
|
|
+ }, update: function () {
|
|
|
|
+ this.set(this.manager.options.touchAction);
|
|
|
|
+ }, compute: function () {
|
|
|
|
+ var a = [];return m(this.manager.recognizers, function (b) {
|
|
|
|
+ r(b.options.enable, [b]) && (a = a.concat(b.getTouchAction()));
|
|
|
|
+ }), Qb(a.join(" "));
|
|
|
|
+ }, preventDefaults: function (a) {
|
|
|
|
+ if (!Ib) {
|
|
|
|
+ var b = a.srcEvent,
|
|
|
|
+ c = a.offsetDirection;if (this.manager.session.prevented) return b.preventDefault(), void 0;var d = this.actions,
|
|
|
|
+ e = w(d, Mb),
|
|
|
|
+ f = w(d, Ob),
|
|
|
|
+ g = w(d, Nb);return e || f && c & X || g && c & Y ? this.preventSrc(b) : void 0;
|
|
|
|
+ }
|
|
|
|
+ }, preventSrc: function (a) {
|
|
|
|
+ this.manager.session.prevented = !0, a.preventDefault();
|
|
|
|
+ } };var Rb = 1,
|
|
|
|
+ Sb = 2,
|
|
|
|
+ Tb = 4,
|
|
|
|
+ Ub = 8,
|
|
|
|
+ Vb = Ub,
|
|
|
|
+ Wb = 16,
|
|
|
|
+ Xb = 32;Yb.prototype = { defaults: {}, set: function (a) {
|
|
|
|
+ return n(this.options, a), this.manager && this.manager.touchAction.update(), this;
|
|
|
|
+ }, recognizeWith: function (a) {
|
|
|
|
+ if (l(a, "recognizeWith", this)) return this;var b = this.simultaneous;return a = _b(a, this), b[a.id] || (b[a.id] = a, a.recognizeWith(this)), this;
|
|
|
|
+ }, dropRecognizeWith: function (a) {
|
|
|
|
+ return l(a, "dropRecognizeWith", this) ? this : (a = _b(a, this), delete this.simultaneous[a.id], this);
|
|
|
|
+ }, requireFailure: function (a) {
|
|
|
|
+ if (l(a, "requireFailure", this)) return this;var b = this.requireFail;return a = _b(a, this), -1 === y(b, a) && (b.push(a), a.requireFailure(this)), this;
|
|
|
|
+ }, dropRequireFailure: function (a) {
|
|
|
|
+ if (l(a, "dropRequireFailure", this)) return this;a = _b(a, this);var b = y(this.requireFail, a);return b > -1 && this.requireFail.splice(b, 1), this;
|
|
|
|
+ }, hasRequireFailures: function () {
|
|
|
|
+ return this.requireFail.length > 0;
|
|
|
|
+ }, canRecognizeWith: function (a) {
|
|
|
|
+ return !!this.simultaneous[a.id];
|
|
|
|
+ }, emit: function (a) {
|
|
|
|
+ function d(d) {
|
|
|
|
+ b.manager.emit(b.options.event + (d ? Zb(c) : ""), a);
|
|
|
|
+ }var b = this,
|
|
|
|
+ c = this.state;Ub > c && d(!0), d(), c >= Ub && d(!0);
|
|
|
|
+ }, tryEmit: function (a) {
|
|
|
|
+ return this.canEmit() ? this.emit(a) : (this.state = Xb, void 0);
|
|
|
|
+ }, canEmit: function () {
|
|
|
|
+ for (var a = 0; a < this.requireFail.length;) {
|
|
|
|
+ if (!(this.requireFail[a].state & (Xb | Rb))) return !1;a++;
|
|
|
|
+ }return !0;
|
|
|
|
+ }, recognize: function (a) {
|
|
|
|
+ var b = n({}, a);return r(this.options.enable, [this, b]) ? (this.state & (Vb | Wb | Xb) && (this.state = Rb), this.state = this.process(b), this.state & (Sb | Tb | Ub | Wb) && this.tryEmit(b), void 0) : (this.reset(), this.state = Xb, void 0);
|
|
|
|
+ }, process: function () {}, getTouchAction: function () {}, reset: function () {} }, p(ac, Yb, { defaults: { pointers: 1 }, attrTest: function (a) {
|
|
|
|
+ var b = this.options.pointers;return 0 === b || a.pointers.length === b;
|
|
|
|
+ }, process: function (a) {
|
|
|
|
+ var b = this.state,
|
|
|
|
+ c = a.eventType,
|
|
|
|
+ d = b & (Sb | Tb),
|
|
|
|
+ e = this.attrTest(a);return d && (c & R || !e) ? b | Wb : d || e ? c & Q ? b | Ub : b & Sb ? b | Tb : Sb : Xb;
|
|
|
|
+ } }), p(bc, ac, { defaults: { event: "pan", threshold: 10, pointers: 1, direction: Z }, getTouchAction: function () {
|
|
|
|
+ var a = this.options.direction,
|
|
|
|
+ b = [];return a & X && b.push(Ob), a & Y && b.push(Nb), b;
|
|
|
|
+ }, directionTest: function (a) {
|
|
|
|
+ var b = this.options,
|
|
|
|
+ c = !0,
|
|
|
|
+ d = a.distance,
|
|
|
|
+ e = a.direction,
|
|
|
|
+ f = a.deltaX,
|
|
|
|
+ g = a.deltaY;return e & b.direction || (b.direction & X ? (e = 0 === f ? S : 0 > f ? T : U, c = f != this.pX, d = Math.abs(a.deltaX)) : (e = 0 === g ? S : 0 > g ? V : W, c = g != this.pY, d = Math.abs(a.deltaY))), a.direction = e, c && d > b.threshold && e & b.direction;
|
|
|
|
+ }, attrTest: function (a) {
|
|
|
|
+ return ac.prototype.attrTest.call(this, a) && (this.state & Sb || !(this.state & Sb) && this.directionTest(a));
|
|
|
|
+ }, emit: function (a) {
|
|
|
|
+ this.pX = a.deltaX, this.pY = a.deltaY;var b = $b(a.direction);b && this.manager.emit(this.options.event + b, a), this._super.emit.call(this, a);
|
|
|
|
+ } }), p(cc, ac, { defaults: { event: "pinch", threshold: 0, pointers: 2 }, getTouchAction: function () {
|
|
|
|
+ return [Mb];
|
|
|
|
+ }, attrTest: function (a) {
|
|
|
|
+ return this._super.attrTest.call(this, a) && (Math.abs(a.scale - 1) > this.options.threshold || this.state & Sb);
|
|
|
|
+ }, emit: function (a) {
|
|
|
|
+ if (this._super.emit.call(this, a), 1 !== a.scale) {
|
|
|
|
+ var b = a.scale < 1 ? "in" : "out";this.manager.emit(this.options.event + b, a);
|
|
|
|
+ }
|
|
|
|
+ } }), p(dc, Yb, { defaults: { event: "press", pointers: 1, time: 500, threshold: 5 }, getTouchAction: function () {
|
|
|
|
+ return [Kb];
|
|
|
|
+ }, process: function (a) {
|
|
|
|
+ var b = this.options,
|
|
|
|
+ c = a.pointers.length === b.pointers,
|
|
|
|
+ d = a.distance < b.threshold,
|
|
|
|
+ e = a.deltaTime > b.time;if (this._input = a, !d || !c || a.eventType & (Q | R) && !e) this.reset();else if (a.eventType & O) this.reset(), this._timer = k(function () {
|
|
|
|
+ this.state = Vb, this.tryEmit();
|
|
|
|
+ }, b.time, this);else if (a.eventType & Q) return Vb;return Xb;
|
|
|
|
+ }, reset: function () {
|
|
|
|
+ clearTimeout(this._timer);
|
|
|
|
+ }, emit: function (a) {
|
|
|
|
+ this.state === Vb && (a && a.eventType & Q ? this.manager.emit(this.options.event + "up", a) : (this._input.timeStamp = j(), this.manager.emit(this.options.event, this._input)));
|
|
|
|
+ } }), p(ec, ac, { defaults: { event: "rotate", threshold: 0, pointers: 2 }, getTouchAction: function () {
|
|
|
|
+ return [Mb];
|
|
|
|
+ }, attrTest: function (a) {
|
|
|
|
+ return this._super.attrTest.call(this, a) && (Math.abs(a.rotation) > this.options.threshold || this.state & Sb);
|
|
|
|
+ } }), p(fc, ac, { defaults: { event: "swipe", threshold: 10, velocity: .65, direction: X | Y, pointers: 1 }, getTouchAction: function () {
|
|
|
|
+ return bc.prototype.getTouchAction.call(this);
|
|
|
|
+ }, attrTest: function (a) {
|
|
|
|
+ var c,
|
|
|
|
+ b = this.options.direction;return b & (X | Y) ? c = a.velocity : b & X ? c = a.velocityX : b & Y && (c = a.velocityY), this._super.attrTest.call(this, a) && b & a.direction && a.distance > this.options.threshold && i(c) > this.options.velocity && a.eventType & Q;
|
|
|
|
+ }, emit: function (a) {
|
|
|
|
+ var b = $b(a.direction);b && this.manager.emit(this.options.event + b, a), this.manager.emit(this.options.event, a);
|
|
|
|
+ } }), p(gc, Yb, { defaults: { event: "tap", pointers: 1, taps: 1, interval: 300, time: 250, threshold: 2, posThreshold: 10 }, getTouchAction: function () {
|
|
|
|
+ return [Lb];
|
|
|
|
+ }, process: function (a) {
|
|
|
|
+ var b = this.options,
|
|
|
|
+ c = a.pointers.length === b.pointers,
|
|
|
|
+ d = a.distance < b.threshold,
|
|
|
|
+ e = a.deltaTime < b.time;if (this.reset(), a.eventType & O && 0 === this.count) return this.failTimeout();if (d && e && c) {
|
|
|
|
+ if (a.eventType != Q) return this.failTimeout();var f = this.pTime ? a.timeStamp - this.pTime < b.interval : !0,
|
|
|
|
+ g = !this.pCenter || kb(this.pCenter, a.center) < b.posThreshold;this.pTime = a.timeStamp, this.pCenter = a.center, g && f ? this.count += 1 : this.count = 1, this._input = a;var h = this.count % b.taps;if (0 === h) return this.hasRequireFailures() ? (this._timer = k(function () {
|
|
|
|
+ this.state = Vb, this.tryEmit();
|
|
|
|
+ }, b.interval, this), Sb) : Vb;
|
|
|
|
+ }return Xb;
|
|
|
|
+ }, failTimeout: function () {
|
|
|
|
+ return this._timer = k(function () {
|
|
|
|
+ this.state = Xb;
|
|
|
|
+ }, this.options.interval, this), Xb;
|
|
|
|
+ }, reset: function () {
|
|
|
|
+ clearTimeout(this._timer);
|
|
|
|
+ }, emit: function () {
|
|
|
|
+ this.state == Vb && (this._input.tapCount = this.count, this.manager.emit(this.options.event, this._input));
|
|
|
|
+ } }), hc.VERSION = "2.0.4", hc.defaults = { domEvents: !1, touchAction: Jb, enable: !0, inputTarget: null, inputClass: null, preset: [[ec, { enable: !1 }], [cc, { enable: !1 }, ["rotate"]], [fc, { direction: X }], [bc, { direction: X }, ["swipe"]], [gc], [gc, { event: "doubletap", taps: 2 }, ["tap"]], [dc]], cssProps: { userSelect: "default", touchSelect: "none", touchCallout: "none", contentZooming: "none", userDrag: "none", tapHighlightColor: "rgba(0,0,0,0)" } };var ic = 1,
|
|
|
|
+ jc = 2;kc.prototype = { set: function (a) {
|
|
|
|
+ return n(this.options, a), a.touchAction && this.touchAction.update(), a.inputTarget && (this.input.destroy(), this.input.target = a.inputTarget, this.input.init()), this;
|
|
|
|
+ }, stop: function (a) {
|
|
|
|
+ this.session.stopped = a ? jc : ic;
|
|
|
|
+ }, recognize: function (a) {
|
|
|
|
+ var b = this.session;if (!b.stopped) {
|
|
|
|
+ this.touchAction.preventDefaults(a);var c,
|
|
|
|
+ d = this.recognizers,
|
|
|
|
+ e = b.curRecognizer;(!e || e && e.state & Vb) && (e = b.curRecognizer = null);for (var f = 0; f < d.length;) {
|
|
|
|
+ c = d[f], b.stopped === jc || e && c != e && !c.canRecognizeWith(e) ? c.reset() : c.recognize(a), !e && c.state & (Sb | Tb | Ub) && (e = b.curRecognizer = c), f++;
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ }, get: function (a) {
|
|
|
|
+ if (a instanceof Yb) return a;for (var b = this.recognizers, c = 0; c < b.length; c++) {
|
|
|
|
+ if (b[c].options.event == a) return b[c];
|
|
|
|
+ }return null;
|
|
|
|
+ }, add: function (a) {
|
|
|
|
+ if (l(a, "add", this)) return this;var b = this.get(a.options.event);return b && this.remove(b), this.recognizers.push(a), a.manager = this, this.touchAction.update(), a;
|
|
|
|
+ }, remove: function (a) {
|
|
|
|
+ if (l(a, "remove", this)) return this;var b = this.recognizers;return a = this.get(a), b.splice(y(b, a), 1), this.touchAction.update(), this;
|
|
|
|
+ }, on: function (a, b) {
|
|
|
|
+ var c = this.handlers;return m(x(a), function (a) {
|
|
|
|
+ c[a] = c[a] || [], c[a].push(b);
|
|
|
|
+ }), this;
|
|
|
|
+ }, off: function (a, b) {
|
|
|
|
+ var c = this.handlers;return m(x(a), function (a) {
|
|
|
|
+ b ? c[a].splice(y(c[a], b), 1) : delete c[a];
|
|
|
|
+ }), this;
|
|
|
|
+ }, emit: function (a, b) {
|
|
|
|
+ this.options.domEvents && mc(a, b);var c = this.handlers[a] && this.handlers[a].slice();if (c && c.length) {
|
|
|
|
+ b.type = a, b.preventDefault = function () {
|
|
|
|
+ b.srcEvent.preventDefault();
|
|
|
|
+ };for (var d = 0; d < c.length;) {
|
|
|
|
+ c[d](b), d++;
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ }, destroy: function () {
|
|
|
|
+ this.element && lc(this, !1), this.handlers = {}, this.session = {}, this.input.destroy(), this.element = null;
|
|
|
|
+ } }, n(hc, { INPUT_START: O, INPUT_MOVE: P, INPUT_END: Q, INPUT_CANCEL: R, STATE_POSSIBLE: Rb, STATE_BEGAN: Sb, STATE_CHANGED: Tb, STATE_ENDED: Ub, STATE_RECOGNIZED: Vb, STATE_CANCELLED: Wb, STATE_FAILED: Xb, DIRECTION_NONE: S, DIRECTION_LEFT: T, DIRECTION_RIGHT: U, DIRECTION_UP: V, DIRECTION_DOWN: W, DIRECTION_HORIZONTAL: X, DIRECTION_VERTICAL: Y, DIRECTION_ALL: Z, Manager: kc, Input: ab, TouchAction: Pb, TouchInput: Eb, MouseInput: rb, PointerEventInput: wb, TouchMouseInput: Gb, SingleTouchInput: Ab, Recognizer: Yb, AttrRecognizer: ac, Tap: gc, Pan: bc, Swipe: fc, Pinch: cc, Rotate: ec, Press: dc, on: t, off: u, each: m, merge: o, extend: n, inherit: p, bindFn: q, prefixed: B }), typeof define == g && define.amd ? define(function () {
|
|
|
|
+ return hc;
|
|
|
|
+ }) : "undefined" != typeof module && module.exports ? module.exports = hc : a[c] = hc;
|
|
|
|
+}(window, document, "Hammer");;(function (factory) {
|
|
|
|
+ if (typeof define === 'function' && define.amd) {
|
|
|
|
+ define(['jquery', 'hammerjs'], factory);
|
|
|
|
+ } else if (typeof exports === 'object') {
|
|
|
|
+ factory(require('jquery'), require('hammerjs'));
|
|
|
|
+ } else {
|
|
|
|
+ factory(jQuery, Hammer);
|
|
|
|
+ }
|
|
|
|
+})(function ($, Hammer) {
|
|
|
|
+ function hammerify(el, options) {
|
|
|
|
+ var $el = $(el);
|
|
|
|
+ if (!$el.data("hammer")) {
|
|
|
|
+ $el.data("hammer", new Hammer($el[0], options));
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ $.fn.hammer = function (options) {
|
|
|
|
+ return this.each(function () {
|
|
|
|
+ hammerify(this, options);
|
|
|
|
+ });
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ // extend the emit method to also trigger jQuery events
|
|
|
|
+ Hammer.Manager.prototype.emit = function (originalEmit) {
|
|
|
|
+ return function (type, data) {
|
|
|
|
+ originalEmit.call(this, type, data);
|
|
|
|
+ $(this.element).trigger({
|
|
|
|
+ type: type,
|
|
|
|
+ gesture: data
|
|
|
|
+ });
|
|
|
|
+ };
|
|
|
|
+ }(Hammer.Manager.prototype.emit);
|
|
|
|
+});
|
|
|
|
+; // Required for Meteor package, the use of window prevents export by Meteor
|
|
|
|
+(function (window) {
|
|
|
|
+ if (window.Package) {
|
|
|
|
+ Materialize = {};
|
|
|
|
+ } else {
|
|
|
|
+ window.Materialize = {};
|
|
|
|
+ }
|
|
|
|
+})(window);
|
|
|
|
+
|
|
|
|
+if (typeof exports !== 'undefined' && !exports.nodeType) {
|
|
|
|
+ if (typeof module !== 'undefined' && !module.nodeType && module.exports) {
|
|
|
|
+ exports = module.exports = Materialize;
|
|
|
|
+ }
|
|
|
|
+ exports.default = Materialize;
|
|
|
|
+}
|
|
|
|
+
|
|
|
|
+/*
|
|
|
|
+ * raf.js
|
|
|
|
+ * https://github.com/ngryman/raf.js
|
|
|
|
+ *
|
|
|
|
+ * original requestAnimationFrame polyfill by Erik Möller
|
|
|
|
+ * inspired from paul_irish gist and post
|
|
|
|
+ *
|
|
|
|
+ * Copyright (c) 2013 ngryman
|
|
|
|
+ * Licensed under the MIT license.
|
|
|
|
+ */
|
|
|
|
+(function (window) {
|
|
|
|
+ var lastTime = 0,
|
|
|
|
+ vendors = ['webkit', 'moz'],
|
|
|
|
+ requestAnimationFrame = window.requestAnimationFrame,
|
|
|
|
+ cancelAnimationFrame = window.cancelAnimationFrame,
|
|
|
|
+ i = vendors.length;
|
|
|
|
+
|
|
|
|
+ // try to un-prefix existing raf
|
|
|
|
+ while (--i >= 0 && !requestAnimationFrame) {
|
|
|
|
+ requestAnimationFrame = window[vendors[i] + 'RequestAnimationFrame'];
|
|
|
|
+ cancelAnimationFrame = window[vendors[i] + 'CancelRequestAnimationFrame'];
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // polyfill with setTimeout fallback
|
|
|
|
+ // heavily inspired from @darius gist mod: https://gist.github.com/paulirish/1579671#comment-837945
|
|
|
|
+ if (!requestAnimationFrame || !cancelAnimationFrame) {
|
|
|
|
+ requestAnimationFrame = function (callback) {
|
|
|
|
+ var now = +Date.now(),
|
|
|
|
+ nextTime = Math.max(lastTime + 16, now);
|
|
|
|
+ return setTimeout(function () {
|
|
|
|
+ callback(lastTime = nextTime);
|
|
|
|
+ }, nextTime - now);
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ cancelAnimationFrame = clearTimeout;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // export to window
|
|
|
|
+ window.requestAnimationFrame = requestAnimationFrame;
|
|
|
|
+ window.cancelAnimationFrame = cancelAnimationFrame;
|
|
|
|
+})(window);
|
|
|
|
+
|
|
|
|
+/**
|
|
|
|
+ * Generate approximated selector string for a jQuery object
|
|
|
|
+ * @param {jQuery} obj jQuery object to be parsed
|
|
|
|
+ * @returns {string}
|
|
|
|
+ */
|
|
|
|
+Materialize.objectSelectorString = function (obj) {
|
|
|
|
+ var tagStr = obj.prop('tagName') || '';
|
|
|
|
+ var idStr = obj.attr('id') || '';
|
|
|
|
+ var classStr = obj.attr('class') || '';
|
|
|
|
+ return (tagStr + idStr + classStr).replace(/\s/g, '');
|
|
|
|
+};
|
|
|
|
+
|
|
|
|
+// Unique Random ID
|
|
|
|
+Materialize.guid = function () {
|
|
|
|
+ function s4() {
|
|
|
|
+ return Math.floor((1 + Math.random()) * 0x10000).toString(16).substring(1);
|
|
|
|
+ }
|
|
|
|
+ return function () {
|
|
|
|
+ return s4() + s4() + '-' + s4() + '-' + s4() + '-' + s4() + '-' + s4() + s4() + s4();
|
|
|
|
+ };
|
|
|
|
+}();
|
|
|
|
+
|
|
|
|
+/**
|
|
|
|
+ * Escapes hash from special characters
|
|
|
|
+ * @param {string} hash String returned from this.hash
|
|
|
|
+ * @returns {string}
|
|
|
|
+ */
|
|
|
|
+Materialize.escapeHash = function (hash) {
|
|
|
|
+ return hash.replace(/(:|\.|\[|\]|,|=)/g, "\\$1");
|
|
|
|
+};
|
|
|
|
+
|
|
|
|
+Materialize.elementOrParentIsFixed = function (element) {
|
|
|
|
+ var $element = $(element);
|
|
|
|
+ var $checkElements = $element.add($element.parents());
|
|
|
|
+ var isFixed = false;
|
|
|
|
+ $checkElements.each(function () {
|
|
|
|
+ if ($(this).css("position") === "fixed") {
|
|
|
|
+ isFixed = true;
|
|
|
|
+ return false;
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ return isFixed;
|
|
|
|
+};
|
|
|
|
+
|
|
|
|
+/**
|
|
|
|
+ * Get time in ms
|
|
|
|
+ * @license https://raw.github.com/jashkenas/underscore/master/LICENSE
|
|
|
|
+ * @type {function}
|
|
|
|
+ * @return {number}
|
|
|
|
+ */
|
|
|
|
+var getTime = Date.now || function () {
|
|
|
|
+ return new Date().getTime();
|
|
|
|
+};
|
|
|
|
+
|
|
|
|
+/**
|
|
|
|
+ * Returns a function, that, when invoked, will only be triggered at most once
|
|
|
|
+ * during a given window of time. Normally, the throttled function will run
|
|
|
|
+ * as much as it can, without ever going more than once per `wait` duration;
|
|
|
|
+ * but if you'd like to disable the execution on the leading edge, pass
|
|
|
|
+ * `{leading: false}`. To disable execution on the trailing edge, ditto.
|
|
|
|
+ * @license https://raw.github.com/jashkenas/underscore/master/LICENSE
|
|
|
|
+ * @param {function} func
|
|
|
|
+ * @param {number} wait
|
|
|
|
+ * @param {Object=} options
|
|
|
|
+ * @returns {Function}
|
|
|
|
+ */
|
|
|
|
+Materialize.throttle = function (func, wait, options) {
|
|
|
|
+ var context, args, result;
|
|
|
|
+ var timeout = null;
|
|
|
|
+ var previous = 0;
|
|
|
|
+ options || (options = {});
|
|
|
|
+ var later = function () {
|
|
|
|
+ previous = options.leading === false ? 0 : getTime();
|
|
|
|
+ timeout = null;
|
|
|
|
+ result = func.apply(context, args);
|
|
|
|
+ context = args = null;
|
|
|
|
+ };
|
|
|
|
+ return function () {
|
|
|
|
+ var now = getTime();
|
|
|
|
+ if (!previous && options.leading === false) previous = now;
|
|
|
|
+ var remaining = wait - (now - previous);
|
|
|
|
+ context = this;
|
|
|
|
+ args = arguments;
|
|
|
|
+ if (remaining <= 0) {
|
|
|
|
+ clearTimeout(timeout);
|
|
|
|
+ timeout = null;
|
|
|
|
+ previous = now;
|
|
|
|
+ result = func.apply(context, args);
|
|
|
|
+ context = args = null;
|
|
|
|
+ } else if (!timeout && options.trailing !== false) {
|
|
|
|
+ timeout = setTimeout(later, remaining);
|
|
|
|
+ }
|
|
|
|
+ return result;
|
|
|
|
+ };
|
|
|
|
+};
|
|
|
|
+
|
|
|
|
+// Velocity has conflicts when loaded with jQuery, this will check for it
|
|
|
|
+// First, check if in noConflict mode
|
|
|
|
+var Vel;
|
|
|
|
+if (jQuery) {
|
|
|
|
+ Vel = jQuery.Velocity;
|
|
|
|
+} else if ($) {
|
|
|
|
+ Vel = $.Velocity;
|
|
|
|
+} else {
|
|
|
|
+ Vel = Velocity;
|
|
|
|
+}
|
|
|
|
+
|
|
|
|
+if (Vel) {
|
|
|
|
+ Materialize.Vel = Vel;
|
|
|
|
+} else {
|
|
|
|
+ Materialize.Vel = Velocity;
|
|
|
|
+}
|
|
|
|
+;(function ($) {
|
|
|
|
+ $.fn.collapsible = function (options, methodParam) {
|
|
|
|
+ var defaults = {
|
|
|
|
+ accordion: undefined,
|
|
|
|
+ onOpen: undefined,
|
|
|
|
+ onClose: undefined
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ var methodName = options;
|
|
|
|
+ options = $.extend(defaults, options);
|
|
|
|
+
|
|
|
|
+ return this.each(function () {
|
|
|
|
+
|
|
|
|
+ var $this = $(this);
|
|
|
|
+
|
|
|
|
+ var $panel_headers = $(this).find('> li > .collapsible-header');
|
|
|
|
+
|
|
|
|
+ var collapsible_type = $this.data("collapsible");
|
|
|
|
+
|
|
|
|
+ /****************
|
|
|
|
+ Helper Functions
|
|
|
|
+ ****************/
|
|
|
|
+
|
|
|
|
+ // Accordion Open
|
|
|
|
+ function accordionOpen(object) {
|
|
|
|
+ $panel_headers = $this.find('> li > .collapsible-header');
|
|
|
|
+ if (object.hasClass('active')) {
|
|
|
|
+ object.parent().addClass('active');
|
|
|
|
+ } else {
|
|
|
|
+ object.parent().removeClass('active');
|
|
|
|
+ }
|
|
|
|
+ if (object.parent().hasClass('active')) {
|
|
|
|
+ object.siblings('.collapsible-body').stop(true, false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () {
|
|
|
|
+ $(this).css('height', '');
|
|
|
|
+ } });
|
|
|
|
+ } else {
|
|
|
|
+ object.siblings('.collapsible-body').stop(true, false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () {
|
|
|
|
+ $(this).css('height', '');
|
|
|
|
+ } });
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ $panel_headers.not(object).removeClass('active').parent().removeClass('active');
|
|
|
|
+
|
|
|
|
+ // Close previously open accordion elements.
|
|
|
|
+ $panel_headers.not(object).parent().children('.collapsible-body').stop(true, false).each(function () {
|
|
|
|
+ if ($(this).is(':visible')) {
|
|
|
|
+ $(this).slideUp({
|
|
|
|
+ duration: 350,
|
|
|
|
+ easing: "easeOutQuart",
|
|
|
|
+ queue: false,
|
|
|
|
+ complete: function () {
|
|
|
|
+ $(this).css('height', '');
|
|
|
|
+ execCallbacks($(this).siblings('.collapsible-header'));
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Expandable Open
|
|
|
|
+ function expandableOpen(object) {
|
|
|
|
+ if (object.hasClass('active')) {
|
|
|
|
+ object.parent().addClass('active');
|
|
|
|
+ } else {
|
|
|
|
+ object.parent().removeClass('active');
|
|
|
|
+ }
|
|
|
|
+ if (object.parent().hasClass('active')) {
|
|
|
|
+ object.siblings('.collapsible-body').stop(true, false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () {
|
|
|
|
+ $(this).css('height', '');
|
|
|
|
+ } });
|
|
|
|
+ } else {
|
|
|
|
+ object.siblings('.collapsible-body').stop(true, false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () {
|
|
|
|
+ $(this).css('height', '');
|
|
|
|
+ } });
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Open collapsible. object: .collapsible-header
|
|
|
|
+ function collapsibleOpen(object, noToggle) {
|
|
|
|
+ if (!noToggle) {
|
|
|
|
+ object.toggleClass('active');
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) {
|
|
|
|
+ // Handle Accordion
|
|
|
|
+ accordionOpen(object);
|
|
|
|
+ } else {
|
|
|
|
+ // Handle Expandables
|
|
|
|
+ expandableOpen(object);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ execCallbacks(object);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Handle callbacks
|
|
|
|
+ function execCallbacks(object) {
|
|
|
|
+ if (object.hasClass('active')) {
|
|
|
|
+ if (typeof options.onOpen === "function") {
|
|
|
|
+ options.onOpen.call(this, object.parent());
|
|
|
|
+ }
|
|
|
|
+ } else {
|
|
|
|
+ if (typeof options.onClose === "function") {
|
|
|
|
+ options.onClose.call(this, object.parent());
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Check if object is children of panel header
|
|
|
|
+ * @param {Object} object Jquery object
|
|
|
|
+ * @return {Boolean} true if it is children
|
|
|
|
+ */
|
|
|
|
+ function isChildrenOfPanelHeader(object) {
|
|
|
|
+
|
|
|
|
+ var panelHeader = getPanelHeader(object);
|
|
|
|
+
|
|
|
|
+ return panelHeader.length > 0;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Get panel header from a children element
|
|
|
|
+ * @param {Object} object Jquery object
|
|
|
|
+ * @return {Object} panel header object
|
|
|
|
+ */
|
|
|
|
+ function getPanelHeader(object) {
|
|
|
|
+
|
|
|
|
+ return object.closest('li > .collapsible-header');
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Turn off any existing event handlers
|
|
|
|
+ function removeEventHandlers() {
|
|
|
|
+ $this.off('click.collapse', '> li > .collapsible-header');
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ /***** End Helper Functions *****/
|
|
|
|
+
|
|
|
|
+ // Methods
|
|
|
|
+ if (methodName === 'destroy') {
|
|
|
|
+ removeEventHandlers();
|
|
|
|
+ return;
|
|
|
|
+ } else if (methodParam >= 0 && methodParam < $panel_headers.length) {
|
|
|
|
+ var $curr_header = $panel_headers.eq(methodParam);
|
|
|
|
+ if ($curr_header.length && (methodName === 'open' || methodName === 'close' && $curr_header.hasClass('active'))) {
|
|
|
|
+ collapsibleOpen($curr_header);
|
|
|
|
+ }
|
|
|
|
+ return;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ removeEventHandlers();
|
|
|
|
+
|
|
|
|
+ // Add click handler to only direct collapsible header children
|
|
|
|
+ $this.on('click.collapse', '> li > .collapsible-header', function (e) {
|
|
|
|
+ var element = $(e.target);
|
|
|
|
+
|
|
|
|
+ if (isChildrenOfPanelHeader(element)) {
|
|
|
|
+ element = getPanelHeader(element);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ collapsibleOpen(element);
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // Open first active
|
|
|
|
+ if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) {
|
|
|
|
+ // Handle Accordion
|
|
|
|
+ collapsibleOpen($panel_headers.filter('.active').first(), true);
|
|
|
|
+ } else {
|
|
|
|
+ // Handle Expandables
|
|
|
|
+ $panel_headers.filter('.active').each(function () {
|
|
|
|
+ collapsibleOpen($(this), true);
|
|
|
|
+ });
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ $(document).ready(function () {
|
|
|
|
+ $('.collapsible').collapsible();
|
|
|
|
+ });
|
|
|
|
+})(jQuery);;(function ($) {
|
|
|
|
+
|
|
|
|
+ // Add posibility to scroll to selected option
|
|
|
|
+ // usefull for select for example
|
|
|
|
+ $.fn.scrollTo = function (elem) {
|
|
|
|
+ $(this).scrollTop($(this).scrollTop() - $(this).offset().top + $(elem).offset().top);
|
|
|
|
+ return this;
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ $.fn.dropdown = function (options) {
|
|
|
|
+ var defaults = {
|
|
|
|
+ inDuration: 300,
|
|
|
|
+ outDuration: 225,
|
|
|
|
+ constrainWidth: true, // Constrains width of dropdown to the activator
|
|
|
|
+ hover: false,
|
|
|
|
+ gutter: 0, // Spacing from edge
|
|
|
|
+ belowOrigin: false,
|
|
|
|
+ alignment: 'left',
|
|
|
|
+ stopPropagation: false
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ // Open dropdown.
|
|
|
|
+ if (options === "open") {
|
|
|
|
+ this.each(function () {
|
|
|
|
+ $(this).trigger('open');
|
|
|
|
+ });
|
|
|
|
+ return false;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Close dropdown.
|
|
|
|
+ if (options === "close") {
|
|
|
|
+ this.each(function () {
|
|
|
|
+ $(this).trigger('close');
|
|
|
|
+ });
|
|
|
|
+ return false;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ this.each(function () {
|
|
|
|
+ var origin = $(this);
|
|
|
|
+ var curr_options = $.extend({}, defaults, options);
|
|
|
|
+ var isFocused = false;
|
|
|
|
+
|
|
|
|
+ // Dropdown menu
|
|
|
|
+ var activates = $("#" + origin.attr('data-activates'));
|
|
|
|
+
|
|
|
|
+ function updateOptions() {
|
|
|
|
+ if (origin.data('induration') !== undefined) curr_options.inDuration = origin.data('induration');
|
|
|
|
+ if (origin.data('outduration') !== undefined) curr_options.outDuration = origin.data('outduration');
|
|
|
|
+ if (origin.data('constrainwidth') !== undefined) curr_options.constrainWidth = origin.data('constrainwidth');
|
|
|
|
+ if (origin.data('hover') !== undefined) curr_options.hover = origin.data('hover');
|
|
|
|
+ if (origin.data('gutter') !== undefined) curr_options.gutter = origin.data('gutter');
|
|
|
|
+ if (origin.data('beloworigin') !== undefined) curr_options.belowOrigin = origin.data('beloworigin');
|
|
|
|
+ if (origin.data('alignment') !== undefined) curr_options.alignment = origin.data('alignment');
|
|
|
|
+ if (origin.data('stoppropagation') !== undefined) curr_options.stopPropagation = origin.data('stoppropagation');
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ updateOptions();
|
|
|
|
+
|
|
|
|
+ // Attach dropdown to its activator
|
|
|
|
+ origin.after(activates);
|
|
|
|
+
|
|
|
|
+ /*
|
|
|
|
+ Helper function to position and resize dropdown.
|
|
|
|
+ Used in hover and click handler.
|
|
|
|
+ */
|
|
|
|
+ function placeDropdown(eventType) {
|
|
|
|
+ // Check for simultaneous focus and click events.
|
|
|
|
+ if (eventType === 'focus') {
|
|
|
|
+ isFocused = true;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Check html data attributes
|
|
|
|
+ updateOptions();
|
|
|
|
+
|
|
|
|
+ // Set Dropdown state
|
|
|
|
+ activates.addClass('active');
|
|
|
|
+ origin.addClass('active');
|
|
|
|
+
|
|
|
|
+ var originWidth = origin[0].getBoundingClientRect().width;
|
|
|
|
+
|
|
|
|
+ // Constrain width
|
|
|
|
+ if (curr_options.constrainWidth === true) {
|
|
|
|
+ activates.css('width', originWidth);
|
|
|
|
+ } else {
|
|
|
|
+ activates.css('white-space', 'nowrap');
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Offscreen detection
|
|
|
|
+ var windowHeight = window.innerHeight;
|
|
|
|
+ var originHeight = origin.innerHeight();
|
|
|
|
+ var offsetLeft = origin.offset().left;
|
|
|
|
+ var offsetTop = origin.offset().top - $(window).scrollTop();
|
|
|
|
+ var currAlignment = curr_options.alignment;
|
|
|
|
+ var gutterSpacing = 0;
|
|
|
|
+ var leftPosition = 0;
|
|
|
|
+
|
|
|
|
+ // Below Origin
|
|
|
|
+ var verticalOffset = 0;
|
|
|
|
+ if (curr_options.belowOrigin === true) {
|
|
|
|
+ verticalOffset = originHeight;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Check for scrolling positioned container.
|
|
|
|
+ var scrollYOffset = 0;
|
|
|
|
+ var scrollXOffset = 0;
|
|
|
|
+ var wrapper = origin.parent();
|
|
|
|
+ if (!wrapper.is('body')) {
|
|
|
|
+ if (wrapper[0].scrollHeight > wrapper[0].clientHeight) {
|
|
|
|
+ scrollYOffset = wrapper[0].scrollTop;
|
|
|
|
+ }
|
|
|
|
+ if (wrapper[0].scrollWidth > wrapper[0].clientWidth) {
|
|
|
|
+ scrollXOffset = wrapper[0].scrollLeft;
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ if (offsetLeft + activates.innerWidth() > $(window).width()) {
|
|
|
|
+ // Dropdown goes past screen on right, force right alignment
|
|
|
|
+ currAlignment = 'right';
|
|
|
|
+ } else if (offsetLeft - activates.innerWidth() + origin.innerWidth() < 0) {
|
|
|
|
+ // Dropdown goes past screen on left, force left alignment
|
|
|
|
+ currAlignment = 'left';
|
|
|
|
+ }
|
|
|
|
+ // Vertical bottom offscreen detection
|
|
|
|
+ if (offsetTop + activates.innerHeight() > windowHeight) {
|
|
|
|
+ // If going upwards still goes offscreen, just crop height of dropdown.
|
|
|
|
+ if (offsetTop + originHeight - activates.innerHeight() < 0) {
|
|
|
|
+ var adjustedHeight = windowHeight - offsetTop - verticalOffset;
|
|
|
|
+ activates.css('max-height', adjustedHeight);
|
|
|
|
+ } else {
|
|
|
|
+ // Flow upwards.
|
|
|
|
+ if (!verticalOffset) {
|
|
|
|
+ verticalOffset += originHeight;
|
|
|
|
+ }
|
|
|
|
+ verticalOffset -= activates.innerHeight();
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Handle edge alignment
|
|
|
|
+ if (currAlignment === 'left') {
|
|
|
|
+ gutterSpacing = curr_options.gutter;
|
|
|
|
+ leftPosition = origin.position().left + gutterSpacing;
|
|
|
|
+ } else if (currAlignment === 'right') {
|
|
|
|
+ // Material icons fix
|
|
|
|
+ activates.stop(true, true).css({
|
|
|
|
+ opacity: 0,
|
|
|
|
+ left: 0
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ var offsetRight = origin.position().left + originWidth - activates.width();
|
|
|
|
+ gutterSpacing = -curr_options.gutter;
|
|
|
|
+ leftPosition = offsetRight + gutterSpacing;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Position dropdown
|
|
|
|
+ activates.css({
|
|
|
|
+ position: 'absolute',
|
|
|
|
+ top: origin.position().top + verticalOffset + scrollYOffset,
|
|
|
|
+ left: leftPosition + scrollXOffset
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // Show dropdown
|
|
|
|
+ activates.slideDown({
|
|
|
|
+ queue: false,
|
|
|
|
+ duration: curr_options.inDuration,
|
|
|
|
+ easing: 'easeOutCubic',
|
|
|
|
+ complete: function () {
|
|
|
|
+ $(this).css('height', '');
|
|
|
|
+ }
|
|
|
|
+ }).animate({ opacity: 1 }, { queue: false, duration: curr_options.inDuration, easing: 'easeOutSine' });
|
|
|
|
+
|
|
|
|
+ // Add click close handler to document
|
|
|
|
+ setTimeout(function () {
|
|
|
|
+ $(document).on('click.' + activates.attr('id'), function (e) {
|
|
|
|
+ hideDropdown();
|
|
|
|
+ $(document).off('click.' + activates.attr('id'));
|
|
|
|
+ });
|
|
|
|
+ }, 0);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ function hideDropdown() {
|
|
|
|
+ // Check for simultaneous focus and click events.
|
|
|
|
+ isFocused = false;
|
|
|
|
+ activates.fadeOut(curr_options.outDuration);
|
|
|
|
+ activates.removeClass('active');
|
|
|
|
+ origin.removeClass('active');
|
|
|
|
+ $(document).off('click.' + activates.attr('id'));
|
|
|
|
+ setTimeout(function () {
|
|
|
|
+ activates.css('max-height', '');
|
|
|
|
+ }, curr_options.outDuration);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Hover
|
|
|
|
+ if (curr_options.hover) {
|
|
|
|
+ var open = false;
|
|
|
|
+ origin.off('click.' + origin.attr('id'));
|
|
|
|
+ // Hover handler to show dropdown
|
|
|
|
+ origin.on('mouseenter', function (e) {
|
|
|
|
+ // Mouse over
|
|
|
|
+ if (open === false) {
|
|
|
|
+ placeDropdown();
|
|
|
|
+ open = true;
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ origin.on('mouseleave', function (e) {
|
|
|
|
+ // If hover on origin then to something other than dropdown content, then close
|
|
|
|
+ var toEl = e.toElement || e.relatedTarget; // added browser compatibility for target element
|
|
|
|
+ if (!$(toEl).closest('.dropdown-content').is(activates)) {
|
|
|
|
+ activates.stop(true, true);
|
|
|
|
+ hideDropdown();
|
|
|
|
+ open = false;
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ activates.on('mouseleave', function (e) {
|
|
|
|
+ // Mouse out
|
|
|
|
+ var toEl = e.toElement || e.relatedTarget;
|
|
|
|
+ if (!$(toEl).closest('.dropdown-button').is(origin)) {
|
|
|
|
+ activates.stop(true, true);
|
|
|
|
+ hideDropdown();
|
|
|
|
+ open = false;
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // Click
|
|
|
|
+ } else {
|
|
|
|
+ // Click handler to show dropdown
|
|
|
|
+ origin.off('click.' + origin.attr('id'));
|
|
|
|
+ origin.on('click.' + origin.attr('id'), function (e) {
|
|
|
|
+ if (!isFocused) {
|
|
|
|
+ if (origin[0] == e.currentTarget && !origin.hasClass('active') && $(e.target).closest('.dropdown-content').length === 0) {
|
|
|
|
+ e.preventDefault(); // Prevents button click from moving window
|
|
|
|
+ if (curr_options.stopPropagation) {
|
|
|
|
+ e.stopPropagation();
|
|
|
|
+ }
|
|
|
|
+ placeDropdown('click');
|
|
|
|
+ }
|
|
|
|
+ // If origin is clicked and menu is open, close menu
|
|
|
|
+ else if (origin.hasClass('active')) {
|
|
|
|
+ hideDropdown();
|
|
|
|
+ $(document).off('click.' + activates.attr('id'));
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ } // End else
|
|
|
|
+
|
|
|
|
+ // Listen to open and close event - useful for select component
|
|
|
|
+ origin.on('open', function (e, eventType) {
|
|
|
|
+ placeDropdown(eventType);
|
|
|
|
+ });
|
|
|
|
+ origin.on('close', hideDropdown);
|
|
|
|
+ });
|
|
|
|
+ }; // End dropdown plugin
|
|
|
|
+
|
|
|
|
+ $(document).ready(function () {
|
|
|
|
+ $('.dropdown-button').dropdown();
|
|
|
|
+ });
|
|
|
|
+})(jQuery);
|
|
|
|
+;(function ($, Vel) {
|
|
|
|
+ 'use strict';
|
|
|
|
+
|
|
|
|
+ var _defaults = {
|
|
|
|
+ opacity: 0.5,
|
|
|
|
+ inDuration: 250,
|
|
|
|
+ outDuration: 250,
|
|
|
|
+ ready: undefined,
|
|
|
|
+ complete: undefined,
|
|
|
|
+ dismissible: true,
|
|
|
|
+ startingTop: '4%',
|
|
|
|
+ endingTop: '10%'
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * @class
|
|
|
|
+ *
|
|
|
|
+ */
|
|
|
|
+
|
|
|
|
+ var Modal = function () {
|
|
|
|
+ /**
|
|
|
|
+ * Construct Modal instance and set up overlay
|
|
|
|
+ * @constructor
|
|
|
|
+ * @param {jQuery} $el
|
|
|
|
+ * @param {Object} options
|
|
|
|
+ */
|
|
|
|
+ function Modal($el, options) {
|
|
|
|
+ _classCallCheck(this, Modal);
|
|
|
|
+
|
|
|
|
+ // If exists, destroy and reinitialize
|
|
|
|
+ if (!!$el[0].M_Modal) {
|
|
|
|
+ $el[0].M_Modal.destroy();
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * The jQuery element
|
|
|
|
+ * @type {jQuery}
|
|
|
|
+ */
|
|
|
|
+ this.$el = $el;
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Options for the modal
|
|
|
|
+ * @member Modal#options
|
|
|
|
+ * @prop {Number} [opacity=0.5] - Opacity of the modal overlay
|
|
|
|
+ * @prop {Number} [inDuration=250] - Length in ms of enter transition
|
|
|
|
+ * @prop {Number} [outDuration=250] - Length in ms of exit transition
|
|
|
|
+ * @prop {Function} ready - Callback function called when modal is finished entering
|
|
|
|
+ * @prop {Function} complete - Callback function called when modal is finished exiting
|
|
|
|
+ * @prop {Boolean} [dismissible=true] - Allow modal to be dismissed by keyboard or overlay click
|
|
|
|
+ * @prop {String} [startingTop='4%'] - startingTop
|
|
|
|
+ * @prop {String} [endingTop='10%'] - endingTop
|
|
|
|
+ */
|
|
|
|
+ this.options = $.extend({}, Modal.defaults, options);
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Describes open/close state of modal
|
|
|
|
+ * @type {Boolean}
|
|
|
|
+ */
|
|
|
|
+ this.isOpen = false;
|
|
|
|
+
|
|
|
|
+ this.$el[0].M_Modal = this;
|
|
|
|
+ this.id = $el.attr('id');
|
|
|
|
+ this.openingTrigger = undefined;
|
|
|
|
+ this.$overlay = $('<div class="modal-overlay"></div>');
|
|
|
|
+
|
|
|
|
+ Modal._increment++;
|
|
|
|
+ Modal._count++;
|
|
|
|
+ this.$overlay[0].style.zIndex = 1000 + Modal._increment * 2;
|
|
|
|
+ this.$el[0].style.zIndex = 1000 + Modal._increment * 2 + 1;
|
|
|
|
+ this.setupEventHandlers();
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ _createClass(Modal, [{
|
|
|
|
+ key: 'getInstance',
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Get Instance
|
|
|
|
+ */
|
|
|
|
+ value: function getInstance() {
|
|
|
|
+ return this;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Teardown component
|
|
|
|
+ */
|
|
|
|
+
|
|
|
|
+ }, {
|
|
|
|
+ key: 'destroy',
|
|
|
|
+ value: function destroy() {
|
|
|
|
+ this.removeEventHandlers();
|
|
|
|
+ this.$el[0].removeAttribute('style');
|
|
|
|
+ if (!!this.$overlay[0].parentNode) {
|
|
|
|
+ this.$overlay[0].parentNode.removeChild(this.$overlay[0]);
|
|
|
|
+ }
|
|
|
|
+ this.$el[0].M_Modal = undefined;
|
|
|
|
+ Modal._count--;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Setup Event Handlers
|
|
|
|
+ */
|
|
|
|
+
|
|
|
|
+ }, {
|
|
|
|
+ key: 'setupEventHandlers',
|
|
|
|
+ value: function setupEventHandlers() {
|
|
|
|
+ this.handleOverlayClickBound = this.handleOverlayClick.bind(this);
|
|
|
|
+ this.handleModalCloseClickBound = this.handleModalCloseClick.bind(this);
|
|
|
|
+
|
|
|
|
+ if (Modal._count === 1) {
|
|
|
|
+ document.body.addEventListener('click', this.handleTriggerClick);
|
|
|
|
+ }
|
|
|
|
+ this.$overlay[0].addEventListener('click', this.handleOverlayClickBound);
|
|
|
|
+ this.$el[0].addEventListener('click', this.handleModalCloseClickBound);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Remove Event Handlers
|
|
|
|
+ */
|
|
|
|
+
|
|
|
|
+ }, {
|
|
|
|
+ key: 'removeEventHandlers',
|
|
|
|
+ value: function removeEventHandlers() {
|
|
|
|
+ if (Modal._count === 0) {
|
|
|
|
+ document.body.removeEventListener('click', this.handleTriggerClick);
|
|
|
|
+ }
|
|
|
|
+ this.$overlay[0].removeEventListener('click', this.handleOverlayClickBound);
|
|
|
|
+ this.$el[0].removeEventListener('click', this.handleModalCloseClickBound);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Handle Trigger Click
|
|
|
|
+ * @param {Event} e
|
|
|
|
+ */
|
|
|
|
+
|
|
|
|
+ }, {
|
|
|
|
+ key: 'handleTriggerClick',
|
|
|
|
+ value: function handleTriggerClick(e) {
|
|
|
|
+ var $trigger = $(e.target).closest('.modal-trigger');
|
|
|
|
+ if (e.target && $trigger.length) {
|
|
|
|
+ var modalId = $trigger[0].getAttribute('href');
|
|
|
|
+ if (modalId) {
|
|
|
|
+ modalId = modalId.slice(1);
|
|
|
|
+ } else {
|
|
|
|
+ modalId = $trigger[0].getAttribute('data-target');
|
|
|
|
+ }
|
|
|
|
+ var modalInstance = document.getElementById(modalId).M_Modal;
|
|
|
|
+ if (modalInstance) {
|
|
|
|
+ modalInstance.open($trigger);
|
|
|
|
+ }
|
|
|
|
+ e.preventDefault();
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Handle Overlay Click
|
|
|
|
+ */
|
|
|
|
+
|
|
|
|
+ }, {
|
|
|
|
+ key: 'handleOverlayClick',
|
|
|
|
+ value: function handleOverlayClick() {
|
|
|
|
+ if (this.options.dismissible) {
|
|
|
|
+ this.close();
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Handle Modal Close Click
|
|
|
|
+ * @param {Event} e
|
|
|
|
+ */
|
|
|
|
+
|
|
|
|
+ }, {
|
|
|
|
+ key: 'handleModalCloseClick',
|
|
|
|
+ value: function handleModalCloseClick(e) {
|
|
|
|
+ var $closeTrigger = $(e.target).closest('.modal-close');
|
|
|
|
+ if (e.target && $closeTrigger.length) {
|
|
|
|
+ this.close();
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Handle Keydown
|
|
|
|
+ * @param {Event} e
|
|
|
|
+ */
|
|
|
|
+
|
|
|
|
+ }, {
|
|
|
|
+ key: 'handleKeydown',
|
|
|
|
+ value: function handleKeydown(e) {
|
|
|
|
+ // ESC key
|
|
|
|
+ if (e.keyCode === 27 && this.options.dismissible) {
|
|
|
|
+ this.close();
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Animate in modal
|
|
|
|
+ */
|
|
|
|
+
|
|
|
|
+ }, {
|
|
|
|
+ key: 'animateIn',
|
|
|
|
+ value: function animateIn() {
|
|
|
|
+ var _this = this;
|
|
|
|
+
|
|
|
|
+ // Set initial styles
|
|
|
|
+ $.extend(this.$el[0].style, {
|
|
|
|
+ display: 'block',
|
|
|
|
+ opacity: 0
|
|
|
|
+ });
|
|
|
|
+ $.extend(this.$overlay[0].style, {
|
|
|
|
+ display: 'block',
|
|
|
|
+ opacity: 0
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // Animate overlay
|
|
|
|
+ Vel(this.$overlay[0], { opacity: this.options.opacity }, { duration: this.options.inDuration, queue: false, ease: 'easeOutCubic' });
|
|
|
|
+
|
|
|
|
+ // Define modal animation options
|
|
|
|
+ var enterVelocityOptions = {
|
|
|
|
+ duration: this.options.inDuration,
|
|
|
|
+ queue: false,
|
|
|
|
+ ease: 'easeOutCubic',
|
|
|
|
+ // Handle modal ready callback
|
|
|
|
+ complete: function () {
|
|
|
|
+ if (typeof _this.options.ready === 'function') {
|
|
|
|
+ _this.options.ready.call(_this, _this.$el, _this.openingTrigger);
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ // Bottom sheet animation
|
|
|
|
+ if (this.$el[0].classList.contains('bottom-sheet')) {
|
|
|
|
+ Vel(this.$el[0], { bottom: 0, opacity: 1 }, enterVelocityOptions);
|
|
|
|
+
|
|
|
|
+ // Normal modal animation
|
|
|
|
+ } else {
|
|
|
|
+ Vel.hook(this.$el[0], 'scaleX', 0.7);
|
|
|
|
+ this.$el[0].style.top = this.options.startingTop;
|
|
|
|
+ Vel(this.$el[0], { top: this.options.endingTop, opacity: 1, scaleX: 1 }, enterVelocityOptions);
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Animate out modal
|
|
|
|
+ */
|
|
|
|
+
|
|
|
|
+ }, {
|
|
|
|
+ key: 'animateOut',
|
|
|
|
+ value: function animateOut() {
|
|
|
|
+ var _this2 = this;
|
|
|
|
+
|
|
|
|
+ // Animate overlay
|
|
|
|
+ Vel(this.$overlay[0], { opacity: 0 }, { duration: this.options.outDuration, queue: false, ease: 'easeOutQuart' });
|
|
|
|
+
|
|
|
|
+ // Define modal animation options
|
|
|
|
+ var exitVelocityOptions = {
|
|
|
|
+ duration: this.options.outDuration,
|
|
|
|
+ queue: false,
|
|
|
|
+ ease: 'easeOutCubic',
|
|
|
|
+ // Handle modal ready callback
|
|
|
|
+ complete: function () {
|
|
|
|
+ _this2.$el[0].style.display = 'none';
|
|
|
|
+ // Call complete callback
|
|
|
|
+ if (typeof _this2.options.complete === 'function') {
|
|
|
|
+ _this2.options.complete.call(_this2, _this2.$el);
|
|
|
|
+ }
|
|
|
|
+ _this2.$overlay[0].parentNode.removeChild(_this2.$overlay[0]);
|
|
|
|
+ }
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ // Bottom sheet animation
|
|
|
|
+ if (this.$el[0].classList.contains('bottom-sheet')) {
|
|
|
|
+ Vel(this.$el[0], { bottom: '-100%', opacity: 0 }, exitVelocityOptions);
|
|
|
|
+
|
|
|
|
+ // Normal modal animation
|
|
|
|
+ } else {
|
|
|
|
+ Vel(this.$el[0], { top: this.options.startingTop, opacity: 0, scaleX: 0.7 }, exitVelocityOptions);
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Open Modal
|
|
|
|
+ * @param {jQuery} [$trigger]
|
|
|
|
+ */
|
|
|
|
+
|
|
|
|
+ }, {
|
|
|
|
+ key: 'open',
|
|
|
|
+ value: function open($trigger) {
|
|
|
|
+ if (this.isOpen) {
|
|
|
|
+ return;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ this.isOpen = true;
|
|
|
|
+ var body = document.body;
|
|
|
|
+ body.style.overflow = 'hidden';
|
|
|
|
+ this.$el[0].classList.add('open');
|
|
|
|
+ body.appendChild(this.$overlay[0]);
|
|
|
|
+
|
|
|
|
+ // Set opening trigger, undefined indicates modal was opened by javascript
|
|
|
|
+ this.openingTrigger = !!$trigger ? $trigger : undefined;
|
|
|
|
+
|
|
|
|
+ if (this.options.dismissible) {
|
|
|
|
+ this.handleKeydownBound = this.handleKeydown.bind(this);
|
|
|
|
+ document.addEventListener('keydown', this.handleKeydownBound);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ this.animateIn();
|
|
|
|
+
|
|
|
|
+ return this;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Close Modal
|
|
|
|
+ */
|
|
|
|
+
|
|
|
|
+ }, {
|
|
|
|
+ key: 'close',
|
|
|
|
+ value: function close() {
|
|
|
|
+ if (!this.isOpen) {
|
|
|
|
+ return;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ this.isOpen = false;
|
|
|
|
+ this.$el[0].classList.remove('open');
|
|
|
|
+ document.body.style.overflow = '';
|
|
|
|
+
|
|
|
|
+ if (this.options.dismissible) {
|
|
|
|
+ document.removeEventListener('keydown', this.handleKeydownBound);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ this.animateOut();
|
|
|
|
+
|
|
|
|
+ return this;
|
|
|
|
+ }
|
|
|
|
+ }], [{
|
|
|
|
+ key: 'init',
|
|
|
|
+ value: function init($els, options) {
|
|
|
|
+ var arr = [];
|
|
|
|
+ $els.each(function () {
|
|
|
|
+ arr.push(new Modal($(this), options));
|
|
|
|
+ });
|
|
|
|
+ return arr;
|
|
|
|
+ }
|
|
|
|
+ }, {
|
|
|
|
+ key: 'defaults',
|
|
|
|
+ get: function () {
|
|
|
|
+ return _defaults;
|
|
|
|
+ }
|
|
|
|
+ }]);
|
|
|
|
+
|
|
|
|
+ return Modal;
|
|
|
|
+ }();
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * @static
|
|
|
|
+ * @memberof Modal
|
|
|
|
+ */
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ Modal._increment = 0;
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * @static
|
|
|
|
+ * @memberof Modal
|
|
|
|
+ */
|
|
|
|
+ Modal._count = 0;
|
|
|
|
+
|
|
|
|
+ Materialize.Modal = Modal;
|
|
|
|
+
|
|
|
|
+ $.fn.modal = function (methodOrOptions) {
|
|
|
|
+ // Call plugin method if valid method name is passed in
|
|
|
|
+ if (Modal.prototype[methodOrOptions]) {
|
|
|
|
+ // Getter methods
|
|
|
|
+ if (methodOrOptions.slice(0, 3) === 'get') {
|
|
|
|
+ return this.first()[0].M_Modal[methodOrOptions]();
|
|
|
|
+
|
|
|
|
+ // Void methods
|
|
|
|
+ } else {
|
|
|
|
+ return this.each(function () {
|
|
|
|
+ this.M_Modal[methodOrOptions]();
|
|
|
|
+ });
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Initialize plugin if options or no argument is passed in
|
|
|
|
+ } else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
|
|
|
|
+ Modal.init(this, arguments[0]);
|
|
|
|
+ return this;
|
|
|
|
+
|
|
|
|
+ // Return error if an unrecognized method name is passed in
|
|
|
|
+ } else {
|
|
|
|
+ $.error('Method ' + methodOrOptions + ' does not exist on jQuery.modal');
|
|
|
|
+ }
|
|
|
|
+ };
|
|
|
|
+})(jQuery, Materialize.Vel);
|
|
|
|
+;(function ($) {
|
|
|
|
+
|
|
|
|
+ $.fn.materialbox = function () {
|
|
|
|
+
|
|
|
|
+ return this.each(function () {
|
|
|
|
+
|
|
|
|
+ if ($(this).hasClass('initialized')) {
|
|
|
|
+ return;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ $(this).addClass('initialized');
|
|
|
|
+
|
|
|
|
+ var overlayActive = false;
|
|
|
|
+ var doneAnimating = true;
|
|
|
|
+ var inDuration = 275;
|
|
|
|
+ var outDuration = 200;
|
|
|
|
+ var origin = $(this);
|
|
|
|
+ var placeholder = $('<div></div>').addClass('material-placeholder');
|
|
|
|
+ var originalWidth = 0;
|
|
|
|
+ var originalHeight = 0;
|
|
|
|
+ var ancestorsChanged;
|
|
|
|
+ var ancestor;
|
|
|
|
+ var originInlineStyles = origin.attr('style');
|
|
|
|
+ origin.wrap(placeholder);
|
|
|
|
+
|
|
|
|
+ // Start click handler
|
|
|
|
+ origin.on('click', function () {
|
|
|
|
+ var placeholder = origin.parent('.material-placeholder');
|
|
|
|
+ var windowWidth = window.innerWidth;
|
|
|
|
+ var windowHeight = window.innerHeight;
|
|
|
|
+ var originalWidth = origin.width();
|
|
|
|
+ var originalHeight = origin.height();
|
|
|
|
+
|
|
|
|
+ // If already modal, return to original
|
|
|
|
+ if (doneAnimating === false) {
|
|
|
|
+ returnToOriginal();
|
|
|
|
+ return false;
|
|
|
|
+ } else if (overlayActive && doneAnimating === true) {
|
|
|
|
+ returnToOriginal();
|
|
|
|
+ return false;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Set states
|
|
|
|
+ doneAnimating = false;
|
|
|
|
+ origin.addClass('active');
|
|
|
|
+ overlayActive = true;
|
|
|
|
+
|
|
|
|
+ // Set positioning for placeholder
|
|
|
|
+ placeholder.css({
|
|
|
|
+ width: placeholder[0].getBoundingClientRect().width,
|
|
|
|
+ height: placeholder[0].getBoundingClientRect().height,
|
|
|
|
+ position: 'relative',
|
|
|
|
+ top: 0,
|
|
|
|
+ left: 0
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // Find ancestor with overflow: hidden; and remove it
|
|
|
|
+ ancestorsChanged = undefined;
|
|
|
|
+ ancestor = placeholder[0].parentNode;
|
|
|
|
+ var count = 0;
|
|
|
|
+ while (ancestor !== null && !$(ancestor).is(document)) {
|
|
|
|
+ var curr = $(ancestor);
|
|
|
|
+ if (curr.css('overflow') !== 'visible') {
|
|
|
|
+ curr.css('overflow', 'visible');
|
|
|
|
+ if (ancestorsChanged === undefined) {
|
|
|
|
+ ancestorsChanged = curr;
|
|
|
|
+ } else {
|
|
|
|
+ ancestorsChanged = ancestorsChanged.add(curr);
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ ancestor = ancestor.parentNode;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Set css on origin
|
|
|
|
+ origin.css({
|
|
|
|
+ position: 'absolute',
|
|
|
|
+ 'z-index': 1000,
|
|
|
|
+ 'will-change': 'left, top, width, height'
|
|
|
|
+ }).data('width', originalWidth).data('height', originalHeight);
|
|
|
|
+
|
|
|
|
+ // Add overlay
|
|
|
|
+ var overlay = $('<div id="materialbox-overlay"></div>').css({
|
|
|
|
+ opacity: 0
|
|
|
|
+ }).click(function () {
|
|
|
|
+ if (doneAnimating === true) returnToOriginal();
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // Put before in origin image to preserve z-index layering.
|
|
|
|
+ origin.before(overlay);
|
|
|
|
+
|
|
|
|
+ // Set dimensions if needed
|
|
|
|
+ var overlayOffset = overlay[0].getBoundingClientRect();
|
|
|
|
+ overlay.css({
|
|
|
|
+ width: windowWidth,
|
|
|
|
+ height: windowHeight,
|
|
|
|
+ left: -1 * overlayOffset.left,
|
|
|
|
+ top: -1 * overlayOffset.top
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // Animate Overlay
|
|
|
|
+ overlay.velocity({ opacity: 1 }, { duration: inDuration, queue: false, easing: 'easeOutQuad' });
|
|
|
|
+
|
|
|
|
+ // Add and animate caption if it exists
|
|
|
|
+ if (origin.data('caption') !== "") {
|
|
|
|
+ var $photo_caption = $('<div class="materialbox-caption"></div>');
|
|
|
|
+ $photo_caption.text(origin.data('caption'));
|
|
|
|
+ $('body').append($photo_caption);
|
|
|
|
+ $photo_caption.css({ "display": "inline" });
|
|
|
|
+ $photo_caption.velocity({ opacity: 1 }, { duration: inDuration, queue: false, easing: 'easeOutQuad' });
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Resize Image
|
|
|
|
+ var ratio = 0;
|
|
|
|
+ var widthPercent = originalWidth / windowWidth;
|
|
|
|
+ var heightPercent = originalHeight / windowHeight;
|
|
|
|
+ var newWidth = 0;
|
|
|
|
+ var newHeight = 0;
|
|
|
|
+
|
|
|
|
+ if (widthPercent > heightPercent) {
|
|
|
|
+ ratio = originalHeight / originalWidth;
|
|
|
|
+ newWidth = windowWidth * 0.9;
|
|
|
|
+ newHeight = windowWidth * 0.9 * ratio;
|
|
|
|
+ } else {
|
|
|
|
+ ratio = originalWidth / originalHeight;
|
|
|
|
+ newWidth = windowHeight * 0.9 * ratio;
|
|
|
|
+ newHeight = windowHeight * 0.9;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Animate image + set z-index
|
|
|
|
+ if (origin.hasClass('responsive-img')) {
|
|
|
|
+ origin.velocity({ 'max-width': newWidth, 'width': originalWidth }, { duration: 0, queue: false,
|
|
|
|
+ complete: function () {
|
|
|
|
+ origin.css({ left: 0, top: 0 }).velocity({
|
|
|
|
+ height: newHeight,
|
|
|
|
+ width: newWidth,
|
|
|
|
+ left: $(document).scrollLeft() + windowWidth / 2 - origin.parent('.material-placeholder').offset().left - newWidth / 2,
|
|
|
|
+ top: $(document).scrollTop() + windowHeight / 2 - origin.parent('.material-placeholder').offset().top - newHeight / 2
|
|
|
|
+ }, {
|
|
|
|
+ duration: inDuration,
|
|
|
|
+ queue: false,
|
|
|
|
+ easing: 'easeOutQuad',
|
|
|
|
+ complete: function () {
|
|
|
|
+ doneAnimating = true;
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ } // End Complete
|
|
|
|
+ }); // End Velocity
|
|
|
|
+ } else {
|
|
|
|
+ origin.css('left', 0).css('top', 0).velocity({
|
|
|
|
+ height: newHeight,
|
|
|
|
+ width: newWidth,
|
|
|
|
+ left: $(document).scrollLeft() + windowWidth / 2 - origin.parent('.material-placeholder').offset().left - newWidth / 2,
|
|
|
|
+ top: $(document).scrollTop() + windowHeight / 2 - origin.parent('.material-placeholder').offset().top - newHeight / 2
|
|
|
|
+ }, {
|
|
|
|
+ duration: inDuration,
|
|
|
|
+ queue: false,
|
|
|
|
+ easing: 'easeOutQuad',
|
|
|
|
+ complete: function () {
|
|
|
|
+ doneAnimating = true;
|
|
|
|
+ }
|
|
|
|
+ }); // End Velocity
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Handle Exit triggers
|
|
|
|
+ $(window).on('scroll.materialbox', function () {
|
|
|
|
+ if (overlayActive) {
|
|
|
|
+ returnToOriginal();
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ $(window).on('resize.materialbox', function () {
|
|
|
|
+ if (overlayActive) {
|
|
|
|
+ returnToOriginal();
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ $(document).on('keyup.materialbox', function (e) {
|
|
|
|
+ // ESC key
|
|
|
|
+ if (e.keyCode === 27 && doneAnimating === true && overlayActive) {
|
|
|
|
+ returnToOriginal();
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ }); // End click handler
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ // This function returns the modaled image to the original spot
|
|
|
|
+ function returnToOriginal() {
|
|
|
|
+
|
|
|
|
+ doneAnimating = false;
|
|
|
|
+
|
|
|
|
+ var placeholder = origin.parent('.material-placeholder');
|
|
|
|
+ var windowWidth = window.innerWidth;
|
|
|
|
+ var windowHeight = window.innerHeight;
|
|
|
|
+ var originalWidth = origin.data('width');
|
|
|
|
+ var originalHeight = origin.data('height');
|
|
|
|
+
|
|
|
|
+ origin.velocity("stop", true);
|
|
|
|
+ $('#materialbox-overlay').velocity("stop", true);
|
|
|
|
+ $('.materialbox-caption').velocity("stop", true);
|
|
|
|
+
|
|
|
|
+ // disable exit handlers
|
|
|
|
+ $(window).off('scroll.materialbox');
|
|
|
|
+ $(document).off('keyup.materialbox');
|
|
|
|
+ $(window).off('resize.materialbox');
|
|
|
|
+
|
|
|
|
+ $('#materialbox-overlay').velocity({ opacity: 0 }, {
|
|
|
|
+ duration: outDuration, // Delay prevents animation overlapping
|
|
|
|
+ queue: false, easing: 'easeOutQuad',
|
|
|
|
+ complete: function () {
|
|
|
|
+ // Remove Overlay
|
|
|
|
+ overlayActive = false;
|
|
|
|
+ $(this).remove();
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // Resize Image
|
|
|
|
+ origin.velocity({
|
|
|
|
+ width: originalWidth,
|
|
|
|
+ height: originalHeight,
|
|
|
|
+ left: 0,
|
|
|
|
+ top: 0
|
|
|
|
+ }, {
|
|
|
|
+ duration: outDuration,
|
|
|
|
+ queue: false, easing: 'easeOutQuad',
|
|
|
|
+ complete: function () {
|
|
|
|
+ placeholder.css({
|
|
|
|
+ height: '',
|
|
|
|
+ width: '',
|
|
|
|
+ position: '',
|
|
|
|
+ top: '',
|
|
|
|
+ left: ''
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ origin.removeAttr('style');
|
|
|
|
+ origin.attr('style', originInlineStyles);
|
|
|
|
+
|
|
|
|
+ // Remove class
|
|
|
|
+ origin.removeClass('active');
|
|
|
|
+ doneAnimating = true;
|
|
|
|
+
|
|
|
|
+ // Remove overflow overrides on ancestors
|
|
|
|
+ if (ancestorsChanged) {
|
|
|
|
+ ancestorsChanged.css('overflow', '');
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // Remove Caption + reset css settings on image
|
|
|
|
+ $('.materialbox-caption').velocity({ opacity: 0 }, {
|
|
|
|
+ duration: outDuration, // Delay prevents animation overlapping
|
|
|
|
+ queue: false, easing: 'easeOutQuad',
|
|
|
|
+ complete: function () {
|
|
|
|
+ $(this).remove();
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ $(document).ready(function () {
|
|
|
|
+ $('.materialboxed').materialbox();
|
|
|
|
+ });
|
|
|
|
+})(jQuery);
|
|
|
|
+;(function ($) {
|
|
|
|
+
|
|
|
|
+ $.fn.parallax = function () {
|
|
|
|
+ var window_width = $(window).width();
|
|
|
|
+ // Parallax Scripts
|
|
|
|
+ return this.each(function (i) {
|
|
|
|
+ var $this = $(this);
|
|
|
|
+ $this.addClass('parallax');
|
|
|
|
+
|
|
|
|
+ function updateParallax(initial) {
|
|
|
|
+ var container_height;
|
|
|
|
+ if (window_width < 601) {
|
|
|
|
+ container_height = $this.height() > 0 ? $this.height() : $this.children("img").height();
|
|
|
|
+ } else {
|
|
|
|
+ container_height = $this.height() > 0 ? $this.height() : 500;
|
|
|
|
+ }
|
|
|
|
+ var $img = $this.children("img").first();
|
|
|
|
+ var img_height = $img.height();
|
|
|
|
+ var parallax_dist = img_height - container_height;
|
|
|
|
+ var bottom = $this.offset().top + container_height;
|
|
|
|
+ var top = $this.offset().top;
|
|
|
|
+ var scrollTop = $(window).scrollTop();
|
|
|
|
+ var windowHeight = window.innerHeight;
|
|
|
|
+ var windowBottom = scrollTop + windowHeight;
|
|
|
|
+ var percentScrolled = (windowBottom - top) / (container_height + windowHeight);
|
|
|
|
+ var parallax = Math.round(parallax_dist * percentScrolled);
|
|
|
|
+
|
|
|
|
+ if (initial) {
|
|
|
|
+ $img.css('display', 'block');
|
|
|
|
+ }
|
|
|
|
+ if (bottom > scrollTop && top < scrollTop + windowHeight) {
|
|
|
|
+ $img.css('transform', "translate3D(-50%," + parallax + "px, 0)");
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Wait for image load
|
|
|
|
+ $this.children("img").one("load", function () {
|
|
|
|
+ updateParallax(true);
|
|
|
|
+ }).each(function () {
|
|
|
|
+ if (this.complete) $(this).trigger("load");
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ $(window).scroll(function () {
|
|
|
|
+ window_width = $(window).width();
|
|
|
|
+ updateParallax(false);
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ $(window).resize(function () {
|
|
|
|
+ window_width = $(window).width();
|
|
|
|
+ updateParallax(false);
|
|
|
|
+ });
|
|
|
|
+ });
|
|
|
|
+ };
|
|
|
|
+})(jQuery);
|
|
|
|
+;(function ($) {
|
|
|
|
+
|
|
|
|
+ var methods = {
|
|
|
|
+ init: function (options) {
|
|
|
|
+ var defaults = {
|
|
|
|
+ onShow: null,
|
|
|
|
+ swipeable: false,
|
|
|
|
+ responsiveThreshold: Infinity // breakpoint for swipeable
|
|
|
|
+ };
|
|
|
|
+ options = $.extend(defaults, options);
|
|
|
|
+ var namespace = Materialize.objectSelectorString($(this));
|
|
|
|
+
|
|
|
|
+ return this.each(function (i) {
|
|
|
|
+
|
|
|
|
+ var uniqueNamespace = namespace + i;
|
|
|
|
+
|
|
|
|
+ // For each set of tabs, we want to keep track of
|
|
|
|
+ // which tab is active and its associated content
|
|
|
|
+ var $this = $(this),
|
|
|
|
+ window_width = $(window).width();
|
|
|
|
+
|
|
|
|
+ var $active,
|
|
|
|
+ $content,
|
|
|
|
+ $links = $this.find('li.tab a'),
|
|
|
|
+ $tabs_width = $this.width(),
|
|
|
|
+ $tabs_content = $(),
|
|
|
|
+ $tabs_wrapper,
|
|
|
|
+ $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length,
|
|
|
|
+ $indicator,
|
|
|
|
+ index = 0,
|
|
|
|
+ prev_index = 0,
|
|
|
|
+ clicked = false,
|
|
|
|
+ clickedTimeout,
|
|
|
|
+ transition = 300;
|
|
|
|
+
|
|
|
|
+ // Finds right attribute for indicator based on active tab.
|
|
|
|
+ // el: jQuery Object
|
|
|
|
+ var calcRightPos = function (el) {
|
|
|
|
+ return Math.ceil($tabs_width - el.position().left - el[0].getBoundingClientRect().width - $this.scrollLeft());
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ // Finds left attribute for indicator based on active tab.
|
|
|
|
+ // el: jQuery Object
|
|
|
|
+ var calcLeftPos = function (el) {
|
|
|
|
+ return Math.floor(el.position().left + $this.scrollLeft());
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ // Animates Indicator to active tab.
|
|
|
|
+ // prev_index: Number
|
|
|
|
+ var animateIndicator = function (prev_index) {
|
|
|
|
+ if (index - prev_index >= 0) {
|
|
|
|
+ $indicator.velocity({ "right": calcRightPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad' });
|
|
|
|
+ $indicator.velocity({ "left": calcLeftPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad', delay: 90 });
|
|
|
|
+ } else {
|
|
|
|
+ $indicator.velocity({ "left": calcLeftPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad' });
|
|
|
|
+ $indicator.velocity({ "right": calcRightPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad', delay: 90 });
|
|
|
|
+ }
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ // Change swipeable according to responsive threshold
|
|
|
|
+ if (options.swipeable) {
|
|
|
|
+ if (window_width > options.responsiveThreshold) {
|
|
|
|
+ options.swipeable = false;
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // If the location.hash matches one of the links, use that as the active tab.
|
|
|
|
+ $active = $($links.filter('[href="' + location.hash + '"]'));
|
|
|
|
+
|
|
|
|
+ // If no match is found, use the first link or any with class 'active' as the initial active tab.
|
|
|
|
+ if ($active.length === 0) {
|
|
|
|
+ $active = $(this).find('li.tab a.active').first();
|
|
|
|
+ }
|
|
|
|
+ if ($active.length === 0) {
|
|
|
|
+ $active = $(this).find('li.tab a').first();
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ $active.addClass('active');
|
|
|
|
+ index = $links.index($active);
|
|
|
|
+ if (index < 0) {
|
|
|
|
+ index = 0;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ if ($active[0] !== undefined) {
|
|
|
|
+ $content = $($active[0].hash);
|
|
|
|
+ $content.addClass('active');
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // append indicator then set indicator width to tab width
|
|
|
|
+ if (!$this.find('.indicator').length) {
|
|
|
|
+ $this.append('<li class="indicator"></li>');
|
|
|
|
+ }
|
|
|
|
+ $indicator = $this.find('.indicator');
|
|
|
|
+
|
|
|
|
+ // we make sure that the indicator is at the end of the tabs
|
|
|
|
+ $this.append($indicator);
|
|
|
|
+
|
|
|
|
+ if ($this.is(":visible")) {
|
|
|
|
+ // $indicator.css({"right": $tabs_width - ((index + 1) * $tab_width)});
|
|
|
|
+ // $indicator.css({"left": index * $tab_width});
|
|
|
|
+ setTimeout(function () {
|
|
|
|
+ $indicator.css({ "right": calcRightPos($active) });
|
|
|
|
+ $indicator.css({ "left": calcLeftPos($active) });
|
|
|
|
+ }, 0);
|
|
|
|
+ }
|
|
|
|
+ $(window).off('resize.tabs-' + uniqueNamespace).on('resize.tabs-' + uniqueNamespace, function () {
|
|
|
|
+ $tabs_width = $this.width();
|
|
|
|
+ $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length;
|
|
|
|
+ if (index < 0) {
|
|
|
|
+ index = 0;
|
|
|
|
+ }
|
|
|
|
+ if ($tab_width !== 0 && $tabs_width !== 0) {
|
|
|
|
+ $indicator.css({ "right": calcRightPos($active) });
|
|
|
|
+ $indicator.css({ "left": calcLeftPos($active) });
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // Initialize Tabs Content.
|
|
|
|
+ if (options.swipeable) {
|
|
|
|
+ // TODO: Duplicate calls with swipeable? handle multiple div wrapping.
|
|
|
|
+ $links.each(function () {
|
|
|
|
+ var $curr_content = $(Materialize.escapeHash(this.hash));
|
|
|
|
+ $curr_content.addClass('carousel-item');
|
|
|
|
+ $tabs_content = $tabs_content.add($curr_content);
|
|
|
|
+ });
|
|
|
|
+ $tabs_wrapper = $tabs_content.wrapAll('<div class="tabs-content carousel"></div>');
|
|
|
|
+ $tabs_content.css('display', '');
|
|
|
|
+ $('.tabs-content.carousel').carousel({
|
|
|
|
+ fullWidth: true,
|
|
|
|
+ noWrap: true,
|
|
|
|
+ onCycleTo: function (item) {
|
|
|
|
+ if (!clicked) {
|
|
|
|
+ var prev_index = index;
|
|
|
|
+ index = $tabs_wrapper.index(item);
|
|
|
|
+ $active.removeClass('active');
|
|
|
|
+ $active = $links.eq(index);
|
|
|
|
+ $active.addClass('active');
|
|
|
|
+ animateIndicator(prev_index);
|
|
|
|
+ if (typeof options.onShow === "function") {
|
|
|
|
+ options.onShow.call($this[0], $content);
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ } else {
|
|
|
|
+ // Hide the remaining content
|
|
|
|
+ $links.not($active).each(function () {
|
|
|
|
+ $(Materialize.escapeHash(this.hash)).hide();
|
|
|
|
+ });
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Bind the click event handler
|
|
|
|
+ $this.off('click.tabs').on('click.tabs', 'a', function (e) {
|
|
|
|
+ if ($(this).parent().hasClass('disabled')) {
|
|
|
|
+ e.preventDefault();
|
|
|
|
+ return;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Act as regular link if target attribute is specified.
|
|
|
|
+ if (!!$(this).attr("target")) {
|
|
|
|
+ return;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ clicked = true;
|
|
|
|
+ $tabs_width = $this.width();
|
|
|
|
+ $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length;
|
|
|
|
+
|
|
|
|
+ // Make the old tab inactive.
|
|
|
|
+ $active.removeClass('active');
|
|
|
|
+ var $oldContent = $content;
|
|
|
|
+
|
|
|
|
+ // Update the variables with the new link and content
|
|
|
|
+ $active = $(this);
|
|
|
|
+ $content = $(Materialize.escapeHash(this.hash));
|
|
|
|
+ $links = $this.find('li.tab a');
|
|
|
|
+ var activeRect = $active.position();
|
|
|
|
+
|
|
|
|
+ // Make the tab active.
|
|
|
|
+ $active.addClass('active');
|
|
|
|
+ prev_index = index;
|
|
|
|
+ index = $links.index($(this));
|
|
|
|
+ if (index < 0) {
|
|
|
|
+ index = 0;
|
|
|
|
+ }
|
|
|
|
+ // Change url to current tab
|
|
|
|
+ // window.location.hash = $active.attr('href');
|
|
|
|
+
|
|
|
|
+ // Swap content
|
|
|
|
+ if (options.swipeable) {
|
|
|
|
+ if ($tabs_content.length) {
|
|
|
|
+ $tabs_content.carousel('set', index, function () {
|
|
|
|
+ if (typeof options.onShow === "function") {
|
|
|
|
+ options.onShow.call($this[0], $content);
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ }
|
|
|
|
+ } else {
|
|
|
|
+ if ($content !== undefined) {
|
|
|
|
+ $content.show();
|
|
|
|
+ $content.addClass('active');
|
|
|
|
+ if (typeof options.onShow === "function") {
|
|
|
|
+ options.onShow.call(this, $content);
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ if ($oldContent !== undefined && !$oldContent.is($content)) {
|
|
|
|
+ $oldContent.hide();
|
|
|
|
+ $oldContent.removeClass('active');
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Reset clicked state
|
|
|
|
+ clickedTimeout = setTimeout(function () {
|
|
|
|
+ clicked = false;
|
|
|
|
+ }, transition);
|
|
|
|
+
|
|
|
|
+ // Update indicator
|
|
|
|
+ animateIndicator(prev_index);
|
|
|
|
+
|
|
|
|
+ // Prevent the anchor's default click action
|
|
|
|
+ e.preventDefault();
|
|
|
|
+ });
|
|
|
|
+ });
|
|
|
|
+ },
|
|
|
|
+ select_tab: function (id) {
|
|
|
|
+ this.find('a[href="#' + id + '"]').trigger('click');
|
|
|
|
+ }
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ $.fn.tabs = function (methodOrOptions) {
|
|
|
|
+ if (methods[methodOrOptions]) {
|
|
|
|
+ return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
|
|
|
|
+ } else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
|
|
|
|
+ // Default to "init"
|
|
|
|
+ return methods.init.apply(this, arguments);
|
|
|
|
+ } else {
|
|
|
|
+ $.error('Method ' + methodOrOptions + ' does not exist on jQuery.tabs');
|
|
|
|
+ }
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ $(document).ready(function () {
|
|
|
|
+ $('ul.tabs').tabs();
|
|
|
|
+ });
|
|
|
|
+})(jQuery);
|
|
|
|
+;(function ($) {
|
|
|
|
+ $.fn.tooltip = function (options) {
|
|
|
|
+ var timeout = null,
|
|
|
|
+ margin = 5;
|
|
|
|
+
|
|
|
|
+ // Defaults
|
|
|
|
+ var defaults = {
|
|
|
|
+ delay: 350,
|
|
|
|
+ tooltip: '',
|
|
|
|
+ position: 'bottom',
|
|
|
|
+ html: false
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ // Remove tooltip from the activator
|
|
|
|
+ if (options === "remove") {
|
|
|
|
+ this.each(function () {
|
|
|
|
+ $('#' + $(this).attr('data-tooltip-id')).remove();
|
|
|
|
+ $(this).removeAttr('data-tooltip-id');
|
|
|
|
+ $(this).off('mouseenter.tooltip mouseleave.tooltip');
|
|
|
|
+ });
|
|
|
|
+ return false;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ options = $.extend(defaults, options);
|
|
|
|
+
|
|
|
|
+ return this.each(function () {
|
|
|
|
+ var tooltipId = Materialize.guid();
|
|
|
|
+ var origin = $(this);
|
|
|
|
+
|
|
|
|
+ // Destroy old tooltip
|
|
|
|
+ if (origin.attr('data-tooltip-id')) {
|
|
|
|
+ $('#' + origin.attr('data-tooltip-id')).remove();
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ origin.attr('data-tooltip-id', tooltipId);
|
|
|
|
+
|
|
|
|
+ // Get attributes.
|
|
|
|
+ var allowHtml, tooltipDelay, tooltipPosition, tooltipText, tooltipEl, backdrop;
|
|
|
|
+ var setAttributes = function () {
|
|
|
|
+ allowHtml = origin.attr('data-html') ? origin.attr('data-html') === 'true' : options.html;
|
|
|
|
+ tooltipDelay = origin.attr('data-delay');
|
|
|
|
+ tooltipDelay = tooltipDelay === undefined || tooltipDelay === '' ? options.delay : tooltipDelay;
|
|
|
|
+ tooltipPosition = origin.attr('data-position');
|
|
|
|
+ tooltipPosition = tooltipPosition === undefined || tooltipPosition === '' ? options.position : tooltipPosition;
|
|
|
|
+ tooltipText = origin.attr('data-tooltip');
|
|
|
|
+ tooltipText = tooltipText === undefined || tooltipText === '' ? options.tooltip : tooltipText;
|
|
|
|
+ };
|
|
|
|
+ setAttributes();
|
|
|
|
+
|
|
|
|
+ var renderTooltipEl = function () {
|
|
|
|
+ var tooltip = $('<div class="material-tooltip"></div>');
|
|
|
|
+
|
|
|
|
+ // Create Text span
|
|
|
|
+ if (allowHtml) {
|
|
|
|
+ tooltipText = $('<span></span>').html(tooltipText);
|
|
|
|
+ } else {
|
|
|
|
+ tooltipText = $('<span></span>').text(tooltipText);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Create tooltip
|
|
|
|
+ tooltip.append(tooltipText).appendTo($('body')).attr('id', tooltipId);
|
|
|
|
+
|
|
|
|
+ // Create backdrop
|
|
|
|
+ backdrop = $('<div class="backdrop"></div>');
|
|
|
|
+ backdrop.appendTo(tooltip);
|
|
|
|
+ return tooltip;
|
|
|
|
+ };
|
|
|
|
+ tooltipEl = renderTooltipEl();
|
|
|
|
+
|
|
|
|
+ // Destroy previously binded events
|
|
|
|
+ origin.off('mouseenter.tooltip mouseleave.tooltip');
|
|
|
|
+ // Mouse In
|
|
|
|
+ var started = false,
|
|
|
|
+ timeoutRef;
|
|
|
|
+ origin.on({ 'mouseenter.tooltip': function (e) {
|
|
|
|
+ var showTooltip = function () {
|
|
|
|
+ setAttributes();
|
|
|
|
+ started = true;
|
|
|
|
+ tooltipEl.velocity('stop');
|
|
|
|
+ backdrop.velocity('stop');
|
|
|
|
+ tooltipEl.css({ visibility: 'visible', left: '0px', top: '0px' });
|
|
|
|
+
|
|
|
|
+ // Tooltip positioning
|
|
|
|
+ var originWidth = origin.outerWidth();
|
|
|
|
+ var originHeight = origin.outerHeight();
|
|
|
|
+ var tooltipHeight = tooltipEl.outerHeight();
|
|
|
|
+ var tooltipWidth = tooltipEl.outerWidth();
|
|
|
|
+ var tooltipVerticalMovement = '0px';
|
|
|
|
+ var tooltipHorizontalMovement = '0px';
|
|
|
|
+ var backdropOffsetWidth = backdrop[0].offsetWidth;
|
|
|
|
+ var backdropOffsetHeight = backdrop[0].offsetHeight;
|
|
|
|
+ var scaleXFactor = 8;
|
|
|
|
+ var scaleYFactor = 8;
|
|
|
|
+ var scaleFactor = 0;
|
|
|
|
+ var targetTop, targetLeft, newCoordinates;
|
|
|
|
+
|
|
|
|
+ if (tooltipPosition === "top") {
|
|
|
|
+ // Top Position
|
|
|
|
+ targetTop = origin.offset().top - tooltipHeight - margin;
|
|
|
|
+ targetLeft = origin.offset().left + originWidth / 2 - tooltipWidth / 2;
|
|
|
|
+ newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
|
|
|
|
+ tooltipVerticalMovement = '-10px';
|
|
|
|
+ backdrop.css({
|
|
|
|
+ bottom: 0,
|
|
|
|
+ left: 0,
|
|
|
|
+ borderRadius: '14px 14px 0 0',
|
|
|
|
+ transformOrigin: '50% 100%',
|
|
|
|
+ marginTop: tooltipHeight,
|
|
|
|
+ marginLeft: tooltipWidth / 2 - backdropOffsetWidth / 2
|
|
|
|
+ });
|
|
|
|
+ }
|
|
|
|
+ // Left Position
|
|
|
|
+ else if (tooltipPosition === "left") {
|
|
|
|
+ targetTop = origin.offset().top + originHeight / 2 - tooltipHeight / 2;
|
|
|
|
+ targetLeft = origin.offset().left - tooltipWidth - margin;
|
|
|
|
+ newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
|
|
|
|
+
|
|
|
|
+ tooltipHorizontalMovement = '-10px';
|
|
|
|
+ backdrop.css({
|
|
|
|
+ top: '-7px',
|
|
|
|
+ right: 0,
|
|
|
|
+ width: '14px',
|
|
|
|
+ height: '14px',
|
|
|
|
+ borderRadius: '14px 0 0 14px',
|
|
|
|
+ transformOrigin: '95% 50%',
|
|
|
|
+ marginTop: tooltipHeight / 2,
|
|
|
|
+ marginLeft: tooltipWidth
|
|
|
|
+ });
|
|
|
|
+ }
|
|
|
|
+ // Right Position
|
|
|
|
+ else if (tooltipPosition === "right") {
|
|
|
|
+ targetTop = origin.offset().top + originHeight / 2 - tooltipHeight / 2;
|
|
|
|
+ targetLeft = origin.offset().left + originWidth + margin;
|
|
|
|
+ newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
|
|
|
|
+
|
|
|
|
+ tooltipHorizontalMovement = '+10px';
|
|
|
|
+ backdrop.css({
|
|
|
|
+ top: '-7px',
|
|
|
|
+ left: 0,
|
|
|
|
+ width: '14px',
|
|
|
|
+ height: '14px',
|
|
|
|
+ borderRadius: '0 14px 14px 0',
|
|
|
|
+ transformOrigin: '5% 50%',
|
|
|
|
+ marginTop: tooltipHeight / 2,
|
|
|
|
+ marginLeft: '0px'
|
|
|
|
+ });
|
|
|
|
+ } else {
|
|
|
|
+ // Bottom Position
|
|
|
|
+ targetTop = origin.offset().top + origin.outerHeight() + margin;
|
|
|
|
+ targetLeft = origin.offset().left + originWidth / 2 - tooltipWidth / 2;
|
|
|
|
+ newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
|
|
|
|
+ tooltipVerticalMovement = '+10px';
|
|
|
|
+ backdrop.css({
|
|
|
|
+ top: 0,
|
|
|
|
+ left: 0,
|
|
|
|
+ marginLeft: tooltipWidth / 2 - backdropOffsetWidth / 2
|
|
|
|
+ });
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Set tooptip css placement
|
|
|
|
+ tooltipEl.css({
|
|
|
|
+ top: newCoordinates.y,
|
|
|
|
+ left: newCoordinates.x
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // Calculate Scale to fill
|
|
|
|
+ scaleXFactor = Math.SQRT2 * tooltipWidth / parseInt(backdropOffsetWidth);
|
|
|
|
+ scaleYFactor = Math.SQRT2 * tooltipHeight / parseInt(backdropOffsetHeight);
|
|
|
|
+ scaleFactor = Math.max(scaleXFactor, scaleYFactor);
|
|
|
|
+
|
|
|
|
+ tooltipEl.velocity({ translateY: tooltipVerticalMovement, translateX: tooltipHorizontalMovement }, { duration: 350, queue: false }).velocity({ opacity: 1 }, { duration: 300, delay: 50, queue: false });
|
|
|
|
+ backdrop.css({ visibility: 'visible' }).velocity({ opacity: 1 }, { duration: 55, delay: 0, queue: false }).velocity({ scaleX: scaleFactor, scaleY: scaleFactor }, { duration: 300, delay: 0, queue: false, easing: 'easeInOutQuad' });
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ timeoutRef = setTimeout(showTooltip, tooltipDelay); // End Interval
|
|
|
|
+
|
|
|
|
+ // Mouse Out
|
|
|
|
+ },
|
|
|
|
+ 'mouseleave.tooltip': function () {
|
|
|
|
+ // Reset State
|
|
|
|
+ started = false;
|
|
|
|
+ clearTimeout(timeoutRef);
|
|
|
|
+
|
|
|
|
+ // Animate back
|
|
|
|
+ setTimeout(function () {
|
|
|
|
+ if (started !== true) {
|
|
|
|
+ tooltipEl.velocity({
|
|
|
|
+ opacity: 0, translateY: 0, translateX: 0 }, { duration: 225, queue: false });
|
|
|
|
+ backdrop.velocity({ opacity: 0, scaleX: 1, scaleY: 1 }, {
|
|
|
|
+ duration: 225,
|
|
|
|
+ queue: false,
|
|
|
|
+ complete: function () {
|
|
|
|
+ backdrop.css({ visibility: 'hidden' });
|
|
|
|
+ tooltipEl.css({ visibility: 'hidden' });
|
|
|
|
+ started = false;
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ }
|
|
|
|
+ }, 225);
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ });
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ var repositionWithinScreen = function (x, y, width, height) {
|
|
|
|
+ var newX = x;
|
|
|
|
+ var newY = y;
|
|
|
|
+
|
|
|
|
+ if (newX < 0) {
|
|
|
|
+ newX = 4;
|
|
|
|
+ } else if (newX + width > window.innerWidth) {
|
|
|
|
+ newX -= newX + width - window.innerWidth;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ if (newY < 0) {
|
|
|
|
+ newY = 4;
|
|
|
|
+ } else if (newY + height > window.innerHeight + $(window).scrollTop) {
|
|
|
|
+ newY -= newY + height - window.innerHeight;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ return { x: newX, y: newY };
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ $(document).ready(function () {
|
|
|
|
+ $('.tooltipped').tooltip();
|
|
|
|
+ });
|
|
|
|
+})(jQuery);
|
|
|
|
+; /*!
|
|
|
|
+ * Waves v0.6.4
|
|
|
|
+ * http://fian.my.id/Waves
|
|
|
|
+ *
|
|
|
|
+ * Copyright 2014 Alfiana E. Sibuea and other contributors
|
|
|
|
+ * Released under the MIT license
|
|
|
|
+ * https://github.com/fians/Waves/blob/master/LICENSE
|
|
|
|
+ */
|
|
|
|
+
|
|
|
|
+;(function (window) {
|
|
|
|
+ 'use strict';
|
|
|
|
+
|
|
|
|
+ var Waves = Waves || {};
|
|
|
|
+ var $$ = document.querySelectorAll.bind(document);
|
|
|
|
+
|
|
|
|
+ // Find exact position of element
|
|
|
|
+ function isWindow(obj) {
|
|
|
|
+ return obj !== null && obj === obj.window;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ function getWindow(elem) {
|
|
|
|
+ return isWindow(elem) ? elem : elem.nodeType === 9 && elem.defaultView;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ function offset(elem) {
|
|
|
|
+ var docElem,
|
|
|
|
+ win,
|
|
|
|
+ box = { top: 0, left: 0 },
|
|
|
|
+ doc = elem && elem.ownerDocument;
|
|
|
|
+
|
|
|
|
+ docElem = doc.documentElement;
|
|
|
|
+
|
|
|
|
+ if (typeof elem.getBoundingClientRect !== typeof undefined) {
|
|
|
|
+ box = elem.getBoundingClientRect();
|
|
|
|
+ }
|
|
|
|
+ win = getWindow(doc);
|
|
|
|
+ return {
|
|
|
|
+ top: box.top + win.pageYOffset - docElem.clientTop,
|
|
|
|
+ left: box.left + win.pageXOffset - docElem.clientLeft
|
|
|
|
+ };
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ function convertStyle(obj) {
|
|
|
|
+ var style = '';
|
|
|
|
+
|
|
|
|
+ for (var a in obj) {
|
|
|
|
+ if (obj.hasOwnProperty(a)) {
|
|
|
|
+ style += a + ':' + obj[a] + ';';
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ return style;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ var Effect = {
|
|
|
|
+
|
|
|
|
+ // Effect delay
|
|
|
|
+ duration: 750,
|
|
|
|
+
|
|
|
|
+ show: function (e, element) {
|
|
|
|
+
|
|
|
|
+ // Disable right click
|
|
|
|
+ if (e.button === 2) {
|
|
|
|
+ return false;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ var el = element || this;
|
|
|
|
+
|
|
|
|
+ // Create ripple
|
|
|
|
+ var ripple = document.createElement('div');
|
|
|
|
+ ripple.className = 'waves-ripple';
|
|
|
|
+ el.appendChild(ripple);
|
|
|
|
+
|
|
|
|
+ // Get click coordinate and element witdh
|
|
|
|
+ var pos = offset(el);
|
|
|
|
+ var relativeY = e.pageY - pos.top;
|
|
|
|
+ var relativeX = e.pageX - pos.left;
|
|
|
|
+ var scale = 'scale(' + el.clientWidth / 100 * 10 + ')';
|
|
|
|
+
|
|
|
|
+ // Support for touch devices
|
|
|
|
+ if ('touches' in e) {
|
|
|
|
+ relativeY = e.touches[0].pageY - pos.top;
|
|
|
|
+ relativeX = e.touches[0].pageX - pos.left;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Attach data to element
|
|
|
|
+ ripple.setAttribute('data-hold', Date.now());
|
|
|
|
+ ripple.setAttribute('data-scale', scale);
|
|
|
|
+ ripple.setAttribute('data-x', relativeX);
|
|
|
|
+ ripple.setAttribute('data-y', relativeY);
|
|
|
|
+
|
|
|
|
+ // Set ripple position
|
|
|
|
+ var rippleStyle = {
|
|
|
|
+ 'top': relativeY + 'px',
|
|
|
|
+ 'left': relativeX + 'px'
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ ripple.className = ripple.className + ' waves-notransition';
|
|
|
|
+ ripple.setAttribute('style', convertStyle(rippleStyle));
|
|
|
|
+ ripple.className = ripple.className.replace('waves-notransition', '');
|
|
|
|
+
|
|
|
|
+ // Scale the ripple
|
|
|
|
+ rippleStyle['-webkit-transform'] = scale;
|
|
|
|
+ rippleStyle['-moz-transform'] = scale;
|
|
|
|
+ rippleStyle['-ms-transform'] = scale;
|
|
|
|
+ rippleStyle['-o-transform'] = scale;
|
|
|
|
+ rippleStyle.transform = scale;
|
|
|
|
+ rippleStyle.opacity = '1';
|
|
|
|
+
|
|
|
|
+ rippleStyle['-webkit-transition-duration'] = Effect.duration + 'ms';
|
|
|
|
+ rippleStyle['-moz-transition-duration'] = Effect.duration + 'ms';
|
|
|
|
+ rippleStyle['-o-transition-duration'] = Effect.duration + 'ms';
|
|
|
|
+ rippleStyle['transition-duration'] = Effect.duration + 'ms';
|
|
|
|
+
|
|
|
|
+ rippleStyle['-webkit-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
|
|
|
|
+ rippleStyle['-moz-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
|
|
|
|
+ rippleStyle['-o-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
|
|
|
|
+ rippleStyle['transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
|
|
|
|
+
|
|
|
|
+ ripple.setAttribute('style', convertStyle(rippleStyle));
|
|
|
|
+ },
|
|
|
|
+
|
|
|
|
+ hide: function (e) {
|
|
|
|
+ TouchHandler.touchup(e);
|
|
|
|
+
|
|
|
|
+ var el = this;
|
|
|
|
+ var width = el.clientWidth * 1.4;
|
|
|
|
+
|
|
|
|
+ // Get first ripple
|
|
|
|
+ var ripple = null;
|
|
|
|
+ var ripples = el.getElementsByClassName('waves-ripple');
|
|
|
|
+ if (ripples.length > 0) {
|
|
|
|
+ ripple = ripples[ripples.length - 1];
|
|
|
|
+ } else {
|
|
|
|
+ return false;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ var relativeX = ripple.getAttribute('data-x');
|
|
|
|
+ var relativeY = ripple.getAttribute('data-y');
|
|
|
|
+ var scale = ripple.getAttribute('data-scale');
|
|
|
|
+
|
|
|
|
+ // Get delay beetween mousedown and mouse leave
|
|
|
|
+ var diff = Date.now() - Number(ripple.getAttribute('data-hold'));
|
|
|
|
+ var delay = 350 - diff;
|
|
|
|
+
|
|
|
|
+ if (delay < 0) {
|
|
|
|
+ delay = 0;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Fade out ripple after delay
|
|
|
|
+ setTimeout(function () {
|
|
|
|
+ var style = {
|
|
|
|
+ 'top': relativeY + 'px',
|
|
|
|
+ 'left': relativeX + 'px',
|
|
|
|
+ 'opacity': '0',
|
|
|
|
+
|
|
|
|
+ // Duration
|
|
|
|
+ '-webkit-transition-duration': Effect.duration + 'ms',
|
|
|
|
+ '-moz-transition-duration': Effect.duration + 'ms',
|
|
|
|
+ '-o-transition-duration': Effect.duration + 'ms',
|
|
|
|
+ 'transition-duration': Effect.duration + 'ms',
|
|
|
|
+ '-webkit-transform': scale,
|
|
|
|
+ '-moz-transform': scale,
|
|
|
|
+ '-ms-transform': scale,
|
|
|
|
+ '-o-transform': scale,
|
|
|
|
+ 'transform': scale
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ ripple.setAttribute('style', convertStyle(style));
|
|
|
|
+
|
|
|
|
+ setTimeout(function () {
|
|
|
|
+ try {
|
|
|
|
+ el.removeChild(ripple);
|
|
|
|
+ } catch (e) {
|
|
|
|
+ return false;
|
|
|
|
+ }
|
|
|
|
+ }, Effect.duration);
|
|
|
|
+ }, delay);
|
|
|
|
+ },
|
|
|
|
+
|
|
|
|
+ // Little hack to make <input> can perform waves effect
|
|
|
|
+ wrapInput: function (elements) {
|
|
|
|
+ for (var a = 0; a < elements.length; a++) {
|
|
|
|
+ var el = elements[a];
|
|
|
|
+
|
|
|
|
+ if (el.tagName.toLowerCase() === 'input') {
|
|
|
|
+ var parent = el.parentNode;
|
|
|
|
+
|
|
|
|
+ // If input already have parent just pass through
|
|
|
|
+ if (parent.tagName.toLowerCase() === 'i' && parent.className.indexOf('waves-effect') !== -1) {
|
|
|
|
+ continue;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Put element class and style to the specified parent
|
|
|
|
+ var wrapper = document.createElement('i');
|
|
|
|
+ wrapper.className = el.className + ' waves-input-wrapper';
|
|
|
|
+
|
|
|
|
+ var elementStyle = el.getAttribute('style');
|
|
|
|
+
|
|
|
|
+ if (!elementStyle) {
|
|
|
|
+ elementStyle = '';
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ wrapper.setAttribute('style', elementStyle);
|
|
|
|
+
|
|
|
|
+ el.className = 'waves-button-input';
|
|
|
|
+ el.removeAttribute('style');
|
|
|
|
+
|
|
|
|
+ // Put element as child
|
|
|
|
+ parent.replaceChild(wrapper, el);
|
|
|
|
+ wrapper.appendChild(el);
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Disable mousedown event for 500ms during and after touch
|
|
|
|
+ */
|
|
|
|
+ var TouchHandler = {
|
|
|
|
+ /* uses an integer rather than bool so there's no issues with
|
|
|
|
+ * needing to clear timeouts if another touch event occurred
|
|
|
|
+ * within the 500ms. Cannot mouseup between touchstart and
|
|
|
|
+ * touchend, nor in the 500ms after touchend. */
|
|
|
|
+ touches: 0,
|
|
|
|
+ allowEvent: function (e) {
|
|
|
|
+ var allow = true;
|
|
|
|
+
|
|
|
|
+ if (e.type === 'touchstart') {
|
|
|
|
+ TouchHandler.touches += 1; //push
|
|
|
|
+ } else if (e.type === 'touchend' || e.type === 'touchcancel') {
|
|
|
|
+ setTimeout(function () {
|
|
|
|
+ if (TouchHandler.touches > 0) {
|
|
|
|
+ TouchHandler.touches -= 1; //pop after 500ms
|
|
|
|
+ }
|
|
|
|
+ }, 500);
|
|
|
|
+ } else if (e.type === 'mousedown' && TouchHandler.touches > 0) {
|
|
|
|
+ allow = false;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ return allow;
|
|
|
|
+ },
|
|
|
|
+ touchup: function (e) {
|
|
|
|
+ TouchHandler.allowEvent(e);
|
|
|
|
+ }
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Delegated click handler for .waves-effect element.
|
|
|
|
+ * returns null when .waves-effect element not in "click tree"
|
|
|
|
+ */
|
|
|
|
+ function getWavesEffectElement(e) {
|
|
|
|
+ if (TouchHandler.allowEvent(e) === false) {
|
|
|
|
+ return null;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ var element = null;
|
|
|
|
+ var target = e.target || e.srcElement;
|
|
|
|
+
|
|
|
|
+ while (target.parentNode !== null) {
|
|
|
|
+ if (!(target instanceof SVGElement) && target.className.indexOf('waves-effect') !== -1) {
|
|
|
|
+ element = target;
|
|
|
|
+ break;
|
|
|
|
+ }
|
|
|
|
+ target = target.parentNode;
|
|
|
|
+ }
|
|
|
|
+ return element;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Bubble the click and show effect if .waves-effect elem was found
|
|
|
|
+ */
|
|
|
|
+ function showEffect(e) {
|
|
|
|
+ var element = getWavesEffectElement(e);
|
|
|
|
+
|
|
|
|
+ if (element !== null) {
|
|
|
|
+ Effect.show(e, element);
|
|
|
|
+
|
|
|
|
+ if ('ontouchstart' in window) {
|
|
|
|
+ element.addEventListener('touchend', Effect.hide, false);
|
|
|
|
+ element.addEventListener('touchcancel', Effect.hide, false);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ element.addEventListener('mouseup', Effect.hide, false);
|
|
|
|
+ element.addEventListener('mouseleave', Effect.hide, false);
|
|
|
|
+ element.addEventListener('dragend', Effect.hide, false);
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ Waves.displayEffect = function (options) {
|
|
|
|
+ options = options || {};
|
|
|
|
+
|
|
|
|
+ if ('duration' in options) {
|
|
|
|
+ Effect.duration = options.duration;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ //Wrap input inside <i> tag
|
|
|
|
+ Effect.wrapInput($$('.waves-effect'));
|
|
|
|
+
|
|
|
|
+ if ('ontouchstart' in window) {
|
|
|
|
+ document.body.addEventListener('touchstart', showEffect, false);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ document.body.addEventListener('mousedown', showEffect, false);
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Attach Waves to an input element (or any element which doesn't
|
|
|
|
+ * bubble mouseup/mousedown events).
|
|
|
|
+ * Intended to be used with dynamically loaded forms/inputs, or
|
|
|
|
+ * where the user doesn't want a delegated click handler.
|
|
|
|
+ */
|
|
|
|
+ Waves.attach = function (element) {
|
|
|
|
+ //FUTURE: automatically add waves classes and allow users
|
|
|
|
+ // to specify them with an options param? Eg. light/classic/button
|
|
|
|
+ if (element.tagName.toLowerCase() === 'input') {
|
|
|
|
+ Effect.wrapInput([element]);
|
|
|
|
+ element = element.parentNode;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ if ('ontouchstart' in window) {
|
|
|
|
+ element.addEventListener('touchstart', showEffect, false);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ element.addEventListener('mousedown', showEffect, false);
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ window.Waves = Waves;
|
|
|
|
+
|
|
|
|
+ document.addEventListener('DOMContentLoaded', function () {
|
|
|
|
+ Waves.displayEffect();
|
|
|
|
+ }, false);
|
|
|
|
+})(window);
|
|
|
|
+;(function ($, Vel) {
|
|
|
|
+ 'use strict';
|
|
|
|
+
|
|
|
|
+ var _defaults = {
|
|
|
|
+ displayLength: Infinity,
|
|
|
|
+ inDuration: 300,
|
|
|
|
+ outDuration: 375,
|
|
|
|
+ className: undefined,
|
|
|
|
+ completeCallback: undefined,
|
|
|
|
+ activationPercent: 0.8
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ var Toast = function () {
|
|
|
|
+ function Toast(message, displayLength, className, completeCallback) {
|
|
|
|
+ _classCallCheck(this, Toast);
|
|
|
|
+
|
|
|
|
+ if (!message) {
|
|
|
|
+ return;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Options for the toast
|
|
|
|
+ * @member Toast#options
|
|
|
|
+ */
|
|
|
|
+ this.options = {
|
|
|
|
+ displayLength: displayLength,
|
|
|
|
+ className: className,
|
|
|
|
+ completeCallback: completeCallback
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ this.options = $.extend({}, Toast.defaults, this.options);
|
|
|
|
+ this.message = message;
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Describes current pan state toast
|
|
|
|
+ * @type {Boolean}
|
|
|
|
+ */
|
|
|
|
+ this.panning = false;
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Time remaining until toast is removed
|
|
|
|
+ */
|
|
|
|
+ this.timeRemaining = this.options.displayLength;
|
|
|
|
+
|
|
|
|
+ if (Toast._toasts.length === 0) {
|
|
|
|
+ Toast._createContainer();
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Create new toast
|
|
|
|
+ Toast._toasts.push(this);
|
|
|
|
+ var toastElement = this.createToast();
|
|
|
|
+ toastElement.M_Toast = this;
|
|
|
|
+ this.el = toastElement;
|
|
|
|
+ this._animateIn();
|
|
|
|
+ this.setTimer();
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ _createClass(Toast, [{
|
|
|
|
+ key: 'createToast',
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Create toast and append it to toast container
|
|
|
|
+ */
|
|
|
|
+ value: function createToast() {
|
|
|
|
+ var toast = document.createElement('div');
|
|
|
|
+ toast.classList.add('toast');
|
|
|
|
+
|
|
|
|
+ // Add custom classes onto toast
|
|
|
|
+ if (this.options.className) {
|
|
|
|
+ var classes = this.options.className.split(' ');
|
|
|
|
+ var i = void 0,
|
|
|
|
+ count = void 0;
|
|
|
|
+ for (i = 0, count = classes.length; i < count; i++) {
|
|
|
|
+ toast.classList.add(classes[i]);
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Set content
|
|
|
|
+ if (typeof HTMLElement === 'object' ? this.message instanceof HTMLElement : this.message && typeof this.message === 'object' && this.message !== null && this.message.nodeType === 1 && typeof this.message.nodeName === 'string') {
|
|
|
|
+ toast.appendChild(this.message);
|
|
|
|
+
|
|
|
|
+ // Check if it is jQuery object
|
|
|
|
+ } else if (this.message instanceof jQuery) {
|
|
|
|
+ $(toast).append(this.message);
|
|
|
|
+
|
|
|
|
+ // Insert as text;
|
|
|
|
+ } else {
|
|
|
|
+ toast.innerHTML = this.message;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Append toasft
|
|
|
|
+ Toast._container.appendChild(toast);
|
|
|
|
+ return toast;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Animate in toast
|
|
|
|
+ */
|
|
|
|
+
|
|
|
|
+ }, {
|
|
|
|
+ key: '_animateIn',
|
|
|
|
+ value: function _animateIn() {
|
|
|
|
+ // Animate toast in
|
|
|
|
+ Vel(this.el, { top: 0, opacity: 1 }, {
|
|
|
|
+ duration: 300,
|
|
|
|
+ easing: 'easeOutCubic',
|
|
|
|
+ queue: false
|
|
|
|
+ });
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Create setInterval which automatically removes toast when timeRemaining >= 0
|
|
|
|
+ * has been reached
|
|
|
|
+ */
|
|
|
|
+
|
|
|
|
+ }, {
|
|
|
|
+ key: 'setTimer',
|
|
|
|
+ value: function setTimer() {
|
|
|
|
+ var _this3 = this;
|
|
|
|
+
|
|
|
|
+ if (this.timeRemaining !== Infinity) {
|
|
|
|
+ this.counterInterval = setInterval(function () {
|
|
|
|
+ // If toast is not being dragged, decrease its time remaining
|
|
|
|
+ if (!_this3.panning) {
|
|
|
|
+ _this3.timeRemaining -= 20;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Animate toast out
|
|
|
|
+ if (_this3.timeRemaining <= 0) {
|
|
|
|
+ _this3.remove();
|
|
|
|
+ }
|
|
|
|
+ }, 20);
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Dismiss toast with animation
|
|
|
|
+ */
|
|
|
|
+
|
|
|
|
+ }, {
|
|
|
|
+ key: 'remove',
|
|
|
|
+ value: function remove() {
|
|
|
|
+ var _this4 = this;
|
|
|
|
+
|
|
|
|
+ window.clearInterval(this.counterInterval);
|
|
|
|
+ var activationDistance = this.el.offsetWidth * this.options.activationPercent;
|
|
|
|
+
|
|
|
|
+ if (this.wasSwiped) {
|
|
|
|
+ this.el.style.transition = 'transform .05s, opacity .05s';
|
|
|
|
+ this.el.style.transform = 'translateX(' + activationDistance + 'px)';
|
|
|
|
+ this.el.style.opacity = 0;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ Vel(this.el, { opacity: 0, marginTop: '-40px' }, {
|
|
|
|
+ duration: this.options.outDuration,
|
|
|
|
+ easing: 'easeOutExpo',
|
|
|
|
+ queue: false,
|
|
|
|
+ complete: function () {
|
|
|
|
+ // Call the optional callback
|
|
|
|
+ if (typeof _this4.options.completeCallback === 'function') {
|
|
|
|
+ _this4.options.completeCallback();
|
|
|
|
+ }
|
|
|
|
+ // Remove toast from DOM
|
|
|
|
+ _this4.el.parentNode.removeChild(_this4.el);
|
|
|
|
+ Toast._toasts.splice(Toast._toasts.indexOf(_this4), 1);
|
|
|
|
+ if (Toast._toasts.length === 0) {
|
|
|
|
+ Toast._removeContainer();
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ }
|
|
|
|
+ }], [{
|
|
|
|
+ key: '_createContainer',
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Append toast container and add event handlers
|
|
|
|
+ */
|
|
|
|
+ value: function _createContainer() {
|
|
|
|
+ var container = document.createElement('div');
|
|
|
|
+ container.setAttribute('id', 'toast-container');
|
|
|
|
+
|
|
|
|
+ // Add event handler
|
|
|
|
+ container.addEventListener('touchstart', Toast._onDragStart);
|
|
|
|
+ container.addEventListener('touchmove', Toast._onDragMove);
|
|
|
|
+ container.addEventListener('touchend', Toast._onDragEnd);
|
|
|
|
+
|
|
|
|
+ container.addEventListener('mousedown', Toast._onDragStart);
|
|
|
|
+ document.addEventListener('mousemove', Toast._onDragMove);
|
|
|
|
+ document.addEventListener('mouseup', Toast._onDragEnd);
|
|
|
|
+
|
|
|
|
+ document.body.appendChild(container);
|
|
|
|
+ Toast._container = container;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Remove toast container and event handlers
|
|
|
|
+ */
|
|
|
|
+
|
|
|
|
+ }, {
|
|
|
|
+ key: '_removeContainer',
|
|
|
|
+ value: function _removeContainer() {
|
|
|
|
+ // Add event handler
|
|
|
|
+ document.removeEventListener('mousemove', Toast._onDragMove);
|
|
|
|
+ document.removeEventListener('mouseup', Toast._onDragEnd);
|
|
|
|
+
|
|
|
|
+ Toast._container.parentNode.removeChild(Toast._container);
|
|
|
|
+ Toast._container = null;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Begin drag handler
|
|
|
|
+ * @param {Event} e
|
|
|
|
+ */
|
|
|
|
+
|
|
|
|
+ }, {
|
|
|
|
+ key: '_onDragStart',
|
|
|
|
+ value: function _onDragStart(e) {
|
|
|
|
+ if (e.target && $(e.target).closest('.toast').length) {
|
|
|
|
+ var $toast = $(e.target).closest('.toast');
|
|
|
|
+ var toast = $toast[0].M_Toast;
|
|
|
|
+ toast.panning = true;
|
|
|
|
+ Toast._draggedToast = toast;
|
|
|
|
+ toast.el.classList.add('panning');
|
|
|
|
+ toast.el.style.transition = '';
|
|
|
|
+ toast.startingXPos = Toast._xPos(e);
|
|
|
|
+ toast.time = Date.now();
|
|
|
|
+ toast.xPos = Toast._xPos(e);
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Drag move handler
|
|
|
|
+ * @param {Event} e
|
|
|
|
+ */
|
|
|
|
+
|
|
|
|
+ }, {
|
|
|
|
+ key: '_onDragMove',
|
|
|
|
+ value: function _onDragMove(e) {
|
|
|
|
+ if (!!Toast._draggedToast) {
|
|
|
|
+ e.preventDefault();
|
|
|
|
+ var toast = Toast._draggedToast;
|
|
|
|
+ toast.deltaX = Math.abs(toast.xPos - Toast._xPos(e));
|
|
|
|
+ toast.xPos = Toast._xPos(e);
|
|
|
|
+ toast.velocityX = toast.deltaX / (Date.now() - toast.time);
|
|
|
|
+ toast.time = Date.now();
|
|
|
|
+
|
|
|
|
+ var totalDeltaX = toast.xPos - toast.startingXPos;
|
|
|
|
+ var activationDistance = toast.el.offsetWidth * toast.options.activationPercent;
|
|
|
|
+ toast.el.style.transform = 'translateX(' + totalDeltaX + 'px)';
|
|
|
|
+ toast.el.style.opacity = 1 - Math.abs(totalDeltaX / activationDistance);
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * End drag handler
|
|
|
|
+ * @param {Event} e
|
|
|
|
+ */
|
|
|
|
+
|
|
|
|
+ }, {
|
|
|
|
+ key: '_onDragEnd',
|
|
|
|
+ value: function _onDragEnd(e) {
|
|
|
|
+ if (!!Toast._draggedToast) {
|
|
|
|
+ var toast = Toast._draggedToast;
|
|
|
|
+ toast.panning = false;
|
|
|
|
+ toast.el.classList.remove('panning');
|
|
|
|
+
|
|
|
|
+ var totalDeltaX = toast.xPos - toast.startingXPos;
|
|
|
|
+ var activationDistance = toast.el.offsetWidth * toast.options.activationPercent;
|
|
|
|
+ var shouldBeDismissed = Math.abs(totalDeltaX) > activationDistance || toast.velocityX > 1;
|
|
|
|
+
|
|
|
|
+ // Remove toast
|
|
|
|
+ if (shouldBeDismissed) {
|
|
|
|
+ toast.wasSwiped = true;
|
|
|
|
+ toast.remove();
|
|
|
|
+
|
|
|
|
+ // Animate toast back to original position
|
|
|
|
+ } else {
|
|
|
|
+ toast.el.style.transition = 'transform .2s, opacity .2s';
|
|
|
|
+ toast.el.style.transform = '';
|
|
|
|
+ toast.el.style.opacity = '';
|
|
|
|
+ }
|
|
|
|
+ Toast._draggedToast = null;
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Get x position of mouse or touch event
|
|
|
|
+ * @param {Event} e
|
|
|
|
+ */
|
|
|
|
+
|
|
|
|
+ }, {
|
|
|
|
+ key: '_xPos',
|
|
|
|
+ value: function _xPos(e) {
|
|
|
|
+ if (e.targetTouches && e.targetTouches.length >= 1) {
|
|
|
|
+ return e.targetTouches[0].clientX;
|
|
|
|
+ }
|
|
|
|
+ // mouse event
|
|
|
|
+ return e.clientX;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Remove all toasts
|
|
|
|
+ */
|
|
|
|
+
|
|
|
|
+ }, {
|
|
|
|
+ key: 'removeAll',
|
|
|
|
+ value: function removeAll() {
|
|
|
|
+ for (var toastIndex in Toast._toasts) {
|
|
|
|
+ Toast._toasts[toastIndex].remove();
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ }, {
|
|
|
|
+ key: 'defaults',
|
|
|
|
+ get: function () {
|
|
|
|
+ return _defaults;
|
|
|
|
+ }
|
|
|
|
+ }]);
|
|
|
|
+
|
|
|
|
+ return Toast;
|
|
|
|
+ }();
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * @static
|
|
|
|
+ * @memberof Toast
|
|
|
|
+ * @type {Array.<Toast>}
|
|
|
|
+ */
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ Toast._toasts = [];
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * @static
|
|
|
|
+ * @memberof Toast
|
|
|
|
+ */
|
|
|
|
+ Toast._container = null;
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * @static
|
|
|
|
+ * @memberof Toast
|
|
|
|
+ * @type {Toast}
|
|
|
|
+ */
|
|
|
|
+ Toast._draggedToast = null;
|
|
|
|
+
|
|
|
|
+ Materialize.Toast = Toast;
|
|
|
|
+ Materialize.toast = function (message, displayLength, className, completeCallback) {
|
|
|
|
+ return new Toast(message, displayLength, className, completeCallback);
|
|
|
|
+ };
|
|
|
|
+})(jQuery, Materialize.Vel);
|
|
|
|
+;(function ($) {
|
|
|
|
+
|
|
|
|
+ var methods = {
|
|
|
|
+ init: function (options) {
|
|
|
|
+ var defaults = {
|
|
|
|
+ menuWidth: 300,
|
|
|
|
+ edge: 'left',
|
|
|
|
+ closeOnClick: false,
|
|
|
|
+ draggable: true,
|
|
|
|
+ onOpen: null,
|
|
|
|
+ onClose: null
|
|
|
|
+ };
|
|
|
|
+ options = $.extend(defaults, options);
|
|
|
|
+
|
|
|
|
+ $(this).each(function () {
|
|
|
|
+ var $this = $(this);
|
|
|
|
+ var menuId = $this.attr('data-activates');
|
|
|
|
+ var menu = $("#" + menuId);
|
|
|
|
+
|
|
|
|
+ // Set to width
|
|
|
|
+ if (options.menuWidth != 300) {
|
|
|
|
+ menu.css('width', options.menuWidth);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Add Touch Area
|
|
|
|
+ var $dragTarget = $('.drag-target[data-sidenav="' + menuId + '"]');
|
|
|
|
+ if (options.draggable) {
|
|
|
|
+ // Regenerate dragTarget
|
|
|
|
+ if ($dragTarget.length) {
|
|
|
|
+ $dragTarget.remove();
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ $dragTarget = $('<div class="drag-target"></div>').attr('data-sidenav', menuId);
|
|
|
|
+ $('body').append($dragTarget);
|
|
|
|
+ } else {
|
|
|
|
+ $dragTarget = $();
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ if (options.edge == 'left') {
|
|
|
|
+ menu.css('transform', 'translateX(-100%)');
|
|
|
|
+ $dragTarget.css({ 'left': 0 }); // Add Touch Area
|
|
|
|
+ } else {
|
|
|
|
+ menu.addClass('right-aligned') // Change text-alignment to right
|
|
|
|
+ .css('transform', 'translateX(100%)');
|
|
|
|
+ $dragTarget.css({ 'right': 0 }); // Add Touch Area
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // If fixed sidenav, bring menu out
|
|
|
|
+ if (menu.hasClass('fixed')) {
|
|
|
|
+ if (window.innerWidth > 992) {
|
|
|
|
+ menu.css('transform', 'translateX(0)');
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Window resize to reset on large screens fixed
|
|
|
|
+ if (menu.hasClass('fixed')) {
|
|
|
|
+ $(window).resize(function () {
|
|
|
|
+ if (window.innerWidth > 992) {
|
|
|
|
+ // Close menu if window is resized bigger than 992 and user has fixed sidenav
|
|
|
|
+ if ($('#sidenav-overlay').length !== 0 && menuOut) {
|
|
|
|
+ removeMenu(true);
|
|
|
|
+ } else {
|
|
|
|
+ // menu.removeAttr('style');
|
|
|
|
+ menu.css('transform', 'translateX(0%)');
|
|
|
|
+ // menu.css('width', options.menuWidth);
|
|
|
|
+ }
|
|
|
|
+ } else if (menuOut === false) {
|
|
|
|
+ if (options.edge === 'left') {
|
|
|
|
+ menu.css('transform', 'translateX(-100%)');
|
|
|
|
+ } else {
|
|
|
|
+ menu.css('transform', 'translateX(100%)');
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // if closeOnClick, then add close event for all a tags in side sideNav
|
|
|
|
+ if (options.closeOnClick === true) {
|
|
|
|
+ menu.on("click.itemclick", "a:not(.collapsible-header)", function () {
|
|
|
|
+ if (!(window.innerWidth > 992 && menu.hasClass('fixed'))) {
|
|
|
|
+ removeMenu();
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ var removeMenu = function (restoreNav) {
|
|
|
|
+ panning = false;
|
|
|
|
+ menuOut = false;
|
|
|
|
+ // Reenable scrolling
|
|
|
|
+ $('body').css({
|
|
|
|
+ overflow: '',
|
|
|
|
+ width: ''
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ $('#sidenav-overlay').velocity({ opacity: 0 }, { duration: 200,
|
|
|
|
+ queue: false, easing: 'easeOutQuad',
|
|
|
|
+ complete: function () {
|
|
|
|
+ $(this).remove();
|
|
|
|
+ } });
|
|
|
|
+ if (options.edge === 'left') {
|
|
|
|
+ // Reset phantom div
|
|
|
|
+ $dragTarget.css({ width: '', right: '', left: '0' });
|
|
|
|
+ menu.velocity({ 'translateX': '-100%' }, { duration: 200,
|
|
|
|
+ queue: false,
|
|
|
|
+ easing: 'easeOutCubic',
|
|
|
|
+ complete: function () {
|
|
|
|
+ if (restoreNav === true) {
|
|
|
|
+ // Restore Fixed sidenav
|
|
|
|
+ menu.removeAttr('style');
|
|
|
|
+ menu.css('width', options.menuWidth);
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ });
|
|
|
|
+ } else {
|
|
|
|
+ // Reset phantom div
|
|
|
|
+ $dragTarget.css({ width: '', right: '0', left: '' });
|
|
|
|
+ menu.velocity({ 'translateX': '100%' }, { duration: 200,
|
|
|
|
+ queue: false,
|
|
|
|
+ easing: 'easeOutCubic',
|
|
|
|
+ complete: function () {
|
|
|
|
+ if (restoreNav === true) {
|
|
|
|
+ // Restore Fixed sidenav
|
|
|
|
+ menu.removeAttr('style');
|
|
|
|
+ menu.css('width', options.menuWidth);
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Callback
|
|
|
|
+ if (typeof options.onClose === 'function') {
|
|
|
|
+ options.onClose.call(this, menu);
|
|
|
|
+ }
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ // Touch Event
|
|
|
|
+ var panning = false;
|
|
|
|
+ var menuOut = false;
|
|
|
|
+
|
|
|
|
+ if (options.draggable) {
|
|
|
|
+ $dragTarget.on('click', function () {
|
|
|
|
+ if (menuOut) {
|
|
|
|
+ removeMenu();
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ $dragTarget.hammer({
|
|
|
|
+ prevent_default: false
|
|
|
|
+ }).on('pan', function (e) {
|
|
|
|
+
|
|
|
|
+ if (e.gesture.pointerType == "touch") {
|
|
|
|
+
|
|
|
|
+ var direction = e.gesture.direction;
|
|
|
|
+ var x = e.gesture.center.x;
|
|
|
|
+ var y = e.gesture.center.y;
|
|
|
|
+ var velocityX = e.gesture.velocityX;
|
|
|
|
+
|
|
|
|
+ // Vertical scroll bugfix
|
|
|
|
+ if (x === 0 && y === 0) {
|
|
|
|
+ return;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Disable Scrolling
|
|
|
|
+ var $body = $('body');
|
|
|
|
+ var $overlay = $('#sidenav-overlay');
|
|
|
|
+ var oldWidth = $body.innerWidth();
|
|
|
|
+ $body.css('overflow', 'hidden');
|
|
|
|
+ $body.width(oldWidth);
|
|
|
|
+
|
|
|
|
+ // If overlay does not exist, create one and if it is clicked, close menu
|
|
|
|
+ if ($overlay.length === 0) {
|
|
|
|
+ $overlay = $('<div id="sidenav-overlay"></div>');
|
|
|
|
+ $overlay.css('opacity', 0).click(function () {
|
|
|
|
+ removeMenu();
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // Run 'onOpen' when sidenav is opened via touch/swipe if applicable
|
|
|
|
+ if (typeof options.onOpen === 'function') {
|
|
|
|
+ options.onOpen.call(this, menu);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ $('body').append($overlay);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Keep within boundaries
|
|
|
|
+ if (options.edge === 'left') {
|
|
|
|
+ if (x > options.menuWidth) {
|
|
|
|
+ x = options.menuWidth;
|
|
|
|
+ } else if (x < 0) {
|
|
|
|
+ x = 0;
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ if (options.edge === 'left') {
|
|
|
|
+ // Left Direction
|
|
|
|
+ if (x < options.menuWidth / 2) {
|
|
|
|
+ menuOut = false;
|
|
|
|
+ }
|
|
|
|
+ // Right Direction
|
|
|
|
+ else if (x >= options.menuWidth / 2) {
|
|
|
|
+ menuOut = true;
|
|
|
|
+ }
|
|
|
|
+ menu.css('transform', 'translateX(' + (x - options.menuWidth) + 'px)');
|
|
|
|
+ } else {
|
|
|
|
+ // Left Direction
|
|
|
|
+ if (x < window.innerWidth - options.menuWidth / 2) {
|
|
|
|
+ menuOut = true;
|
|
|
|
+ }
|
|
|
|
+ // Right Direction
|
|
|
|
+ else if (x >= window.innerWidth - options.menuWidth / 2) {
|
|
|
|
+ menuOut = false;
|
|
|
|
+ }
|
|
|
|
+ var rightPos = x - options.menuWidth / 2;
|
|
|
|
+ if (rightPos < 0) {
|
|
|
|
+ rightPos = 0;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ menu.css('transform', 'translateX(' + rightPos + 'px)');
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Percentage overlay
|
|
|
|
+ var overlayPerc;
|
|
|
|
+ if (options.edge === 'left') {
|
|
|
|
+ overlayPerc = x / options.menuWidth;
|
|
|
|
+ $overlay.velocity({ opacity: overlayPerc }, { duration: 10, queue: false, easing: 'easeOutQuad' });
|
|
|
|
+ } else {
|
|
|
|
+ overlayPerc = Math.abs((x - window.innerWidth) / options.menuWidth);
|
|
|
|
+ $overlay.velocity({ opacity: overlayPerc }, { duration: 10, queue: false, easing: 'easeOutQuad' });
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ }).on('panend', function (e) {
|
|
|
|
+
|
|
|
|
+ if (e.gesture.pointerType == "touch") {
|
|
|
|
+ var $overlay = $('#sidenav-overlay');
|
|
|
|
+ var velocityX = e.gesture.velocityX;
|
|
|
|
+ var x = e.gesture.center.x;
|
|
|
|
+ var leftPos = x - options.menuWidth;
|
|
|
|
+ var rightPos = x - options.menuWidth / 2;
|
|
|
|
+ if (leftPos > 0) {
|
|
|
|
+ leftPos = 0;
|
|
|
|
+ }
|
|
|
|
+ if (rightPos < 0) {
|
|
|
|
+ rightPos = 0;
|
|
|
|
+ }
|
|
|
|
+ panning = false;
|
|
|
|
+
|
|
|
|
+ if (options.edge === 'left') {
|
|
|
|
+ // If velocityX <= 0.3 then the user is flinging the menu closed so ignore menuOut
|
|
|
|
+ if (menuOut && velocityX <= 0.3 || velocityX < -0.5) {
|
|
|
|
+ // Return menu to open
|
|
|
|
+ if (leftPos !== 0) {
|
|
|
|
+ menu.velocity({ 'translateX': [0, leftPos] }, { duration: 300, queue: false, easing: 'easeOutQuad' });
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ $overlay.velocity({ opacity: 1 }, { duration: 50, queue: false, easing: 'easeOutQuad' });
|
|
|
|
+ $dragTarget.css({ width: '50%', right: 0, left: '' });
|
|
|
|
+ menuOut = true;
|
|
|
|
+ } else if (!menuOut || velocityX > 0.3) {
|
|
|
|
+ // Enable Scrolling
|
|
|
|
+ $('body').css({
|
|
|
|
+ overflow: '',
|
|
|
|
+ width: ''
|
|
|
|
+ });
|
|
|
|
+ // Slide menu closed
|
|
|
|
+ menu.velocity({ 'translateX': [-1 * options.menuWidth - 10, leftPos] }, { duration: 200, queue: false, easing: 'easeOutQuad' });
|
|
|
|
+ $overlay.velocity({ opacity: 0 }, { duration: 200, queue: false, easing: 'easeOutQuad',
|
|
|
|
+ complete: function () {
|
|
|
|
+ // Run 'onClose' when sidenav is closed via touch/swipe if applicable
|
|
|
|
+ if (typeof options.onClose === 'function') {
|
|
|
|
+ options.onClose.call(this, menu);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ $(this).remove();
|
|
|
|
+ } });
|
|
|
|
+ $dragTarget.css({ width: '10px', right: '', left: 0 });
|
|
|
|
+ }
|
|
|
|
+ } else {
|
|
|
|
+ if (menuOut && velocityX >= -0.3 || velocityX > 0.5) {
|
|
|
|
+ // Return menu to open
|
|
|
|
+ if (rightPos !== 0) {
|
|
|
|
+ menu.velocity({ 'translateX': [0, rightPos] }, { duration: 300, queue: false, easing: 'easeOutQuad' });
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ $overlay.velocity({ opacity: 1 }, { duration: 50, queue: false, easing: 'easeOutQuad' });
|
|
|
|
+ $dragTarget.css({ width: '50%', right: '', left: 0 });
|
|
|
|
+ menuOut = true;
|
|
|
|
+ } else if (!menuOut || velocityX < -0.3) {
|
|
|
|
+ // Enable Scrolling
|
|
|
|
+ $('body').css({
|
|
|
|
+ overflow: '',
|
|
|
|
+ width: ''
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // Slide menu closed
|
|
|
|
+ menu.velocity({ 'translateX': [options.menuWidth + 10, rightPos] }, { duration: 200, queue: false, easing: 'easeOutQuad' });
|
|
|
|
+ $overlay.velocity({ opacity: 0 }, { duration: 200, queue: false, easing: 'easeOutQuad',
|
|
|
|
+ complete: function () {
|
|
|
|
+ // Run 'onClose' when sidenav is closed via touch/swipe if applicable
|
|
|
|
+ if (typeof options.onClose === 'function') {
|
|
|
|
+ options.onClose.call(this, menu);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ $(this).remove();
|
|
|
|
+ } });
|
|
|
|
+ $dragTarget.css({ width: '10px', right: 0, left: '' });
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ $this.off('click.sidenav').on('click.sidenav', function () {
|
|
|
|
+ if (menuOut === true) {
|
|
|
|
+ menuOut = false;
|
|
|
|
+ panning = false;
|
|
|
|
+ removeMenu();
|
|
|
|
+ } else {
|
|
|
|
+
|
|
|
|
+ // Disable Scrolling
|
|
|
|
+ var $body = $('body');
|
|
|
|
+ var $overlay = $('<div id="sidenav-overlay"></div>');
|
|
|
|
+ var oldWidth = $body.innerWidth();
|
|
|
|
+ $body.css('overflow', 'hidden');
|
|
|
|
+ $body.width(oldWidth);
|
|
|
|
+
|
|
|
|
+ // Push current drag target on top of DOM tree
|
|
|
|
+ $('body').append($dragTarget);
|
|
|
|
+
|
|
|
|
+ if (options.edge === 'left') {
|
|
|
|
+ $dragTarget.css({ width: '50%', right: 0, left: '' });
|
|
|
|
+ menu.velocity({ 'translateX': [0, -1 * options.menuWidth] }, { duration: 300, queue: false, easing: 'easeOutQuad' });
|
|
|
|
+ } else {
|
|
|
|
+ $dragTarget.css({ width: '50%', right: '', left: 0 });
|
|
|
|
+ menu.velocity({ 'translateX': [0, options.menuWidth] }, { duration: 300, queue: false, easing: 'easeOutQuad' });
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Overlay close on click
|
|
|
|
+ $overlay.css('opacity', 0).click(function () {
|
|
|
|
+ menuOut = false;
|
|
|
|
+ panning = false;
|
|
|
|
+ removeMenu();
|
|
|
|
+ $overlay.velocity({ opacity: 0 }, { duration: 300, queue: false, easing: 'easeOutQuad',
|
|
|
|
+ complete: function () {
|
|
|
|
+ $(this).remove();
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // Append body
|
|
|
|
+ $('body').append($overlay);
|
|
|
|
+ $overlay.velocity({ opacity: 1 }, { duration: 300, queue: false, easing: 'easeOutQuad',
|
|
|
|
+ complete: function () {
|
|
|
|
+ menuOut = true;
|
|
|
|
+ panning = false;
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // Callback
|
|
|
|
+ if (typeof options.onOpen === 'function') {
|
|
|
|
+ options.onOpen.call(this, menu);
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ return false;
|
|
|
|
+ });
|
|
|
|
+ });
|
|
|
|
+ },
|
|
|
|
+ destroy: function () {
|
|
|
|
+ var $overlay = $('#sidenav-overlay');
|
|
|
|
+ var $dragTarget = $('.drag-target[data-sidenav="' + $(this).attr('data-activates') + '"]');
|
|
|
|
+ $overlay.trigger('click');
|
|
|
|
+ $dragTarget.remove();
|
|
|
|
+ $(this).off('click');
|
|
|
|
+ $overlay.remove();
|
|
|
|
+ },
|
|
|
|
+ show: function () {
|
|
|
|
+ this.trigger('click');
|
|
|
|
+ },
|
|
|
|
+ hide: function () {
|
|
|
|
+ $('#sidenav-overlay').trigger('click');
|
|
|
|
+ }
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ $.fn.sideNav = function (methodOrOptions) {
|
|
|
|
+ if (methods[methodOrOptions]) {
|
|
|
|
+ return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
|
|
|
|
+ } else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
|
|
|
|
+ // Default to "init"
|
|
|
|
+ return methods.init.apply(this, arguments);
|
|
|
|
+ } else {
|
|
|
|
+ $.error('Method ' + methodOrOptions + ' does not exist on jQuery.sideNav');
|
|
|
|
+ }
|
|
|
|
+ }; // Plugin end
|
|
|
|
+})(jQuery);
|
|
|
|
+; /**
|
|
|
|
+ * Extend jquery with a scrollspy plugin.
|
|
|
|
+ * This watches the window scroll and fires events when elements are scrolled into viewport.
|
|
|
|
+ *
|
|
|
|
+ * throttle() and getTime() taken from Underscore.js
|
|
|
|
+ * https://github.com/jashkenas/underscore
|
|
|
|
+ *
|
|
|
|
+ * @author Copyright 2013 John Smart
|
|
|
|
+ * @license https://raw.github.com/thesmart/jquery-scrollspy/master/LICENSE
|
|
|
|
+ * @see https://github.com/thesmart
|
|
|
|
+ * @version 0.1.2
|
|
|
|
+ */
|
|
|
|
+(function ($) {
|
|
|
|
+
|
|
|
|
+ var jWindow = $(window);
|
|
|
|
+ var elements = [];
|
|
|
|
+ var elementsInView = [];
|
|
|
|
+ var isSpying = false;
|
|
|
|
+ var ticks = 0;
|
|
|
|
+ var unique_id = 1;
|
|
|
|
+ var offset = {
|
|
|
|
+ top: 0,
|
|
|
|
+ right: 0,
|
|
|
|
+ bottom: 0,
|
|
|
|
+ left: 0
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Find elements that are within the boundary
|
|
|
|
+ * @param {number} top
|
|
|
|
+ * @param {number} right
|
|
|
|
+ * @param {number} bottom
|
|
|
|
+ * @param {number} left
|
|
|
|
+ * @return {jQuery} A collection of elements
|
|
|
|
+ */
|
|
|
|
+ };function findElements(top, right, bottom, left) {
|
|
|
|
+ var hits = $();
|
|
|
|
+ $.each(elements, function (i, element) {
|
|
|
|
+ if (element.height() > 0) {
|
|
|
|
+ var elTop = element.offset().top,
|
|
|
|
+ elLeft = element.offset().left,
|
|
|
|
+ elRight = elLeft + element.width(),
|
|
|
|
+ elBottom = elTop + element.height();
|
|
|
|
+
|
|
|
|
+ var isIntersect = !(elLeft > right || elRight < left || elTop > bottom || elBottom < top);
|
|
|
|
+
|
|
|
|
+ if (isIntersect) {
|
|
|
|
+ hits.push(element);
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ return hits;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Called when the user scrolls the window
|
|
|
|
+ */
|
|
|
|
+ function onScroll(scrollOffset) {
|
|
|
|
+ // unique tick id
|
|
|
|
+ ++ticks;
|
|
|
|
+
|
|
|
|
+ // viewport rectangle
|
|
|
|
+ var top = jWindow.scrollTop(),
|
|
|
|
+ left = jWindow.scrollLeft(),
|
|
|
|
+ right = left + jWindow.width(),
|
|
|
|
+ bottom = top + jWindow.height();
|
|
|
|
+
|
|
|
|
+ // determine which elements are in view
|
|
|
|
+ var intersections = findElements(top + offset.top + scrollOffset || 200, right + offset.right, bottom + offset.bottom, left + offset.left);
|
|
|
|
+ $.each(intersections, function (i, element) {
|
|
|
|
+
|
|
|
|
+ var lastTick = element.data('scrollSpy:ticks');
|
|
|
|
+ if (typeof lastTick != 'number') {
|
|
|
|
+ // entered into view
|
|
|
|
+ element.triggerHandler('scrollSpy:enter');
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // update tick id
|
|
|
|
+ element.data('scrollSpy:ticks', ticks);
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // determine which elements are no longer in view
|
|
|
|
+ $.each(elementsInView, function (i, element) {
|
|
|
|
+ var lastTick = element.data('scrollSpy:ticks');
|
|
|
|
+ if (typeof lastTick == 'number' && lastTick !== ticks) {
|
|
|
|
+ // exited from view
|
|
|
|
+ element.triggerHandler('scrollSpy:exit');
|
|
|
|
+ element.data('scrollSpy:ticks', null);
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // remember elements in view for next tick
|
|
|
|
+ elementsInView = intersections;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Called when window is resized
|
|
|
|
+ */
|
|
|
|
+ function onWinSize() {
|
|
|
|
+ jWindow.trigger('scrollSpy:winSize');
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Enables ScrollSpy using a selector
|
|
|
|
+ * @param {jQuery|string} selector The elements collection, or a selector
|
|
|
|
+ * @param {Object=} options Optional.
|
|
|
|
+ throttle : number -> scrollspy throttling. Default: 100 ms
|
|
|
|
+ offsetTop : number -> offset from top. Default: 0
|
|
|
|
+ offsetRight : number -> offset from right. Default: 0
|
|
|
|
+ offsetBottom : number -> offset from bottom. Default: 0
|
|
|
|
+ offsetLeft : number -> offset from left. Default: 0
|
|
|
|
+ activeClass : string -> Class name to be added to the active link. Default: active
|
|
|
|
+ * @returns {jQuery}
|
|
|
|
+ */
|
|
|
|
+ $.scrollSpy = function (selector, options) {
|
|
|
|
+ var defaults = {
|
|
|
|
+ throttle: 100,
|
|
|
|
+ scrollOffset: 200, // offset - 200 allows elements near bottom of page to scroll
|
|
|
|
+ activeClass: 'active',
|
|
|
|
+ getActiveElement: function (id) {
|
|
|
|
+ return 'a[href="#' + id + '"]';
|
|
|
|
+ }
|
|
|
|
+ };
|
|
|
|
+ options = $.extend(defaults, options);
|
|
|
|
+
|
|
|
|
+ var visible = [];
|
|
|
|
+ selector = $(selector);
|
|
|
|
+ selector.each(function (i, element) {
|
|
|
|
+ elements.push($(element));
|
|
|
|
+ $(element).data("scrollSpy:id", i);
|
|
|
|
+ // Smooth scroll to section
|
|
|
|
+ $('a[href="#' + $(element).attr('id') + '"]').click(function (e) {
|
|
|
|
+ e.preventDefault();
|
|
|
|
+ var offset = $(Materialize.escapeHash(this.hash)).offset().top + 1;
|
|
|
|
+ $('html, body').animate({ scrollTop: offset - options.scrollOffset }, { duration: 400, queue: false, easing: 'easeOutCubic' });
|
|
|
|
+ });
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ offset.top = options.offsetTop || 0;
|
|
|
|
+ offset.right = options.offsetRight || 0;
|
|
|
|
+ offset.bottom = options.offsetBottom || 0;
|
|
|
|
+ offset.left = options.offsetLeft || 0;
|
|
|
|
+
|
|
|
|
+ var throttledScroll = Materialize.throttle(function () {
|
|
|
|
+ onScroll(options.scrollOffset);
|
|
|
|
+ }, options.throttle || 100);
|
|
|
|
+ var readyScroll = function () {
|
|
|
|
+ $(document).ready(throttledScroll);
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ if (!isSpying) {
|
|
|
|
+ jWindow.on('scroll', readyScroll);
|
|
|
|
+ jWindow.on('resize', readyScroll);
|
|
|
|
+ isSpying = true;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // perform a scan once, after current execution context, and after dom is ready
|
|
|
|
+ setTimeout(readyScroll, 0);
|
|
|
|
+
|
|
|
|
+ selector.on('scrollSpy:enter', function () {
|
|
|
|
+ visible = $.grep(visible, function (value) {
|
|
|
|
+ return value.height() != 0;
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ var $this = $(this);
|
|
|
|
+
|
|
|
|
+ if (visible[0]) {
|
|
|
|
+ $(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass);
|
|
|
|
+ if ($this.data('scrollSpy:id') < visible[0].data('scrollSpy:id')) {
|
|
|
|
+ visible.unshift($(this));
|
|
|
|
+ } else {
|
|
|
|
+ visible.push($(this));
|
|
|
|
+ }
|
|
|
|
+ } else {
|
|
|
|
+ visible.push($(this));
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ $(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass);
|
|
|
|
+ });
|
|
|
|
+ selector.on('scrollSpy:exit', function () {
|
|
|
|
+ visible = $.grep(visible, function (value) {
|
|
|
|
+ return value.height() != 0;
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ if (visible[0]) {
|
|
|
|
+ $(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass);
|
|
|
|
+ var $this = $(this);
|
|
|
|
+ visible = $.grep(visible, function (value) {
|
|
|
|
+ return value.attr('id') != $this.attr('id');
|
|
|
|
+ });
|
|
|
|
+ if (visible[0]) {
|
|
|
|
+ // Check if empty
|
|
|
|
+ $(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass);
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ return selector;
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Listen for window resize events
|
|
|
|
+ * @param {Object=} options Optional. Set { throttle: number } to change throttling. Default: 100 ms
|
|
|
|
+ * @returns {jQuery} $(window)
|
|
|
|
+ */
|
|
|
|
+ $.winSizeSpy = function (options) {
|
|
|
|
+ $.winSizeSpy = function () {
|
|
|
|
+ return jWindow;
|
|
|
|
+ }; // lock from multiple calls
|
|
|
|
+ options = options || {
|
|
|
|
+ throttle: 100
|
|
|
|
+ };
|
|
|
|
+ return jWindow.on('resize', Materialize.throttle(onWinSize, options.throttle || 100));
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Enables ScrollSpy on a collection of elements
|
|
|
|
+ * e.g. $('.scrollSpy').scrollSpy()
|
|
|
|
+ * @param {Object=} options Optional.
|
|
|
|
+ throttle : number -> scrollspy throttling. Default: 100 ms
|
|
|
|
+ offsetTop : number -> offset from top. Default: 0
|
|
|
|
+ offsetRight : number -> offset from right. Default: 0
|
|
|
|
+ offsetBottom : number -> offset from bottom. Default: 0
|
|
|
|
+ offsetLeft : number -> offset from left. Default: 0
|
|
|
|
+ * @returns {jQuery}
|
|
|
|
+ */
|
|
|
|
+ $.fn.scrollSpy = function (options) {
|
|
|
|
+ return $.scrollSpy($(this), options);
|
|
|
|
+ };
|
|
|
|
+})(jQuery);
|
|
|
|
+;(function ($) {
|
|
|
|
+ $(document).ready(function () {
|
|
|
|
+
|
|
|
|
+ // Function to update labels of text fields
|
|
|
|
+ Materialize.updateTextFields = function () {
|
|
|
|
+ var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea';
|
|
|
|
+ $(input_selector).each(function (index, element) {
|
|
|
|
+ var $this = $(this);
|
|
|
|
+ if ($(element).val().length > 0 || $(element).is(':focus') || element.autofocus || $this.attr('placeholder') !== undefined) {
|
|
|
|
+ $this.siblings('label').addClass('active');
|
|
|
|
+ } else if ($(element)[0].validity) {
|
|
|
|
+ $this.siblings('label').toggleClass('active', $(element)[0].validity.badInput === true);
|
|
|
|
+ } else {
|
|
|
|
+ $this.siblings('label').removeClass('active');
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ // Text based inputs
|
|
|
|
+ var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea';
|
|
|
|
+
|
|
|
|
+ // Add active if form auto complete
|
|
|
|
+ $(document).on('change', input_selector, function () {
|
|
|
|
+ if ($(this).val().length !== 0 || $(this).attr('placeholder') !== undefined) {
|
|
|
|
+ $(this).siblings('label').addClass('active');
|
|
|
|
+ }
|
|
|
|
+ validate_field($(this));
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // Add active if input element has been pre-populated on document ready
|
|
|
|
+ $(document).ready(function () {
|
|
|
|
+ Materialize.updateTextFields();
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // HTML DOM FORM RESET handling
|
|
|
|
+ $(document).on('reset', function (e) {
|
|
|
|
+ var formReset = $(e.target);
|
|
|
|
+ if (formReset.is('form')) {
|
|
|
|
+ formReset.find(input_selector).removeClass('valid').removeClass('invalid');
|
|
|
|
+ formReset.find(input_selector).each(function () {
|
|
|
|
+ if ($(this).attr('value') === '') {
|
|
|
|
+ $(this).siblings('label').removeClass('active');
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // Reset select
|
|
|
|
+ formReset.find('select.initialized').each(function () {
|
|
|
|
+ var reset_text = formReset.find('option[selected]').text();
|
|
|
|
+ formReset.siblings('input.select-dropdown').val(reset_text);
|
|
|
|
+ });
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // Add active when element has focus
|
|
|
|
+ $(document).on('focus', input_selector, function () {
|
|
|
|
+ $(this).siblings('label, .prefix').addClass('active');
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ $(document).on('blur', input_selector, function () {
|
|
|
|
+ var $inputElement = $(this);
|
|
|
|
+ var selector = ".prefix";
|
|
|
|
+
|
|
|
|
+ if ($inputElement.val().length === 0 && $inputElement[0].validity.badInput !== true && $inputElement.attr('placeholder') === undefined) {
|
|
|
|
+ selector += ", label";
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ $inputElement.siblings(selector).removeClass('active');
|
|
|
|
+
|
|
|
|
+ validate_field($inputElement);
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ window.validate_field = function (object) {
|
|
|
|
+ var hasLength = object.attr('data-length') !== undefined;
|
|
|
|
+ var lenAttr = parseInt(object.attr('data-length'));
|
|
|
|
+ var len = object.val().length;
|
|
|
|
+
|
|
|
|
+ if (object.val().length === 0 && object[0].validity.badInput === false && !object.is(':required')) {
|
|
|
|
+ if (object.hasClass('validate')) {
|
|
|
|
+ object.removeClass('valid');
|
|
|
|
+ object.removeClass('invalid');
|
|
|
|
+ }
|
|
|
|
+ } else {
|
|
|
|
+ if (object.hasClass('validate')) {
|
|
|
|
+ // Check for character counter attributes
|
|
|
|
+ if (object.is(':valid') && hasLength && len <= lenAttr || object.is(':valid') && !hasLength) {
|
|
|
|
+ object.removeClass('invalid');
|
|
|
|
+ object.addClass('valid');
|
|
|
|
+ } else {
|
|
|
|
+ object.removeClass('valid');
|
|
|
|
+ object.addClass('invalid');
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ // Radio and Checkbox focus class
|
|
|
|
+ var radio_checkbox = 'input[type=radio], input[type=checkbox]';
|
|
|
|
+ $(document).on('keyup.radio', radio_checkbox, function (e) {
|
|
|
|
+ // TAB, check if tabbing to radio or checkbox.
|
|
|
|
+ if (e.which === 9) {
|
|
|
|
+ $(this).addClass('tabbed');
|
|
|
|
+ var $this = $(this);
|
|
|
|
+ $this.one('blur', function (e) {
|
|
|
|
+
|
|
|
|
+ $(this).removeClass('tabbed');
|
|
|
|
+ });
|
|
|
|
+ return;
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // Textarea Auto Resize
|
|
|
|
+ var hiddenDiv = $('.hiddendiv').first();
|
|
|
|
+ if (!hiddenDiv.length) {
|
|
|
|
+ hiddenDiv = $('<div class="hiddendiv common"></div>');
|
|
|
|
+ $('body').append(hiddenDiv);
|
|
|
|
+ }
|
|
|
|
+ var text_area_selector = '.materialize-textarea';
|
|
|
|
+
|
|
|
|
+ function textareaAutoResize($textarea) {
|
|
|
|
+ // Set font properties of hiddenDiv
|
|
|
|
+
|
|
|
|
+ var fontFamily = $textarea.css('font-family');
|
|
|
|
+ var fontSize = $textarea.css('font-size');
|
|
|
|
+ var lineHeight = $textarea.css('line-height');
|
|
|
|
+ var padding = $textarea.css('padding');
|
|
|
|
+
|
|
|
|
+ if (fontSize) {
|
|
|
|
+ hiddenDiv.css('font-size', fontSize);
|
|
|
|
+ }
|
|
|
|
+ if (fontFamily) {
|
|
|
|
+ hiddenDiv.css('font-family', fontFamily);
|
|
|
|
+ }
|
|
|
|
+ if (lineHeight) {
|
|
|
|
+ hiddenDiv.css('line-height', lineHeight);
|
|
|
|
+ }
|
|
|
|
+ if (padding) {
|
|
|
|
+ hiddenDiv.css('padding', padding);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Set original-height, if none
|
|
|
|
+ if (!$textarea.data('original-height')) {
|
|
|
|
+ $textarea.data('original-height', $textarea.height());
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ if ($textarea.attr('wrap') === 'off') {
|
|
|
|
+ hiddenDiv.css('overflow-wrap', 'normal').css('white-space', 'pre');
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ hiddenDiv.text($textarea.val() + '\n');
|
|
|
|
+ var content = hiddenDiv.html().replace(/\n/g, '<br>');
|
|
|
|
+ hiddenDiv.html(content);
|
|
|
|
+
|
|
|
|
+ // When textarea is hidden, width goes crazy.
|
|
|
|
+ // Approximate with half of window size
|
|
|
|
+
|
|
|
|
+ if ($textarea.is(':visible')) {
|
|
|
|
+ hiddenDiv.css('width', $textarea.width());
|
|
|
|
+ } else {
|
|
|
|
+ hiddenDiv.css('width', $(window).width() / 2);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Resize if the new height is greater than the
|
|
|
|
+ * original height of the textarea
|
|
|
|
+ */
|
|
|
|
+ if ($textarea.data('original-height') <= hiddenDiv.height()) {
|
|
|
|
+ $textarea.css('height', hiddenDiv.height());
|
|
|
|
+ } else if ($textarea.val().length < $textarea.data('previous-length')) {
|
|
|
|
+ /**
|
|
|
|
+ * In case the new height is less than original height, it
|
|
|
|
+ * means the textarea has less text than before
|
|
|
|
+ * So we set the height to the original one
|
|
|
|
+ */
|
|
|
|
+ $textarea.css('height', $textarea.data('original-height'));
|
|
|
|
+ }
|
|
|
|
+ $textarea.data('previous-length', $textarea.val().length);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ $(text_area_selector).each(function () {
|
|
|
|
+ var $textarea = $(this);
|
|
|
|
+ /**
|
|
|
|
+ * Instead of resizing textarea on document load,
|
|
|
|
+ * store the original height and the original length
|
|
|
|
+ */
|
|
|
|
+ $textarea.data('original-height', $textarea.height());
|
|
|
|
+ $textarea.data('previous-length', $textarea.val().length);
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ $('body').on('keyup keydown autoresize', text_area_selector, function () {
|
|
|
|
+ textareaAutoResize($(this));
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // File Input Path
|
|
|
|
+ $(document).on('change', '.file-field input[type="file"]', function () {
|
|
|
|
+ var file_field = $(this).closest('.file-field');
|
|
|
|
+ var path_input = file_field.find('input.file-path');
|
|
|
|
+ var files = $(this)[0].files;
|
|
|
|
+ var file_names = [];
|
|
|
|
+ for (var i = 0; i < files.length; i++) {
|
|
|
|
+ file_names.push(files[i].name);
|
|
|
|
+ }
|
|
|
|
+ path_input.val(file_names.join(", "));
|
|
|
|
+ path_input.trigger('change');
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ /****************
|
|
|
|
+ * Range Input *
|
|
|
|
+ ****************/
|
|
|
|
+
|
|
|
|
+ var range_type = 'input[type=range]';
|
|
|
|
+ var range_mousedown = false;
|
|
|
|
+ var left;
|
|
|
|
+
|
|
|
|
+ $(range_type).each(function () {
|
|
|
|
+ var thumb = $('<span class="thumb"><span class="value"></span></span>');
|
|
|
|
+ $(this).after(thumb);
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ var showRangeBubble = function (thumb) {
|
|
|
|
+ var paddingLeft = parseInt(thumb.parent().css('padding-left'));
|
|
|
|
+ var marginLeft = -7 + paddingLeft + 'px';
|
|
|
|
+ thumb.velocity({ height: "30px", width: "30px", top: "-30px", marginLeft: marginLeft }, { duration: 300, easing: 'easeOutExpo' });
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ var calcRangeOffset = function (range) {
|
|
|
|
+ var width = range.width() - 15;
|
|
|
|
+ var max = parseFloat(range.attr('max'));
|
|
|
|
+ var min = parseFloat(range.attr('min'));
|
|
|
|
+ var percent = (parseFloat(range.val()) - min) / (max - min);
|
|
|
|
+ return percent * width;
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ var range_wrapper = '.range-field';
|
|
|
|
+ $(document).on('change', range_type, function (e) {
|
|
|
|
+ var thumb = $(this).siblings('.thumb');
|
|
|
|
+ thumb.find('.value').html($(this).val());
|
|
|
|
+
|
|
|
|
+ if (!thumb.hasClass('active')) {
|
|
|
|
+ showRangeBubble(thumb);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ var offsetLeft = calcRangeOffset($(this));
|
|
|
|
+ thumb.addClass('active').css('left', offsetLeft);
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ $(document).on('mousedown touchstart', range_type, function (e) {
|
|
|
|
+ var thumb = $(this).siblings('.thumb');
|
|
|
|
+
|
|
|
|
+ // If thumb indicator does not exist yet, create it
|
|
|
|
+ if (thumb.length <= 0) {
|
|
|
|
+ thumb = $('<span class="thumb"><span class="value"></span></span>');
|
|
|
|
+ $(this).after(thumb);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Set indicator value
|
|
|
|
+ thumb.find('.value').html($(this).val());
|
|
|
|
+
|
|
|
|
+ range_mousedown = true;
|
|
|
|
+ $(this).addClass('active');
|
|
|
|
+
|
|
|
|
+ if (!thumb.hasClass('active')) {
|
|
|
|
+ showRangeBubble(thumb);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ if (e.type !== 'input') {
|
|
|
|
+ var offsetLeft = calcRangeOffset($(this));
|
|
|
|
+ thumb.addClass('active').css('left', offsetLeft);
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ $(document).on('mouseup touchend', range_wrapper, function () {
|
|
|
|
+ range_mousedown = false;
|
|
|
|
+ $(this).removeClass('active');
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ $(document).on('input mousemove touchmove', range_wrapper, function (e) {
|
|
|
|
+ var thumb = $(this).children('.thumb');
|
|
|
|
+ var left;
|
|
|
|
+ var input = $(this).find(range_type);
|
|
|
|
+
|
|
|
|
+ if (range_mousedown) {
|
|
|
|
+ if (!thumb.hasClass('active')) {
|
|
|
|
+ showRangeBubble(thumb);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ var offsetLeft = calcRangeOffset(input);
|
|
|
|
+ thumb.addClass('active').css('left', offsetLeft);
|
|
|
|
+ thumb.find('.value').html(thumb.siblings(range_type).val());
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ $(document).on('mouseout touchleave', range_wrapper, function () {
|
|
|
|
+ if (!range_mousedown) {
|
|
|
|
+
|
|
|
|
+ var thumb = $(this).children('.thumb');
|
|
|
|
+ var paddingLeft = parseInt($(this).css('padding-left'));
|
|
|
|
+ var marginLeft = 7 + paddingLeft + 'px';
|
|
|
|
+
|
|
|
|
+ if (thumb.hasClass('active')) {
|
|
|
|
+ thumb.velocity({ height: '0', width: '0', top: '10px', marginLeft: marginLeft }, { duration: 100 });
|
|
|
|
+ }
|
|
|
|
+ thumb.removeClass('active');
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ /**************************
|
|
|
|
+ * Auto complete plugin *
|
|
|
|
+ *************************/
|
|
|
|
+ $.fn.autocomplete = function (options) {
|
|
|
|
+ // Defaults
|
|
|
|
+ var defaults = {
|
|
|
|
+ data: {},
|
|
|
|
+ limit: Infinity,
|
|
|
|
+ onAutocomplete: null,
|
|
|
|
+ minLength: 1
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ options = $.extend(defaults, options);
|
|
|
|
+
|
|
|
|
+ return this.each(function () {
|
|
|
|
+ var $input = $(this);
|
|
|
|
+ var data = options.data,
|
|
|
|
+ count = 0,
|
|
|
|
+ activeIndex = -1,
|
|
|
|
+ oldVal,
|
|
|
|
+ $inputDiv = $input.closest('.input-field'); // Div to append on
|
|
|
|
+
|
|
|
|
+ // Check if data isn't empty
|
|
|
|
+ if (!$.isEmptyObject(data)) {
|
|
|
|
+ var $autocomplete = $('<ul class="autocomplete-content dropdown-content"></ul>');
|
|
|
|
+ var $oldAutocomplete;
|
|
|
|
+
|
|
|
|
+ // Append autocomplete element.
|
|
|
|
+ // Prevent double structure init.
|
|
|
|
+ if ($inputDiv.length) {
|
|
|
|
+ $oldAutocomplete = $inputDiv.children('.autocomplete-content.dropdown-content').first();
|
|
|
|
+ if (!$oldAutocomplete.length) {
|
|
|
|
+ $inputDiv.append($autocomplete); // Set ul in body
|
|
|
|
+ }
|
|
|
|
+ } else {
|
|
|
|
+ $oldAutocomplete = $input.next('.autocomplete-content.dropdown-content');
|
|
|
|
+ if (!$oldAutocomplete.length) {
|
|
|
|
+ $input.after($autocomplete);
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ if ($oldAutocomplete.length) {
|
|
|
|
+ $autocomplete = $oldAutocomplete;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Highlight partial match.
|
|
|
|
+ var highlight = function (string, $el) {
|
|
|
|
+ var img = $el.find('img');
|
|
|
|
+ var matchStart = $el.text().toLowerCase().indexOf("" + string.toLowerCase() + ""),
|
|
|
|
+ matchEnd = matchStart + string.length - 1,
|
|
|
|
+ beforeMatch = $el.text().slice(0, matchStart),
|
|
|
|
+ matchText = $el.text().slice(matchStart, matchEnd + 1),
|
|
|
|
+ afterMatch = $el.text().slice(matchEnd + 1);
|
|
|
|
+ $el.html("<span>" + beforeMatch + "<span class='highlight'>" + matchText + "</span>" + afterMatch + "</span>");
|
|
|
|
+ if (img.length) {
|
|
|
|
+ $el.prepend(img);
|
|
|
|
+ }
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ // Reset current element position
|
|
|
|
+ var resetCurrentElement = function () {
|
|
|
|
+ activeIndex = -1;
|
|
|
|
+ $autocomplete.find('.active').removeClass('active');
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ // Remove autocomplete elements
|
|
|
|
+ var removeAutocomplete = function () {
|
|
|
|
+ $autocomplete.empty();
|
|
|
|
+ resetCurrentElement();
|
|
|
|
+ oldVal = undefined;
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ $input.off('blur.autocomplete').on('blur.autocomplete', function () {
|
|
|
|
+ removeAutocomplete();
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // Perform search
|
|
|
|
+ $input.off('keyup.autocomplete focus.autocomplete').on('keyup.autocomplete focus.autocomplete', function (e) {
|
|
|
|
+ // Reset count.
|
|
|
|
+ count = 0;
|
|
|
|
+ var val = $input.val().toLowerCase();
|
|
|
|
+
|
|
|
|
+ // Don't capture enter or arrow key usage.
|
|
|
|
+ if (e.which === 13 || e.which === 38 || e.which === 40) {
|
|
|
|
+ return;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Check if the input isn't empty
|
|
|
|
+ if (oldVal !== val) {
|
|
|
|
+ removeAutocomplete();
|
|
|
|
+
|
|
|
|
+ if (val.length >= options.minLength) {
|
|
|
|
+ for (var key in data) {
|
|
|
|
+ if (data.hasOwnProperty(key) && key.toLowerCase().indexOf(val) !== -1) {
|
|
|
|
+ // Break if past limit
|
|
|
|
+ if (count >= options.limit) {
|
|
|
|
+ break;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ var autocompleteOption = $('<li></li>');
|
|
|
|
+ if (!!data[key]) {
|
|
|
|
+ autocompleteOption.append('<img src="' + data[key] + '" class="right circle"><span>' + key + '</span>');
|
|
|
|
+ } else {
|
|
|
|
+ autocompleteOption.append('<span>' + key + '</span>');
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ $autocomplete.append(autocompleteOption);
|
|
|
|
+ highlight(val, autocompleteOption);
|
|
|
|
+ count++;
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Update oldVal
|
|
|
|
+ oldVal = val;
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ $input.off('keydown.autocomplete').on('keydown.autocomplete', function (e) {
|
|
|
|
+ // Arrow keys and enter key usage
|
|
|
|
+ var keyCode = e.which,
|
|
|
|
+ liElement,
|
|
|
|
+ numItems = $autocomplete.children('li').length,
|
|
|
|
+ $active = $autocomplete.children('.active').first();
|
|
|
|
+
|
|
|
|
+ // select element on Enter
|
|
|
|
+ if (keyCode === 13 && activeIndex >= 0) {
|
|
|
|
+ liElement = $autocomplete.children('li').eq(activeIndex);
|
|
|
|
+ if (liElement.length) {
|
|
|
|
+ liElement.trigger('mousedown.autocomplete');
|
|
|
|
+ e.preventDefault();
|
|
|
|
+ }
|
|
|
|
+ return;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Capture up and down key
|
|
|
|
+ if (keyCode === 38 || keyCode === 40) {
|
|
|
|
+ e.preventDefault();
|
|
|
|
+
|
|
|
|
+ if (keyCode === 38 && activeIndex > 0) {
|
|
|
|
+ activeIndex--;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ if (keyCode === 40 && activeIndex < numItems - 1) {
|
|
|
|
+ activeIndex++;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ $active.removeClass('active');
|
|
|
|
+ if (activeIndex >= 0) {
|
|
|
|
+ $autocomplete.children('li').eq(activeIndex).addClass('active');
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // Set input value
|
|
|
|
+ $autocomplete.off('mousedown.autocomplete touchstart.autocomplete').on('mousedown.autocomplete touchstart.autocomplete', 'li', function () {
|
|
|
|
+ var text = $(this).text().trim();
|
|
|
|
+ $input.val(text);
|
|
|
|
+ $input.trigger('change');
|
|
|
|
+ removeAutocomplete();
|
|
|
|
+
|
|
|
|
+ // Handle onAutocomplete callback.
|
|
|
|
+ if (typeof options.onAutocomplete === "function") {
|
|
|
|
+ options.onAutocomplete.call(this, text);
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // Empty data
|
|
|
|
+ } else {
|
|
|
|
+ $input.off('keyup.autocomplete focus.autocomplete');
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ };
|
|
|
|
+ }); // End of $(document).ready
|
|
|
|
+
|
|
|
|
+ /*******************
|
|
|
|
+ * Select Plugin *
|
|
|
|
+ ******************/
|
|
|
|
+ $.fn.material_select = function (callback) {
|
|
|
|
+ $(this).each(function () {
|
|
|
|
+ var $select = $(this);
|
|
|
|
+
|
|
|
|
+ if ($select.hasClass('browser-default')) {
|
|
|
|
+ return; // Continue to next (return false breaks out of entire loop)
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ var multiple = $select.attr('multiple') ? true : false,
|
|
|
|
+ lastID = $select.attr('data-select-id'); // Tear down structure if Select needs to be rebuilt
|
|
|
|
+
|
|
|
|
+ if (lastID) {
|
|
|
|
+ $select.parent().find('span.caret').remove();
|
|
|
|
+ $select.parent().find('input').remove();
|
|
|
|
+
|
|
|
|
+ $select.unwrap();
|
|
|
|
+ $('ul#select-options-' + lastID).remove();
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // If destroying the select, remove the selelct-id and reset it to it's uninitialized state.
|
|
|
|
+ if (callback === 'destroy') {
|
|
|
|
+ $select.removeAttr('data-select-id').removeClass('initialized');
|
|
|
|
+ $(window).off('click.select');
|
|
|
|
+ return;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ var uniqueID = Materialize.guid();
|
|
|
|
+ $select.attr('data-select-id', uniqueID);
|
|
|
|
+ var wrapper = $('<div class="select-wrapper"></div>');
|
|
|
|
+ wrapper.addClass($select.attr('class'));
|
|
|
|
+ if ($select.is(':disabled')) wrapper.addClass('disabled');
|
|
|
|
+ var options = $('<ul id="select-options-' + uniqueID + '" class="dropdown-content select-dropdown ' + (multiple ? 'multiple-select-dropdown' : '') + '"></ul>'),
|
|
|
|
+ selectChildren = $select.children('option, optgroup'),
|
|
|
|
+ valuesSelected = [],
|
|
|
|
+ optionsHover = false;
|
|
|
|
+
|
|
|
|
+ var label = $select.find('option:selected').html() || $select.find('option:first').html() || "";
|
|
|
|
+
|
|
|
|
+ // Function that renders and appends the option taking into
|
|
|
|
+ // account type and possible image icon.
|
|
|
|
+ var appendOptionWithIcon = function (select, option, type) {
|
|
|
|
+ // Add disabled attr if disabled
|
|
|
|
+ var disabledClass = option.is(':disabled') ? 'disabled ' : '';
|
|
|
|
+ var optgroupClass = type === 'optgroup-option' ? 'optgroup-option ' : '';
|
|
|
|
+ var multipleCheckbox = multiple ? '<input type="checkbox"' + disabledClass + '/><label></label>' : '';
|
|
|
|
+
|
|
|
|
+ // add icons
|
|
|
|
+ var icon_url = option.data('icon');
|
|
|
|
+ var classes = option.attr('class');
|
|
|
|
+ if (!!icon_url) {
|
|
|
|
+ var classString = '';
|
|
|
|
+ if (!!classes) classString = ' class="' + classes + '"';
|
|
|
|
+
|
|
|
|
+ // Check for multiple type.
|
|
|
|
+ options.append($('<li class="' + disabledClass + optgroupClass + '"><img alt="" src="' + icon_url + '"' + classString + '><span>' + multipleCheckbox + option.html() + '</span></li>'));
|
|
|
|
+ return true;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Check for multiple type.
|
|
|
|
+ options.append($('<li class="' + disabledClass + optgroupClass + '"><span>' + multipleCheckbox + option.html() + '</span></li>'));
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ /* Create dropdown structure. */
|
|
|
|
+ if (selectChildren.length) {
|
|
|
|
+ selectChildren.each(function () {
|
|
|
|
+ if ($(this).is('option')) {
|
|
|
|
+ // Direct descendant option.
|
|
|
|
+ if (multiple) {
|
|
|
|
+ appendOptionWithIcon($select, $(this), 'multiple');
|
|
|
|
+ } else {
|
|
|
|
+ appendOptionWithIcon($select, $(this));
|
|
|
|
+ }
|
|
|
|
+ } else if ($(this).is('optgroup')) {
|
|
|
|
+ // Optgroup.
|
|
|
|
+ var selectOptions = $(this).children('option');
|
|
|
|
+ options.append($('<li class="optgroup"><span>' + $(this).attr('label') + '</span></li>'));
|
|
|
|
+
|
|
|
|
+ selectOptions.each(function () {
|
|
|
|
+ appendOptionWithIcon($select, $(this), 'optgroup-option');
|
|
|
|
+ });
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ options.find('li:not(.optgroup)').each(function (i) {
|
|
|
|
+ $(this).click(function (e) {
|
|
|
|
+ // Check if option element is disabled
|
|
|
|
+ if (!$(this).hasClass('disabled') && !$(this).hasClass('optgroup')) {
|
|
|
|
+ var selected = true;
|
|
|
|
+
|
|
|
|
+ if (multiple) {
|
|
|
|
+ $('input[type="checkbox"]', this).prop('checked', function (i, v) {
|
|
|
|
+ return !v;
|
|
|
|
+ });
|
|
|
|
+ selected = toggleEntryFromArray(valuesSelected, i, $select);
|
|
|
|
+ $newSelect.trigger('focus');
|
|
|
|
+ } else {
|
|
|
|
+ options.find('li').removeClass('active');
|
|
|
|
+ $(this).toggleClass('active');
|
|
|
|
+ $newSelect.val($(this).text());
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ activateOption(options, $(this));
|
|
|
|
+ $select.find('option').eq(i).prop('selected', selected);
|
|
|
|
+ // Trigger onchange() event
|
|
|
|
+ $select.trigger('change');
|
|
|
|
+ if (typeof callback !== 'undefined') callback();
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ e.stopPropagation();
|
|
|
|
+ });
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // Wrap Elements
|
|
|
|
+ $select.wrap(wrapper);
|
|
|
|
+ // Add Select Display Element
|
|
|
|
+ var dropdownIcon = $('<span class="caret">▼</span>');
|
|
|
|
+
|
|
|
|
+ // escape double quotes
|
|
|
|
+ var sanitizedLabelHtml = label.replace(/"/g, '"');
|
|
|
|
+
|
|
|
|
+ var $newSelect = $('<input type="text" class="select-dropdown" readonly="true" ' + ($select.is(':disabled') ? 'disabled' : '') + ' data-activates="select-options-' + uniqueID + '" value="' + sanitizedLabelHtml + '"/>');
|
|
|
|
+ $select.before($newSelect);
|
|
|
|
+ $newSelect.before(dropdownIcon);
|
|
|
|
+
|
|
|
|
+ $newSelect.after(options);
|
|
|
|
+ // Check if section element is disabled
|
|
|
|
+ if (!$select.is(':disabled')) {
|
|
|
|
+ $newSelect.dropdown({ 'hover': false });
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Copy tabindex
|
|
|
|
+ if ($select.attr('tabindex')) {
|
|
|
|
+ $($newSelect[0]).attr('tabindex', $select.attr('tabindex'));
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ $select.addClass('initialized');
|
|
|
|
+
|
|
|
|
+ $newSelect.on({
|
|
|
|
+ 'focus': function () {
|
|
|
|
+ if ($('ul.select-dropdown').not(options[0]).is(':visible')) {
|
|
|
|
+ $('input.select-dropdown').trigger('close');
|
|
|
|
+ $(window).off('click.select');
|
|
|
|
+ }
|
|
|
|
+ if (!options.is(':visible')) {
|
|
|
|
+ $(this).trigger('open', ['focus']);
|
|
|
|
+ var label = $(this).val();
|
|
|
|
+ if (multiple && label.indexOf(',') >= 0) {
|
|
|
|
+ label = label.split(',')[0];
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ var selectedOption = options.find('li').filter(function () {
|
|
|
|
+ return $(this).text().toLowerCase() === label.toLowerCase();
|
|
|
|
+ })[0];
|
|
|
|
+ activateOption(options, selectedOption, true);
|
|
|
|
+
|
|
|
|
+ $(window).off('click.select').on('click.select', function () {
|
|
|
|
+ multiple && (optionsHover || $newSelect.trigger('close'));
|
|
|
|
+ $(window).off('click.select');
|
|
|
|
+ });
|
|
|
|
+ }
|
|
|
|
+ },
|
|
|
|
+ 'click': function (e) {
|
|
|
|
+ e.stopPropagation();
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ $newSelect.on('blur', function () {
|
|
|
|
+ if (!multiple) {
|
|
|
|
+ $(this).trigger('close');
|
|
|
|
+ $(window).off('click.select');
|
|
|
|
+ }
|
|
|
|
+ options.find('li.selected').removeClass('selected');
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ options.hover(function () {
|
|
|
|
+ optionsHover = true;
|
|
|
|
+ }, function () {
|
|
|
|
+ optionsHover = false;
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // Add initial multiple selections.
|
|
|
|
+ if (multiple) {
|
|
|
|
+ $select.find("option:selected:not(:disabled)").each(function () {
|
|
|
|
+ var index = this.index;
|
|
|
|
+
|
|
|
|
+ toggleEntryFromArray(valuesSelected, index, $select);
|
|
|
|
+ options.find("li:not(.optgroup)").eq(index).find(":checkbox").prop("checked", true);
|
|
|
|
+ });
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Make option as selected and scroll to selected position
|
|
|
|
+ * @param {jQuery} collection Select options jQuery element
|
|
|
|
+ * @param {Element} newOption element of the new option
|
|
|
|
+ * @param {Boolean} firstActivation If on first activation of select
|
|
|
|
+ */
|
|
|
|
+ var activateOption = function (collection, newOption, firstActivation) {
|
|
|
|
+ if (newOption) {
|
|
|
|
+ collection.find('li.selected').removeClass('selected');
|
|
|
|
+ var option = $(newOption);
|
|
|
|
+ option.addClass('selected');
|
|
|
|
+ if (!multiple || !!firstActivation) {
|
|
|
|
+ options.scrollTo(option);
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ // Allow user to search by typing
|
|
|
|
+ // this array is cleared after 1 second
|
|
|
|
+ var filterQuery = [],
|
|
|
|
+ onKeyDown = function (e) {
|
|
|
|
+ // TAB - switch to another input
|
|
|
|
+ if (e.which == 9) {
|
|
|
|
+ $newSelect.trigger('close');
|
|
|
|
+ return;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // ARROW DOWN WHEN SELECT IS CLOSED - open select options
|
|
|
|
+ if (e.which == 40 && !options.is(':visible')) {
|
|
|
|
+ $newSelect.trigger('open');
|
|
|
|
+ return;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // ENTER WHEN SELECT IS CLOSED - submit form
|
|
|
|
+ if (e.which == 13 && !options.is(':visible')) {
|
|
|
|
+ return;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ e.preventDefault();
|
|
|
|
+
|
|
|
|
+ // CASE WHEN USER TYPE LETTERS
|
|
|
|
+ var letter = String.fromCharCode(e.which).toLowerCase(),
|
|
|
|
+ nonLetters = [9, 13, 27, 38, 40];
|
|
|
|
+ if (letter && nonLetters.indexOf(e.which) === -1) {
|
|
|
|
+ filterQuery.push(letter);
|
|
|
|
+
|
|
|
|
+ var string = filterQuery.join(''),
|
|
|
|
+ newOption = options.find('li').filter(function () {
|
|
|
|
+ return $(this).text().toLowerCase().indexOf(string) === 0;
|
|
|
|
+ })[0];
|
|
|
|
+
|
|
|
|
+ if (newOption) {
|
|
|
|
+ activateOption(options, newOption);
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // ENTER - select option and close when select options are opened
|
|
|
|
+ if (e.which == 13) {
|
|
|
|
+ var activeOption = options.find('li.selected:not(.disabled)')[0];
|
|
|
|
+ if (activeOption) {
|
|
|
|
+ $(activeOption).trigger('click');
|
|
|
|
+ if (!multiple) {
|
|
|
|
+ $newSelect.trigger('close');
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // ARROW DOWN - move to next not disabled option
|
|
|
|
+ if (e.which == 40) {
|
|
|
|
+ if (options.find('li.selected').length) {
|
|
|
|
+ newOption = options.find('li.selected').next('li:not(.disabled)')[0];
|
|
|
|
+ } else {
|
|
|
|
+ newOption = options.find('li:not(.disabled)')[0];
|
|
|
|
+ }
|
|
|
|
+ activateOption(options, newOption);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // ESC - close options
|
|
|
|
+ if (e.which == 27) {
|
|
|
|
+ $newSelect.trigger('close');
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // ARROW UP - move to previous not disabled option
|
|
|
|
+ if (e.which == 38) {
|
|
|
|
+ newOption = options.find('li.selected').prev('li:not(.disabled)')[0];
|
|
|
|
+ if (newOption) activateOption(options, newOption);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Automaticaly clean filter query so user can search again by starting letters
|
|
|
|
+ setTimeout(function () {
|
|
|
|
+ filterQuery = [];
|
|
|
|
+ }, 1000);
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ $newSelect.on('keydown', onKeyDown);
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ function toggleEntryFromArray(entriesArray, entryIndex, select) {
|
|
|
|
+ var index = entriesArray.indexOf(entryIndex),
|
|
|
|
+ notAdded = index === -1;
|
|
|
|
+
|
|
|
|
+ if (notAdded) {
|
|
|
|
+ entriesArray.push(entryIndex);
|
|
|
|
+ } else {
|
|
|
|
+ entriesArray.splice(index, 1);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ select.siblings('ul.dropdown-content').find('li:not(.optgroup)').eq(entryIndex).toggleClass('active');
|
|
|
|
+
|
|
|
|
+ // use notAdded instead of true (to detect if the option is selected or not)
|
|
|
|
+ select.find('option').eq(entryIndex).prop('selected', notAdded);
|
|
|
|
+ setValueToInput(entriesArray, select);
|
|
|
|
+
|
|
|
|
+ return notAdded;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ function setValueToInput(entriesArray, select) {
|
|
|
|
+ var value = '';
|
|
|
|
+
|
|
|
|
+ for (var i = 0, count = entriesArray.length; i < count; i++) {
|
|
|
|
+ var text = select.find('option').eq(entriesArray[i]).text();
|
|
|
|
+
|
|
|
|
+ i === 0 ? value += text : value += ', ' + text;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ if (value === '') {
|
|
|
|
+ value = select.find('option:disabled').eq(0).text();
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ select.siblings('input.select-dropdown').val(value);
|
|
|
|
+ }
|
|
|
|
+ };
|
|
|
|
+})(jQuery);
|
|
|
|
+;(function ($) {
|
|
|
|
+
|
|
|
|
+ var methods = {
|
|
|
|
+
|
|
|
|
+ init: function (options) {
|
|
|
|
+ var defaults = {
|
|
|
|
+ indicators: true,
|
|
|
|
+ height: 400,
|
|
|
|
+ transition: 500,
|
|
|
|
+ interval: 6000
|
|
|
|
+ };
|
|
|
|
+ options = $.extend(defaults, options);
|
|
|
|
+
|
|
|
|
+ return this.each(function () {
|
|
|
|
+
|
|
|
|
+ // For each slider, we want to keep track of
|
|
|
|
+ // which slide is active and its associated content
|
|
|
|
+ var $this = $(this);
|
|
|
|
+ var $slider = $this.find('ul.slides').first();
|
|
|
|
+ var $slides = $slider.find('> li');
|
|
|
|
+ var $active_index = $slider.find('.active').index();
|
|
|
|
+ var $active, $indicators, $interval;
|
|
|
|
+ if ($active_index != -1) {
|
|
|
|
+ $active = $slides.eq($active_index);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Transitions the caption depending on alignment
|
|
|
|
+ function captionTransition(caption, duration) {
|
|
|
|
+ if (caption.hasClass("center-align")) {
|
|
|
|
+ caption.velocity({ opacity: 0, translateY: -100 }, { duration: duration, queue: false });
|
|
|
|
+ } else if (caption.hasClass("right-align")) {
|
|
|
|
+ caption.velocity({ opacity: 0, translateX: 100 }, { duration: duration, queue: false });
|
|
|
|
+ } else if (caption.hasClass("left-align")) {
|
|
|
|
+ caption.velocity({ opacity: 0, translateX: -100 }, { duration: duration, queue: false });
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // This function will transition the slide to any index of the next slide
|
|
|
|
+ function moveToSlide(index) {
|
|
|
|
+ // Wrap around indices.
|
|
|
|
+ if (index >= $slides.length) index = 0;else if (index < 0) index = $slides.length - 1;
|
|
|
|
+
|
|
|
|
+ $active_index = $slider.find('.active').index();
|
|
|
|
+
|
|
|
|
+ // Only do if index changes
|
|
|
|
+ if ($active_index != index) {
|
|
|
|
+ $active = $slides.eq($active_index);
|
|
|
|
+ $caption = $active.find('.caption');
|
|
|
|
+
|
|
|
|
+ $active.removeClass('active');
|
|
|
|
+ $active.velocity({ opacity: 0 }, { duration: options.transition, queue: false, easing: 'easeOutQuad',
|
|
|
|
+ complete: function () {
|
|
|
|
+ $slides.not('.active').velocity({ opacity: 0, translateX: 0, translateY: 0 }, { duration: 0, queue: false });
|
|
|
|
+ } });
|
|
|
|
+ captionTransition($caption, options.transition);
|
|
|
|
+
|
|
|
|
+ // Update indicators
|
|
|
|
+ if (options.indicators) {
|
|
|
|
+ $indicators.eq($active_index).removeClass('active');
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ $slides.eq(index).velocity({ opacity: 1 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' });
|
|
|
|
+ $slides.eq(index).find('.caption').velocity({ opacity: 1, translateX: 0, translateY: 0 }, { duration: options.transition, delay: options.transition, queue: false, easing: 'easeOutQuad' });
|
|
|
|
+ $slides.eq(index).addClass('active');
|
|
|
|
+
|
|
|
|
+ // Update indicators
|
|
|
|
+ if (options.indicators) {
|
|
|
|
+ $indicators.eq(index).addClass('active');
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Set height of slider
|
|
|
|
+ // If fullscreen, do nothing
|
|
|
|
+ if (!$this.hasClass('fullscreen')) {
|
|
|
|
+ if (options.indicators) {
|
|
|
|
+ // Add height if indicators are present
|
|
|
|
+ $this.height(options.height + 40);
|
|
|
|
+ } else {
|
|
|
|
+ $this.height(options.height);
|
|
|
|
+ }
|
|
|
|
+ $slider.height(options.height);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Set initial positions of captions
|
|
|
|
+ $slides.find('.caption').each(function () {
|
|
|
|
+ captionTransition($(this), 0);
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // Move img src into background-image
|
|
|
|
+ $slides.find('img').each(function () {
|
|
|
|
+ var placeholderBase64 = 'data:image/gif;base64,R0lGODlhAQABAIABAP///wAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw==';
|
|
|
|
+ if ($(this).attr('src') !== placeholderBase64) {
|
|
|
|
+ $(this).css('background-image', 'url("' + $(this).attr('src') + '")');
|
|
|
|
+ $(this).attr('src', placeholderBase64);
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // dynamically add indicators
|
|
|
|
+ if (options.indicators) {
|
|
|
|
+ $indicators = $('<ul class="indicators"></ul>');
|
|
|
|
+ $slides.each(function (index) {
|
|
|
|
+ var $indicator = $('<li class="indicator-item"></li>');
|
|
|
|
+
|
|
|
|
+ // Handle clicks on indicators
|
|
|
|
+ $indicator.click(function () {
|
|
|
|
+ var $parent = $slider.parent();
|
|
|
|
+ var curr_index = $parent.find($(this)).index();
|
|
|
|
+ moveToSlide(curr_index);
|
|
|
|
+
|
|
|
|
+ // reset interval
|
|
|
|
+ clearInterval($interval);
|
|
|
|
+ $interval = setInterval(function () {
|
|
|
|
+ $active_index = $slider.find('.active').index();
|
|
|
|
+ if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
|
|
|
|
+ else $active_index += 1;
|
|
|
|
+
|
|
|
|
+ moveToSlide($active_index);
|
|
|
|
+ }, options.transition + options.interval);
|
|
|
|
+ });
|
|
|
|
+ $indicators.append($indicator);
|
|
|
|
+ });
|
|
|
|
+ $this.append($indicators);
|
|
|
|
+ $indicators = $this.find('ul.indicators').find('li.indicator-item');
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ if ($active) {
|
|
|
|
+ $active.show();
|
|
|
|
+ } else {
|
|
|
|
+ $slides.first().addClass('active').velocity({ opacity: 1 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' });
|
|
|
|
+
|
|
|
|
+ $active_index = 0;
|
|
|
|
+ $active = $slides.eq($active_index);
|
|
|
|
+
|
|
|
|
+ // Update indicators
|
|
|
|
+ if (options.indicators) {
|
|
|
|
+ $indicators.eq($active_index).addClass('active');
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Adjust height to current slide
|
|
|
|
+ $active.find('img').each(function () {
|
|
|
|
+ $active.find('.caption').velocity({ opacity: 1, translateX: 0, translateY: 0 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' });
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // auto scroll
|
|
|
|
+ $interval = setInterval(function () {
|
|
|
|
+ $active_index = $slider.find('.active').index();
|
|
|
|
+ moveToSlide($active_index + 1);
|
|
|
|
+ }, options.transition + options.interval);
|
|
|
|
+
|
|
|
|
+ // HammerJS, Swipe navigation
|
|
|
|
+
|
|
|
|
+ // Touch Event
|
|
|
|
+ var panning = false;
|
|
|
|
+ var swipeLeft = false;
|
|
|
|
+ var swipeRight = false;
|
|
|
|
+
|
|
|
|
+ $this.hammer({
|
|
|
|
+ prevent_default: false
|
|
|
|
+ }).on('pan', function (e) {
|
|
|
|
+ if (e.gesture.pointerType === "touch") {
|
|
|
|
+
|
|
|
|
+ // reset interval
|
|
|
|
+ clearInterval($interval);
|
|
|
|
+
|
|
|
|
+ var direction = e.gesture.direction;
|
|
|
|
+ var x = e.gesture.deltaX;
|
|
|
|
+ var velocityX = e.gesture.velocityX;
|
|
|
|
+ var velocityY = e.gesture.velocityY;
|
|
|
|
+
|
|
|
|
+ $curr_slide = $slider.find('.active');
|
|
|
|
+ if (Math.abs(velocityX) > Math.abs(velocityY)) {
|
|
|
|
+ $curr_slide.velocity({ translateX: x
|
|
|
|
+ }, { duration: 50, queue: false, easing: 'easeOutQuad' });
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Swipe Left
|
|
|
|
+ if (direction === 4 && (x > $this.innerWidth() / 2 || velocityX < -0.65)) {
|
|
|
|
+ swipeRight = true;
|
|
|
|
+ }
|
|
|
|
+ // Swipe Right
|
|
|
|
+ else if (direction === 2 && (x < -1 * $this.innerWidth() / 2 || velocityX > 0.65)) {
|
|
|
|
+ swipeLeft = true;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Make Slide Behind active slide visible
|
|
|
|
+ var next_slide;
|
|
|
|
+ if (swipeLeft) {
|
|
|
|
+ next_slide = $curr_slide.next();
|
|
|
|
+ if (next_slide.length === 0) {
|
|
|
|
+ next_slide = $slides.first();
|
|
|
|
+ }
|
|
|
|
+ next_slide.velocity({ opacity: 1
|
|
|
|
+ }, { duration: 300, queue: false, easing: 'easeOutQuad' });
|
|
|
|
+ }
|
|
|
|
+ if (swipeRight) {
|
|
|
|
+ next_slide = $curr_slide.prev();
|
|
|
|
+ if (next_slide.length === 0) {
|
|
|
|
+ next_slide = $slides.last();
|
|
|
|
+ }
|
|
|
|
+ next_slide.velocity({ opacity: 1
|
|
|
|
+ }, { duration: 300, queue: false, easing: 'easeOutQuad' });
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ }).on('panend', function (e) {
|
|
|
|
+ if (e.gesture.pointerType === "touch") {
|
|
|
|
+
|
|
|
|
+ $curr_slide = $slider.find('.active');
|
|
|
|
+ panning = false;
|
|
|
|
+ curr_index = $slider.find('.active').index();
|
|
|
|
+
|
|
|
|
+ if (!swipeRight && !swipeLeft || $slides.length <= 1) {
|
|
|
|
+ // Return to original spot
|
|
|
|
+ $curr_slide.velocity({ translateX: 0
|
|
|
|
+ }, { duration: 300, queue: false, easing: 'easeOutQuad' });
|
|
|
|
+ } else if (swipeLeft) {
|
|
|
|
+ moveToSlide(curr_index + 1);
|
|
|
|
+ $curr_slide.velocity({ translateX: -1 * $this.innerWidth() }, { duration: 300, queue: false, easing: 'easeOutQuad',
|
|
|
|
+ complete: function () {
|
|
|
|
+ $curr_slide.velocity({ opacity: 0, translateX: 0 }, { duration: 0, queue: false });
|
|
|
|
+ } });
|
|
|
|
+ } else if (swipeRight) {
|
|
|
|
+ moveToSlide(curr_index - 1);
|
|
|
|
+ $curr_slide.velocity({ translateX: $this.innerWidth() }, { duration: 300, queue: false, easing: 'easeOutQuad',
|
|
|
|
+ complete: function () {
|
|
|
|
+ $curr_slide.velocity({ opacity: 0, translateX: 0 }, { duration: 0, queue: false });
|
|
|
|
+ } });
|
|
|
|
+ }
|
|
|
|
+ swipeLeft = false;
|
|
|
|
+ swipeRight = false;
|
|
|
|
+
|
|
|
|
+ // Restart interval
|
|
|
|
+ clearInterval($interval);
|
|
|
|
+ $interval = setInterval(function () {
|
|
|
|
+ $active_index = $slider.find('.active').index();
|
|
|
|
+ if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
|
|
|
|
+ else $active_index += 1;
|
|
|
|
+
|
|
|
|
+ moveToSlide($active_index);
|
|
|
|
+ }, options.transition + options.interval);
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ $this.on('sliderPause', function () {
|
|
|
|
+ clearInterval($interval);
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ $this.on('sliderStart', function () {
|
|
|
|
+ clearInterval($interval);
|
|
|
|
+ $interval = setInterval(function () {
|
|
|
|
+ $active_index = $slider.find('.active').index();
|
|
|
|
+ if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
|
|
|
|
+ else $active_index += 1;
|
|
|
|
+
|
|
|
|
+ moveToSlide($active_index);
|
|
|
|
+ }, options.transition + options.interval);
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ $this.on('sliderNext', function () {
|
|
|
|
+ $active_index = $slider.find('.active').index();
|
|
|
|
+ moveToSlide($active_index + 1);
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ $this.on('sliderPrev', function () {
|
|
|
|
+ $active_index = $slider.find('.active').index();
|
|
|
|
+ moveToSlide($active_index - 1);
|
|
|
|
+ });
|
|
|
|
+ });
|
|
|
|
+ },
|
|
|
|
+ pause: function () {
|
|
|
|
+ $(this).trigger('sliderPause');
|
|
|
|
+ },
|
|
|
|
+ start: function () {
|
|
|
|
+ $(this).trigger('sliderStart');
|
|
|
|
+ },
|
|
|
|
+ next: function () {
|
|
|
|
+ $(this).trigger('sliderNext');
|
|
|
|
+ },
|
|
|
|
+ prev: function () {
|
|
|
|
+ $(this).trigger('sliderPrev');
|
|
|
|
+ }
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ $.fn.slider = function (methodOrOptions) {
|
|
|
|
+ if (methods[methodOrOptions]) {
|
|
|
|
+ return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
|
|
|
|
+ } else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
|
|
|
|
+ // Default to "init"
|
|
|
|
+ return methods.init.apply(this, arguments);
|
|
|
|
+ } else {
|
|
|
|
+ $.error('Method ' + methodOrOptions + ' does not exist on jQuery.tooltip');
|
|
|
|
+ }
|
|
|
|
+ }; // Plugin end
|
|
|
|
+})(jQuery);
|
|
|
|
+;(function ($) {
|
|
|
|
+ $(document).ready(function () {
|
|
|
|
+
|
|
|
|
+ $(document).on('click.card', '.card', function (e) {
|
|
|
|
+ if ($(this).find('> .card-reveal').length) {
|
|
|
|
+ var $card = $(e.target).closest('.card');
|
|
|
|
+ if ($card.data('initialOverflow') === undefined) {
|
|
|
|
+ $card.data('initialOverflow', $card.css('overflow') === undefined ? '' : $card.css('overflow'));
|
|
|
|
+ }
|
|
|
|
+ if ($(e.target).is($('.card-reveal .card-title>i'))) {
|
|
|
|
+ // Make Reveal animate down and display none
|
|
|
|
+ $(this).find('.card-reveal').velocity({ translateY: 0 }, {
|
|
|
|
+ duration: 225,
|
|
|
|
+ queue: false,
|
|
|
|
+ easing: 'easeInOutQuad',
|
|
|
|
+ complete: function () {
|
|
|
|
+ $(this).css({ display: 'none' });
|
|
|
|
+ $card.css('overflow', $card.data('initialOverflow'));
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ } else if ($(e.target).is($('.card .activator')) || $(e.target).is($('.card .activator i'))) {
|
|
|
|
+ $card.css('overflow', 'hidden');
|
|
|
|
+ $(this).find('.card-reveal').css({ display: 'block' }).velocity("stop", false).velocity({ translateY: '-100%' }, { duration: 300, queue: false, easing: 'easeInOutQuad' });
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ });
|
|
|
|
+})(jQuery);
|
|
|
|
+;(function ($) {
|
|
|
|
+ var materialChipsDefaults = {
|
|
|
|
+ data: [],
|
|
|
|
+ placeholder: '',
|
|
|
|
+ secondaryPlaceholder: '',
|
|
|
|
+ autocompleteOptions: {}
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ $(document).ready(function () {
|
|
|
|
+ // Handle removal of static chips.
|
|
|
|
+ $(document).on('click', '.chip .close', function (e) {
|
|
|
|
+ var $chips = $(this).closest('.chips');
|
|
|
|
+ if ($chips.attr('data-initialized')) {
|
|
|
|
+ return;
|
|
|
|
+ }
|
|
|
|
+ $(this).closest('.chip').remove();
|
|
|
|
+ });
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ $.fn.material_chip = function (options) {
|
|
|
|
+ var self = this;
|
|
|
|
+ this.$el = $(this);
|
|
|
|
+ this.$document = $(document);
|
|
|
|
+ this.SELS = {
|
|
|
|
+ CHIPS: '.chips',
|
|
|
|
+ CHIP: '.chip',
|
|
|
|
+ INPUT: 'input',
|
|
|
|
+ DELETE: '.material-icons',
|
|
|
|
+ SELECTED_CHIP: '.selected'
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ if ('data' === options) {
|
|
|
|
+ return this.$el.data('chips');
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ var curr_options = $.extend({}, materialChipsDefaults, options);
|
|
|
|
+ self.hasAutocomplete = !$.isEmptyObject(curr_options.autocompleteOptions.data);
|
|
|
|
+
|
|
|
|
+ // Initialize
|
|
|
|
+ this.init = function () {
|
|
|
|
+ var i = 0;
|
|
|
|
+ var chips;
|
|
|
|
+ self.$el.each(function () {
|
|
|
|
+ var $chips = $(this);
|
|
|
|
+ var chipId = Materialize.guid();
|
|
|
|
+ self.chipId = chipId;
|
|
|
|
+
|
|
|
|
+ if (!curr_options.data || !(curr_options.data instanceof Array)) {
|
|
|
|
+ curr_options.data = [];
|
|
|
|
+ }
|
|
|
|
+ $chips.data('chips', curr_options.data);
|
|
|
|
+ $chips.attr('data-index', i);
|
|
|
|
+ $chips.attr('data-initialized', true);
|
|
|
|
+
|
|
|
|
+ if (!$chips.hasClass(self.SELS.CHIPS)) {
|
|
|
|
+ $chips.addClass('chips');
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ self.chips($chips, chipId);
|
|
|
|
+ i++;
|
|
|
|
+ });
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ this.handleEvents = function () {
|
|
|
|
+ var SELS = self.SELS;
|
|
|
|
+
|
|
|
|
+ self.$document.off('click.chips-focus', SELS.CHIPS).on('click.chips-focus', SELS.CHIPS, function (e) {
|
|
|
|
+ $(e.target).find(SELS.INPUT).focus();
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ self.$document.off('click.chips-select', SELS.CHIP).on('click.chips-select', SELS.CHIP, function (e) {
|
|
|
|
+ var $chip = $(e.target);
|
|
|
|
+ if ($chip.length) {
|
|
|
|
+ var wasSelected = $chip.hasClass('selected');
|
|
|
|
+ var $chips = $chip.closest(SELS.CHIPS);
|
|
|
|
+ $(SELS.CHIP).removeClass('selected');
|
|
|
|
+
|
|
|
|
+ if (!wasSelected) {
|
|
|
|
+ self.selectChip($chip.index(), $chips);
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ self.$document.off('keydown.chips').on('keydown.chips', function (e) {
|
|
|
|
+ if ($(e.target).is('input, textarea')) {
|
|
|
|
+ return;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // delete
|
|
|
|
+ var $chip = self.$document.find(SELS.CHIP + SELS.SELECTED_CHIP);
|
|
|
|
+ var $chips = $chip.closest(SELS.CHIPS);
|
|
|
|
+ var length = $chip.siblings(SELS.CHIP).length;
|
|
|
|
+ var index;
|
|
|
|
+
|
|
|
|
+ if (!$chip.length) {
|
|
|
|
+ return;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ if (e.which === 8 || e.which === 46) {
|
|
|
|
+ e.preventDefault();
|
|
|
|
+
|
|
|
|
+ index = $chip.index();
|
|
|
|
+ self.deleteChip(index, $chips);
|
|
|
|
+
|
|
|
|
+ var selectIndex = null;
|
|
|
|
+ if (index + 1 < length) {
|
|
|
|
+ selectIndex = index;
|
|
|
|
+ } else if (index === length || index + 1 === length) {
|
|
|
|
+ selectIndex = length - 1;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ if (selectIndex < 0) selectIndex = null;
|
|
|
|
+
|
|
|
|
+ if (null !== selectIndex) {
|
|
|
|
+ self.selectChip(selectIndex, $chips);
|
|
|
|
+ }
|
|
|
|
+ if (!length) $chips.find('input').focus();
|
|
|
|
+
|
|
|
|
+ // left
|
|
|
|
+ } else if (e.which === 37) {
|
|
|
|
+ index = $chip.index() - 1;
|
|
|
|
+ if (index < 0) {
|
|
|
|
+ return;
|
|
|
|
+ }
|
|
|
|
+ $(SELS.CHIP).removeClass('selected');
|
|
|
|
+ self.selectChip(index, $chips);
|
|
|
|
+
|
|
|
|
+ // right
|
|
|
|
+ } else if (e.which === 39) {
|
|
|
|
+ index = $chip.index() + 1;
|
|
|
|
+ $(SELS.CHIP).removeClass('selected');
|
|
|
|
+ if (index > length) {
|
|
|
|
+ $chips.find('input').focus();
|
|
|
|
+ return;
|
|
|
|
+ }
|
|
|
|
+ self.selectChip(index, $chips);
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ self.$document.off('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT, function (e) {
|
|
|
|
+ var $currChips = $(e.target).closest(SELS.CHIPS);
|
|
|
|
+ $currChips.addClass('focus');
|
|
|
|
+ $currChips.siblings('label, .prefix').addClass('active');
|
|
|
|
+ $(SELS.CHIP).removeClass('selected');
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ self.$document.off('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT, function (e) {
|
|
|
|
+ var $currChips = $(e.target).closest(SELS.CHIPS);
|
|
|
|
+ $currChips.removeClass('focus');
|
|
|
|
+
|
|
|
|
+ // Remove active if empty
|
|
|
|
+ if ($currChips.data('chips') === undefined || !$currChips.data('chips').length) {
|
|
|
|
+ $currChips.siblings('label').removeClass('active');
|
|
|
|
+ }
|
|
|
|
+ $currChips.siblings('.prefix').removeClass('active');
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ self.$document.off('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT).on('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT, function (e) {
|
|
|
|
+ var $target = $(e.target);
|
|
|
|
+ var $chips = $target.closest(SELS.CHIPS);
|
|
|
|
+ var chipsLength = $chips.children(SELS.CHIP).length;
|
|
|
|
+
|
|
|
|
+ // enter
|
|
|
|
+ if (13 === e.which) {
|
|
|
|
+ // Override enter if autocompleting.
|
|
|
|
+ if (self.hasAutocomplete && $chips.find('.autocomplete-content.dropdown-content').length && $chips.find('.autocomplete-content.dropdown-content').children().length) {
|
|
|
|
+ return;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ e.preventDefault();
|
|
|
|
+ self.addChip({ tag: $target.val() }, $chips);
|
|
|
|
+ $target.val('');
|
|
|
|
+ return;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // delete or left
|
|
|
|
+ if ((8 === e.keyCode || 37 === e.keyCode) && '' === $target.val() && chipsLength) {
|
|
|
|
+ e.preventDefault();
|
|
|
|
+ self.selectChip(chipsLength - 1, $chips);
|
|
|
|
+ $target.blur();
|
|
|
|
+ return;
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // Click on delete icon in chip.
|
|
|
|
+ self.$document.off('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE).on('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE, function (e) {
|
|
|
|
+ var $target = $(e.target);
|
|
|
|
+ var $chips = $target.closest(SELS.CHIPS);
|
|
|
|
+ var $chip = $target.closest(SELS.CHIP);
|
|
|
|
+ e.stopPropagation();
|
|
|
|
+ self.deleteChip($chip.index(), $chips);
|
|
|
|
+ $chips.find('input').focus();
|
|
|
|
+ });
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ this.chips = function ($chips, chipId) {
|
|
|
|
+ $chips.empty();
|
|
|
|
+ $chips.data('chips').forEach(function (elem) {
|
|
|
|
+ $chips.append(self.renderChip(elem));
|
|
|
|
+ });
|
|
|
|
+ $chips.append($('<input id="' + chipId + '" class="input" placeholder="">'));
|
|
|
|
+ self.setPlaceholder($chips);
|
|
|
|
+
|
|
|
|
+ // Set for attribute for label
|
|
|
|
+ var label = $chips.next('label');
|
|
|
|
+ if (label.length) {
|
|
|
|
+ label.attr('for', chipId);
|
|
|
|
+
|
|
|
|
+ if ($chips.data('chips') !== undefined && $chips.data('chips').length) {
|
|
|
|
+ label.addClass('active');
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Setup autocomplete if needed.
|
|
|
|
+ var input = $('#' + chipId);
|
|
|
|
+ if (self.hasAutocomplete) {
|
|
|
|
+ curr_options.autocompleteOptions.onAutocomplete = function (val) {
|
|
|
|
+ self.addChip({ tag: val }, $chips);
|
|
|
|
+ input.val('');
|
|
|
|
+ input.focus();
|
|
|
|
+ };
|
|
|
|
+ input.autocomplete(curr_options.autocompleteOptions);
|
|
|
|
+ }
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Render chip jQuery element.
|
|
|
|
+ * @param {Object} elem
|
|
|
|
+ * @return {jQuery}
|
|
|
|
+ */
|
|
|
|
+ this.renderChip = function (elem) {
|
|
|
|
+ if (!elem.tag) return;
|
|
|
|
+
|
|
|
|
+ var $renderedChip = $('<div class="chip"></div>');
|
|
|
|
+ $renderedChip.text(elem.tag);
|
|
|
|
+ if (elem.image) {
|
|
|
|
+ $renderedChip.prepend($('<img />').attr('src', elem.image));
|
|
|
|
+ }
|
|
|
|
+ $renderedChip.append($('<i class="material-icons close">close</i>'));
|
|
|
|
+ return $renderedChip;
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ this.setPlaceholder = function ($chips) {
|
|
|
|
+ if ($chips.data('chips') !== undefined && !$chips.data('chips').length && curr_options.placeholder) {
|
|
|
|
+ $chips.find('input').prop('placeholder', curr_options.placeholder);
|
|
|
|
+ } else if (($chips.data('chips') === undefined || !!$chips.data('chips').length) && curr_options.secondaryPlaceholder) {
|
|
|
|
+ $chips.find('input').prop('placeholder', curr_options.secondaryPlaceholder);
|
|
|
|
+ }
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ this.isValid = function ($chips, elem) {
|
|
|
|
+ var chips = $chips.data('chips');
|
|
|
|
+ var exists = false;
|
|
|
|
+ for (var i = 0; i < chips.length; i++) {
|
|
|
|
+ if (chips[i].tag === elem.tag) {
|
|
|
|
+ exists = true;
|
|
|
|
+ return;
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ return '' !== elem.tag && !exists;
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ this.addChip = function (elem, $chips) {
|
|
|
|
+ if (!self.isValid($chips, elem)) {
|
|
|
|
+ return;
|
|
|
|
+ }
|
|
|
|
+ var $renderedChip = self.renderChip(elem);
|
|
|
|
+ var newData = [];
|
|
|
|
+ var oldData = $chips.data('chips');
|
|
|
|
+ for (var i = 0; i < oldData.length; i++) {
|
|
|
|
+ newData.push(oldData[i]);
|
|
|
|
+ }
|
|
|
|
+ newData.push(elem);
|
|
|
|
+
|
|
|
|
+ $chips.data('chips', newData);
|
|
|
|
+ $renderedChip.insertBefore($chips.find('input'));
|
|
|
|
+ $chips.trigger('chip.add', elem);
|
|
|
|
+ self.setPlaceholder($chips);
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ this.deleteChip = function (chipIndex, $chips) {
|
|
|
|
+ var chip = $chips.data('chips')[chipIndex];
|
|
|
|
+ $chips.find('.chip').eq(chipIndex).remove();
|
|
|
|
+
|
|
|
|
+ var newData = [];
|
|
|
|
+ var oldData = $chips.data('chips');
|
|
|
|
+ for (var i = 0; i < oldData.length; i++) {
|
|
|
|
+ if (i !== chipIndex) {
|
|
|
|
+ newData.push(oldData[i]);
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ $chips.data('chips', newData);
|
|
|
|
+ $chips.trigger('chip.delete', chip);
|
|
|
|
+ self.setPlaceholder($chips);
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ this.selectChip = function (chipIndex, $chips) {
|
|
|
|
+ var $chip = $chips.find('.chip').eq(chipIndex);
|
|
|
|
+ if ($chip && false === $chip.hasClass('selected')) {
|
|
|
|
+ $chip.addClass('selected');
|
|
|
|
+ $chips.trigger('chip.select', $chips.data('chips')[chipIndex]);
|
|
|
|
+ }
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ this.getChipsElement = function (index, $chips) {
|
|
|
|
+ return $chips.eq(index);
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ // init
|
|
|
|
+ this.init();
|
|
|
|
+
|
|
|
|
+ this.handleEvents();
|
|
|
|
+ };
|
|
|
|
+})(jQuery);
|
|
|
|
+;(function ($) {
|
|
|
|
+ $.fn.pushpin = function (options) {
|
|
|
|
+ // Defaults
|
|
|
|
+ var defaults = {
|
|
|
|
+ top: 0,
|
|
|
|
+ bottom: Infinity,
|
|
|
|
+ offset: 0
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ // Remove pushpin event and classes
|
|
|
|
+ if (options === "remove") {
|
|
|
|
+ this.each(function () {
|
|
|
|
+ if (id = $(this).data('pushpin-id')) {
|
|
|
|
+ $(window).off('scroll.' + id);
|
|
|
|
+ $(this).removeData('pushpin-id').removeClass('pin-top pinned pin-bottom').removeAttr('style');
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ return false;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ options = $.extend(defaults, options);
|
|
|
|
+
|
|
|
|
+ $index = 0;
|
|
|
|
+ return this.each(function () {
|
|
|
|
+ var $uniqueId = Materialize.guid(),
|
|
|
|
+ $this = $(this),
|
|
|
|
+ $original_offset = $(this).offset().top;
|
|
|
|
+
|
|
|
|
+ function removePinClasses(object) {
|
|
|
|
+ object.removeClass('pin-top');
|
|
|
|
+ object.removeClass('pinned');
|
|
|
|
+ object.removeClass('pin-bottom');
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ function updateElements(objects, scrolled) {
|
|
|
|
+ objects.each(function () {
|
|
|
|
+ // Add position fixed (because its between top and bottom)
|
|
|
|
+ if (options.top <= scrolled && options.bottom >= scrolled && !$(this).hasClass('pinned')) {
|
|
|
|
+ removePinClasses($(this));
|
|
|
|
+ $(this).css('top', options.offset);
|
|
|
|
+ $(this).addClass('pinned');
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Add pin-top (when scrolled position is above top)
|
|
|
|
+ if (scrolled < options.top && !$(this).hasClass('pin-top')) {
|
|
|
|
+ removePinClasses($(this));
|
|
|
|
+ $(this).css('top', 0);
|
|
|
|
+ $(this).addClass('pin-top');
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Add pin-bottom (when scrolled position is below bottom)
|
|
|
|
+ if (scrolled > options.bottom && !$(this).hasClass('pin-bottom')) {
|
|
|
|
+ removePinClasses($(this));
|
|
|
|
+ $(this).addClass('pin-bottom');
|
|
|
|
+ $(this).css('top', options.bottom - $original_offset);
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ $(this).data('pushpin-id', $uniqueId);
|
|
|
|
+ updateElements($this, $(window).scrollTop());
|
|
|
|
+ $(window).on('scroll.' + $uniqueId, function () {
|
|
|
|
+ var $scrolled = $(window).scrollTop() + options.offset;
|
|
|
|
+ updateElements($this, $scrolled);
|
|
|
|
+ });
|
|
|
|
+ });
|
|
|
|
+ };
|
|
|
|
+})(jQuery);;(function ($) {
|
|
|
|
+ $(document).ready(function () {
|
|
|
|
+
|
|
|
|
+ // jQuery reverse
|
|
|
|
+ $.fn.reverse = [].reverse;
|
|
|
|
+
|
|
|
|
+ // Hover behaviour: make sure this doesn't work on .click-to-toggle FABs!
|
|
|
|
+ $(document).on('mouseenter.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function (e) {
|
|
|
|
+ var $this = $(this);
|
|
|
|
+ openFABMenu($this);
|
|
|
|
+ });
|
|
|
|
+ $(document).on('mouseleave.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function (e) {
|
|
|
|
+ var $this = $(this);
|
|
|
|
+ closeFABMenu($this);
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // Toggle-on-click behaviour.
|
|
|
|
+ $(document).on('click.fabClickToggle', '.fixed-action-btn.click-to-toggle > a', function (e) {
|
|
|
|
+ var $this = $(this);
|
|
|
|
+ var $menu = $this.parent();
|
|
|
|
+ if ($menu.hasClass('active')) {
|
|
|
|
+ closeFABMenu($menu);
|
|
|
|
+ } else {
|
|
|
|
+ openFABMenu($menu);
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // Toolbar transition behaviour.
|
|
|
|
+ $(document).on('click.fabToolbar', '.fixed-action-btn.toolbar > a', function (e) {
|
|
|
|
+ var $this = $(this);
|
|
|
|
+ var $menu = $this.parent();
|
|
|
|
+ FABtoToolbar($menu);
|
|
|
|
+ });
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ $.fn.extend({
|
|
|
|
+ openFAB: function () {
|
|
|
|
+ openFABMenu($(this));
|
|
|
|
+ },
|
|
|
|
+ closeFAB: function () {
|
|
|
|
+ closeFABMenu($(this));
|
|
|
|
+ },
|
|
|
|
+ openToolbar: function () {
|
|
|
|
+ FABtoToolbar($(this));
|
|
|
|
+ },
|
|
|
|
+ closeToolbar: function () {
|
|
|
|
+ toolbarToFAB($(this));
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ var openFABMenu = function (btn) {
|
|
|
|
+ var $this = btn;
|
|
|
|
+ if ($this.hasClass('active') === false) {
|
|
|
|
+
|
|
|
|
+ // Get direction option
|
|
|
|
+ var horizontal = $this.hasClass('horizontal');
|
|
|
|
+ var offsetY, offsetX;
|
|
|
|
+
|
|
|
|
+ if (horizontal === true) {
|
|
|
|
+ offsetX = 40;
|
|
|
|
+ } else {
|
|
|
|
+ offsetY = 40;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ $this.addClass('active');
|
|
|
|
+ $this.find('ul .btn-floating').velocity({ scaleY: ".4", scaleX: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px' }, { duration: 0 });
|
|
|
|
+
|
|
|
|
+ var time = 0;
|
|
|
|
+ $this.find('ul .btn-floating').reverse().each(function () {
|
|
|
|
+ $(this).velocity({ opacity: "1", scaleX: "1", scaleY: "1", translateY: "0", translateX: '0' }, { duration: 80, delay: time });
|
|
|
|
+ time += 40;
|
|
|
|
+ });
|
|
|
|
+ }
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ var closeFABMenu = function (btn) {
|
|
|
|
+ var $this = btn;
|
|
|
|
+ // Get direction option
|
|
|
|
+ var horizontal = $this.hasClass('horizontal');
|
|
|
|
+ var offsetY, offsetX;
|
|
|
|
+
|
|
|
|
+ if (horizontal === true) {
|
|
|
|
+ offsetX = 40;
|
|
|
|
+ } else {
|
|
|
|
+ offsetY = 40;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ $this.removeClass('active');
|
|
|
|
+ var time = 0;
|
|
|
|
+ $this.find('ul .btn-floating').velocity("stop", true);
|
|
|
|
+ $this.find('ul .btn-floating').velocity({ opacity: "0", scaleX: ".4", scaleY: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px' }, { duration: 80 });
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Transform FAB into toolbar
|
|
|
|
+ * @param {Object} object jQuery object
|
|
|
|
+ */
|
|
|
|
+ var FABtoToolbar = function (btn) {
|
|
|
|
+ if (btn.attr('data-open') === "true") {
|
|
|
|
+ return;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ var offsetX, offsetY, scaleFactor;
|
|
|
|
+ var windowWidth = window.innerWidth;
|
|
|
|
+ var windowHeight = window.innerHeight;
|
|
|
|
+ var btnRect = btn[0].getBoundingClientRect();
|
|
|
|
+ var anchor = btn.find('> a').first();
|
|
|
|
+ var menu = btn.find('> ul').first();
|
|
|
|
+ var backdrop = $('<div class="fab-backdrop"></div>');
|
|
|
|
+ var fabColor = anchor.css('background-color');
|
|
|
|
+ anchor.append(backdrop);
|
|
|
|
+
|
|
|
|
+ offsetX = btnRect.left - windowWidth / 2 + btnRect.width / 2;
|
|
|
|
+ offsetY = windowHeight - btnRect.bottom;
|
|
|
|
+ scaleFactor = windowWidth / backdrop.width();
|
|
|
|
+ btn.attr('data-origin-bottom', btnRect.bottom);
|
|
|
|
+ btn.attr('data-origin-left', btnRect.left);
|
|
|
|
+ btn.attr('data-origin-width', btnRect.width);
|
|
|
|
+
|
|
|
|
+ // Set initial state
|
|
|
|
+ btn.addClass('active');
|
|
|
|
+ btn.attr('data-open', true);
|
|
|
|
+ btn.css({
|
|
|
|
+ 'text-align': 'center',
|
|
|
|
+ width: '100%',
|
|
|
|
+ bottom: 0,
|
|
|
|
+ left: 0,
|
|
|
|
+ transform: 'translateX(' + offsetX + 'px)',
|
|
|
|
+ transition: 'none'
|
|
|
|
+ });
|
|
|
|
+ anchor.css({
|
|
|
|
+ transform: 'translateY(' + -offsetY + 'px)',
|
|
|
|
+ transition: 'none'
|
|
|
|
+ });
|
|
|
|
+ backdrop.css({
|
|
|
|
+ 'background-color': fabColor
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ setTimeout(function () {
|
|
|
|
+ btn.css({
|
|
|
|
+ transform: '',
|
|
|
|
+ transition: 'transform .2s cubic-bezier(0.550, 0.085, 0.680, 0.530), background-color 0s linear .2s'
|
|
|
|
+ });
|
|
|
|
+ anchor.css({
|
|
|
|
+ overflow: 'visible',
|
|
|
|
+ transform: '',
|
|
|
|
+ transition: 'transform .2s'
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ setTimeout(function () {
|
|
|
|
+ btn.css({
|
|
|
|
+ overflow: 'hidden',
|
|
|
|
+ 'background-color': fabColor
|
|
|
|
+ });
|
|
|
|
+ backdrop.css({
|
|
|
|
+ transform: 'scale(' + scaleFactor + ')',
|
|
|
|
+ transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)'
|
|
|
|
+ });
|
|
|
|
+ menu.find('> li > a').css({
|
|
|
|
+ opacity: 1
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // Scroll to close.
|
|
|
|
+ $(window).on('scroll.fabToolbarClose', function () {
|
|
|
|
+ toolbarToFAB(btn);
|
|
|
|
+ $(window).off('scroll.fabToolbarClose');
|
|
|
|
+ $(document).off('click.fabToolbarClose');
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ $(document).on('click.fabToolbarClose', function (e) {
|
|
|
|
+ if (!$(e.target).closest(menu).length) {
|
|
|
|
+ toolbarToFAB(btn);
|
|
|
|
+ $(window).off('scroll.fabToolbarClose');
|
|
|
|
+ $(document).off('click.fabToolbarClose');
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ }, 100);
|
|
|
|
+ }, 0);
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Transform toolbar back into FAB
|
|
|
|
+ * @param {Object} object jQuery object
|
|
|
|
+ */
|
|
|
|
+ var toolbarToFAB = function (btn) {
|
|
|
|
+ if (btn.attr('data-open') !== "true") {
|
|
|
|
+ return;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ var offsetX, offsetY, scaleFactor;
|
|
|
|
+ var windowWidth = window.innerWidth;
|
|
|
|
+ var windowHeight = window.innerHeight;
|
|
|
|
+ var btnWidth = btn.attr('data-origin-width');
|
|
|
|
+ var btnBottom = btn.attr('data-origin-bottom');
|
|
|
|
+ var btnLeft = btn.attr('data-origin-left');
|
|
|
|
+ var anchor = btn.find('> .btn-floating').first();
|
|
|
|
+ var menu = btn.find('> ul').first();
|
|
|
|
+ var backdrop = btn.find('.fab-backdrop');
|
|
|
|
+ var fabColor = anchor.css('background-color');
|
|
|
|
+
|
|
|
|
+ offsetX = btnLeft - windowWidth / 2 + btnWidth / 2;
|
|
|
|
+ offsetY = windowHeight - btnBottom;
|
|
|
|
+ scaleFactor = windowWidth / backdrop.width();
|
|
|
|
+
|
|
|
|
+ // Hide backdrop
|
|
|
|
+ btn.removeClass('active');
|
|
|
|
+ btn.attr('data-open', false);
|
|
|
|
+ btn.css({
|
|
|
|
+ 'background-color': 'transparent',
|
|
|
|
+ transition: 'none'
|
|
|
|
+ });
|
|
|
|
+ anchor.css({
|
|
|
|
+ transition: 'none'
|
|
|
|
+ });
|
|
|
|
+ backdrop.css({
|
|
|
|
+ transform: 'scale(0)',
|
|
|
|
+ 'background-color': fabColor
|
|
|
|
+ });
|
|
|
|
+ menu.find('> li > a').css({
|
|
|
|
+ opacity: ''
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ setTimeout(function () {
|
|
|
|
+ backdrop.remove();
|
|
|
|
+
|
|
|
|
+ // Set initial state.
|
|
|
|
+ btn.css({
|
|
|
|
+ 'text-align': '',
|
|
|
|
+ width: '',
|
|
|
|
+ bottom: '',
|
|
|
|
+ left: '',
|
|
|
|
+ overflow: '',
|
|
|
|
+ 'background-color': '',
|
|
|
|
+ transform: 'translate3d(' + -offsetX + 'px,0,0)'
|
|
|
|
+ });
|
|
|
|
+ anchor.css({
|
|
|
|
+ overflow: '',
|
|
|
|
+ transform: 'translate3d(0,' + offsetY + 'px,0)'
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ setTimeout(function () {
|
|
|
|
+ btn.css({
|
|
|
|
+ transform: 'translate3d(0,0,0)',
|
|
|
|
+ transition: 'transform .2s'
|
|
|
|
+ });
|
|
|
|
+ anchor.css({
|
|
|
|
+ transform: 'translate3d(0,0,0)',
|
|
|
|
+ transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)'
|
|
|
|
+ });
|
|
|
|
+ }, 20);
|
|
|
|
+ }, 200);
|
|
|
|
+ };
|
|
|
|
+})(jQuery);
|
|
|
|
+;(function ($) {
|
|
|
|
+ // Image transition function
|
|
|
|
+ Materialize.fadeInImage = function (selectorOrEl) {
|
|
|
|
+ var element;
|
|
|
|
+ if (typeof selectorOrEl === 'string') {
|
|
|
|
+ element = $(selectorOrEl);
|
|
|
|
+ } else if (typeof selectorOrEl === 'object') {
|
|
|
|
+ element = selectorOrEl;
|
|
|
|
+ } else {
|
|
|
|
+ return;
|
|
|
|
+ }
|
|
|
|
+ element.css({ opacity: 0 });
|
|
|
|
+ $(element).velocity({ opacity: 1 }, {
|
|
|
|
+ duration: 650,
|
|
|
|
+ queue: false,
|
|
|
|
+ easing: 'easeOutSine'
|
|
|
|
+ });
|
|
|
|
+ $(element).velocity({ opacity: 1 }, {
|
|
|
|
+ duration: 1300,
|
|
|
|
+ queue: false,
|
|
|
|
+ easing: 'swing',
|
|
|
|
+ step: function (now, fx) {
|
|
|
|
+ fx.start = 100;
|
|
|
|
+ var grayscale_setting = now / 100;
|
|
|
|
+ var brightness_setting = 150 - (100 - now) / 1.75;
|
|
|
|
+
|
|
|
|
+ if (brightness_setting < 100) {
|
|
|
|
+ brightness_setting = 100;
|
|
|
|
+ }
|
|
|
|
+ if (now >= 0) {
|
|
|
|
+ $(this).css({
|
|
|
|
+ "-webkit-filter": "grayscale(" + grayscale_setting + ")" + "brightness(" + brightness_setting + "%)",
|
|
|
|
+ "filter": "grayscale(" + grayscale_setting + ")" + "brightness(" + brightness_setting + "%)"
|
|
|
|
+ });
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ // Horizontal staggered list
|
|
|
|
+ Materialize.showStaggeredList = function (selectorOrEl) {
|
|
|
|
+ var element;
|
|
|
|
+ if (typeof selectorOrEl === 'string') {
|
|
|
|
+ element = $(selectorOrEl);
|
|
|
|
+ } else if (typeof selectorOrEl === 'object') {
|
|
|
|
+ element = selectorOrEl;
|
|
|
|
+ } else {
|
|
|
|
+ return;
|
|
|
|
+ }
|
|
|
|
+ var time = 0;
|
|
|
|
+ element.find('li').velocity({ translateX: "-100px" }, { duration: 0 });
|
|
|
|
+
|
|
|
|
+ element.find('li').each(function () {
|
|
|
|
+ $(this).velocity({ opacity: "1", translateX: "0" }, { duration: 800, delay: time, easing: [60, 10] });
|
|
|
|
+ time += 120;
|
|
|
|
+ });
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ $(document).ready(function () {
|
|
|
|
+ // Hardcoded .staggered-list scrollFire
|
|
|
|
+ // var staggeredListOptions = [];
|
|
|
|
+ // $('ul.staggered-list').each(function (i) {
|
|
|
|
+
|
|
|
|
+ // var label = 'scrollFire-' + i;
|
|
|
|
+ // $(this).addClass(label);
|
|
|
|
+ // staggeredListOptions.push(
|
|
|
|
+ // {selector: 'ul.staggered-list.' + label,
|
|
|
|
+ // offset: 200,
|
|
|
|
+ // callback: 'showStaggeredList("ul.staggered-list.' + label + '")'});
|
|
|
|
+ // });
|
|
|
|
+ // scrollFire(staggeredListOptions);
|
|
|
|
+
|
|
|
|
+ // HammerJS, Swipe navigation
|
|
|
|
+
|
|
|
|
+ // Touch Event
|
|
|
|
+ var swipeLeft = false;
|
|
|
|
+ var swipeRight = false;
|
|
|
|
+
|
|
|
|
+ // Dismissible Collections
|
|
|
|
+ $('.dismissable').each(function () {
|
|
|
|
+ $(this).hammer({
|
|
|
|
+ prevent_default: false
|
|
|
|
+ }).on('pan', function (e) {
|
|
|
|
+ if (e.gesture.pointerType === "touch") {
|
|
|
|
+ var $this = $(this);
|
|
|
|
+ var direction = e.gesture.direction;
|
|
|
|
+ var x = e.gesture.deltaX;
|
|
|
|
+ var velocityX = e.gesture.velocityX;
|
|
|
|
+
|
|
|
|
+ $this.velocity({ translateX: x
|
|
|
|
+ }, { duration: 50, queue: false, easing: 'easeOutQuad' });
|
|
|
|
+
|
|
|
|
+ // Swipe Left
|
|
|
|
+ if (direction === 4 && (x > $this.innerWidth() / 2 || velocityX < -0.75)) {
|
|
|
|
+ swipeLeft = true;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Swipe Right
|
|
|
|
+ if (direction === 2 && (x < -1 * $this.innerWidth() / 2 || velocityX > 0.75)) {
|
|
|
|
+ swipeRight = true;
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ }).on('panend', function (e) {
|
|
|
|
+ // Reset if collection is moved back into original position
|
|
|
|
+ if (Math.abs(e.gesture.deltaX) < $(this).innerWidth() / 2) {
|
|
|
|
+ swipeRight = false;
|
|
|
|
+ swipeLeft = false;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ if (e.gesture.pointerType === "touch") {
|
|
|
|
+ var $this = $(this);
|
|
|
|
+ if (swipeLeft || swipeRight) {
|
|
|
|
+ var fullWidth;
|
|
|
|
+ if (swipeLeft) {
|
|
|
|
+ fullWidth = $this.innerWidth();
|
|
|
|
+ } else {
|
|
|
|
+ fullWidth = -1 * $this.innerWidth();
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ $this.velocity({ translateX: fullWidth
|
|
|
|
+ }, { duration: 100, queue: false, easing: 'easeOutQuad', complete: function () {
|
|
|
|
+ $this.css('border', 'none');
|
|
|
|
+ $this.velocity({ height: 0, padding: 0
|
|
|
|
+ }, { duration: 200, queue: false, easing: 'easeOutQuad', complete: function () {
|
|
|
|
+ $this.remove();
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ } else {
|
|
|
|
+ $this.velocity({ translateX: 0
|
|
|
|
+ }, { duration: 100, queue: false, easing: 'easeOutQuad' });
|
|
|
|
+ }
|
|
|
|
+ swipeLeft = false;
|
|
|
|
+ swipeRight = false;
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // time = 0
|
|
|
|
+ // // Vertical Staggered list
|
|
|
|
+ // $('ul.staggered-list.vertical li').velocity(
|
|
|
|
+ // { translateY: "100px"},
|
|
|
|
+ // { duration: 0 });
|
|
|
|
+
|
|
|
|
+ // $('ul.staggered-list.vertical li').each(function() {
|
|
|
|
+ // $(this).velocity(
|
|
|
|
+ // { opacity: "1", translateY: "0"},
|
|
|
|
+ // { duration: 800, delay: time, easing: [60, 25] });
|
|
|
|
+ // time += 120;
|
|
|
|
+ // });
|
|
|
|
+
|
|
|
|
+ // // Fade in and Scale
|
|
|
|
+ // $('.fade-in.scale').velocity(
|
|
|
|
+ // { scaleX: .4, scaleY: .4, translateX: -600},
|
|
|
|
+ // { duration: 0});
|
|
|
|
+ // $('.fade-in').each(function() {
|
|
|
|
+ // $(this).velocity(
|
|
|
|
+ // { opacity: "1", scaleX: 1, scaleY: 1, translateX: 0},
|
|
|
|
+ // { duration: 800, easing: [60, 10] });
|
|
|
|
+ // });
|
|
|
|
+ });
|
|
|
|
+})(jQuery);
|
|
|
|
+;(function ($) {
|
|
|
|
+
|
|
|
|
+ var scrollFireEventsHandled = false;
|
|
|
|
+
|
|
|
|
+ // Input: Array of JSON objects {selector, offset, callback}
|
|
|
|
+ Materialize.scrollFire = function (options) {
|
|
|
|
+ var onScroll = function () {
|
|
|
|
+ var windowScroll = window.pageYOffset + window.innerHeight;
|
|
|
|
+
|
|
|
|
+ for (var i = 0; i < options.length; i++) {
|
|
|
|
+ // Get options from each line
|
|
|
|
+ var value = options[i];
|
|
|
|
+ var selector = value.selector,
|
|
|
|
+ offset = value.offset,
|
|
|
|
+ callback = value.callback;
|
|
|
|
+
|
|
|
|
+ var currentElement = document.querySelector(selector);
|
|
|
|
+ if (currentElement !== null) {
|
|
|
|
+ var elementOffset = currentElement.getBoundingClientRect().top + window.pageYOffset;
|
|
|
|
+
|
|
|
|
+ if (windowScroll > elementOffset + offset) {
|
|
|
|
+ if (value.done !== true) {
|
|
|
|
+ if (typeof callback === 'function') {
|
|
|
|
+ callback.call(this, currentElement);
|
|
|
|
+ } else if (typeof callback === 'string') {
|
|
|
|
+ var callbackFunc = new Function(callback);
|
|
|
|
+ callbackFunc(currentElement);
|
|
|
|
+ }
|
|
|
|
+ value.done = true;
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ var throttledScroll = Materialize.throttle(function () {
|
|
|
|
+ onScroll();
|
|
|
|
+ }, options.throttle || 100);
|
|
|
|
+
|
|
|
|
+ if (!scrollFireEventsHandled) {
|
|
|
|
+ window.addEventListener("scroll", throttledScroll);
|
|
|
|
+ window.addEventListener("resize", throttledScroll);
|
|
|
|
+ scrollFireEventsHandled = true;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // perform a scan once, after current execution context, and after dom is ready
|
|
|
|
+ setTimeout(throttledScroll, 0);
|
|
|
|
+ };
|
|
|
|
+})(jQuery);
|
|
|
|
+; /*!
|
|
|
|
+ * pickadate.js v3.5.0, 2014/04/13
|
|
|
|
+ * By Amsul, http://amsul.ca
|
|
|
|
+ * Hosted on http://amsul.github.io/pickadate.js
|
|
|
|
+ * Licensed under MIT
|
|
|
|
+ */
|
|
|
|
+
|
|
|
|
+(function (factory) {
|
|
|
|
+
|
|
|
|
+ Materialize.Picker = factory(jQuery);
|
|
|
|
+})(function ($) {
|
|
|
|
+
|
|
|
|
+ var $window = $(window);
|
|
|
|
+ var $document = $(document);
|
|
|
|
+ var $html = $(document.documentElement);
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * The picker constructor that creates a blank picker.
|
|
|
|
+ */
|
|
|
|
+ function PickerConstructor(ELEMENT, NAME, COMPONENT, OPTIONS) {
|
|
|
|
+
|
|
|
|
+ // If there’s no element, return the picker constructor.
|
|
|
|
+ if (!ELEMENT) return PickerConstructor;
|
|
|
|
+
|
|
|
|
+ var IS_DEFAULT_THEME = false,
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ // The state of the picker.
|
|
|
|
+ STATE = {
|
|
|
|
+ id: ELEMENT.id || 'P' + Math.abs(~~(Math.random() * new Date()))
|
|
|
|
+ },
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ // Merge the defaults and options passed.
|
|
|
|
+ SETTINGS = COMPONENT ? $.extend(true, {}, COMPONENT.defaults, OPTIONS) : OPTIONS || {},
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ // Merge the default classes with the settings classes.
|
|
|
|
+ CLASSES = $.extend({}, PickerConstructor.klasses(), SETTINGS.klass),
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ // The element node wrapper into a jQuery object.
|
|
|
|
+ $ELEMENT = $(ELEMENT),
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ // Pseudo picker constructor.
|
|
|
|
+ PickerInstance = function () {
|
|
|
|
+ return this.start();
|
|
|
|
+ },
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ // The picker prototype.
|
|
|
|
+ P = PickerInstance.prototype = {
|
|
|
|
+
|
|
|
|
+ constructor: PickerInstance,
|
|
|
|
+
|
|
|
|
+ $node: $ELEMENT,
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Initialize everything
|
|
|
|
+ */
|
|
|
|
+ start: function () {
|
|
|
|
+
|
|
|
|
+ // If it’s already started, do nothing.
|
|
|
|
+ if (STATE && STATE.start) return P;
|
|
|
|
+
|
|
|
|
+ // Update the picker states.
|
|
|
|
+ STATE.methods = {};
|
|
|
|
+ STATE.start = true;
|
|
|
|
+ STATE.open = false;
|
|
|
|
+ STATE.type = ELEMENT.type;
|
|
|
|
+
|
|
|
|
+ // Confirm focus state, convert into text input to remove UA stylings,
|
|
|
|
+ // and set as readonly to prevent keyboard popup.
|
|
|
|
+ ELEMENT.autofocus = ELEMENT == getActiveElement();
|
|
|
|
+ ELEMENT.readOnly = !SETTINGS.editable;
|
|
|
|
+ ELEMENT.id = ELEMENT.id || STATE.id;
|
|
|
|
+ if (ELEMENT.type != 'text') {
|
|
|
|
+ ELEMENT.type = 'text';
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Create a new picker component with the settings.
|
|
|
|
+ P.component = new COMPONENT(P, SETTINGS);
|
|
|
|
+
|
|
|
|
+ // Create the picker root with a holder and then prepare it.
|
|
|
|
+ P.$root = $(PickerConstructor._.node('div', createWrappedComponent(), CLASSES.picker, 'id="' + ELEMENT.id + '_root" tabindex="0"'));
|
|
|
|
+ prepareElementRoot();
|
|
|
|
+
|
|
|
|
+ // If there’s a format for the hidden input element, create the element.
|
|
|
|
+ if (SETTINGS.formatSubmit) {
|
|
|
|
+ prepareElementHidden();
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Prepare the input element.
|
|
|
|
+ prepareElement();
|
|
|
|
+
|
|
|
|
+ // Insert the root as specified in the settings.
|
|
|
|
+ if (SETTINGS.container) $(SETTINGS.container).append(P.$root);else $ELEMENT.before(P.$root);
|
|
|
|
+
|
|
|
|
+ // Bind the default component and settings events.
|
|
|
|
+ P.on({
|
|
|
|
+ start: P.component.onStart,
|
|
|
|
+ render: P.component.onRender,
|
|
|
|
+ stop: P.component.onStop,
|
|
|
|
+ open: P.component.onOpen,
|
|
|
|
+ close: P.component.onClose,
|
|
|
|
+ set: P.component.onSet
|
|
|
|
+ }).on({
|
|
|
|
+ start: SETTINGS.onStart,
|
|
|
|
+ render: SETTINGS.onRender,
|
|
|
|
+ stop: SETTINGS.onStop,
|
|
|
|
+ open: SETTINGS.onOpen,
|
|
|
|
+ close: SETTINGS.onClose,
|
|
|
|
+ set: SETTINGS.onSet
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // Once we’re all set, check the theme in use.
|
|
|
|
+ IS_DEFAULT_THEME = isUsingDefaultTheme(P.$root.children()[0]);
|
|
|
|
+
|
|
|
|
+ // If the element has autofocus, open the picker.
|
|
|
|
+ if (ELEMENT.autofocus) {
|
|
|
|
+ P.open();
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Trigger queued the “start” and “render” events.
|
|
|
|
+ return P.trigger('start').trigger('render');
|
|
|
|
+ }, //start
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Render a new picker
|
|
|
|
+ */
|
|
|
|
+ render: function (entireComponent) {
|
|
|
|
+
|
|
|
|
+ // Insert a new component holder in the root or box.
|
|
|
|
+ if (entireComponent) P.$root.html(createWrappedComponent());else P.$root.find('.' + CLASSES.box).html(P.component.nodes(STATE.open));
|
|
|
|
+
|
|
|
|
+ // Trigger the queued “render” events.
|
|
|
|
+ return P.trigger('render');
|
|
|
|
+ }, //render
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Destroy everything
|
|
|
|
+ */
|
|
|
|
+ stop: function () {
|
|
|
|
+
|
|
|
|
+ // If it’s already stopped, do nothing.
|
|
|
|
+ if (!STATE.start) return P;
|
|
|
|
+
|
|
|
|
+ // Then close the picker.
|
|
|
|
+ P.close();
|
|
|
|
+
|
|
|
|
+ // Remove the hidden field.
|
|
|
|
+ if (P._hidden) {
|
|
|
|
+ P._hidden.parentNode.removeChild(P._hidden);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Remove the root.
|
|
|
|
+ P.$root.remove();
|
|
|
|
+
|
|
|
|
+ // Remove the input class, remove the stored data, and unbind
|
|
|
|
+ // the events (after a tick for IE - see `P.close`).
|
|
|
|
+ $ELEMENT.removeClass(CLASSES.input).removeData(NAME);
|
|
|
|
+ setTimeout(function () {
|
|
|
|
+ $ELEMENT.off('.' + STATE.id);
|
|
|
|
+ }, 0);
|
|
|
|
+
|
|
|
|
+ // Restore the element state
|
|
|
|
+ ELEMENT.type = STATE.type;
|
|
|
|
+ ELEMENT.readOnly = false;
|
|
|
|
+
|
|
|
|
+ // Trigger the queued “stop” events.
|
|
|
|
+ P.trigger('stop');
|
|
|
|
+
|
|
|
|
+ // Reset the picker states.
|
|
|
|
+ STATE.methods = {};
|
|
|
|
+ STATE.start = false;
|
|
|
|
+
|
|
|
|
+ return P;
|
|
|
|
+ }, //stop
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Open up the picker
|
|
|
|
+ */
|
|
|
|
+ open: function (dontGiveFocus) {
|
|
|
|
+
|
|
|
|
+ // If it’s already open, do nothing.
|
|
|
|
+ if (STATE.open) return P;
|
|
|
|
+
|
|
|
|
+ // Add the “active” class.
|
|
|
|
+ $ELEMENT.addClass(CLASSES.active);
|
|
|
|
+ aria(ELEMENT, 'expanded', true);
|
|
|
|
+
|
|
|
|
+ // * A Firefox bug, when `html` has `overflow:hidden`, results in
|
|
|
|
+ // killing transitions :(. So add the “opened” state on the next tick.
|
|
|
|
+ // Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289
|
|
|
|
+ setTimeout(function () {
|
|
|
|
+
|
|
|
|
+ // Add the “opened” class to the picker root.
|
|
|
|
+ P.$root.addClass(CLASSES.opened);
|
|
|
|
+ aria(P.$root[0], 'hidden', false);
|
|
|
|
+ }, 0);
|
|
|
|
+
|
|
|
|
+ // If we have to give focus, bind the element and doc events.
|
|
|
|
+ if (dontGiveFocus !== false) {
|
|
|
|
+
|
|
|
|
+ // Set it as open.
|
|
|
|
+ STATE.open = true;
|
|
|
|
+
|
|
|
|
+ // Prevent the page from scrolling.
|
|
|
|
+ if (IS_DEFAULT_THEME) {
|
|
|
|
+ $html.css('overflow', 'hidden').css('padding-right', '+=' + getScrollbarWidth());
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Pass focus to the root element’s jQuery object.
|
|
|
|
+ // * Workaround for iOS8 to bring the picker’s root into view.
|
|
|
|
+ P.$root.eq(0).focus();
|
|
|
|
+
|
|
|
|
+ // Bind the document events.
|
|
|
|
+ $document.on('click.' + STATE.id + ' focusin.' + STATE.id, function (event) {
|
|
|
|
+
|
|
|
|
+ var target = event.target;
|
|
|
|
+
|
|
|
|
+ // If the target of the event is not the element, close the picker picker.
|
|
|
|
+ // * Don’t worry about clicks or focusins on the root because those don’t bubble up.
|
|
|
|
+ // Also, for Firefox, a click on an `option` element bubbles up directly
|
|
|
|
+ // to the doc. So make sure the target wasn't the doc.
|
|
|
|
+ // * In Firefox stopPropagation() doesn’t prevent right-click events from bubbling,
|
|
|
|
+ // which causes the picker to unexpectedly close when right-clicking it. So make
|
|
|
|
+ // sure the event wasn’t a right-click.
|
|
|
|
+ if (target != ELEMENT && target != document && event.which != 3) {
|
|
|
|
+
|
|
|
|
+ // If the target was the holder that covers the screen,
|
|
|
|
+ // keep the element focused to maintain tabindex.
|
|
|
|
+ P.close(target === P.$root.children()[0]);
|
|
|
|
+ }
|
|
|
|
+ }).on('keydown.' + STATE.id, function (event) {
|
|
|
|
+
|
|
|
|
+ var
|
|
|
|
+ // Get the keycode.
|
|
|
|
+ keycode = event.keyCode,
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ // Translate that to a selection change.
|
|
|
|
+ keycodeToMove = P.component.key[keycode],
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ // Grab the target.
|
|
|
|
+ target = event.target;
|
|
|
|
+
|
|
|
|
+ // On escape, close the picker and give focus.
|
|
|
|
+ if (keycode == 27) {
|
|
|
|
+ P.close(true);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Check if there is a key movement or “enter” keypress on the element.
|
|
|
|
+ else if (target == P.$root[0] && (keycodeToMove || keycode == 13)) {
|
|
|
|
+
|
|
|
|
+ // Prevent the default action to stop page movement.
|
|
|
|
+ event.preventDefault();
|
|
|
|
+
|
|
|
|
+ // Trigger the key movement action.
|
|
|
|
+ if (keycodeToMove) {
|
|
|
|
+ PickerConstructor._.trigger(P.component.key.go, P, [PickerConstructor._.trigger(keycodeToMove)]);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // On “enter”, if the highlighted item isn’t disabled, set the value and close.
|
|
|
|
+ else if (!P.$root.find('.' + CLASSES.highlighted).hasClass(CLASSES.disabled)) {
|
|
|
|
+ P.set('select', P.component.item.highlight);
|
|
|
|
+ if (SETTINGS.closeOnSelect) {
|
|
|
|
+ P.close(true);
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // If the target is within the root and “enter” is pressed,
|
|
|
|
+ // prevent the default action and trigger a click on the target instead.
|
|
|
|
+ else if ($.contains(P.$root[0], target) && keycode == 13) {
|
|
|
|
+ event.preventDefault();
|
|
|
|
+ target.click();
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Trigger the queued “open” events.
|
|
|
|
+ return P.trigger('open');
|
|
|
|
+ }, //open
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Close the picker
|
|
|
|
+ */
|
|
|
|
+ close: function (giveFocus) {
|
|
|
|
+
|
|
|
|
+ // If we need to give focus, do it before changing states.
|
|
|
|
+ if (giveFocus) {
|
|
|
|
+ // ....ah yes! It would’ve been incomplete without a crazy workaround for IE :|
|
|
|
|
+ // The focus is triggered *after* the close has completed - causing it
|
|
|
|
+ // to open again. So unbind and rebind the event at the next tick.
|
|
|
|
+ P.$root.off('focus.toOpen').eq(0).focus();
|
|
|
|
+ setTimeout(function () {
|
|
|
|
+ P.$root.on('focus.toOpen', handleFocusToOpenEvent);
|
|
|
|
+ }, 0);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Remove the “active” class.
|
|
|
|
+ $ELEMENT.removeClass(CLASSES.active);
|
|
|
|
+ aria(ELEMENT, 'expanded', false);
|
|
|
|
+
|
|
|
|
+ // * A Firefox bug, when `html` has `overflow:hidden`, results in
|
|
|
|
+ // killing transitions :(. So remove the “opened” state on the next tick.
|
|
|
|
+ // Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289
|
|
|
|
+ setTimeout(function () {
|
|
|
|
+
|
|
|
|
+ // Remove the “opened” and “focused” class from the picker root.
|
|
|
|
+ P.$root.removeClass(CLASSES.opened + ' ' + CLASSES.focused);
|
|
|
|
+ aria(P.$root[0], 'hidden', true);
|
|
|
|
+ }, 0);
|
|
|
|
+
|
|
|
|
+ // If it’s already closed, do nothing more.
|
|
|
|
+ if (!STATE.open) return P;
|
|
|
|
+
|
|
|
|
+ // Set it as closed.
|
|
|
|
+ STATE.open = false;
|
|
|
|
+
|
|
|
|
+ // Allow the page to scroll.
|
|
|
|
+ if (IS_DEFAULT_THEME) {
|
|
|
|
+ $html.css('overflow', '').css('padding-right', '-=' + getScrollbarWidth());
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Unbind the document events.
|
|
|
|
+ $document.off('.' + STATE.id);
|
|
|
|
+
|
|
|
|
+ // Trigger the queued “close” events.
|
|
|
|
+ return P.trigger('close');
|
|
|
|
+ }, //close
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Clear the values
|
|
|
|
+ */
|
|
|
|
+ clear: function (options) {
|
|
|
|
+ return P.set('clear', null, options);
|
|
|
|
+ }, //clear
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Set something
|
|
|
|
+ */
|
|
|
|
+ set: function (thing, value, options) {
|
|
|
|
+
|
|
|
|
+ var thingItem,
|
|
|
|
+ thingValue,
|
|
|
|
+ thingIsObject = $.isPlainObject(thing),
|
|
|
|
+ thingObject = thingIsObject ? thing : {};
|
|
|
|
+
|
|
|
|
+ // Make sure we have usable options.
|
|
|
|
+ options = thingIsObject && $.isPlainObject(value) ? value : options || {};
|
|
|
|
+
|
|
|
|
+ if (thing) {
|
|
|
|
+
|
|
|
|
+ // If the thing isn’t an object, make it one.
|
|
|
|
+ if (!thingIsObject) {
|
|
|
|
+ thingObject[thing] = value;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Go through the things of items to set.
|
|
|
|
+ for (thingItem in thingObject) {
|
|
|
|
+
|
|
|
|
+ // Grab the value of the thing.
|
|
|
|
+ thingValue = thingObject[thingItem];
|
|
|
|
+
|
|
|
|
+ // First, if the item exists and there’s a value, set it.
|
|
|
|
+ if (thingItem in P.component.item) {
|
|
|
|
+ if (thingValue === undefined) thingValue = null;
|
|
|
|
+ P.component.set(thingItem, thingValue, options);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Then, check to update the element value and broadcast a change.
|
|
|
|
+ if (thingItem == 'select' || thingItem == 'clear') {
|
|
|
|
+ $ELEMENT.val(thingItem == 'clear' ? '' : P.get(thingItem, SETTINGS.format)).trigger('change');
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Render a new picker.
|
|
|
|
+ P.render();
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // When the method isn’t muted, trigger queued “set” events and pass the `thingObject`.
|
|
|
|
+ return options.muted ? P : P.trigger('set', thingObject);
|
|
|
|
+ }, //set
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Get something
|
|
|
|
+ */
|
|
|
|
+ get: function (thing, format) {
|
|
|
|
+
|
|
|
|
+ // Make sure there’s something to get.
|
|
|
|
+ thing = thing || 'value';
|
|
|
|
+
|
|
|
|
+ // If a picker state exists, return that.
|
|
|
|
+ if (STATE[thing] != null) {
|
|
|
|
+ return STATE[thing];
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Return the submission value, if that.
|
|
|
|
+ if (thing == 'valueSubmit') {
|
|
|
|
+ if (P._hidden) {
|
|
|
|
+ return P._hidden.value;
|
|
|
|
+ }
|
|
|
|
+ thing = 'value';
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Return the value, if that.
|
|
|
|
+ if (thing == 'value') {
|
|
|
|
+ return ELEMENT.value;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Check if a component item exists, return that.
|
|
|
|
+ if (thing in P.component.item) {
|
|
|
|
+ if (typeof format == 'string') {
|
|
|
|
+ var thingValue = P.component.get(thing);
|
|
|
|
+ return thingValue ? PickerConstructor._.trigger(P.component.formats.toString, P.component, [format, thingValue]) : '';
|
|
|
|
+ }
|
|
|
|
+ return P.component.get(thing);
|
|
|
|
+ }
|
|
|
|
+ }, //get
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Bind events on the things.
|
|
|
|
+ */
|
|
|
|
+ on: function (thing, method, internal) {
|
|
|
|
+
|
|
|
|
+ var thingName,
|
|
|
|
+ thingMethod,
|
|
|
|
+ thingIsObject = $.isPlainObject(thing),
|
|
|
|
+ thingObject = thingIsObject ? thing : {};
|
|
|
|
+
|
|
|
|
+ if (thing) {
|
|
|
|
+
|
|
|
|
+ // If the thing isn’t an object, make it one.
|
|
|
|
+ if (!thingIsObject) {
|
|
|
|
+ thingObject[thing] = method;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Go through the things to bind to.
|
|
|
|
+ for (thingName in thingObject) {
|
|
|
|
+
|
|
|
|
+ // Grab the method of the thing.
|
|
|
|
+ thingMethod = thingObject[thingName];
|
|
|
|
+
|
|
|
|
+ // If it was an internal binding, prefix it.
|
|
|
|
+ if (internal) {
|
|
|
|
+ thingName = '_' + thingName;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Make sure the thing methods collection exists.
|
|
|
|
+ STATE.methods[thingName] = STATE.methods[thingName] || [];
|
|
|
|
+
|
|
|
|
+ // Add the method to the relative method collection.
|
|
|
|
+ STATE.methods[thingName].push(thingMethod);
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ return P;
|
|
|
|
+ }, //on
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Unbind events on the things.
|
|
|
|
+ */
|
|
|
|
+ off: function () {
|
|
|
|
+ var i,
|
|
|
|
+ thingName,
|
|
|
|
+ names = arguments;
|
|
|
|
+ for (i = 0, namesCount = names.length; i < namesCount; i += 1) {
|
|
|
|
+ thingName = names[i];
|
|
|
|
+ if (thingName in STATE.methods) {
|
|
|
|
+ delete STATE.methods[thingName];
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ return P;
|
|
|
|
+ },
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Fire off method events.
|
|
|
|
+ */
|
|
|
|
+ trigger: function (name, data) {
|
|
|
|
+ var _trigger = function (name) {
|
|
|
|
+ var methodList = STATE.methods[name];
|
|
|
|
+ if (methodList) {
|
|
|
|
+ methodList.map(function (method) {
|
|
|
|
+ PickerConstructor._.trigger(method, P, [data]);
|
|
|
|
+ });
|
|
|
|
+ }
|
|
|
|
+ };
|
|
|
|
+ _trigger('_' + name);
|
|
|
|
+ _trigger(name);
|
|
|
|
+ return P;
|
|
|
|
+ } //trigger
|
|
|
|
+ //PickerInstance.prototype
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Wrap the picker holder components together.
|
|
|
|
+ */
|
|
|
|
+ };function createWrappedComponent() {
|
|
|
|
+
|
|
|
|
+ // Create a picker wrapper holder
|
|
|
|
+ return PickerConstructor._.node('div',
|
|
|
|
+
|
|
|
|
+ // Create a picker wrapper node
|
|
|
|
+ PickerConstructor._.node('div',
|
|
|
|
+
|
|
|
|
+ // Create a picker frame
|
|
|
|
+ PickerConstructor._.node('div',
|
|
|
|
+
|
|
|
|
+ // Create a picker box node
|
|
|
|
+ PickerConstructor._.node('div',
|
|
|
|
+
|
|
|
|
+ // Create the components nodes.
|
|
|
|
+ P.component.nodes(STATE.open),
|
|
|
|
+
|
|
|
|
+ // The picker box class
|
|
|
|
+ CLASSES.box),
|
|
|
|
+
|
|
|
|
+ // Picker wrap class
|
|
|
|
+ CLASSES.wrap),
|
|
|
|
+
|
|
|
|
+ // Picker frame class
|
|
|
|
+ CLASSES.frame),
|
|
|
|
+
|
|
|
|
+ // Picker holder class
|
|
|
|
+ CLASSES.holder); //endreturn
|
|
|
|
+ } //createWrappedComponent
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Prepare the input element with all bindings.
|
|
|
|
+ */
|
|
|
|
+ function prepareElement() {
|
|
|
|
+
|
|
|
|
+ $ELEMENT.
|
|
|
|
+
|
|
|
|
+ // Store the picker data by component name.
|
|
|
|
+ data(NAME, P).
|
|
|
|
+
|
|
|
|
+ // Add the “input” class name.
|
|
|
|
+ addClass(CLASSES.input).
|
|
|
|
+
|
|
|
|
+ // Remove the tabindex.
|
|
|
|
+ attr('tabindex', -1).
|
|
|
|
+
|
|
|
|
+ // If there’s a `data-value`, update the value of the element.
|
|
|
|
+ val($ELEMENT.data('value') ? P.get('select', SETTINGS.format) : ELEMENT.value);
|
|
|
|
+
|
|
|
|
+ // Only bind keydown events if the element isn’t editable.
|
|
|
|
+ if (!SETTINGS.editable) {
|
|
|
|
+
|
|
|
|
+ $ELEMENT.
|
|
|
|
+
|
|
|
|
+ // On focus/click, focus onto the root to open it up.
|
|
|
|
+ on('focus.' + STATE.id + ' click.' + STATE.id, function (event) {
|
|
|
|
+ event.preventDefault();
|
|
|
|
+ P.$root.eq(0).focus();
|
|
|
|
+ }).
|
|
|
|
+
|
|
|
|
+ // Handle keyboard event based on the picker being opened or not.
|
|
|
|
+ on('keydown.' + STATE.id, handleKeydownEvent);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Update the aria attributes.
|
|
|
|
+ aria(ELEMENT, {
|
|
|
|
+ haspopup: true,
|
|
|
|
+ expanded: false,
|
|
|
|
+ readonly: false,
|
|
|
|
+ owns: ELEMENT.id + '_root'
|
|
|
|
+ });
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Prepare the root picker element with all bindings.
|
|
|
|
+ */
|
|
|
|
+ function prepareElementRoot() {
|
|
|
|
+
|
|
|
|
+ P.$root.on({
|
|
|
|
+
|
|
|
|
+ // For iOS8.
|
|
|
|
+ keydown: handleKeydownEvent,
|
|
|
|
+
|
|
|
|
+ // When something within the root is focused, stop from bubbling
|
|
|
|
+ // to the doc and remove the “focused” state from the root.
|
|
|
|
+ focusin: function (event) {
|
|
|
|
+ P.$root.removeClass(CLASSES.focused);
|
|
|
|
+ event.stopPropagation();
|
|
|
|
+ },
|
|
|
|
+
|
|
|
|
+ // When something within the root holder is clicked, stop it
|
|
|
|
+ // from bubbling to the doc.
|
|
|
|
+ 'mousedown click': function (event) {
|
|
|
|
+
|
|
|
|
+ var target = event.target;
|
|
|
|
+
|
|
|
|
+ // Make sure the target isn’t the root holder so it can bubble up.
|
|
|
|
+ if (target != P.$root.children()[0]) {
|
|
|
|
+
|
|
|
|
+ event.stopPropagation();
|
|
|
|
+
|
|
|
|
+ // * For mousedown events, cancel the default action in order to
|
|
|
|
+ // prevent cases where focus is shifted onto external elements
|
|
|
|
+ // when using things like jQuery mobile or MagnificPopup (ref: #249 & #120).
|
|
|
|
+ // Also, for Firefox, don’t prevent action on the `option` element.
|
|
|
|
+ if (event.type == 'mousedown' && !$(target).is('input, select, textarea, button, option')) {
|
|
|
|
+
|
|
|
|
+ event.preventDefault();
|
|
|
|
+
|
|
|
|
+ // Re-focus onto the root so that users can click away
|
|
|
|
+ // from elements focused within the picker.
|
|
|
|
+ P.$root.eq(0).focus();
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ }).
|
|
|
|
+
|
|
|
|
+ // Add/remove the “target” class on focus and blur.
|
|
|
|
+ on({
|
|
|
|
+ focus: function () {
|
|
|
|
+ $ELEMENT.addClass(CLASSES.target);
|
|
|
|
+ },
|
|
|
|
+ blur: function () {
|
|
|
|
+ $ELEMENT.removeClass(CLASSES.target);
|
|
|
|
+ }
|
|
|
|
+ }).
|
|
|
|
+
|
|
|
|
+ // Open the picker and adjust the root “focused” state
|
|
|
|
+ on('focus.toOpen', handleFocusToOpenEvent).
|
|
|
|
+
|
|
|
|
+ // If there’s a click on an actionable element, carry out the actions.
|
|
|
|
+ on('click', '[data-pick], [data-nav], [data-clear], [data-close]', function () {
|
|
|
|
+
|
|
|
|
+ var $target = $(this),
|
|
|
|
+ targetData = $target.data(),
|
|
|
|
+ targetDisabled = $target.hasClass(CLASSES.navDisabled) || $target.hasClass(CLASSES.disabled),
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ // * For IE, non-focusable elements can be active elements as well
|
|
|
|
+ // (http://stackoverflow.com/a/2684561).
|
|
|
|
+ activeElement = getActiveElement();
|
|
|
|
+ activeElement = activeElement && (activeElement.type || activeElement.href) && activeElement;
|
|
|
|
+
|
|
|
|
+ // If it’s disabled or nothing inside is actively focused, re-focus the element.
|
|
|
|
+ if (targetDisabled || activeElement && !$.contains(P.$root[0], activeElement)) {
|
|
|
|
+ P.$root.eq(0).focus();
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // If something is superficially changed, update the `highlight` based on the `nav`.
|
|
|
|
+ if (!targetDisabled && targetData.nav) {
|
|
|
|
+ P.set('highlight', P.component.item.highlight, { nav: targetData.nav });
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // If something is picked, set `select` then close with focus.
|
|
|
|
+ else if (!targetDisabled && 'pick' in targetData) {
|
|
|
|
+ P.set('select', targetData.pick);
|
|
|
|
+ if (SETTINGS.closeOnSelect) {
|
|
|
|
+ P.close(true);
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // If a “clear” button is pressed, empty the values and close with focus.
|
|
|
|
+ else if (targetData.clear) {
|
|
|
|
+ P.clear();
|
|
|
|
+ if (SETTINGS.closeOnSelect) {
|
|
|
|
+ P.close(true);
|
|
|
|
+ }
|
|
|
|
+ } else if (targetData.close) {
|
|
|
|
+ P.close(true);
|
|
|
|
+ }
|
|
|
|
+ }); //P.$root
|
|
|
|
+
|
|
|
|
+ aria(P.$root[0], 'hidden', true);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Prepare the hidden input element along with all bindings.
|
|
|
|
+ */
|
|
|
|
+ function prepareElementHidden() {
|
|
|
|
+
|
|
|
|
+ var name;
|
|
|
|
+
|
|
|
|
+ if (SETTINGS.hiddenName === true) {
|
|
|
|
+ name = ELEMENT.name;
|
|
|
|
+ ELEMENT.name = '';
|
|
|
|
+ } else {
|
|
|
|
+ name = [typeof SETTINGS.hiddenPrefix == 'string' ? SETTINGS.hiddenPrefix : '', typeof SETTINGS.hiddenSuffix == 'string' ? SETTINGS.hiddenSuffix : '_submit'];
|
|
|
|
+ name = name[0] + ELEMENT.name + name[1];
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ P._hidden = $('<input ' + 'type=hidden ' +
|
|
|
|
+
|
|
|
|
+ // Create the name using the original input’s with a prefix and suffix.
|
|
|
|
+ 'name="' + name + '"' + (
|
|
|
|
+
|
|
|
|
+ // If the element has a value, set the hidden value as well.
|
|
|
|
+ $ELEMENT.data('value') || ELEMENT.value ? ' value="' + P.get('select', SETTINGS.formatSubmit) + '"' : '') + '>')[0];
|
|
|
|
+
|
|
|
|
+ $ELEMENT.
|
|
|
|
+
|
|
|
|
+ // If the value changes, update the hidden input with the correct format.
|
|
|
|
+ on('change.' + STATE.id, function () {
|
|
|
|
+ P._hidden.value = ELEMENT.value ? P.get('select', SETTINGS.formatSubmit) : '';
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // Insert the hidden input as specified in the settings.
|
|
|
|
+ if (SETTINGS.container) $(SETTINGS.container).append(P._hidden);else $ELEMENT.before(P._hidden);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // For iOS8.
|
|
|
|
+ function handleKeydownEvent(event) {
|
|
|
|
+
|
|
|
|
+ var keycode = event.keyCode,
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ // Check if one of the delete keys was pressed.
|
|
|
|
+ isKeycodeDelete = /^(8|46)$/.test(keycode);
|
|
|
|
+
|
|
|
|
+ // For some reason IE clears the input value on “escape”.
|
|
|
|
+ if (keycode == 27) {
|
|
|
|
+ P.close();
|
|
|
|
+ return false;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Check if `space` or `delete` was pressed or the picker is closed with a key movement.
|
|
|
|
+ if (keycode == 32 || isKeycodeDelete || !STATE.open && P.component.key[keycode]) {
|
|
|
|
+
|
|
|
|
+ // Prevent it from moving the page and bubbling to doc.
|
|
|
|
+ event.preventDefault();
|
|
|
|
+ event.stopPropagation();
|
|
|
|
+
|
|
|
|
+ // If `delete` was pressed, clear the values and close the picker.
|
|
|
|
+ // Otherwise open the picker.
|
|
|
|
+ if (isKeycodeDelete) {
|
|
|
|
+ P.clear().close();
|
|
|
|
+ } else {
|
|
|
|
+ P.open();
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Separated for IE
|
|
|
|
+ function handleFocusToOpenEvent(event) {
|
|
|
|
+
|
|
|
|
+ // Stop the event from propagating to the doc.
|
|
|
|
+ event.stopPropagation();
|
|
|
|
+
|
|
|
|
+ // If it’s a focus event, add the “focused” class to the root.
|
|
|
|
+ if (event.type == 'focus') {
|
|
|
|
+ P.$root.addClass(CLASSES.focused);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // And then finally open the picker.
|
|
|
|
+ P.open();
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Return a new picker instance.
|
|
|
|
+ return new PickerInstance();
|
|
|
|
+ } //PickerConstructor
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * The default classes and prefix to use for the HTML classes.
|
|
|
|
+ */
|
|
|
|
+ PickerConstructor.klasses = function (prefix) {
|
|
|
|
+ prefix = prefix || 'picker';
|
|
|
|
+ return {
|
|
|
|
+
|
|
|
|
+ picker: prefix,
|
|
|
|
+ opened: prefix + '--opened',
|
|
|
|
+ focused: prefix + '--focused',
|
|
|
|
+
|
|
|
|
+ input: prefix + '__input',
|
|
|
|
+ active: prefix + '__input--active',
|
|
|
|
+ target: prefix + '__input--target',
|
|
|
|
+
|
|
|
|
+ holder: prefix + '__holder',
|
|
|
|
+
|
|
|
|
+ frame: prefix + '__frame',
|
|
|
|
+ wrap: prefix + '__wrap',
|
|
|
|
+
|
|
|
|
+ box: prefix + '__box'
|
|
|
|
+ };
|
|
|
|
+ }; //PickerConstructor.klasses
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Check if the default theme is being used.
|
|
|
|
+ */
|
|
|
|
+ function isUsingDefaultTheme(element) {
|
|
|
|
+
|
|
|
|
+ var theme,
|
|
|
|
+ prop = 'position';
|
|
|
|
+
|
|
|
|
+ // For IE.
|
|
|
|
+ if (element.currentStyle) {
|
|
|
|
+ theme = element.currentStyle[prop];
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // For normal browsers.
|
|
|
|
+ else if (window.getComputedStyle) {
|
|
|
|
+ theme = getComputedStyle(element)[prop];
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ return theme == 'fixed';
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Get the width of the browser’s scrollbar.
|
|
|
|
+ * Taken from: https://github.com/VodkaBears/Remodal/blob/master/src/jquery.remodal.js
|
|
|
|
+ */
|
|
|
|
+ function getScrollbarWidth() {
|
|
|
|
+
|
|
|
|
+ if ($html.height() <= $window.height()) {
|
|
|
|
+ return 0;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ var $outer = $('<div style="visibility:hidden;width:100px" />').appendTo('body');
|
|
|
|
+
|
|
|
|
+ // Get the width without scrollbars.
|
|
|
|
+ var widthWithoutScroll = $outer[0].offsetWidth;
|
|
|
|
+
|
|
|
|
+ // Force adding scrollbars.
|
|
|
|
+ $outer.css('overflow', 'scroll');
|
|
|
|
+
|
|
|
|
+ // Add the inner div.
|
|
|
|
+ var $inner = $('<div style="width:100%" />').appendTo($outer);
|
|
|
|
+
|
|
|
|
+ // Get the width with scrollbars.
|
|
|
|
+ var widthWithScroll = $inner[0].offsetWidth;
|
|
|
|
+
|
|
|
|
+ // Remove the divs.
|
|
|
|
+ $outer.remove();
|
|
|
|
+
|
|
|
|
+ // Return the difference between the widths.
|
|
|
|
+ return widthWithoutScroll - widthWithScroll;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * PickerConstructor helper methods.
|
|
|
|
+ */
|
|
|
|
+ PickerConstructor._ = {
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Create a group of nodes. Expects:
|
|
|
|
+ * `
|
|
|
|
+ {
|
|
|
|
+ min: {Integer},
|
|
|
|
+ max: {Integer},
|
|
|
|
+ i: {Integer},
|
|
|
|
+ node: {String},
|
|
|
|
+ item: {Function}
|
|
|
|
+ }
|
|
|
|
+ * `
|
|
|
|
+ */
|
|
|
|
+ group: function (groupObject) {
|
|
|
|
+
|
|
|
|
+ var
|
|
|
|
+ // Scope for the looped object
|
|
|
|
+ loopObjectScope,
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ // Create the nodes list
|
|
|
|
+ nodesList = '',
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ // The counter starts from the `min`
|
|
|
|
+ counter = PickerConstructor._.trigger(groupObject.min, groupObject);
|
|
|
|
+
|
|
|
|
+ // Loop from the `min` to `max`, incrementing by `i`
|
|
|
|
+ for (; counter <= PickerConstructor._.trigger(groupObject.max, groupObject, [counter]); counter += groupObject.i) {
|
|
|
|
+
|
|
|
|
+ // Trigger the `item` function within scope of the object
|
|
|
|
+ loopObjectScope = PickerConstructor._.trigger(groupObject.item, groupObject, [counter]);
|
|
|
|
+
|
|
|
|
+ // Splice the subgroup and create nodes out of the sub nodes
|
|
|
|
+ nodesList += PickerConstructor._.node(groupObject.node, loopObjectScope[0], // the node
|
|
|
|
+ loopObjectScope[1], // the classes
|
|
|
|
+ loopObjectScope[2] // the attributes
|
|
|
|
+ );
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Return the list of nodes
|
|
|
|
+ return nodesList;
|
|
|
|
+ }, //group
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Create a dom node string
|
|
|
|
+ */
|
|
|
|
+ node: function (wrapper, item, klass, attribute) {
|
|
|
|
+
|
|
|
|
+ // If the item is false-y, just return an empty string
|
|
|
|
+ if (!item) return '';
|
|
|
|
+
|
|
|
|
+ // If the item is an array, do a join
|
|
|
|
+ item = $.isArray(item) ? item.join('') : item;
|
|
|
|
+
|
|
|
|
+ // Check for the class
|
|
|
|
+ klass = klass ? ' class="' + klass + '"' : '';
|
|
|
|
+
|
|
|
|
+ // Check for any attributes
|
|
|
|
+ attribute = attribute ? ' ' + attribute : '';
|
|
|
|
+
|
|
|
|
+ // Return the wrapped item
|
|
|
|
+ return '<' + wrapper + klass + attribute + '>' + item + '</' + wrapper + '>';
|
|
|
|
+ }, //node
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Lead numbers below 10 with a zero.
|
|
|
|
+ */
|
|
|
|
+ lead: function (number) {
|
|
|
|
+ return (number < 10 ? '0' : '') + number;
|
|
|
|
+ },
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Trigger a function otherwise return the value.
|
|
|
|
+ */
|
|
|
|
+ trigger: function (callback, scope, args) {
|
|
|
|
+ return typeof callback == 'function' ? callback.apply(scope, args || []) : callback;
|
|
|
|
+ },
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * If the second character is a digit, length is 2 otherwise 1.
|
|
|
|
+ */
|
|
|
|
+ digits: function (string) {
|
|
|
|
+ return (/\d/.test(string[1]) ? 2 : 1
|
|
|
|
+ );
|
|
|
|
+ },
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Tell if something is a date object.
|
|
|
|
+ */
|
|
|
|
+ isDate: function (value) {
|
|
|
|
+ return {}.toString.call(value).indexOf('Date') > -1 && this.isInteger(value.getDate());
|
|
|
|
+ },
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Tell if something is an integer.
|
|
|
|
+ */
|
|
|
|
+ isInteger: function (value) {
|
|
|
|
+ return {}.toString.call(value).indexOf('Number') > -1 && value % 1 === 0;
|
|
|
|
+ },
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Create ARIA attribute strings.
|
|
|
|
+ */
|
|
|
|
+ ariaAttr: ariaAttr //PickerConstructor._
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Extend the picker with a component and defaults.
|
|
|
|
+ */
|
|
|
|
+ };PickerConstructor.extend = function (name, Component) {
|
|
|
|
+
|
|
|
|
+ // Extend jQuery.
|
|
|
|
+ $.fn[name] = function (options, action) {
|
|
|
|
+
|
|
|
|
+ // Grab the component data.
|
|
|
|
+ var componentData = this.data(name);
|
|
|
|
+
|
|
|
|
+ // If the picker is requested, return the data object.
|
|
|
|
+ if (options == 'picker') {
|
|
|
|
+ return componentData;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // If the component data exists and `options` is a string, carry out the action.
|
|
|
|
+ if (componentData && typeof options == 'string') {
|
|
|
|
+ return PickerConstructor._.trigger(componentData[options], componentData, [action]);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Otherwise go through each matched element and if the component
|
|
|
|
+ // doesn’t exist, create a new picker using `this` element
|
|
|
|
+ // and merging the defaults and options with a deep copy.
|
|
|
|
+ return this.each(function () {
|
|
|
|
+ var $this = $(this);
|
|
|
|
+ if (!$this.data(name)) {
|
|
|
|
+ new PickerConstructor(this, name, Component, options);
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ // Set the defaults.
|
|
|
|
+ $.fn[name].defaults = Component.defaults;
|
|
|
|
+ }; //PickerConstructor.extend
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ function aria(element, attribute, value) {
|
|
|
|
+ if ($.isPlainObject(attribute)) {
|
|
|
|
+ for (var key in attribute) {
|
|
|
|
+ ariaSet(element, key, attribute[key]);
|
|
|
|
+ }
|
|
|
|
+ } else {
|
|
|
|
+ ariaSet(element, attribute, value);
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ function ariaSet(element, attribute, value) {
|
|
|
|
+ element.setAttribute((attribute == 'role' ? '' : 'aria-') + attribute, value);
|
|
|
|
+ }
|
|
|
|
+ function ariaAttr(attribute, data) {
|
|
|
|
+ if (!$.isPlainObject(attribute)) {
|
|
|
|
+ attribute = { attribute: data };
|
|
|
|
+ }
|
|
|
|
+ data = '';
|
|
|
|
+ for (var key in attribute) {
|
|
|
|
+ var attr = (key == 'role' ? '' : 'aria-') + key,
|
|
|
|
+ attrVal = attribute[key];
|
|
|
|
+ data += attrVal == null ? '' : attr + '="' + attribute[key] + '"';
|
|
|
|
+ }
|
|
|
|
+ return data;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // IE8 bug throws an error for activeElements within iframes.
|
|
|
|
+ function getActiveElement() {
|
|
|
|
+ try {
|
|
|
|
+ return document.activeElement;
|
|
|
|
+ } catch (err) {}
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Expose the picker constructor.
|
|
|
|
+ return PickerConstructor;
|
|
|
|
+});
|
|
|
|
+; /*!
|
|
|
|
+ * Date picker for pickadate.js v3.5.0
|
|
|
|
+ * http://amsul.github.io/pickadate.js/date.htm
|
|
|
|
+ */
|
|
|
|
+
|
|
|
|
+(function (factory) {
|
|
|
|
+ factory(Materialize.Picker, jQuery);
|
|
|
|
+})(function (Picker, $) {
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Globals and constants
|
|
|
|
+ */
|
|
|
|
+ var DAYS_IN_WEEK = 7,
|
|
|
|
+ WEEKS_IN_CALENDAR = 6,
|
|
|
|
+ _ = Picker._;
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * The date picker constructor
|
|
|
|
+ */
|
|
|
|
+ function DatePicker(picker, settings) {
|
|
|
|
+
|
|
|
|
+ var calendar = this,
|
|
|
|
+ element = picker.$node[0],
|
|
|
|
+ elementValue = element.value,
|
|
|
|
+ elementDataValue = picker.$node.data('value'),
|
|
|
|
+ valueString = elementDataValue || elementValue,
|
|
|
|
+ formatString = elementDataValue ? settings.formatSubmit : settings.format,
|
|
|
|
+ isRTL = function () {
|
|
|
|
+
|
|
|
|
+ return element.currentStyle ?
|
|
|
|
+
|
|
|
|
+ // For IE.
|
|
|
|
+ element.currentStyle.direction == 'rtl' :
|
|
|
|
+
|
|
|
|
+ // For normal browsers.
|
|
|
|
+ getComputedStyle(picker.$root[0]).direction == 'rtl';
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ calendar.settings = settings;
|
|
|
|
+ calendar.$node = picker.$node;
|
|
|
|
+
|
|
|
|
+ // The queue of methods that will be used to build item objects.
|
|
|
|
+ calendar.queue = {
|
|
|
|
+ min: 'measure create',
|
|
|
|
+ max: 'measure create',
|
|
|
|
+ now: 'now create',
|
|
|
|
+ select: 'parse create validate',
|
|
|
|
+ highlight: 'parse navigate create validate',
|
|
|
|
+ view: 'parse create validate viewset',
|
|
|
|
+ disable: 'deactivate',
|
|
|
|
+ enable: 'activate'
|
|
|
|
+
|
|
|
|
+ // The component's item object.
|
|
|
|
+ };calendar.item = {};
|
|
|
|
+
|
|
|
|
+ calendar.item.clear = null;
|
|
|
|
+ calendar.item.disable = (settings.disable || []).slice(0);
|
|
|
|
+ calendar.item.enable = -function (collectionDisabled) {
|
|
|
|
+ return collectionDisabled[0] === true ? collectionDisabled.shift() : -1;
|
|
|
|
+ }(calendar.item.disable);
|
|
|
|
+
|
|
|
|
+ calendar.set('min', settings.min).set('max', settings.max).set('now');
|
|
|
|
+
|
|
|
|
+ // When there’s a value, set the `select`, which in turn
|
|
|
|
+ // also sets the `highlight` and `view`.
|
|
|
|
+ if (valueString) {
|
|
|
|
+ calendar.set('select', valueString, { format: formatString });
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // If there’s no value, default to highlighting “today”.
|
|
|
|
+ else {
|
|
|
|
+ calendar.set('select', null).set('highlight', calendar.item.now);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // The keycode to movement mapping.
|
|
|
|
+ calendar.key = {
|
|
|
|
+ 40: 7, // Down
|
|
|
|
+ 38: -7, // Up
|
|
|
|
+ 39: function () {
|
|
|
|
+ return isRTL() ? -1 : 1;
|
|
|
|
+ }, // Right
|
|
|
|
+ 37: function () {
|
|
|
|
+ return isRTL() ? 1 : -1;
|
|
|
|
+ }, // Left
|
|
|
|
+ go: function (timeChange) {
|
|
|
|
+ var highlightedObject = calendar.item.highlight,
|
|
|
|
+ targetDate = new Date(highlightedObject.year, highlightedObject.month, highlightedObject.date + timeChange);
|
|
|
|
+ calendar.set('highlight', targetDate, { interval: timeChange });
|
|
|
|
+ this.render();
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Bind some picker events.
|
|
|
|
+ };picker.on('render', function () {
|
|
|
|
+ picker.$root.find('.' + settings.klass.selectMonth).on('change', function () {
|
|
|
|
+ var value = this.value;
|
|
|
|
+ if (value) {
|
|
|
|
+ picker.set('highlight', [picker.get('view').year, value, picker.get('highlight').date]);
|
|
|
|
+ picker.$root.find('.' + settings.klass.selectMonth).trigger('focus');
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ picker.$root.find('.' + settings.klass.selectYear).on('change', function () {
|
|
|
|
+ var value = this.value;
|
|
|
|
+ if (value) {
|
|
|
|
+ picker.set('highlight', [value, picker.get('view').month, picker.get('highlight').date]);
|
|
|
|
+ picker.$root.find('.' + settings.klass.selectYear).trigger('focus');
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ }, 1).on('open', function () {
|
|
|
|
+ var includeToday = '';
|
|
|
|
+ if (calendar.disabled(calendar.get('now'))) {
|
|
|
|
+ includeToday = ':not(.' + settings.klass.buttonToday + ')';
|
|
|
|
+ }
|
|
|
|
+ picker.$root.find('button' + includeToday + ', select').attr('disabled', false);
|
|
|
|
+ }, 1).on('close', function () {
|
|
|
|
+ picker.$root.find('button, select').attr('disabled', true);
|
|
|
|
+ }, 1);
|
|
|
|
+ } //DatePicker
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Set a datepicker item object.
|
|
|
|
+ */
|
|
|
|
+ DatePicker.prototype.set = function (type, value, options) {
|
|
|
|
+
|
|
|
|
+ var calendar = this,
|
|
|
|
+ calendarItem = calendar.item;
|
|
|
|
+
|
|
|
|
+ // If the value is `null` just set it immediately.
|
|
|
|
+ if (value === null) {
|
|
|
|
+ if (type == 'clear') type = 'select';
|
|
|
|
+ calendarItem[type] = value;
|
|
|
|
+ return calendar;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Otherwise go through the queue of methods, and invoke the functions.
|
|
|
|
+ // Update this as the time unit, and set the final value as this item.
|
|
|
|
+ // * In the case of `enable`, keep the queue but set `disable` instead.
|
|
|
|
+ // And in the case of `flip`, keep the queue but set `enable` instead.
|
|
|
|
+ calendarItem[type == 'enable' ? 'disable' : type == 'flip' ? 'enable' : type] = calendar.queue[type].split(' ').map(function (method) {
|
|
|
|
+ value = calendar[method](type, value, options);
|
|
|
|
+ return value;
|
|
|
|
+ }).pop();
|
|
|
|
+
|
|
|
|
+ // Check if we need to cascade through more updates.
|
|
|
|
+ if (type == 'select') {
|
|
|
|
+ calendar.set('highlight', calendarItem.select, options);
|
|
|
|
+ } else if (type == 'highlight') {
|
|
|
|
+ calendar.set('view', calendarItem.highlight, options);
|
|
|
|
+ } else if (type.match(/^(flip|min|max|disable|enable)$/)) {
|
|
|
|
+ if (calendarItem.select && calendar.disabled(calendarItem.select)) {
|
|
|
|
+ calendar.set('select', calendarItem.select, options);
|
|
|
|
+ }
|
|
|
|
+ if (calendarItem.highlight && calendar.disabled(calendarItem.highlight)) {
|
|
|
|
+ calendar.set('highlight', calendarItem.highlight, options);
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ return calendar;
|
|
|
|
+ }; //DatePicker.prototype.set
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Get a datepicker item object.
|
|
|
|
+ */
|
|
|
|
+ DatePicker.prototype.get = function (type) {
|
|
|
|
+ return this.item[type];
|
|
|
|
+ }; //DatePicker.prototype.get
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Create a picker date object.
|
|
|
|
+ */
|
|
|
|
+ DatePicker.prototype.create = function (type, value, options) {
|
|
|
|
+
|
|
|
|
+ var isInfiniteValue,
|
|
|
|
+ calendar = this;
|
|
|
|
+
|
|
|
|
+ // If there’s no value, use the type as the value.
|
|
|
|
+ value = value === undefined ? type : value;
|
|
|
|
+
|
|
|
|
+ // If it’s infinity, update the value.
|
|
|
|
+ if (value == -Infinity || value == Infinity) {
|
|
|
|
+ isInfiniteValue = value;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // If it’s an object, use the native date object.
|
|
|
|
+ else if ($.isPlainObject(value) && _.isInteger(value.pick)) {
|
|
|
|
+ value = value.obj;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // If it’s an array, convert it into a date and make sure
|
|
|
|
+ // that it’s a valid date – otherwise default to today.
|
|
|
|
+ else if ($.isArray(value)) {
|
|
|
|
+ value = new Date(value[0], value[1], value[2]);
|
|
|
|
+ value = _.isDate(value) ? value : calendar.create().obj;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // If it’s a number or date object, make a normalized date.
|
|
|
|
+ else if (_.isInteger(value) || _.isDate(value)) {
|
|
|
|
+ value = calendar.normalize(new Date(value), options);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // If it’s a literal true or any other case, set it to now.
|
|
|
|
+ else /*if ( value === true )*/{
|
|
|
|
+ value = calendar.now(type, value, options);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Return the compiled object.
|
|
|
|
+ return {
|
|
|
|
+ year: isInfiniteValue || value.getFullYear(),
|
|
|
|
+ month: isInfiniteValue || value.getMonth(),
|
|
|
|
+ date: isInfiniteValue || value.getDate(),
|
|
|
|
+ day: isInfiniteValue || value.getDay(),
|
|
|
|
+ obj: isInfiniteValue || value,
|
|
|
|
+ pick: isInfiniteValue || value.getTime()
|
|
|
|
+ };
|
|
|
|
+ }; //DatePicker.prototype.create
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Create a range limit object using an array, date object,
|
|
|
|
+ * literal “true”, or integer relative to another time.
|
|
|
|
+ */
|
|
|
|
+ DatePicker.prototype.createRange = function (from, to) {
|
|
|
|
+
|
|
|
|
+ var calendar = this,
|
|
|
|
+ createDate = function (date) {
|
|
|
|
+ if (date === true || $.isArray(date) || _.isDate(date)) {
|
|
|
|
+ return calendar.create(date);
|
|
|
|
+ }
|
|
|
|
+ return date;
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ // Create objects if possible.
|
|
|
|
+ if (!_.isInteger(from)) {
|
|
|
|
+ from = createDate(from);
|
|
|
|
+ }
|
|
|
|
+ if (!_.isInteger(to)) {
|
|
|
|
+ to = createDate(to);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Create relative dates.
|
|
|
|
+ if (_.isInteger(from) && $.isPlainObject(to)) {
|
|
|
|
+ from = [to.year, to.month, to.date + from];
|
|
|
|
+ } else if (_.isInteger(to) && $.isPlainObject(from)) {
|
|
|
|
+ to = [from.year, from.month, from.date + to];
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ return {
|
|
|
|
+ from: createDate(from),
|
|
|
|
+ to: createDate(to)
|
|
|
|
+ };
|
|
|
|
+ }; //DatePicker.prototype.createRange
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Check if a date unit falls within a date range object.
|
|
|
|
+ */
|
|
|
|
+ DatePicker.prototype.withinRange = function (range, dateUnit) {
|
|
|
|
+ range = this.createRange(range.from, range.to);
|
|
|
|
+ return dateUnit.pick >= range.from.pick && dateUnit.pick <= range.to.pick;
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Check if two date range objects overlap.
|
|
|
|
+ */
|
|
|
|
+ DatePicker.prototype.overlapRanges = function (one, two) {
|
|
|
|
+
|
|
|
|
+ var calendar = this;
|
|
|
|
+
|
|
|
|
+ // Convert the ranges into comparable dates.
|
|
|
|
+ one = calendar.createRange(one.from, one.to);
|
|
|
|
+ two = calendar.createRange(two.from, two.to);
|
|
|
|
+
|
|
|
|
+ return calendar.withinRange(one, two.from) || calendar.withinRange(one, two.to) || calendar.withinRange(two, one.from) || calendar.withinRange(two, one.to);
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Get the date today.
|
|
|
|
+ */
|
|
|
|
+ DatePicker.prototype.now = function (type, value, options) {
|
|
|
|
+ value = new Date();
|
|
|
|
+ if (options && options.rel) {
|
|
|
|
+ value.setDate(value.getDate() + options.rel);
|
|
|
|
+ }
|
|
|
|
+ return this.normalize(value, options);
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Navigate to next/prev month.
|
|
|
|
+ */
|
|
|
|
+ DatePicker.prototype.navigate = function (type, value, options) {
|
|
|
|
+
|
|
|
|
+ var targetDateObject,
|
|
|
|
+ targetYear,
|
|
|
|
+ targetMonth,
|
|
|
|
+ targetDate,
|
|
|
|
+ isTargetArray = $.isArray(value),
|
|
|
|
+ isTargetObject = $.isPlainObject(value),
|
|
|
|
+ viewsetObject = this.item.view; /*,
|
|
|
|
+ safety = 100*/
|
|
|
|
+
|
|
|
|
+ if (isTargetArray || isTargetObject) {
|
|
|
|
+
|
|
|
|
+ if (isTargetObject) {
|
|
|
|
+ targetYear = value.year;
|
|
|
|
+ targetMonth = value.month;
|
|
|
|
+ targetDate = value.date;
|
|
|
|
+ } else {
|
|
|
|
+ targetYear = +value[0];
|
|
|
|
+ targetMonth = +value[1];
|
|
|
|
+ targetDate = +value[2];
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // If we’re navigating months but the view is in a different
|
|
|
|
+ // month, navigate to the view’s year and month.
|
|
|
|
+ if (options && options.nav && viewsetObject && viewsetObject.month !== targetMonth) {
|
|
|
|
+ targetYear = viewsetObject.year;
|
|
|
|
+ targetMonth = viewsetObject.month;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Figure out the expected target year and month.
|
|
|
|
+ targetDateObject = new Date(targetYear, targetMonth + (options && options.nav ? options.nav : 0), 1);
|
|
|
|
+ targetYear = targetDateObject.getFullYear();
|
|
|
|
+ targetMonth = targetDateObject.getMonth();
|
|
|
|
+
|
|
|
|
+ // If the month we’re going to doesn’t have enough days,
|
|
|
|
+ // keep decreasing the date until we reach the month’s last date.
|
|
|
|
+ while ( /*safety &&*/new Date(targetYear, targetMonth, targetDate).getMonth() !== targetMonth) {
|
|
|
|
+ targetDate -= 1;
|
|
|
|
+ /*safety -= 1
|
|
|
|
+ if ( !safety ) {
|
|
|
|
+ throw 'Fell into an infinite loop while navigating to ' + new Date( targetYear, targetMonth, targetDate ) + '.'
|
|
|
|
+ }*/
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ value = [targetYear, targetMonth, targetDate];
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ return value;
|
|
|
|
+ }; //DatePicker.prototype.navigate
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Normalize a date by setting the hours to midnight.
|
|
|
|
+ */
|
|
|
|
+ DatePicker.prototype.normalize = function (value /*, options*/) {
|
|
|
|
+ value.setHours(0, 0, 0, 0);
|
|
|
|
+ return value;
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Measure the range of dates.
|
|
|
|
+ */
|
|
|
|
+ DatePicker.prototype.measure = function (type, value /*, options*/) {
|
|
|
|
+
|
|
|
|
+ var calendar = this;
|
|
|
|
+
|
|
|
|
+ // If it’s anything false-y, remove the limits.
|
|
|
|
+ if (!value) {
|
|
|
|
+ value = type == 'min' ? -Infinity : Infinity;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // If it’s a string, parse it.
|
|
|
|
+ else if (typeof value == 'string') {
|
|
|
|
+ value = calendar.parse(type, value);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // If it's an integer, get a date relative to today.
|
|
|
|
+ else if (_.isInteger(value)) {
|
|
|
|
+ value = calendar.now(type, value, { rel: value });
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ return value;
|
|
|
|
+ }; ///DatePicker.prototype.measure
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Create a viewset object based on navigation.
|
|
|
|
+ */
|
|
|
|
+ DatePicker.prototype.viewset = function (type, dateObject /*, options*/) {
|
|
|
|
+ return this.create([dateObject.year, dateObject.month, 1]);
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Validate a date as enabled and shift if needed.
|
|
|
|
+ */
|
|
|
|
+ DatePicker.prototype.validate = function (type, dateObject, options) {
|
|
|
|
+
|
|
|
|
+ var calendar = this,
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ // Keep a reference to the original date.
|
|
|
|
+ originalDateObject = dateObject,
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ // Make sure we have an interval.
|
|
|
|
+ interval = options && options.interval ? options.interval : 1,
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ // Check if the calendar enabled dates are inverted.
|
|
|
|
+ isFlippedBase = calendar.item.enable === -1,
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ // Check if we have any enabled dates after/before now.
|
|
|
|
+ hasEnabledBeforeTarget,
|
|
|
|
+ hasEnabledAfterTarget,
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ // The min & max limits.
|
|
|
|
+ minLimitObject = calendar.item.min,
|
|
|
|
+ maxLimitObject = calendar.item.max,
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ // Check if we’ve reached the limit during shifting.
|
|
|
|
+ reachedMin,
|
|
|
|
+ reachedMax,
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ // Check if the calendar is inverted and at least one weekday is enabled.
|
|
|
|
+ hasEnabledWeekdays = isFlippedBase && calendar.item.disable.filter(function (value) {
|
|
|
|
+
|
|
|
|
+ // If there’s a date, check where it is relative to the target.
|
|
|
|
+ if ($.isArray(value)) {
|
|
|
|
+ var dateTime = calendar.create(value).pick;
|
|
|
|
+ if (dateTime < dateObject.pick) hasEnabledBeforeTarget = true;else if (dateTime > dateObject.pick) hasEnabledAfterTarget = true;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Return only integers for enabled weekdays.
|
|
|
|
+ return _.isInteger(value);
|
|
|
|
+ }).length; /*,
|
|
|
|
+ safety = 100*/
|
|
|
|
+
|
|
|
|
+ // Cases to validate for:
|
|
|
|
+ // [1] Not inverted and date disabled.
|
|
|
|
+ // [2] Inverted and some dates enabled.
|
|
|
|
+ // [3] Not inverted and out of range.
|
|
|
|
+ //
|
|
|
|
+ // Cases to **not** validate for:
|
|
|
|
+ // • Navigating months.
|
|
|
|
+ // • Not inverted and date enabled.
|
|
|
|
+ // • Inverted and all dates disabled.
|
|
|
|
+ // • ..and anything else.
|
|
|
|
+ if (!options || !options.nav) if (
|
|
|
|
+ /* 1 */!isFlippedBase && calendar.disabled(dateObject) ||
|
|
|
|
+ /* 2 */isFlippedBase && calendar.disabled(dateObject) && (hasEnabledWeekdays || hasEnabledBeforeTarget || hasEnabledAfterTarget) ||
|
|
|
|
+ /* 3 */!isFlippedBase && (dateObject.pick <= minLimitObject.pick || dateObject.pick >= maxLimitObject.pick)) {
|
|
|
|
+
|
|
|
|
+ // When inverted, flip the direction if there aren’t any enabled weekdays
|
|
|
|
+ // and there are no enabled dates in the direction of the interval.
|
|
|
|
+ if (isFlippedBase && !hasEnabledWeekdays && (!hasEnabledAfterTarget && interval > 0 || !hasEnabledBeforeTarget && interval < 0)) {
|
|
|
|
+ interval *= -1;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Keep looping until we reach an enabled date.
|
|
|
|
+ while ( /*safety &&*/calendar.disabled(dateObject)) {
|
|
|
|
+
|
|
|
|
+ /*safety -= 1
|
|
|
|
+ if ( !safety ) {
|
|
|
|
+ throw 'Fell into an infinite loop while validating ' + dateObject.obj + '.'
|
|
|
|
+ }*/
|
|
|
|
+
|
|
|
|
+ // If we’ve looped into the next/prev month with a large interval, return to the original date and flatten the interval.
|
|
|
|
+ if (Math.abs(interval) > 1 && (dateObject.month < originalDateObject.month || dateObject.month > originalDateObject.month)) {
|
|
|
|
+ dateObject = originalDateObject;
|
|
|
|
+ interval = interval > 0 ? 1 : -1;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // If we’ve reached the min/max limit, reverse the direction, flatten the interval and set it to the limit.
|
|
|
|
+ if (dateObject.pick <= minLimitObject.pick) {
|
|
|
|
+ reachedMin = true;
|
|
|
|
+ interval = 1;
|
|
|
|
+ dateObject = calendar.create([minLimitObject.year, minLimitObject.month, minLimitObject.date + (dateObject.pick === minLimitObject.pick ? 0 : -1)]);
|
|
|
|
+ } else if (dateObject.pick >= maxLimitObject.pick) {
|
|
|
|
+ reachedMax = true;
|
|
|
|
+ interval = -1;
|
|
|
|
+ dateObject = calendar.create([maxLimitObject.year, maxLimitObject.month, maxLimitObject.date + (dateObject.pick === maxLimitObject.pick ? 0 : 1)]);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // If we’ve reached both limits, just break out of the loop.
|
|
|
|
+ if (reachedMin && reachedMax) {
|
|
|
|
+ break;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Finally, create the shifted date using the interval and keep looping.
|
|
|
|
+ dateObject = calendar.create([dateObject.year, dateObject.month, dateObject.date + interval]);
|
|
|
|
+ }
|
|
|
|
+ } //endif
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ // Return the date object settled on.
|
|
|
|
+ return dateObject;
|
|
|
|
+ }; //DatePicker.prototype.validate
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Check if a date is disabled.
|
|
|
|
+ */
|
|
|
|
+ DatePicker.prototype.disabled = function (dateToVerify) {
|
|
|
|
+
|
|
|
|
+ var calendar = this,
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ // Filter through the disabled dates to check if this is one.
|
|
|
|
+ isDisabledMatch = calendar.item.disable.filter(function (dateToDisable) {
|
|
|
|
+
|
|
|
|
+ // If the date is a number, match the weekday with 0index and `firstDay` check.
|
|
|
|
+ if (_.isInteger(dateToDisable)) {
|
|
|
|
+ return dateToVerify.day === (calendar.settings.firstDay ? dateToDisable : dateToDisable - 1) % 7;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // If it’s an array or a native JS date, create and match the exact date.
|
|
|
|
+ if ($.isArray(dateToDisable) || _.isDate(dateToDisable)) {
|
|
|
|
+ return dateToVerify.pick === calendar.create(dateToDisable).pick;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // If it’s an object, match a date within the “from” and “to” range.
|
|
|
|
+ if ($.isPlainObject(dateToDisable)) {
|
|
|
|
+ return calendar.withinRange(dateToDisable, dateToVerify);
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // If this date matches a disabled date, confirm it’s not inverted.
|
|
|
|
+ isDisabledMatch = isDisabledMatch.length && !isDisabledMatch.filter(function (dateToDisable) {
|
|
|
|
+ return $.isArray(dateToDisable) && dateToDisable[3] == 'inverted' || $.isPlainObject(dateToDisable) && dateToDisable.inverted;
|
|
|
|
+ }).length;
|
|
|
|
+
|
|
|
|
+ // Check the calendar “enabled” flag and respectively flip the
|
|
|
|
+ // disabled state. Then also check if it’s beyond the min/max limits.
|
|
|
|
+ return calendar.item.enable === -1 ? !isDisabledMatch : isDisabledMatch || dateToVerify.pick < calendar.item.min.pick || dateToVerify.pick > calendar.item.max.pick;
|
|
|
|
+ }; //DatePicker.prototype.disabled
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Parse a string into a usable type.
|
|
|
|
+ */
|
|
|
|
+ DatePicker.prototype.parse = function (type, value, options) {
|
|
|
|
+
|
|
|
|
+ var calendar = this,
|
|
|
|
+ parsingObject = {};
|
|
|
|
+
|
|
|
|
+ // If it’s already parsed, we’re good.
|
|
|
|
+ if (!value || typeof value != 'string') {
|
|
|
|
+ return value;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // We need a `.format` to parse the value with.
|
|
|
|
+ if (!(options && options.format)) {
|
|
|
|
+ options = options || {};
|
|
|
|
+ options.format = calendar.settings.format;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Convert the format into an array and then map through it.
|
|
|
|
+ calendar.formats.toArray(options.format).map(function (label) {
|
|
|
|
+
|
|
|
|
+ var
|
|
|
|
+ // Grab the formatting label.
|
|
|
|
+ formattingLabel = calendar.formats[label],
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ // The format length is from the formatting label function or the
|
|
|
|
+ // label length without the escaping exclamation (!) mark.
|
|
|
|
+ formatLength = formattingLabel ? _.trigger(formattingLabel, calendar, [value, parsingObject]) : label.replace(/^!/, '').length;
|
|
|
|
+
|
|
|
|
+ // If there's a format label, split the value up to the format length.
|
|
|
|
+ // Then add it to the parsing object with appropriate label.
|
|
|
|
+ if (formattingLabel) {
|
|
|
|
+ parsingObject[label] = value.substr(0, formatLength);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Update the value as the substring from format length to end.
|
|
|
|
+ value = value.substr(formatLength);
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // Compensate for month 0index.
|
|
|
|
+ return [parsingObject.yyyy || parsingObject.yy, +(parsingObject.mm || parsingObject.m) - 1, parsingObject.dd || parsingObject.d];
|
|
|
|
+ }; //DatePicker.prototype.parse
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Various formats to display the object in.
|
|
|
|
+ */
|
|
|
|
+ DatePicker.prototype.formats = function () {
|
|
|
|
+
|
|
|
|
+ // Return the length of the first word in a collection.
|
|
|
|
+ function getWordLengthFromCollection(string, collection, dateObject) {
|
|
|
|
+
|
|
|
|
+ // Grab the first word from the string.
|
|
|
|
+ var word = string.match(/\w+/)[0];
|
|
|
|
+
|
|
|
|
+ // If there's no month index, add it to the date object
|
|
|
|
+ if (!dateObject.mm && !dateObject.m) {
|
|
|
|
+ dateObject.m = collection.indexOf(word) + 1;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Return the length of the word.
|
|
|
|
+ return word.length;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Get the length of the first word in a string.
|
|
|
|
+ function getFirstWordLength(string) {
|
|
|
|
+ return string.match(/\w+/)[0].length;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ return {
|
|
|
|
+
|
|
|
|
+ d: function (string, dateObject) {
|
|
|
|
+
|
|
|
|
+ // If there's string, then get the digits length.
|
|
|
|
+ // Otherwise return the selected date.
|
|
|
|
+ return string ? _.digits(string) : dateObject.date;
|
|
|
|
+ },
|
|
|
|
+ dd: function (string, dateObject) {
|
|
|
|
+
|
|
|
|
+ // If there's a string, then the length is always 2.
|
|
|
|
+ // Otherwise return the selected date with a leading zero.
|
|
|
|
+ return string ? 2 : _.lead(dateObject.date);
|
|
|
|
+ },
|
|
|
|
+ ddd: function (string, dateObject) {
|
|
|
|
+
|
|
|
|
+ // If there's a string, then get the length of the first word.
|
|
|
|
+ // Otherwise return the short selected weekday.
|
|
|
|
+ return string ? getFirstWordLength(string) : this.settings.weekdaysShort[dateObject.day];
|
|
|
|
+ },
|
|
|
|
+ dddd: function (string, dateObject) {
|
|
|
|
+
|
|
|
|
+ // If there's a string, then get the length of the first word.
|
|
|
|
+ // Otherwise return the full selected weekday.
|
|
|
|
+ return string ? getFirstWordLength(string) : this.settings.weekdaysFull[dateObject.day];
|
|
|
|
+ },
|
|
|
|
+ m: function (string, dateObject) {
|
|
|
|
+
|
|
|
|
+ // If there's a string, then get the length of the digits
|
|
|
|
+ // Otherwise return the selected month with 0index compensation.
|
|
|
|
+ return string ? _.digits(string) : dateObject.month + 1;
|
|
|
|
+ },
|
|
|
|
+ mm: function (string, dateObject) {
|
|
|
|
+
|
|
|
|
+ // If there's a string, then the length is always 2.
|
|
|
|
+ // Otherwise return the selected month with 0index and leading zero.
|
|
|
|
+ return string ? 2 : _.lead(dateObject.month + 1);
|
|
|
|
+ },
|
|
|
|
+ mmm: function (string, dateObject) {
|
|
|
|
+
|
|
|
|
+ var collection = this.settings.monthsShort;
|
|
|
|
+
|
|
|
|
+ // If there's a string, get length of the relevant month from the short
|
|
|
|
+ // months collection. Otherwise return the selected month from that collection.
|
|
|
|
+ return string ? getWordLengthFromCollection(string, collection, dateObject) : collection[dateObject.month];
|
|
|
|
+ },
|
|
|
|
+ mmmm: function (string, dateObject) {
|
|
|
|
+
|
|
|
|
+ var collection = this.settings.monthsFull;
|
|
|
|
+
|
|
|
|
+ // If there's a string, get length of the relevant month from the full
|
|
|
|
+ // months collection. Otherwise return the selected month from that collection.
|
|
|
|
+ return string ? getWordLengthFromCollection(string, collection, dateObject) : collection[dateObject.month];
|
|
|
|
+ },
|
|
|
|
+ yy: function (string, dateObject) {
|
|
|
|
+
|
|
|
|
+ // If there's a string, then the length is always 2.
|
|
|
|
+ // Otherwise return the selected year by slicing out the first 2 digits.
|
|
|
|
+ return string ? 2 : ('' + dateObject.year).slice(2);
|
|
|
|
+ },
|
|
|
|
+ yyyy: function (string, dateObject) {
|
|
|
|
+
|
|
|
|
+ // If there's a string, then the length is always 4.
|
|
|
|
+ // Otherwise return the selected year.
|
|
|
|
+ return string ? 4 : dateObject.year;
|
|
|
|
+ },
|
|
|
|
+
|
|
|
|
+ // Create an array by splitting the formatting string passed.
|
|
|
|
+ toArray: function (formatString) {
|
|
|
|
+ return formatString.split(/(d{1,4}|m{1,4}|y{4}|yy|!.)/g);
|
|
|
|
+ },
|
|
|
|
+
|
|
|
|
+ // Format an object into a string using the formatting options.
|
|
|
|
+ toString: function (formatString, itemObject) {
|
|
|
|
+ var calendar = this;
|
|
|
|
+ return calendar.formats.toArray(formatString).map(function (label) {
|
|
|
|
+ return _.trigger(calendar.formats[label], calendar, [0, itemObject]) || label.replace(/^!/, '');
|
|
|
|
+ }).join('');
|
|
|
|
+ }
|
|
|
|
+ };
|
|
|
|
+ }(); //DatePicker.prototype.formats
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Check if two date units are the exact.
|
|
|
|
+ */
|
|
|
|
+ DatePicker.prototype.isDateExact = function (one, two) {
|
|
|
|
+
|
|
|
|
+ var calendar = this;
|
|
|
|
+
|
|
|
|
+ // When we’re working with weekdays, do a direct comparison.
|
|
|
|
+ if (_.isInteger(one) && _.isInteger(two) || typeof one == 'boolean' && typeof two == 'boolean') {
|
|
|
|
+ return one === two;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // When we’re working with date representations, compare the “pick” value.
|
|
|
|
+ if ((_.isDate(one) || $.isArray(one)) && (_.isDate(two) || $.isArray(two))) {
|
|
|
|
+ return calendar.create(one).pick === calendar.create(two).pick;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // When we’re working with range objects, compare the “from” and “to”.
|
|
|
|
+ if ($.isPlainObject(one) && $.isPlainObject(two)) {
|
|
|
|
+ return calendar.isDateExact(one.from, two.from) && calendar.isDateExact(one.to, two.to);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ return false;
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Check if two date units overlap.
|
|
|
|
+ */
|
|
|
|
+ DatePicker.prototype.isDateOverlap = function (one, two) {
|
|
|
|
+
|
|
|
|
+ var calendar = this,
|
|
|
|
+ firstDay = calendar.settings.firstDay ? 1 : 0;
|
|
|
|
+
|
|
|
|
+ // When we’re working with a weekday index, compare the days.
|
|
|
|
+ if (_.isInteger(one) && (_.isDate(two) || $.isArray(two))) {
|
|
|
|
+ one = one % 7 + firstDay;
|
|
|
|
+ return one === calendar.create(two).day + 1;
|
|
|
|
+ }
|
|
|
|
+ if (_.isInteger(two) && (_.isDate(one) || $.isArray(one))) {
|
|
|
|
+ two = two % 7 + firstDay;
|
|
|
|
+ return two === calendar.create(one).day + 1;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // When we’re working with range objects, check if the ranges overlap.
|
|
|
|
+ if ($.isPlainObject(one) && $.isPlainObject(two)) {
|
|
|
|
+ return calendar.overlapRanges(one, two);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ return false;
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Flip the “enabled” state.
|
|
|
|
+ */
|
|
|
|
+ DatePicker.prototype.flipEnable = function (val) {
|
|
|
|
+ var itemObject = this.item;
|
|
|
|
+ itemObject.enable = val || (itemObject.enable == -1 ? 1 : -1);
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Mark a collection of dates as “disabled”.
|
|
|
|
+ */
|
|
|
|
+ DatePicker.prototype.deactivate = function (type, datesToDisable) {
|
|
|
|
+
|
|
|
|
+ var calendar = this,
|
|
|
|
+ disabledItems = calendar.item.disable.slice(0);
|
|
|
|
+
|
|
|
|
+ // If we’re flipping, that’s all we need to do.
|
|
|
|
+ if (datesToDisable == 'flip') {
|
|
|
|
+ calendar.flipEnable();
|
|
|
|
+ } else if (datesToDisable === false) {
|
|
|
|
+ calendar.flipEnable(1);
|
|
|
|
+ disabledItems = [];
|
|
|
|
+ } else if (datesToDisable === true) {
|
|
|
|
+ calendar.flipEnable(-1);
|
|
|
|
+ disabledItems = [];
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Otherwise go through the dates to disable.
|
|
|
|
+ else {
|
|
|
|
+
|
|
|
|
+ datesToDisable.map(function (unitToDisable) {
|
|
|
|
+
|
|
|
|
+ var matchFound;
|
|
|
|
+
|
|
|
|
+ // When we have disabled items, check for matches.
|
|
|
|
+ // If something is matched, immediately break out.
|
|
|
|
+ for (var index = 0; index < disabledItems.length; index += 1) {
|
|
|
|
+ if (calendar.isDateExact(unitToDisable, disabledItems[index])) {
|
|
|
|
+ matchFound = true;
|
|
|
|
+ break;
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // If nothing was found, add the validated unit to the collection.
|
|
|
|
+ if (!matchFound) {
|
|
|
|
+ if (_.isInteger(unitToDisable) || _.isDate(unitToDisable) || $.isArray(unitToDisable) || $.isPlainObject(unitToDisable) && unitToDisable.from && unitToDisable.to) {
|
|
|
|
+ disabledItems.push(unitToDisable);
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Return the updated collection.
|
|
|
|
+ return disabledItems;
|
|
|
|
+ }; //DatePicker.prototype.deactivate
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Mark a collection of dates as “enabled”.
|
|
|
|
+ */
|
|
|
|
+ DatePicker.prototype.activate = function (type, datesToEnable) {
|
|
|
|
+
|
|
|
|
+ var calendar = this,
|
|
|
|
+ disabledItems = calendar.item.disable,
|
|
|
|
+ disabledItemsCount = disabledItems.length;
|
|
|
|
+
|
|
|
|
+ // If we’re flipping, that’s all we need to do.
|
|
|
|
+ if (datesToEnable == 'flip') {
|
|
|
|
+ calendar.flipEnable();
|
|
|
|
+ } else if (datesToEnable === true) {
|
|
|
|
+ calendar.flipEnable(1);
|
|
|
|
+ disabledItems = [];
|
|
|
|
+ } else if (datesToEnable === false) {
|
|
|
|
+ calendar.flipEnable(-1);
|
|
|
|
+ disabledItems = [];
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Otherwise go through the disabled dates.
|
|
|
|
+ else {
|
|
|
|
+
|
|
|
|
+ datesToEnable.map(function (unitToEnable) {
|
|
|
|
+
|
|
|
|
+ var matchFound, disabledUnit, index, isExactRange;
|
|
|
|
+
|
|
|
|
+ // Go through the disabled items and try to find a match.
|
|
|
|
+ for (index = 0; index < disabledItemsCount; index += 1) {
|
|
|
|
+
|
|
|
|
+ disabledUnit = disabledItems[index];
|
|
|
|
+
|
|
|
|
+ // When an exact match is found, remove it from the collection.
|
|
|
|
+ if (calendar.isDateExact(disabledUnit, unitToEnable)) {
|
|
|
|
+ matchFound = disabledItems[index] = null;
|
|
|
|
+ isExactRange = true;
|
|
|
|
+ break;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // When an overlapped match is found, add the “inverted” state to it.
|
|
|
|
+ else if (calendar.isDateOverlap(disabledUnit, unitToEnable)) {
|
|
|
|
+ if ($.isPlainObject(unitToEnable)) {
|
|
|
|
+ unitToEnable.inverted = true;
|
|
|
|
+ matchFound = unitToEnable;
|
|
|
|
+ } else if ($.isArray(unitToEnable)) {
|
|
|
|
+ matchFound = unitToEnable;
|
|
|
|
+ if (!matchFound[3]) matchFound.push('inverted');
|
|
|
|
+ } else if (_.isDate(unitToEnable)) {
|
|
|
|
+ matchFound = [unitToEnable.getFullYear(), unitToEnable.getMonth(), unitToEnable.getDate(), 'inverted'];
|
|
|
|
+ }
|
|
|
|
+ break;
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // If a match was found, remove a previous duplicate entry.
|
|
|
|
+ if (matchFound) for (index = 0; index < disabledItemsCount; index += 1) {
|
|
|
|
+ if (calendar.isDateExact(disabledItems[index], unitToEnable)) {
|
|
|
|
+ disabledItems[index] = null;
|
|
|
|
+ break;
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // In the event that we’re dealing with an exact range of dates,
|
|
|
|
+ // make sure there are no “inverted” dates because of it.
|
|
|
|
+ if (isExactRange) for (index = 0; index < disabledItemsCount; index += 1) {
|
|
|
|
+ if (calendar.isDateOverlap(disabledItems[index], unitToEnable)) {
|
|
|
|
+ disabledItems[index] = null;
|
|
|
|
+ break;
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // If something is still matched, add it into the collection.
|
|
|
|
+ if (matchFound) {
|
|
|
|
+ disabledItems.push(matchFound);
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Return the updated collection.
|
|
|
|
+ return disabledItems.filter(function (val) {
|
|
|
|
+ return val != null;
|
|
|
|
+ });
|
|
|
|
+ }; //DatePicker.prototype.activate
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Create a string for the nodes in the picker.
|
|
|
|
+ */
|
|
|
|
+ DatePicker.prototype.nodes = function (isOpen) {
|
|
|
|
+
|
|
|
|
+ var calendar = this,
|
|
|
|
+ settings = calendar.settings,
|
|
|
|
+ calendarItem = calendar.item,
|
|
|
|
+ nowObject = calendarItem.now,
|
|
|
|
+ selectedObject = calendarItem.select,
|
|
|
|
+ highlightedObject = calendarItem.highlight,
|
|
|
|
+ viewsetObject = calendarItem.view,
|
|
|
|
+ disabledCollection = calendarItem.disable,
|
|
|
|
+ minLimitObject = calendarItem.min,
|
|
|
|
+ maxLimitObject = calendarItem.max,
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ // Create the calendar table head using a copy of weekday labels collection.
|
|
|
|
+ // * We do a copy so we don't mutate the original array.
|
|
|
|
+ tableHead = function (collection, fullCollection) {
|
|
|
|
+
|
|
|
|
+ // If the first day should be Monday, move Sunday to the end.
|
|
|
|
+ if (settings.firstDay) {
|
|
|
|
+ collection.push(collection.shift());
|
|
|
|
+ fullCollection.push(fullCollection.shift());
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Create and return the table head group.
|
|
|
|
+ return _.node('thead', _.node('tr', _.group({
|
|
|
|
+ min: 0,
|
|
|
|
+ max: DAYS_IN_WEEK - 1,
|
|
|
|
+ i: 1,
|
|
|
|
+ node: 'th',
|
|
|
|
+ item: function (counter) {
|
|
|
|
+ return [collection[counter], settings.klass.weekdays, 'scope=col title="' + fullCollection[counter] + '"'];
|
|
|
|
+ }
|
|
|
|
+ }))); //endreturn
|
|
|
|
+
|
|
|
|
+ // Materialize modified
|
|
|
|
+ }((settings.showWeekdaysFull ? settings.weekdaysFull : settings.weekdaysLetter).slice(0), settings.weekdaysFull.slice(0)),
|
|
|
|
+ //tableHead
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ // Create the nav for next/prev month.
|
|
|
|
+ createMonthNav = function (next) {
|
|
|
|
+
|
|
|
|
+ // Otherwise, return the created month tag.
|
|
|
|
+ return _.node('div', ' ', settings.klass['nav' + (next ? 'Next' : 'Prev')] + (
|
|
|
|
+
|
|
|
|
+ // If the focused month is outside the range, disabled the button.
|
|
|
|
+ next && viewsetObject.year >= maxLimitObject.year && viewsetObject.month >= maxLimitObject.month || !next && viewsetObject.year <= minLimitObject.year && viewsetObject.month <= minLimitObject.month ? ' ' + settings.klass.navDisabled : ''), 'data-nav=' + (next || -1) + ' ' + _.ariaAttr({
|
|
|
|
+ role: 'button',
|
|
|
|
+ controls: calendar.$node[0].id + '_table'
|
|
|
|
+ }) + ' ' + 'title="' + (next ? settings.labelMonthNext : settings.labelMonthPrev) + '"'); //endreturn
|
|
|
|
+ },
|
|
|
|
+ //createMonthNav
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ // Create the month label.
|
|
|
|
+ //Materialize modified
|
|
|
|
+ createMonthLabel = function (override) {
|
|
|
|
+
|
|
|
|
+ var monthsCollection = settings.showMonthsShort ? settings.monthsShort : settings.monthsFull;
|
|
|
|
+
|
|
|
|
+ // Materialize modified
|
|
|
|
+ if (override == "short_months") {
|
|
|
|
+ monthsCollection = settings.monthsShort;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // If there are months to select, add a dropdown menu.
|
|
|
|
+ if (settings.selectMonths && override == undefined) {
|
|
|
|
+
|
|
|
|
+ return _.node('select', _.group({
|
|
|
|
+ min: 0,
|
|
|
|
+ max: 11,
|
|
|
|
+ i: 1,
|
|
|
|
+ node: 'option',
|
|
|
|
+ item: function (loopedMonth) {
|
|
|
|
+
|
|
|
|
+ return [
|
|
|
|
+
|
|
|
|
+ // The looped month and no classes.
|
|
|
|
+ monthsCollection[loopedMonth], 0,
|
|
|
|
+
|
|
|
|
+ // Set the value and selected index.
|
|
|
|
+ 'value=' + loopedMonth + (viewsetObject.month == loopedMonth ? ' selected' : '') + (viewsetObject.year == minLimitObject.year && loopedMonth < minLimitObject.month || viewsetObject.year == maxLimitObject.year && loopedMonth > maxLimitObject.month ? ' disabled' : '')];
|
|
|
|
+ }
|
|
|
|
+ }), settings.klass.selectMonth + ' browser-default', (isOpen ? '' : 'disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' + 'title="' + settings.labelMonthSelect + '"');
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Materialize modified
|
|
|
|
+ if (override == "short_months") if (selectedObject != null) return monthsCollection[selectedObject.month];else return monthsCollection[viewsetObject.month];
|
|
|
|
+
|
|
|
|
+ // If there's a need for a month selector
|
|
|
|
+ return _.node('div', monthsCollection[viewsetObject.month], settings.klass.month);
|
|
|
|
+ },
|
|
|
|
+ //createMonthLabel
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ // Create the year label.
|
|
|
|
+ // Materialize modified
|
|
|
|
+ createYearLabel = function (override) {
|
|
|
|
+
|
|
|
|
+ var focusedYear = viewsetObject.year,
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ // If years selector is set to a literal "true", set it to 5. Otherwise
|
|
|
|
+ // divide in half to get half before and half after focused year.
|
|
|
|
+ numberYears = settings.selectYears === true ? 5 : ~~(settings.selectYears / 2);
|
|
|
|
+
|
|
|
|
+ // If there are years to select, add a dropdown menu.
|
|
|
|
+ if (numberYears) {
|
|
|
|
+
|
|
|
|
+ var minYear = minLimitObject.year,
|
|
|
|
+ maxYear = maxLimitObject.year,
|
|
|
|
+ lowestYear = focusedYear - numberYears,
|
|
|
|
+ highestYear = focusedYear + numberYears;
|
|
|
|
+
|
|
|
|
+ // If the min year is greater than the lowest year, increase the highest year
|
|
|
|
+ // by the difference and set the lowest year to the min year.
|
|
|
|
+ if (minYear > lowestYear) {
|
|
|
|
+ highestYear += minYear - lowestYear;
|
|
|
|
+ lowestYear = minYear;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // If the max year is less than the highest year, decrease the lowest year
|
|
|
|
+ // by the lower of the two: available and needed years. Then set the
|
|
|
|
+ // highest year to the max year.
|
|
|
|
+ if (maxYear < highestYear) {
|
|
|
|
+
|
|
|
|
+ var availableYears = lowestYear - minYear,
|
|
|
|
+ neededYears = highestYear - maxYear;
|
|
|
|
+
|
|
|
|
+ lowestYear -= availableYears > neededYears ? neededYears : availableYears;
|
|
|
|
+ highestYear = maxYear;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ if (settings.selectYears && override == undefined) {
|
|
|
|
+ return _.node('select', _.group({
|
|
|
|
+ min: lowestYear,
|
|
|
|
+ max: highestYear,
|
|
|
|
+ i: 1,
|
|
|
|
+ node: 'option',
|
|
|
|
+ item: function (loopedYear) {
|
|
|
|
+ return [
|
|
|
|
+
|
|
|
|
+ // The looped year and no classes.
|
|
|
|
+ loopedYear, 0,
|
|
|
|
+
|
|
|
|
+ // Set the value and selected index.
|
|
|
|
+ 'value=' + loopedYear + (focusedYear == loopedYear ? ' selected' : '')];
|
|
|
|
+ }
|
|
|
|
+ }), settings.klass.selectYear + ' browser-default', (isOpen ? '' : 'disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' + 'title="' + settings.labelYearSelect + '"');
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Materialize modified
|
|
|
|
+ if (override === 'raw' && selectedObject != null) {
|
|
|
|
+ return _.node('div', selectedObject.year);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Otherwise just return the year focused
|
|
|
|
+ return _.node('div', focusedYear, settings.klass.year);
|
|
|
|
+ }; //createYearLabel
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ // Materialize modified
|
|
|
|
+ createDayLabel = function () {
|
|
|
|
+ if (selectedObject != null) return selectedObject.date;else return nowObject.date;
|
|
|
|
+ };
|
|
|
|
+ createWeekdayLabel = function () {
|
|
|
|
+ var display_day;
|
|
|
|
+
|
|
|
|
+ if (selectedObject != null) display_day = selectedObject.day;else display_day = nowObject.day;
|
|
|
|
+ var weekday = settings.weekdaysShort[display_day];
|
|
|
|
+ return weekday;
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ // Create and return the entire calendar.
|
|
|
|
+
|
|
|
|
+ return _.node(
|
|
|
|
+ // Date presentation View
|
|
|
|
+ 'div', _.node(
|
|
|
|
+ // Div for Year
|
|
|
|
+ 'div', createYearLabel("raw"), settings.klass.year_display) + _.node('span', createWeekdayLabel() + ', ', "picker__weekday-display") + _.node(
|
|
|
|
+ // Div for short Month
|
|
|
|
+ 'span', createMonthLabel("short_months") + ' ', settings.klass.month_display) + _.node(
|
|
|
|
+ // Div for Day
|
|
|
|
+ 'span', createDayLabel(), settings.klass.day_display), settings.klass.date_display) +
|
|
|
|
+ // Calendar container
|
|
|
|
+ _.node('div', _.node('div', _.node('div', (settings.selectYears ? createMonthLabel() + createYearLabel() : createMonthLabel() + createYearLabel()) + createMonthNav() + createMonthNav(1), settings.klass.header) + _.node('table', tableHead + _.node('tbody', _.group({
|
|
|
|
+ min: 0,
|
|
|
|
+ max: WEEKS_IN_CALENDAR - 1,
|
|
|
|
+ i: 1,
|
|
|
|
+ node: 'tr',
|
|
|
|
+ item: function (rowCounter) {
|
|
|
|
+
|
|
|
|
+ // If Monday is the first day and the month starts on Sunday, shift the date back a week.
|
|
|
|
+ var shiftDateBy = settings.firstDay && calendar.create([viewsetObject.year, viewsetObject.month, 1]).day === 0 ? -7 : 0;
|
|
|
|
+
|
|
|
|
+ return [_.group({
|
|
|
|
+ min: DAYS_IN_WEEK * rowCounter - viewsetObject.day + shiftDateBy + 1, // Add 1 for weekday 0index
|
|
|
|
+ max: function () {
|
|
|
|
+ return this.min + DAYS_IN_WEEK - 1;
|
|
|
|
+ },
|
|
|
|
+ i: 1,
|
|
|
|
+ node: 'td',
|
|
|
|
+ item: function (targetDate) {
|
|
|
|
+
|
|
|
|
+ // Convert the time date from a relative date to a target date.
|
|
|
|
+ targetDate = calendar.create([viewsetObject.year, viewsetObject.month, targetDate + (settings.firstDay ? 1 : 0)]);
|
|
|
|
+
|
|
|
|
+ var isSelected = selectedObject && selectedObject.pick == targetDate.pick,
|
|
|
|
+ isHighlighted = highlightedObject && highlightedObject.pick == targetDate.pick,
|
|
|
|
+ isDisabled = disabledCollection && calendar.disabled(targetDate) || targetDate.pick < minLimitObject.pick || targetDate.pick > maxLimitObject.pick,
|
|
|
|
+ formattedDate = _.trigger(calendar.formats.toString, calendar, [settings.format, targetDate]);
|
|
|
|
+
|
|
|
|
+ return [_.node('div', targetDate.date, function (klasses) {
|
|
|
|
+
|
|
|
|
+ // Add the `infocus` or `outfocus` classes based on month in view.
|
|
|
|
+ klasses.push(viewsetObject.month == targetDate.month ? settings.klass.infocus : settings.klass.outfocus);
|
|
|
|
+
|
|
|
|
+ // Add the `today` class if needed.
|
|
|
|
+ if (nowObject.pick == targetDate.pick) {
|
|
|
|
+ klasses.push(settings.klass.now);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Add the `selected` class if something's selected and the time matches.
|
|
|
|
+ if (isSelected) {
|
|
|
|
+ klasses.push(settings.klass.selected);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Add the `highlighted` class if something's highlighted and the time matches.
|
|
|
|
+ if (isHighlighted) {
|
|
|
|
+ klasses.push(settings.klass.highlighted);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Add the `disabled` class if something's disabled and the object matches.
|
|
|
|
+ if (isDisabled) {
|
|
|
|
+ klasses.push(settings.klass.disabled);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ return klasses.join(' ');
|
|
|
|
+ }([settings.klass.day]), 'data-pick=' + targetDate.pick + ' ' + _.ariaAttr({
|
|
|
|
+ role: 'gridcell',
|
|
|
|
+ label: formattedDate,
|
|
|
|
+ selected: isSelected && calendar.$node.val() === formattedDate ? true : null,
|
|
|
|
+ activedescendant: isHighlighted ? true : null,
|
|
|
|
+ disabled: isDisabled ? true : null
|
|
|
|
+ }) + ' ' + (isDisabled ? '' : 'tabindex="0"')), '', _.ariaAttr({ role: 'presentation' })]; //endreturn
|
|
|
|
+ }
|
|
|
|
+ })]; //endreturn
|
|
|
|
+ }
|
|
|
|
+ })), settings.klass.table, 'id="' + calendar.$node[0].id + '_table' + '" ' + _.ariaAttr({
|
|
|
|
+ role: 'grid',
|
|
|
|
+ controls: calendar.$node[0].id,
|
|
|
|
+ readonly: true
|
|
|
|
+ })), settings.klass.calendar_container) // end calendar
|
|
|
|
+
|
|
|
|
+ +
|
|
|
|
+
|
|
|
|
+ // * For Firefox forms to submit, make sure to set the buttons’ `type` attributes as “button”.
|
|
|
|
+ _.node('div', _.node('button', settings.today, "btn-flat picker__today waves-effect", 'type=button data-pick=' + nowObject.pick + (isOpen && !calendar.disabled(nowObject) ? '' : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })) + _.node('button', settings.clear, "btn-flat picker__clear waves-effect", 'type=button data-clear=1' + (isOpen ? '' : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })) + _.node('button', settings.close, "btn-flat picker__close waves-effect", 'type=button data-close=true ' + (isOpen ? '' : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })), settings.klass.footer), 'picker__container__wrapper'); //endreturn
|
|
|
|
+ }; //DatePicker.prototype.nodes
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * The date picker defaults.
|
|
|
|
+ */
|
|
|
|
+ DatePicker.defaults = function (prefix) {
|
|
|
|
+
|
|
|
|
+ return {
|
|
|
|
+
|
|
|
|
+ // The title label to use for the month nav buttons
|
|
|
|
+ labelMonthNext: 'Next month',
|
|
|
|
+ labelMonthPrev: 'Previous month',
|
|
|
|
+
|
|
|
|
+ // The title label to use for the dropdown selectors
|
|
|
|
+ labelMonthSelect: 'Select a month',
|
|
|
|
+ labelYearSelect: 'Select a year',
|
|
|
|
+
|
|
|
|
+ // Months and weekdays
|
|
|
|
+ monthsFull: ['January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December'],
|
|
|
|
+ monthsShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'],
|
|
|
|
+ weekdaysFull: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'],
|
|
|
|
+ weekdaysShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'],
|
|
|
|
+
|
|
|
|
+ // Materialize modified
|
|
|
|
+ weekdaysLetter: ['S', 'M', 'T', 'W', 'T', 'F', 'S'],
|
|
|
|
+
|
|
|
|
+ // Today and clear
|
|
|
|
+ today: 'Today',
|
|
|
|
+ clear: 'Clear',
|
|
|
|
+ close: 'Ok',
|
|
|
|
+
|
|
|
|
+ // Picker close behavior (Prevent a change in behaviour for backwards compatibility)
|
|
|
|
+ closeOnSelect: false,
|
|
|
|
+
|
|
|
|
+ // The format to show on the `input` element
|
|
|
|
+ format: 'd mmmm, yyyy',
|
|
|
|
+
|
|
|
|
+ // Classes
|
|
|
|
+ klass: {
|
|
|
|
+
|
|
|
|
+ table: prefix + 'table',
|
|
|
|
+
|
|
|
|
+ header: prefix + 'header',
|
|
|
|
+
|
|
|
|
+ // Materialize Added klasses
|
|
|
|
+ date_display: prefix + 'date-display',
|
|
|
|
+ day_display: prefix + 'day-display',
|
|
|
|
+ month_display: prefix + 'month-display',
|
|
|
|
+ year_display: prefix + 'year-display',
|
|
|
|
+ calendar_container: prefix + 'calendar-container',
|
|
|
|
+ // end
|
|
|
|
+
|
|
|
|
+
|
|
|
|
+ navPrev: prefix + 'nav--prev',
|
|
|
|
+ navNext: prefix + 'nav--next',
|
|
|
|
+ navDisabled: prefix + 'nav--disabled',
|
|
|
|
+
|
|
|
|
+ month: prefix + 'month',
|
|
|
|
+ year: prefix + 'year',
|
|
|
|
+
|
|
|
|
+ selectMonth: prefix + 'select--month',
|
|
|
|
+ selectYear: prefix + 'select--year',
|
|
|
|
+
|
|
|
|
+ weekdays: prefix + 'weekday',
|
|
|
|
+
|
|
|
|
+ day: prefix + 'day',
|
|
|
|
+ disabled: prefix + 'day--disabled',
|
|
|
|
+ selected: prefix + 'day--selected',
|
|
|
|
+ highlighted: prefix + 'day--highlighted',
|
|
|
|
+ now: prefix + 'day--today',
|
|
|
|
+ infocus: prefix + 'day--infocus',
|
|
|
|
+ outfocus: prefix + 'day--outfocus',
|
|
|
|
+
|
|
|
|
+ footer: prefix + 'footer',
|
|
|
|
+
|
|
|
|
+ buttonClear: prefix + 'button--clear',
|
|
|
|
+ buttonToday: prefix + 'button--today',
|
|
|
|
+ buttonClose: prefix + 'button--close'
|
|
|
|
+ }
|
|
|
|
+ };
|
|
|
|
+ }(Picker.klasses().picker + '__');
|
|
|
|
+
|
|
|
|
+ /**
|
|
|
|
+ * Extend the picker to add the date picker.
|
|
|
|
+ */
|
|
|
|
+ Picker.extend('pickadate', DatePicker);
|
|
|
|
+});
|
|
|
|
+; /*!
|
|
|
|
+ * ClockPicker v0.0.7 (http://weareoutman.github.io/clockpicker/)
|
|
|
|
+ * Copyright 2014 Wang Shenwei.
|
|
|
|
+ * Licensed under MIT (https://github.com/weareoutman/clockpicker/blob/gh-pages/LICENSE)
|
|
|
|
+ *
|
|
|
|
+ * Further modified
|
|
|
|
+ * Copyright 2015 Ching Yaw Hao.
|
|
|
|
+ */
|
|
|
|
+
|
|
|
|
+(function ($) {
|
|
|
|
+ var $win = $(window),
|
|
|
|
+ $doc = $(document);
|
|
|
|
+
|
|
|
|
+ // Can I use inline svg ?
|
|
|
|
+ var svgNS = 'http://www.w3.org/2000/svg',
|
|
|
|
+ svgSupported = 'SVGAngle' in window && function () {
|
|
|
|
+ var supported,
|
|
|
|
+ el = document.createElement('div');
|
|
|
|
+ el.innerHTML = '<svg/>';
|
|
|
|
+ supported = (el.firstChild && el.firstChild.namespaceURI) == svgNS;
|
|
|
|
+ el.innerHTML = '';
|
|
|
|
+ return supported;
|
|
|
|
+ }();
|
|
|
|
+
|
|
|
|
+ // Can I use transition ?
|
|
|
|
+ var transitionSupported = function () {
|
|
|
|
+ var style = document.createElement('div').style;
|
|
|
|
+ return 'transition' in style || 'WebkitTransition' in style || 'MozTransition' in style || 'msTransition' in style || 'OTransition' in style;
|
|
|
|
+ }();
|
|
|
|
+
|
|
|
|
+ // Listen touch events in touch screen device, instead of mouse events in desktop.
|
|
|
|
+ var touchSupported = 'ontouchstart' in window,
|
|
|
|
+ mousedownEvent = 'mousedown' + (touchSupported ? ' touchstart' : ''),
|
|
|
|
+ mousemoveEvent = 'mousemove.clockpicker' + (touchSupported ? ' touchmove.clockpicker' : ''),
|
|
|
|
+ mouseupEvent = 'mouseup.clockpicker' + (touchSupported ? ' touchend.clockpicker' : '');
|
|
|
|
+
|
|
|
|
+ // Vibrate the device if supported
|
|
|
|
+ var vibrate = navigator.vibrate ? 'vibrate' : navigator.webkitVibrate ? 'webkitVibrate' : null;
|
|
|
|
+
|
|
|
|
+ function createSvgElement(name) {
|
|
|
|
+ return document.createElementNS(svgNS, name);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ function leadingZero(num) {
|
|
|
|
+ return (num < 10 ? '0' : '') + num;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Get a unique id
|
|
|
|
+ var idCounter = 0;
|
|
|
|
+ function uniqueId(prefix) {
|
|
|
|
+ var id = ++idCounter + '';
|
|
|
|
+ return prefix ? prefix + id : id;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Clock size
|
|
|
|
+ var dialRadius = 135,
|
|
|
|
+ outerRadius = 105,
|
|
|
|
+
|
|
|
|
+ // innerRadius = 80 on 12 hour clock
|
|
|
|
+ innerRadius = 70,
|
|
|
|
+ tickRadius = 20,
|
|
|
|
+ diameter = dialRadius * 2,
|
|
|
|
+ duration = transitionSupported ? 350 : 1;
|
|
|
|
+
|
|
|
|
+ // Popover template
|
|
|
|
+ var tpl = ['<div class="clockpicker picker">', '<div class="picker__holder">', '<div class="picker__frame">', '<div class="picker__wrap">', '<div class="picker__box">', '<div class="picker__date-display">', '<div class="clockpicker-display">', '<div class="clockpicker-display-column">', '<span class="clockpicker-span-hours text-primary"></span>', ':', '<span class="clockpicker-span-minutes"></span>', '</div>', '<div class="clockpicker-display-column clockpicker-display-am-pm">', '<div class="clockpicker-span-am-pm"></div>', '</div>', '</div>', '</div>', '<div class="picker__container__wrapper">', '<div class="picker__calendar-container">', '<div class="clockpicker-plate">', '<div class="clockpicker-canvas"></div>', '<div class="clockpicker-dial clockpicker-hours"></div>', '<div class="clockpicker-dial clockpicker-minutes clockpicker-dial-out"></div>', '</div>', '<div class="clockpicker-am-pm-block">', '</div>', '</div>', '<div class="picker__footer">', '</div>', '</div>', '</div>', '</div>', '</div>', '</div>', '</div>'].join('');
|
|
|
|
+
|
|
|
|
+ // ClockPicker
|
|
|
|
+ function ClockPicker(element, options) {
|
|
|
|
+ var popover = $(tpl),
|
|
|
|
+ plate = popover.find('.clockpicker-plate'),
|
|
|
|
+ holder = popover.find('.picker__holder'),
|
|
|
|
+ hoursView = popover.find('.clockpicker-hours'),
|
|
|
|
+ minutesView = popover.find('.clockpicker-minutes'),
|
|
|
|
+ amPmBlock = popover.find('.clockpicker-am-pm-block'),
|
|
|
|
+ isInput = element.prop('tagName') === 'INPUT',
|
|
|
|
+ input = isInput ? element : element.find('input'),
|
|
|
|
+ label = $("label[for=" + input.attr("id") + "]"),
|
|
|
|
+ self = this;
|
|
|
|
+
|
|
|
|
+ this.id = uniqueId('cp');
|
|
|
|
+ this.element = element;
|
|
|
|
+ this.holder = holder;
|
|
|
|
+ this.options = options;
|
|
|
|
+ this.isAppended = false;
|
|
|
|
+ this.isShown = false;
|
|
|
|
+ this.currentView = 'hours';
|
|
|
|
+ this.isInput = isInput;
|
|
|
|
+ this.input = input;
|
|
|
|
+ this.label = label;
|
|
|
|
+ this.popover = popover;
|
|
|
|
+ this.plate = plate;
|
|
|
|
+ this.hoursView = hoursView;
|
|
|
|
+ this.minutesView = minutesView;
|
|
|
|
+ this.amPmBlock = amPmBlock;
|
|
|
|
+ this.spanHours = popover.find('.clockpicker-span-hours');
|
|
|
|
+ this.spanMinutes = popover.find('.clockpicker-span-minutes');
|
|
|
|
+ this.spanAmPm = popover.find('.clockpicker-span-am-pm');
|
|
|
|
+ this.footer = popover.find('.picker__footer');
|
|
|
|
+ this.amOrPm = "PM";
|
|
|
|
+
|
|
|
|
+ // Setup for for 12 hour clock if option is selected
|
|
|
|
+ if (options.twelvehour) {
|
|
|
|
+ if (!options.ampmclickable) {
|
|
|
|
+ this.spanAmPm.empty();
|
|
|
|
+ $('<div id="click-am">AM</div>').appendTo(this.spanAmPm);
|
|
|
|
+ $('<div id="click-pm">PM</div>').appendTo(this.spanAmPm);
|
|
|
|
+ } else {
|
|
|
|
+ this.spanAmPm.empty();
|
|
|
|
+ $('<div id="click-am">AM</div>').on("click", function () {
|
|
|
|
+ self.spanAmPm.children('#click-am').addClass("text-primary");
|
|
|
|
+ self.spanAmPm.children('#click-pm').removeClass("text-primary");
|
|
|
|
+ self.amOrPm = "AM";
|
|
|
|
+ }).appendTo(this.spanAmPm);
|
|
|
|
+ $('<div id="click-pm">PM</div>').on("click", function () {
|
|
|
|
+ self.spanAmPm.children('#click-pm').addClass("text-primary");
|
|
|
|
+ self.spanAmPm.children('#click-am').removeClass("text-primary");
|
|
|
|
+ self.amOrPm = 'PM';
|
|
|
|
+ }).appendTo(this.spanAmPm);
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Add buttons to footer
|
|
|
|
+ $('<button type="button" class="btn-flat picker__clear" tabindex="' + (options.twelvehour ? '3' : '1') + '">' + options.cleartext + '</button>').click($.proxy(this.clear, this)).appendTo(this.footer);
|
|
|
|
+ $('<button type="button" class="btn-flat picker__close" tabindex="' + (options.twelvehour ? '3' : '1') + '">' + options.canceltext + '</button>').click($.proxy(this.hide, this)).appendTo(this.footer);
|
|
|
|
+ $('<button type="button" class="btn-flat picker__close" tabindex="' + (options.twelvehour ? '3' : '1') + '">' + options.donetext + '</button>').click($.proxy(this.done, this)).appendTo(this.footer);
|
|
|
|
+
|
|
|
|
+ this.spanHours.click($.proxy(this.toggleView, this, 'hours'));
|
|
|
|
+ this.spanMinutes.click($.proxy(this.toggleView, this, 'minutes'));
|
|
|
|
+
|
|
|
|
+ // Show or toggle
|
|
|
|
+ input.on('focus.clockpicker click.clockpicker', $.proxy(this.show, this));
|
|
|
|
+
|
|
|
|
+ // Build ticks
|
|
|
|
+ var tickTpl = $('<div class="clockpicker-tick"></div>'),
|
|
|
|
+ i,
|
|
|
|
+ tick,
|
|
|
|
+ radian,
|
|
|
|
+ radius;
|
|
|
|
+
|
|
|
|
+ // Hours view
|
|
|
|
+ if (options.twelvehour) {
|
|
|
|
+ for (i = 1; i < 13; i += 1) {
|
|
|
|
+ tick = tickTpl.clone();
|
|
|
|
+ radian = i / 6 * Math.PI;
|
|
|
|
+ radius = outerRadius;
|
|
|
|
+ tick.css({
|
|
|
|
+ left: dialRadius + Math.sin(radian) * radius - tickRadius,
|
|
|
|
+ top: dialRadius - Math.cos(radian) * radius - tickRadius
|
|
|
|
+ });
|
|
|
|
+ tick.html(i === 0 ? '00' : i);
|
|
|
|
+ hoursView.append(tick);
|
|
|
|
+ tick.on(mousedownEvent, mousedown);
|
|
|
|
+ }
|
|
|
|
+ } else {
|
|
|
|
+ for (i = 0; i < 24; i += 1) {
|
|
|
|
+ tick = tickTpl.clone();
|
|
|
|
+ radian = i / 6 * Math.PI;
|
|
|
|
+ var inner = i > 0 && i < 13;
|
|
|
|
+ radius = inner ? innerRadius : outerRadius;
|
|
|
|
+ tick.css({
|
|
|
|
+ left: dialRadius + Math.sin(radian) * radius - tickRadius,
|
|
|
|
+ top: dialRadius - Math.cos(radian) * radius - tickRadius
|
|
|
|
+ });
|
|
|
|
+ tick.html(i === 0 ? '00' : i);
|
|
|
|
+ hoursView.append(tick);
|
|
|
|
+ tick.on(mousedownEvent, mousedown);
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Minutes view
|
|
|
|
+ for (i = 0; i < 60; i += 5) {
|
|
|
|
+ tick = tickTpl.clone();
|
|
|
|
+ radian = i / 30 * Math.PI;
|
|
|
|
+ tick.css({
|
|
|
|
+ left: dialRadius + Math.sin(radian) * outerRadius - tickRadius,
|
|
|
|
+ top: dialRadius - Math.cos(radian) * outerRadius - tickRadius
|
|
|
|
+ });
|
|
|
|
+ tick.html(leadingZero(i));
|
|
|
|
+ minutesView.append(tick);
|
|
|
|
+ tick.on(mousedownEvent, mousedown);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Clicking on minutes view space
|
|
|
|
+ plate.on(mousedownEvent, function (e) {
|
|
|
|
+ if ($(e.target).closest('.clockpicker-tick').length === 0) {
|
|
|
|
+ mousedown(e, true);
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // Mousedown or touchstart
|
|
|
|
+ function mousedown(e, space) {
|
|
|
|
+ var offset = plate.offset(),
|
|
|
|
+ isTouch = /^touch/.test(e.type),
|
|
|
|
+ x0 = offset.left + dialRadius,
|
|
|
|
+ y0 = offset.top + dialRadius,
|
|
|
|
+ dx = (isTouch ? e.originalEvent.touches[0] : e).pageX - x0,
|
|
|
|
+ dy = (isTouch ? e.originalEvent.touches[0] : e).pageY - y0,
|
|
|
|
+ z = Math.sqrt(dx * dx + dy * dy),
|
|
|
|
+ moved = false;
|
|
|
|
+
|
|
|
|
+ // When clicking on minutes view space, check the mouse position
|
|
|
|
+ if (space && (z < outerRadius - tickRadius || z > outerRadius + tickRadius)) {
|
|
|
|
+ return;
|
|
|
|
+ }
|
|
|
|
+ e.preventDefault();
|
|
|
|
+
|
|
|
|
+ // Set cursor style of body after 200ms
|
|
|
|
+ var movingTimer = setTimeout(function () {
|
|
|
|
+ self.popover.addClass('clockpicker-moving');
|
|
|
|
+ }, 200);
|
|
|
|
+
|
|
|
|
+ // Clock
|
|
|
|
+ self.setHand(dx, dy, !space, true);
|
|
|
|
+
|
|
|
|
+ // Mousemove on document
|
|
|
|
+ $doc.off(mousemoveEvent).on(mousemoveEvent, function (e) {
|
|
|
|
+ e.preventDefault();
|
|
|
|
+ var isTouch = /^touch/.test(e.type),
|
|
|
|
+ x = (isTouch ? e.originalEvent.touches[0] : e).pageX - x0,
|
|
|
|
+ y = (isTouch ? e.originalEvent.touches[0] : e).pageY - y0;
|
|
|
|
+ if (!moved && x === dx && y === dy) {
|
|
|
|
+ // Clicking in chrome on windows will trigger a mousemove event
|
|
|
|
+ return;
|
|
|
|
+ }
|
|
|
|
+ moved = true;
|
|
|
|
+ self.setHand(x, y, false, true);
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // Mouseup on document
|
|
|
|
+ $doc.off(mouseupEvent).on(mouseupEvent, function (e) {
|
|
|
|
+ $doc.off(mouseupEvent);
|
|
|
|
+ e.preventDefault();
|
|
|
|
+ var isTouch = /^touch/.test(e.type),
|
|
|
|
+ x = (isTouch ? e.originalEvent.changedTouches[0] : e).pageX - x0,
|
|
|
|
+ y = (isTouch ? e.originalEvent.changedTouches[0] : e).pageY - y0;
|
|
|
|
+ if ((space || moved) && x === dx && y === dy) {
|
|
|
|
+ self.setHand(x, y);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ if (self.currentView === 'hours') {
|
|
|
|
+ self.toggleView('minutes', duration / 2);
|
|
|
|
+ } else if (options.autoclose) {
|
|
|
|
+ self.minutesView.addClass('clockpicker-dial-out');
|
|
|
|
+ setTimeout(function () {
|
|
|
|
+ self.done();
|
|
|
|
+ }, duration / 2);
|
|
|
|
+ }
|
|
|
|
+ plate.prepend(canvas);
|
|
|
|
+
|
|
|
|
+ // Reset cursor style of body
|
|
|
|
+ clearTimeout(movingTimer);
|
|
|
|
+ self.popover.removeClass('clockpicker-moving');
|
|
|
|
+
|
|
|
|
+ // Unbind mousemove event
|
|
|
|
+ $doc.off(mousemoveEvent);
|
|
|
|
+ });
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ if (svgSupported) {
|
|
|
|
+ // Draw clock hands and others
|
|
|
|
+ var canvas = popover.find('.clockpicker-canvas'),
|
|
|
|
+ svg = createSvgElement('svg');
|
|
|
|
+ svg.setAttribute('class', 'clockpicker-svg');
|
|
|
|
+ svg.setAttribute('width', diameter);
|
|
|
|
+ svg.setAttribute('height', diameter);
|
|
|
|
+ var g = createSvgElement('g');
|
|
|
|
+ g.setAttribute('transform', 'translate(' + dialRadius + ',' + dialRadius + ')');
|
|
|
|
+ var bearing = createSvgElement('circle');
|
|
|
|
+ bearing.setAttribute('class', 'clockpicker-canvas-bearing');
|
|
|
|
+ bearing.setAttribute('cx', 0);
|
|
|
|
+ bearing.setAttribute('cy', 0);
|
|
|
|
+ bearing.setAttribute('r', 4);
|
|
|
|
+ var hand = createSvgElement('line');
|
|
|
|
+ hand.setAttribute('x1', 0);
|
|
|
|
+ hand.setAttribute('y1', 0);
|
|
|
|
+ var bg = createSvgElement('circle');
|
|
|
|
+ bg.setAttribute('class', 'clockpicker-canvas-bg');
|
|
|
|
+ bg.setAttribute('r', tickRadius);
|
|
|
|
+ g.appendChild(hand);
|
|
|
|
+ g.appendChild(bg);
|
|
|
|
+ g.appendChild(bearing);
|
|
|
|
+ svg.appendChild(g);
|
|
|
|
+ canvas.append(svg);
|
|
|
|
+
|
|
|
|
+ this.hand = hand;
|
|
|
|
+ this.bg = bg;
|
|
|
|
+ this.bearing = bearing;
|
|
|
|
+ this.g = g;
|
|
|
|
+ this.canvas = canvas;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ raiseCallback(this.options.init);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ function raiseCallback(callbackFunction) {
|
|
|
|
+ if (callbackFunction && typeof callbackFunction === "function") callbackFunction();
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Default options
|
|
|
|
+ ClockPicker.DEFAULTS = {
|
|
|
|
+ 'default': '', // default time, 'now' or '13:14' e.g.
|
|
|
|
+ fromnow: 0, // set default time to * milliseconds from now (using with default = 'now')
|
|
|
|
+ donetext: 'Ok', // done button text
|
|
|
|
+ cleartext: 'Clear',
|
|
|
|
+ canceltext: 'Cancel',
|
|
|
|
+ autoclose: false, // auto close when minute is selected
|
|
|
|
+ ampmclickable: true, // set am/pm button on itself
|
|
|
|
+ darktheme: false, // set to dark theme
|
|
|
|
+ twelvehour: true, // change to 12 hour AM/PM clock from 24 hour
|
|
|
|
+ vibrate: true // vibrate the device when dragging clock hand
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ // Show or hide popover
|
|
|
|
+ ClockPicker.prototype.toggle = function () {
|
|
|
|
+ this[this.isShown ? 'hide' : 'show']();
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ // Set popover position
|
|
|
|
+ ClockPicker.prototype.locate = function () {
|
|
|
|
+ var element = this.element,
|
|
|
|
+ popover = this.popover,
|
|
|
|
+ offset = element.offset(),
|
|
|
|
+ width = element.outerWidth(),
|
|
|
|
+ height = element.outerHeight(),
|
|
|
|
+ align = this.options.align,
|
|
|
|
+ self = this;
|
|
|
|
+
|
|
|
|
+ popover.show();
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ // Show popover
|
|
|
|
+ ClockPicker.prototype.show = function (e) {
|
|
|
|
+ // Not show again
|
|
|
|
+ if (this.isShown) {
|
|
|
|
+ return;
|
|
|
|
+ }
|
|
|
|
+ raiseCallback(this.options.beforeShow);
|
|
|
|
+ $(':input').each(function () {
|
|
|
|
+ $(this).attr('tabindex', -1);
|
|
|
|
+ });
|
|
|
|
+ var self = this;
|
|
|
|
+ // Initialize
|
|
|
|
+ this.input.blur();
|
|
|
|
+ this.popover.addClass('picker--opened');
|
|
|
|
+ this.input.addClass('picker__input picker__input--active');
|
|
|
|
+ $(document.body).css('overflow', 'hidden');
|
|
|
|
+ // Get the time
|
|
|
|
+ var value = ((this.input.prop('value') || this.options['default'] || '') + '').split(':');
|
|
|
|
+ if (this.options.twelvehour && !(typeof value[1] === 'undefined')) {
|
|
|
|
+ if (value[1].indexOf("AM") > 0) {
|
|
|
|
+ this.amOrPm = 'AM';
|
|
|
|
+ } else {
|
|
|
|
+ this.amOrPm = 'PM';
|
|
|
|
+ }
|
|
|
|
+ value[1] = value[1].replace("AM", "").replace("PM", "");
|
|
|
|
+ }
|
|
|
|
+ if (value[0] === 'now') {
|
|
|
|
+ var now = new Date(+new Date() + this.options.fromnow);
|
|
|
|
+ value = [now.getHours(), now.getMinutes()];
|
|
|
|
+ if (this.options.twelvehour) {
|
|
|
|
+ this.amOrPm = value[0] >= 12 && value[0] < 24 ? 'PM' : 'AM';
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ this.hours = +value[0] || 0;
|
|
|
|
+ this.minutes = +value[1] || 0;
|
|
|
|
+ this.spanHours.html(this.hours);
|
|
|
|
+ this.spanMinutes.html(leadingZero(this.minutes));
|
|
|
|
+ if (!this.isAppended) {
|
|
|
|
+
|
|
|
|
+ // Append popover to input by default
|
|
|
|
+ var containerEl = document.querySelector(this.options.container);
|
|
|
|
+ if (this.options.container && containerEl) {
|
|
|
|
+ containerEl.appendChild(this.popover[0]);
|
|
|
|
+ } else {
|
|
|
|
+ this.popover.insertAfter(this.input);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ if (this.options.twelvehour) {
|
|
|
|
+ if (this.amOrPm === 'PM') {
|
|
|
|
+ this.spanAmPm.children('#click-pm').addClass("text-primary");
|
|
|
|
+ this.spanAmPm.children('#click-am').removeClass("text-primary");
|
|
|
|
+ } else {
|
|
|
|
+ this.spanAmPm.children('#click-am').addClass("text-primary");
|
|
|
|
+ this.spanAmPm.children('#click-pm').removeClass("text-primary");
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ // Reset position when resize
|
|
|
|
+ $win.on('resize.clockpicker' + this.id, function () {
|
|
|
|
+ if (self.isShown) {
|
|
|
|
+ self.locate();
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ this.isAppended = true;
|
|
|
|
+ }
|
|
|
|
+ // Toggle to hours view
|
|
|
|
+ this.toggleView('hours');
|
|
|
|
+ // Set position
|
|
|
|
+ this.locate();
|
|
|
|
+ this.isShown = true;
|
|
|
|
+ // Hide when clicking or tabbing on any element except the clock and input
|
|
|
|
+ $doc.on('click.clockpicker.' + this.id + ' focusin.clockpicker.' + this.id, function (e) {
|
|
|
|
+ var target = $(e.target);
|
|
|
|
+ if (target.closest(self.popover.find('.picker__wrap')).length === 0 && target.closest(self.input).length === 0) {
|
|
|
|
+ self.hide();
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ // Hide when ESC is pressed
|
|
|
|
+ $doc.on('keyup.clockpicker.' + this.id, function (e) {
|
|
|
|
+ if (e.keyCode === 27) {
|
|
|
|
+ self.hide();
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ raiseCallback(this.options.afterShow);
|
|
|
|
+ };
|
|
|
|
+ // Hide popover
|
|
|
|
+ ClockPicker.prototype.hide = function () {
|
|
|
|
+ raiseCallback(this.options.beforeHide);
|
|
|
|
+ this.input.removeClass('picker__input picker__input--active');
|
|
|
|
+ this.popover.removeClass('picker--opened');
|
|
|
|
+ $(document.body).css('overflow', 'visible');
|
|
|
|
+ this.isShown = false;
|
|
|
|
+ $(':input').each(function (index) {
|
|
|
|
+ $(this).attr('tabindex', index + 1);
|
|
|
|
+ });
|
|
|
|
+ // Unbinding events on document
|
|
|
|
+ $doc.off('click.clockpicker.' + this.id + ' focusin.clockpicker.' + this.id);
|
|
|
|
+ $doc.off('keyup.clockpicker.' + this.id);
|
|
|
|
+ this.popover.hide();
|
|
|
|
+ raiseCallback(this.options.afterHide);
|
|
|
|
+ };
|
|
|
|
+ // Toggle to hours or minutes view
|
|
|
|
+ ClockPicker.prototype.toggleView = function (view, delay) {
|
|
|
|
+ var raiseAfterHourSelect = false;
|
|
|
|
+ if (view === 'minutes' && $(this.hoursView).css("visibility") === "visible") {
|
|
|
|
+ raiseCallback(this.options.beforeHourSelect);
|
|
|
|
+ raiseAfterHourSelect = true;
|
|
|
|
+ }
|
|
|
|
+ var isHours = view === 'hours',
|
|
|
|
+ nextView = isHours ? this.hoursView : this.minutesView,
|
|
|
|
+ hideView = isHours ? this.minutesView : this.hoursView;
|
|
|
|
+ this.currentView = view;
|
|
|
|
+
|
|
|
|
+ this.spanHours.toggleClass('text-primary', isHours);
|
|
|
|
+ this.spanMinutes.toggleClass('text-primary', !isHours);
|
|
|
|
+
|
|
|
|
+ // Let's make transitions
|
|
|
|
+ hideView.addClass('clockpicker-dial-out');
|
|
|
|
+ nextView.css('visibility', 'visible').removeClass('clockpicker-dial-out');
|
|
|
|
+
|
|
|
|
+ // Reset clock hand
|
|
|
|
+ this.resetClock(delay);
|
|
|
|
+
|
|
|
|
+ // After transitions ended
|
|
|
|
+ clearTimeout(this.toggleViewTimer);
|
|
|
|
+ this.toggleViewTimer = setTimeout(function () {
|
|
|
|
+ hideView.css('visibility', 'hidden');
|
|
|
|
+ }, duration);
|
|
|
|
+
|
|
|
|
+ if (raiseAfterHourSelect) {
|
|
|
|
+ raiseCallback(this.options.afterHourSelect);
|
|
|
|
+ }
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ // Reset clock hand
|
|
|
|
+ ClockPicker.prototype.resetClock = function (delay) {
|
|
|
|
+ var view = this.currentView,
|
|
|
|
+ value = this[view],
|
|
|
|
+ isHours = view === 'hours',
|
|
|
|
+ unit = Math.PI / (isHours ? 6 : 30),
|
|
|
|
+ radian = value * unit,
|
|
|
|
+ radius = isHours && value > 0 && value < 13 ? innerRadius : outerRadius,
|
|
|
|
+ x = Math.sin(radian) * radius,
|
|
|
|
+ y = -Math.cos(radian) * radius,
|
|
|
|
+ self = this;
|
|
|
|
+
|
|
|
|
+ if (svgSupported && delay) {
|
|
|
|
+ self.canvas.addClass('clockpicker-canvas-out');
|
|
|
|
+ setTimeout(function () {
|
|
|
|
+ self.canvas.removeClass('clockpicker-canvas-out');
|
|
|
|
+ self.setHand(x, y);
|
|
|
|
+ }, delay);
|
|
|
|
+ } else this.setHand(x, y);
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ // Set clock hand to (x, y)
|
|
|
|
+ ClockPicker.prototype.setHand = function (x, y, roundBy5, dragging) {
|
|
|
|
+ var radian = Math.atan2(x, -y),
|
|
|
|
+ isHours = this.currentView === 'hours',
|
|
|
|
+ unit = Math.PI / (isHours || roundBy5 ? 6 : 30),
|
|
|
|
+ z = Math.sqrt(x * x + y * y),
|
|
|
|
+ options = this.options,
|
|
|
|
+ inner = isHours && z < (outerRadius + innerRadius) / 2,
|
|
|
|
+ radius = inner ? innerRadius : outerRadius,
|
|
|
|
+ value;
|
|
|
|
+
|
|
|
|
+ if (options.twelvehour) {
|
|
|
|
+ radius = outerRadius;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Radian should in range [0, 2PI]
|
|
|
|
+ if (radian < 0) {
|
|
|
|
+ radian = Math.PI * 2 + radian;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Get the round value
|
|
|
|
+ value = Math.round(radian / unit);
|
|
|
|
+
|
|
|
|
+ // Get the round radian
|
|
|
|
+ radian = value * unit;
|
|
|
|
+
|
|
|
|
+ // Correct the hours or minutes
|
|
|
|
+ if (options.twelvehour) {
|
|
|
|
+ if (isHours) {
|
|
|
|
+ if (value === 0) value = 12;
|
|
|
|
+ } else {
|
|
|
|
+ if (roundBy5) value *= 5;
|
|
|
|
+ if (value === 60) value = 0;
|
|
|
|
+ }
|
|
|
|
+ } else {
|
|
|
|
+ if (isHours) {
|
|
|
|
+ if (value === 12) value = 0;
|
|
|
|
+ value = inner ? value === 0 ? 12 : value : value === 0 ? 0 : value + 12;
|
|
|
|
+ } else {
|
|
|
|
+ if (roundBy5) value *= 5;
|
|
|
|
+ if (value === 60) value = 0;
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Once hours or minutes changed, vibrate the device
|
|
|
|
+ if (this[this.currentView] !== value) {
|
|
|
|
+ if (vibrate && this.options.vibrate) {
|
|
|
|
+ // Do not vibrate too frequently
|
|
|
|
+ if (!this.vibrateTimer) {
|
|
|
|
+ navigator[vibrate](10);
|
|
|
|
+ this.vibrateTimer = setTimeout($.proxy(function () {
|
|
|
|
+ this.vibrateTimer = null;
|
|
|
|
+ }, this), 100);
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ this[this.currentView] = value;
|
|
|
|
+ if (isHours) {
|
|
|
|
+ this['spanHours'].html(value);
|
|
|
|
+ } else {
|
|
|
|
+ this['spanMinutes'].html(leadingZero(value));
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // If svg is not supported, just add an active class to the tick
|
|
|
|
+ if (!svgSupported) {
|
|
|
|
+ this[isHours ? 'hoursView' : 'minutesView'].find('.clockpicker-tick').each(function () {
|
|
|
|
+ var tick = $(this);
|
|
|
|
+ tick.toggleClass('active', value === +tick.html());
|
|
|
|
+ });
|
|
|
|
+ return;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Set clock hand and others' position
|
|
|
|
+ var cx1 = Math.sin(radian) * (radius - tickRadius),
|
|
|
|
+ cy1 = -Math.cos(radian) * (radius - tickRadius),
|
|
|
|
+ cx2 = Math.sin(radian) * radius,
|
|
|
|
+ cy2 = -Math.cos(radian) * radius;
|
|
|
|
+ this.hand.setAttribute('x2', cx1);
|
|
|
|
+ this.hand.setAttribute('y2', cy1);
|
|
|
|
+ this.bg.setAttribute('cx', cx2);
|
|
|
|
+ this.bg.setAttribute('cy', cy2);
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ // Hours and minutes are selected
|
|
|
|
+ ClockPicker.prototype.done = function () {
|
|
|
|
+ raiseCallback(this.options.beforeDone);
|
|
|
|
+ this.hide();
|
|
|
|
+ this.label.addClass('active');
|
|
|
|
+
|
|
|
|
+ var last = this.input.prop('value'),
|
|
|
|
+ value = leadingZero(this.hours) + ':' + leadingZero(this.minutes);
|
|
|
|
+ if (this.options.twelvehour) {
|
|
|
|
+ value = value + this.amOrPm;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ this.input.prop('value', value);
|
|
|
|
+ if (value !== last) {
|
|
|
|
+ this.input.triggerHandler('change');
|
|
|
|
+ if (!this.isInput) {
|
|
|
|
+ this.element.trigger('change');
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ if (this.options.autoclose) this.input.trigger('blur');
|
|
|
|
+
|
|
|
|
+ raiseCallback(this.options.afterDone);
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ // Clear input field
|
|
|
|
+ ClockPicker.prototype.clear = function () {
|
|
|
|
+ this.hide();
|
|
|
|
+ this.label.removeClass('active');
|
|
|
|
+
|
|
|
|
+ var last = this.input.prop('value'),
|
|
|
|
+ value = '';
|
|
|
|
+
|
|
|
|
+ this.input.prop('value', value);
|
|
|
|
+ if (value !== last) {
|
|
|
|
+ this.input.triggerHandler('change');
|
|
|
|
+ if (!this.isInput) {
|
|
|
|
+ this.element.trigger('change');
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ if (this.options.autoclose) {
|
|
|
|
+ this.input.trigger('blur');
|
|
|
|
+ }
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ // Remove clockpicker from input
|
|
|
|
+ ClockPicker.prototype.remove = function () {
|
|
|
|
+ this.element.removeData('clockpicker');
|
|
|
|
+ this.input.off('focus.clockpicker click.clockpicker');
|
|
|
|
+ if (this.isShown) {
|
|
|
|
+ this.hide();
|
|
|
|
+ }
|
|
|
|
+ if (this.isAppended) {
|
|
|
|
+ $win.off('resize.clockpicker' + this.id);
|
|
|
|
+ this.popover.remove();
|
|
|
|
+ }
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ // Extends $.fn.clockpicker
|
|
|
|
+ $.fn.pickatime = function (option) {
|
|
|
|
+ var args = Array.prototype.slice.call(arguments, 1);
|
|
|
|
+ return this.each(function () {
|
|
|
|
+ var $this = $(this),
|
|
|
|
+ data = $this.data('clockpicker');
|
|
|
|
+ if (!data) {
|
|
|
|
+ var options = $.extend({}, ClockPicker.DEFAULTS, $this.data(), typeof option == 'object' && option);
|
|
|
|
+ $this.data('clockpicker', new ClockPicker($this, options));
|
|
|
|
+ } else {
|
|
|
|
+ // Manual operatsions. show, hide, remove, e.g.
|
|
|
|
+ if (typeof data[option] === 'function') {
|
|
|
|
+ data[option].apply(data, args);
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ };
|
|
|
|
+})(jQuery);
|
|
|
|
+;(function ($) {
|
|
|
|
+
|
|
|
|
+ $.fn.characterCounter = function () {
|
|
|
|
+ return this.each(function () {
|
|
|
|
+ var $input = $(this);
|
|
|
|
+ var $counterElement = $input.parent().find('span[class="character-counter"]');
|
|
|
|
+
|
|
|
|
+ // character counter has already been added appended to the parent container
|
|
|
|
+ if ($counterElement.length) {
|
|
|
|
+ return;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ var itHasLengthAttribute = $input.attr('data-length') !== undefined;
|
|
|
|
+
|
|
|
|
+ if (itHasLengthAttribute) {
|
|
|
|
+ $input.on('input', updateCounter);
|
|
|
|
+ $input.on('focus', updateCounter);
|
|
|
|
+ $input.on('blur', removeCounterElement);
|
|
|
|
+
|
|
|
|
+ addCounterElement($input);
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ function updateCounter() {
|
|
|
|
+ var maxLength = +$(this).attr('data-length'),
|
|
|
|
+ actualLength = +$(this).val().length,
|
|
|
|
+ isValidLength = actualLength <= maxLength;
|
|
|
|
+
|
|
|
|
+ $(this).parent().find('span[class="character-counter"]').html(actualLength + '/' + maxLength);
|
|
|
|
+
|
|
|
|
+ addInputStyle(isValidLength, $(this));
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ function addCounterElement($input) {
|
|
|
|
+ var $counterElement = $input.parent().find('span[class="character-counter"]');
|
|
|
|
+
|
|
|
|
+ if ($counterElement.length) {
|
|
|
|
+ return;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ $counterElement = $('<span/>').addClass('character-counter').css('float', 'right').css('font-size', '12px').css('height', 1);
|
|
|
|
+
|
|
|
|
+ $input.parent().append($counterElement);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ function removeCounterElement() {
|
|
|
|
+ $(this).parent().find('span[class="character-counter"]').html('');
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ function addInputStyle(isValidLength, $input) {
|
|
|
|
+ var inputHasInvalidClass = $input.hasClass('invalid');
|
|
|
|
+ if (isValidLength && inputHasInvalidClass) {
|
|
|
|
+ $input.removeClass('invalid');
|
|
|
|
+ } else if (!isValidLength && !inputHasInvalidClass) {
|
|
|
|
+ $input.removeClass('valid');
|
|
|
|
+ $input.addClass('invalid');
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ $(document).ready(function () {
|
|
|
|
+ $('input, textarea').characterCounter();
|
|
|
|
+ });
|
|
|
|
+})(jQuery);
|
|
|
|
+;(function ($) {
|
|
|
|
+
|
|
|
|
+ var methods = {
|
|
|
|
+
|
|
|
|
+ init: function (options) {
|
|
|
|
+ var defaults = {
|
|
|
|
+ duration: 200, // ms
|
|
|
|
+ dist: -100, // zoom scale TODO: make this more intuitive as an option
|
|
|
|
+ shift: 0, // spacing for center image
|
|
|
|
+ padding: 0, // Padding between non center items
|
|
|
|
+ fullWidth: false, // Change to full width styles
|
|
|
|
+ indicators: false, // Toggle indicators
|
|
|
|
+ noWrap: false, // Don't wrap around and cycle through items.
|
|
|
|
+ onCycleTo: null // Callback for when a new slide is cycled to.
|
|
|
|
+ };
|
|
|
|
+ options = $.extend(defaults, options);
|
|
|
|
+ var namespace = Materialize.objectSelectorString($(this));
|
|
|
|
+
|
|
|
|
+ return this.each(function (i) {
|
|
|
|
+
|
|
|
|
+ var images, item_width, item_height, offset, center, pressed, dim, count, reference, referenceY, amplitude, target, velocity, scrolling, xform, frame, timestamp, ticker, dragged, vertical_dragged;
|
|
|
|
+ var $indicators = $('<ul class="indicators"></ul>');
|
|
|
|
+ var scrollingTimeout = null;
|
|
|
|
+ var oneTimeCallback = null;
|
|
|
|
+
|
|
|
|
+ // Initialize
|
|
|
|
+ var view = $(this);
|
|
|
|
+ var hasMultipleSlides = view.find('.carousel-item').length > 1;
|
|
|
|
+ var showIndicators = (view.attr('data-indicators') || options.indicators) && hasMultipleSlides;
|
|
|
|
+ var noWrap = view.attr('data-no-wrap') || options.noWrap || !hasMultipleSlides;
|
|
|
|
+ var uniqueNamespace = view.attr('data-namespace') || namespace + i;
|
|
|
|
+ view.attr('data-namespace', uniqueNamespace);
|
|
|
|
+
|
|
|
|
+ // Options
|
|
|
|
+ var setCarouselHeight = function (imageOnly) {
|
|
|
|
+ var firstSlide = view.find('.carousel-item.active').length ? view.find('.carousel-item.active').first() : view.find('.carousel-item').first();
|
|
|
|
+ var firstImage = firstSlide.find('img').first();
|
|
|
|
+ if (firstImage.length) {
|
|
|
|
+ if (firstImage[0].complete) {
|
|
|
|
+ // If image won't trigger the load event
|
|
|
|
+ var imageHeight = firstImage.height();
|
|
|
|
+ if (imageHeight > 0) {
|
|
|
|
+ view.css('height', firstImage.height());
|
|
|
|
+ } else {
|
|
|
|
+ // If image still has no height, use the natural dimensions to calculate
|
|
|
|
+ var naturalWidth = firstImage[0].naturalWidth;
|
|
|
|
+ var naturalHeight = firstImage[0].naturalHeight;
|
|
|
|
+ var adjustedHeight = view.width() / naturalWidth * naturalHeight;
|
|
|
|
+ view.css('height', adjustedHeight);
|
|
|
|
+ }
|
|
|
|
+ } else {
|
|
|
|
+ // Get height when image is loaded normally
|
|
|
|
+ firstImage.on('load', function () {
|
|
|
|
+ view.css('height', $(this).height());
|
|
|
|
+ });
|
|
|
|
+ }
|
|
|
|
+ } else if (!imageOnly) {
|
|
|
|
+ var slideHeight = firstSlide.height();
|
|
|
|
+ view.css('height', slideHeight);
|
|
|
|
+ }
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ if (options.fullWidth) {
|
|
|
|
+ options.dist = 0;
|
|
|
|
+ setCarouselHeight();
|
|
|
|
+
|
|
|
|
+ // Offset fixed items when indicators.
|
|
|
|
+ if (showIndicators) {
|
|
|
|
+ view.find('.carousel-fixed-item').addClass('with-indicators');
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Don't double initialize.
|
|
|
|
+ if (view.hasClass('initialized')) {
|
|
|
|
+ // Recalculate variables
|
|
|
|
+ $(window).trigger('resize');
|
|
|
|
+
|
|
|
|
+ // Redraw carousel.
|
|
|
|
+ view.trigger('carouselNext', [0.000001]);
|
|
|
|
+ return true;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ view.addClass('initialized');
|
|
|
|
+ pressed = false;
|
|
|
|
+ offset = target = 0;
|
|
|
|
+ images = [];
|
|
|
|
+ item_width = view.find('.carousel-item').first().innerWidth();
|
|
|
|
+ item_height = view.find('.carousel-item').first().innerHeight();
|
|
|
|
+ dim = item_width * 2 + options.padding;
|
|
|
|
+
|
|
|
|
+ view.find('.carousel-item').each(function (i) {
|
|
|
|
+ images.push($(this)[0]);
|
|
|
|
+ if (showIndicators) {
|
|
|
|
+ var $indicator = $('<li class="indicator-item"></li>');
|
|
|
|
+
|
|
|
|
+ // Add active to first by default.
|
|
|
|
+ if (i === 0) {
|
|
|
|
+ $indicator.addClass('active');
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Handle clicks on indicators.
|
|
|
|
+ $indicator.click(function (e) {
|
|
|
|
+ e.stopPropagation();
|
|
|
|
+
|
|
|
|
+ var index = $(this).index();
|
|
|
|
+ cycleTo(index);
|
|
|
|
+ });
|
|
|
|
+ $indicators.append($indicator);
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ if (showIndicators) {
|
|
|
|
+ view.append($indicators);
|
|
|
|
+ }
|
|
|
|
+ count = images.length;
|
|
|
|
+
|
|
|
|
+ function setupEvents() {
|
|
|
|
+ if (typeof window.ontouchstart !== 'undefined') {
|
|
|
|
+ view.on('touchstart.carousel', tap);
|
|
|
|
+ view.on('touchmove.carousel', drag);
|
|
|
|
+ view.on('touchend.carousel', release);
|
|
|
|
+ }
|
|
|
|
+ view.on('mousedown.carousel', tap);
|
|
|
|
+ view.on('mousemove.carousel', drag);
|
|
|
|
+ view.on('mouseup.carousel', release);
|
|
|
|
+ view.on('mouseleave.carousel', release);
|
|
|
|
+ view.on('click.carousel', click);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ function xpos(e) {
|
|
|
|
+ // touch event
|
|
|
|
+ if (e.targetTouches && e.targetTouches.length >= 1) {
|
|
|
|
+ return e.targetTouches[0].clientX;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // mouse event
|
|
|
|
+ return e.clientX;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ function ypos(e) {
|
|
|
|
+ // touch event
|
|
|
|
+ if (e.targetTouches && e.targetTouches.length >= 1) {
|
|
|
|
+ return e.targetTouches[0].clientY;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // mouse event
|
|
|
|
+ return e.clientY;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ function wrap(x) {
|
|
|
|
+ return x >= count ? x % count : x < 0 ? wrap(count + x % count) : x;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ function scroll(x) {
|
|
|
|
+ // Track scrolling state
|
|
|
|
+ scrolling = true;
|
|
|
|
+ if (!view.hasClass('scrolling')) {
|
|
|
|
+ view.addClass('scrolling');
|
|
|
|
+ }
|
|
|
|
+ if (scrollingTimeout != null) {
|
|
|
|
+ window.clearTimeout(scrollingTimeout);
|
|
|
|
+ }
|
|
|
|
+ scrollingTimeout = window.setTimeout(function () {
|
|
|
|
+ scrolling = false;
|
|
|
|
+ view.removeClass('scrolling');
|
|
|
|
+ }, options.duration);
|
|
|
|
+
|
|
|
|
+ // Start actual scroll
|
|
|
|
+ var i, half, delta, dir, tween, el, alignment, xTranslation;
|
|
|
|
+ var lastCenter = center;
|
|
|
|
+
|
|
|
|
+ offset = typeof x === 'number' ? x : offset;
|
|
|
|
+ center = Math.floor((offset + dim / 2) / dim);
|
|
|
|
+ delta = offset - center * dim;
|
|
|
|
+ dir = delta < 0 ? 1 : -1;
|
|
|
|
+ tween = -dir * delta * 2 / dim;
|
|
|
|
+ half = count >> 1;
|
|
|
|
+
|
|
|
|
+ if (!options.fullWidth) {
|
|
|
|
+ alignment = 'translateX(' + (view[0].clientWidth - item_width) / 2 + 'px) ';
|
|
|
|
+ alignment += 'translateY(' + (view[0].clientHeight - item_height) / 2 + 'px)';
|
|
|
|
+ } else {
|
|
|
|
+ alignment = 'translateX(0)';
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Set indicator active
|
|
|
|
+ if (showIndicators) {
|
|
|
|
+ var diff = center % count;
|
|
|
|
+ var activeIndicator = $indicators.find('.indicator-item.active');
|
|
|
|
+ if (activeIndicator.index() !== diff) {
|
|
|
|
+ activeIndicator.removeClass('active');
|
|
|
|
+ $indicators.find('.indicator-item').eq(diff).addClass('active');
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // center
|
|
|
|
+ // Don't show wrapped items.
|
|
|
|
+ if (!noWrap || center >= 0 && center < count) {
|
|
|
|
+ el = images[wrap(center)];
|
|
|
|
+
|
|
|
|
+ // Add active class to center item.
|
|
|
|
+ if (!$(el).hasClass('active')) {
|
|
|
|
+ view.find('.carousel-item').removeClass('active');
|
|
|
|
+ $(el).addClass('active');
|
|
|
|
+ }
|
|
|
|
+ el.style[xform] = alignment + ' translateX(' + -delta / 2 + 'px)' + ' translateX(' + dir * options.shift * tween * i + 'px)' + ' translateZ(' + options.dist * tween + 'px)';
|
|
|
|
+ el.style.zIndex = 0;
|
|
|
|
+ if (options.fullWidth) {
|
|
|
|
+ tweenedOpacity = 1;
|
|
|
|
+ } else {
|
|
|
|
+ tweenedOpacity = 1 - 0.2 * tween;
|
|
|
|
+ }
|
|
|
|
+ el.style.opacity = tweenedOpacity;
|
|
|
|
+ el.style.display = 'block';
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ for (i = 1; i <= half; ++i) {
|
|
|
|
+ // right side
|
|
|
|
+ if (options.fullWidth) {
|
|
|
|
+ zTranslation = options.dist;
|
|
|
|
+ tweenedOpacity = i === half && delta < 0 ? 1 - tween : 1;
|
|
|
|
+ } else {
|
|
|
|
+ zTranslation = options.dist * (i * 2 + tween * dir);
|
|
|
|
+ tweenedOpacity = 1 - 0.2 * (i * 2 + tween * dir);
|
|
|
|
+ }
|
|
|
|
+ // Don't show wrapped items.
|
|
|
|
+ if (!noWrap || center + i < count) {
|
|
|
|
+ el = images[wrap(center + i)];
|
|
|
|
+ el.style[xform] = alignment + ' translateX(' + (options.shift + (dim * i - delta) / 2) + 'px)' + ' translateZ(' + zTranslation + 'px)';
|
|
|
|
+ el.style.zIndex = -i;
|
|
|
|
+ el.style.opacity = tweenedOpacity;
|
|
|
|
+ el.style.display = 'block';
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // left side
|
|
|
|
+ if (options.fullWidth) {
|
|
|
|
+ zTranslation = options.dist;
|
|
|
|
+ tweenedOpacity = i === half && delta > 0 ? 1 - tween : 1;
|
|
|
|
+ } else {
|
|
|
|
+ zTranslation = options.dist * (i * 2 - tween * dir);
|
|
|
|
+ tweenedOpacity = 1 - 0.2 * (i * 2 - tween * dir);
|
|
|
|
+ }
|
|
|
|
+ // Don't show wrapped items.
|
|
|
|
+ if (!noWrap || center - i >= 0) {
|
|
|
|
+ el = images[wrap(center - i)];
|
|
|
|
+ el.style[xform] = alignment + ' translateX(' + (-options.shift + (-dim * i - delta) / 2) + 'px)' + ' translateZ(' + zTranslation + 'px)';
|
|
|
|
+ el.style.zIndex = -i;
|
|
|
|
+ el.style.opacity = tweenedOpacity;
|
|
|
|
+ el.style.display = 'block';
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // center
|
|
|
|
+ // Don't show wrapped items.
|
|
|
|
+ if (!noWrap || center >= 0 && center < count) {
|
|
|
|
+ el = images[wrap(center)];
|
|
|
|
+ el.style[xform] = alignment + ' translateX(' + -delta / 2 + 'px)' + ' translateX(' + dir * options.shift * tween + 'px)' + ' translateZ(' + options.dist * tween + 'px)';
|
|
|
|
+ el.style.zIndex = 0;
|
|
|
|
+ if (options.fullWidth) {
|
|
|
|
+ tweenedOpacity = 1;
|
|
|
|
+ } else {
|
|
|
|
+ tweenedOpacity = 1 - 0.2 * tween;
|
|
|
|
+ }
|
|
|
|
+ el.style.opacity = tweenedOpacity;
|
|
|
|
+ el.style.display = 'block';
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // onCycleTo callback
|
|
|
|
+ if (lastCenter !== center && typeof options.onCycleTo === "function") {
|
|
|
|
+ var $curr_item = view.find('.carousel-item').eq(wrap(center));
|
|
|
|
+ options.onCycleTo.call(this, $curr_item, dragged);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // One time callback
|
|
|
|
+ if (typeof oneTimeCallback === "function") {
|
|
|
|
+ oneTimeCallback.call(this, $curr_item, dragged);
|
|
|
|
+ oneTimeCallback = null;
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ function track() {
|
|
|
|
+ var now, elapsed, delta, v;
|
|
|
|
+
|
|
|
|
+ now = Date.now();
|
|
|
|
+ elapsed = now - timestamp;
|
|
|
|
+ timestamp = now;
|
|
|
|
+ delta = offset - frame;
|
|
|
|
+ frame = offset;
|
|
|
|
+
|
|
|
|
+ v = 1000 * delta / (1 + elapsed);
|
|
|
|
+ velocity = 0.8 * v + 0.2 * velocity;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ function autoScroll() {
|
|
|
|
+ var elapsed, delta;
|
|
|
|
+
|
|
|
|
+ if (amplitude) {
|
|
|
|
+ elapsed = Date.now() - timestamp;
|
|
|
|
+ delta = amplitude * Math.exp(-elapsed / options.duration);
|
|
|
|
+ if (delta > 2 || delta < -2) {
|
|
|
|
+ scroll(target - delta);
|
|
|
|
+ requestAnimationFrame(autoScroll);
|
|
|
|
+ } else {
|
|
|
|
+ scroll(target);
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ function click(e) {
|
|
|
|
+ // Disable clicks if carousel was dragged.
|
|
|
|
+ if (dragged) {
|
|
|
|
+ e.preventDefault();
|
|
|
|
+ e.stopPropagation();
|
|
|
|
+ return false;
|
|
|
|
+ } else if (!options.fullWidth) {
|
|
|
|
+ var clickedIndex = $(e.target).closest('.carousel-item').index();
|
|
|
|
+ var diff = wrap(center) - clickedIndex;
|
|
|
|
+
|
|
|
|
+ // Disable clicks if carousel was shifted by click
|
|
|
|
+ if (diff !== 0) {
|
|
|
|
+ e.preventDefault();
|
|
|
|
+ e.stopPropagation();
|
|
|
|
+ }
|
|
|
|
+ cycleTo(clickedIndex);
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ function cycleTo(n) {
|
|
|
|
+ var diff = center % count - n;
|
|
|
|
+
|
|
|
|
+ // Account for wraparound.
|
|
|
|
+ if (!noWrap) {
|
|
|
|
+ if (diff < 0) {
|
|
|
|
+ if (Math.abs(diff + count) < Math.abs(diff)) {
|
|
|
|
+ diff += count;
|
|
|
|
+ }
|
|
|
|
+ } else if (diff > 0) {
|
|
|
|
+ if (Math.abs(diff - count) < diff) {
|
|
|
|
+ diff -= count;
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Call prev or next accordingly.
|
|
|
|
+ if (diff < 0) {
|
|
|
|
+ view.trigger('carouselNext', [Math.abs(diff)]);
|
|
|
|
+ } else if (diff > 0) {
|
|
|
|
+ view.trigger('carouselPrev', [diff]);
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ function tap(e) {
|
|
|
|
+ // Fixes firefox draggable image bug
|
|
|
|
+ if (e.type === 'mousedown' && $(e.target).is('img')) {
|
|
|
|
+ e.preventDefault();
|
|
|
|
+ }
|
|
|
|
+ pressed = true;
|
|
|
|
+ dragged = false;
|
|
|
|
+ vertical_dragged = false;
|
|
|
|
+ reference = xpos(e);
|
|
|
|
+ referenceY = ypos(e);
|
|
|
|
+
|
|
|
|
+ velocity = amplitude = 0;
|
|
|
|
+ frame = offset;
|
|
|
|
+ timestamp = Date.now();
|
|
|
|
+ clearInterval(ticker);
|
|
|
|
+ ticker = setInterval(track, 100);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ function drag(e) {
|
|
|
|
+ var x, delta, deltaY;
|
|
|
|
+ if (pressed) {
|
|
|
|
+ x = xpos(e);
|
|
|
|
+ y = ypos(e);
|
|
|
|
+ delta = reference - x;
|
|
|
|
+ deltaY = Math.abs(referenceY - y);
|
|
|
|
+ if (deltaY < 30 && !vertical_dragged) {
|
|
|
|
+ // If vertical scrolling don't allow dragging.
|
|
|
|
+ if (delta > 2 || delta < -2) {
|
|
|
|
+ dragged = true;
|
|
|
|
+ reference = x;
|
|
|
|
+ scroll(offset + delta);
|
|
|
|
+ }
|
|
|
|
+ } else if (dragged) {
|
|
|
|
+ // If dragging don't allow vertical scroll.
|
|
|
|
+ e.preventDefault();
|
|
|
|
+ e.stopPropagation();
|
|
|
|
+ return false;
|
|
|
|
+ } else {
|
|
|
|
+ // Vertical scrolling.
|
|
|
|
+ vertical_dragged = true;
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ if (dragged) {
|
|
|
|
+ // If dragging don't allow vertical scroll.
|
|
|
|
+ e.preventDefault();
|
|
|
|
+ e.stopPropagation();
|
|
|
|
+ return false;
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ function release(e) {
|
|
|
|
+ if (pressed) {
|
|
|
|
+ pressed = false;
|
|
|
|
+ } else {
|
|
|
|
+ return;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ clearInterval(ticker);
|
|
|
|
+ target = offset;
|
|
|
|
+ if (velocity > 10 || velocity < -10) {
|
|
|
|
+ amplitude = 0.9 * velocity;
|
|
|
|
+ target = offset + amplitude;
|
|
|
|
+ }
|
|
|
|
+ target = Math.round(target / dim) * dim;
|
|
|
|
+
|
|
|
|
+ // No wrap of items.
|
|
|
|
+ if (noWrap) {
|
|
|
|
+ if (target >= dim * (count - 1)) {
|
|
|
|
+ target = dim * (count - 1);
|
|
|
|
+ } else if (target < 0) {
|
|
|
|
+ target = 0;
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ amplitude = target - offset;
|
|
|
|
+ timestamp = Date.now();
|
|
|
|
+ requestAnimationFrame(autoScroll);
|
|
|
|
+
|
|
|
|
+ if (dragged) {
|
|
|
|
+ e.preventDefault();
|
|
|
|
+ e.stopPropagation();
|
|
|
|
+ }
|
|
|
|
+ return false;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ xform = 'transform';
|
|
|
|
+ ['webkit', 'Moz', 'O', 'ms'].every(function (prefix) {
|
|
|
|
+ var e = prefix + 'Transform';
|
|
|
|
+ if (typeof document.body.style[e] !== 'undefined') {
|
|
|
|
+ xform = e;
|
|
|
|
+ return false;
|
|
|
|
+ }
|
|
|
|
+ return true;
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ var throttledResize = Materialize.throttle(function () {
|
|
|
|
+ if (options.fullWidth) {
|
|
|
|
+ item_width = view.find('.carousel-item').first().innerWidth();
|
|
|
|
+ var imageHeight = view.find('.carousel-item.active').height();
|
|
|
|
+ dim = item_width * 2 + options.padding;
|
|
|
|
+ offset = center * 2 * item_width;
|
|
|
|
+ target = offset;
|
|
|
|
+ setCarouselHeight(true);
|
|
|
|
+ } else {
|
|
|
|
+ scroll();
|
|
|
|
+ }
|
|
|
|
+ }, 200);
|
|
|
|
+ $(window).off('resize.carousel-' + uniqueNamespace).on('resize.carousel-' + uniqueNamespace, throttledResize);
|
|
|
|
+
|
|
|
|
+ setupEvents();
|
|
|
|
+ scroll(offset);
|
|
|
|
+
|
|
|
|
+ $(this).on('carouselNext', function (e, n, callback) {
|
|
|
|
+ if (n === undefined) {
|
|
|
|
+ n = 1;
|
|
|
|
+ }
|
|
|
|
+ if (typeof callback === "function") {
|
|
|
|
+ oneTimeCallback = callback;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ target = dim * Math.round(offset / dim) + dim * n;
|
|
|
|
+ if (offset !== target) {
|
|
|
|
+ amplitude = target - offset;
|
|
|
|
+ timestamp = Date.now();
|
|
|
|
+ requestAnimationFrame(autoScroll);
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ $(this).on('carouselPrev', function (e, n, callback) {
|
|
|
|
+ if (n === undefined) {
|
|
|
|
+ n = 1;
|
|
|
|
+ }
|
|
|
|
+ if (typeof callback === "function") {
|
|
|
|
+ oneTimeCallback = callback;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ target = dim * Math.round(offset / dim) - dim * n;
|
|
|
|
+ if (offset !== target) {
|
|
|
|
+ amplitude = target - offset;
|
|
|
|
+ timestamp = Date.now();
|
|
|
|
+ requestAnimationFrame(autoScroll);
|
|
|
|
+ }
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ $(this).on('carouselSet', function (e, n, callback) {
|
|
|
|
+ if (n === undefined) {
|
|
|
|
+ n = 0;
|
|
|
|
+ }
|
|
|
|
+ if (typeof callback === "function") {
|
|
|
|
+ oneTimeCallback = callback;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ cycleTo(n);
|
|
|
|
+ });
|
|
|
|
+ });
|
|
|
|
+ },
|
|
|
|
+ next: function (n, callback) {
|
|
|
|
+ $(this).trigger('carouselNext', [n, callback]);
|
|
|
|
+ },
|
|
|
|
+ prev: function (n, callback) {
|
|
|
|
+ $(this).trigger('carouselPrev', [n, callback]);
|
|
|
|
+ },
|
|
|
|
+ set: function (n, callback) {
|
|
|
|
+ $(this).trigger('carouselSet', [n, callback]);
|
|
|
|
+ },
|
|
|
|
+ destroy: function () {
|
|
|
|
+ var uniqueNamespace = $(this).attr('data-namespace');
|
|
|
|
+ $(this).removeAttr('data-namespace');
|
|
|
|
+ $(this).removeClass('initialized');
|
|
|
|
+ $(this).find('.indicators').remove();
|
|
|
|
+
|
|
|
|
+ // Remove event handlers
|
|
|
|
+ $(this).off('carouselNext carouselPrev carouselSet');
|
|
|
|
+ $(window).off('resize.carousel-' + uniqueNamespace);
|
|
|
|
+ if (typeof window.ontouchstart !== 'undefined') {
|
|
|
|
+ $(this).off('touchstart.carousel touchmove.carousel touchend.carousel');
|
|
|
|
+ }
|
|
|
|
+ $(this).off('mousedown.carousel mousemove.carousel mouseup.carousel mouseleave.carousel click.carousel');
|
|
|
|
+ }
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ $.fn.carousel = function (methodOrOptions) {
|
|
|
|
+ if (methods[methodOrOptions]) {
|
|
|
|
+ return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
|
|
|
|
+ } else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
|
|
|
|
+ // Default to "init"
|
|
|
|
+ return methods.init.apply(this, arguments);
|
|
|
|
+ } else {
|
|
|
|
+ $.error('Method ' + methodOrOptions + ' does not exist on jQuery.carousel');
|
|
|
|
+ }
|
|
|
|
+ }; // Plugin end
|
|
|
|
+})(jQuery);
|
|
|
|
+;(function ($) {
|
|
|
|
+
|
|
|
|
+ var methods = {
|
|
|
|
+ init: function (options) {
|
|
|
|
+ return this.each(function () {
|
|
|
|
+ var origin = $('#' + $(this).attr('data-activates'));
|
|
|
|
+ var screen = $('body');
|
|
|
|
+
|
|
|
|
+ // Creating tap target
|
|
|
|
+ var tapTargetEl = $(this);
|
|
|
|
+ var tapTargetWrapper = tapTargetEl.parent('.tap-target-wrapper');
|
|
|
|
+ var tapTargetWave = tapTargetWrapper.find('.tap-target-wave');
|
|
|
|
+ var tapTargetOriginEl = tapTargetWrapper.find('.tap-target-origin');
|
|
|
|
+ var tapTargetContentEl = tapTargetEl.find('.tap-target-content');
|
|
|
|
+
|
|
|
|
+ // Creating wrapper
|
|
|
|
+ if (!tapTargetWrapper.length) {
|
|
|
|
+ tapTargetWrapper = tapTargetEl.wrap($('<div class="tap-target-wrapper"></div>')).parent();
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Creating content
|
|
|
|
+ if (!tapTargetContentEl.length) {
|
|
|
|
+ tapTargetContentEl = $('<div class="tap-target-content"></div>');
|
|
|
|
+ tapTargetEl.append(tapTargetContentEl);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Creating foreground wave
|
|
|
|
+ if (!tapTargetWave.length) {
|
|
|
|
+ tapTargetWave = $('<div class="tap-target-wave"></div>');
|
|
|
|
+
|
|
|
|
+ // Creating origin
|
|
|
|
+ if (!tapTargetOriginEl.length) {
|
|
|
|
+ tapTargetOriginEl = origin.clone(true, true);
|
|
|
|
+ tapTargetOriginEl.addClass('tap-target-origin');
|
|
|
|
+ tapTargetOriginEl.removeAttr('id');
|
|
|
|
+ tapTargetOriginEl.removeAttr('style');
|
|
|
|
+ tapTargetWave.append(tapTargetOriginEl);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ tapTargetWrapper.append(tapTargetWave);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Open
|
|
|
|
+ var openTapTarget = function () {
|
|
|
|
+ if (tapTargetWrapper.is('.open')) {
|
|
|
|
+ return;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Adding open class
|
|
|
|
+ tapTargetWrapper.addClass('open');
|
|
|
|
+
|
|
|
|
+ setTimeout(function () {
|
|
|
|
+ tapTargetOriginEl.off('click.tapTarget').on('click.tapTarget', function (e) {
|
|
|
|
+ closeTapTarget();
|
|
|
|
+ tapTargetOriginEl.off('click.tapTarget');
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ $(document).off('click.tapTarget').on('click.tapTarget', function (e) {
|
|
|
|
+ closeTapTarget();
|
|
|
|
+ $(document).off('click.tapTarget');
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ var throttledCalc = Materialize.throttle(function () {
|
|
|
|
+ calculateTapTarget();
|
|
|
|
+ }, 200);
|
|
|
|
+ $(window).off('resize.tapTarget').on('resize.tapTarget', throttledCalc);
|
|
|
|
+ }, 0);
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ // Close
|
|
|
|
+ var closeTapTarget = function () {
|
|
|
|
+ if (!tapTargetWrapper.is('.open')) {
|
|
|
|
+ return;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ tapTargetWrapper.removeClass('open');
|
|
|
|
+ tapTargetOriginEl.off('click.tapTarget');
|
|
|
|
+ $(document).off('click.tapTarget');
|
|
|
|
+ $(window).off('resize.tapTarget');
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ // Pre calculate
|
|
|
|
+ var calculateTapTarget = function () {
|
|
|
|
+ // Element or parent is fixed position?
|
|
|
|
+ var isFixed = origin.css('position') === 'fixed';
|
|
|
|
+ if (!isFixed) {
|
|
|
|
+ var parents = origin.parents();
|
|
|
|
+ for (var i = 0; i < parents.length; i++) {
|
|
|
|
+ isFixed = $(parents[i]).css('position') == 'fixed';
|
|
|
|
+ if (isFixed) {
|
|
|
|
+ break;
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ // Calculating origin
|
|
|
|
+ var originWidth = origin.outerWidth();
|
|
|
|
+ var originHeight = origin.outerHeight();
|
|
|
|
+ var originTop = isFixed ? origin.offset().top - $(document).scrollTop() : origin.offset().top;
|
|
|
|
+ var originLeft = isFixed ? origin.offset().left - $(document).scrollLeft() : origin.offset().left;
|
|
|
|
+
|
|
|
|
+ // Calculating screen
|
|
|
|
+ var windowWidth = $(window).width();
|
|
|
|
+ var windowHeight = $(window).height();
|
|
|
|
+ var centerX = windowWidth / 2;
|
|
|
|
+ var centerY = windowHeight / 2;
|
|
|
|
+ var isLeft = originLeft <= centerX;
|
|
|
|
+ var isRight = originLeft > centerX;
|
|
|
|
+ var isTop = originTop <= centerY;
|
|
|
|
+ var isBottom = originTop > centerY;
|
|
|
|
+ var isCenterX = originLeft >= windowWidth * 0.25 && originLeft <= windowWidth * 0.75;
|
|
|
|
+ var isCenterY = originTop >= windowHeight * 0.25 && originTop <= windowHeight * 0.75;
|
|
|
|
+
|
|
|
|
+ // Calculating tap target
|
|
|
|
+ var tapTargetWidth = tapTargetEl.outerWidth();
|
|
|
|
+ var tapTargetHeight = tapTargetEl.outerHeight();
|
|
|
|
+ var tapTargetTop = originTop + originHeight / 2 - tapTargetHeight / 2;
|
|
|
|
+ var tapTargetLeft = originLeft + originWidth / 2 - tapTargetWidth / 2;
|
|
|
|
+ var tapTargetPosition = isFixed ? 'fixed' : 'absolute';
|
|
|
|
+
|
|
|
|
+ // Calculating content
|
|
|
|
+ var tapTargetTextWidth = isCenterX ? tapTargetWidth : tapTargetWidth / 2 + originWidth;
|
|
|
|
+ var tapTargetTextHeight = tapTargetHeight / 2;
|
|
|
|
+ var tapTargetTextTop = isTop ? tapTargetHeight / 2 : 0;
|
|
|
|
+ var tapTargetTextBottom = 0;
|
|
|
|
+ var tapTargetTextLeft = isLeft && !isCenterX ? tapTargetWidth / 2 - originWidth : 0;
|
|
|
|
+ var tapTargetTextRight = 0;
|
|
|
|
+ var tapTargetTextPadding = originWidth;
|
|
|
|
+ var tapTargetTextAlign = isBottom ? 'bottom' : 'top';
|
|
|
|
+
|
|
|
|
+ // Calculating wave
|
|
|
|
+ var tapTargetWaveWidth = originWidth > originHeight ? originWidth * 2 : originWidth * 2;
|
|
|
|
+ var tapTargetWaveHeight = tapTargetWaveWidth;
|
|
|
|
+ var tapTargetWaveTop = tapTargetHeight / 2 - tapTargetWaveHeight / 2;
|
|
|
|
+ var tapTargetWaveLeft = tapTargetWidth / 2 - tapTargetWaveWidth / 2;
|
|
|
|
+
|
|
|
|
+ // Setting tap target
|
|
|
|
+ var tapTargetWrapperCssObj = {};
|
|
|
|
+ tapTargetWrapperCssObj.top = isTop ? tapTargetTop : '';
|
|
|
|
+ tapTargetWrapperCssObj.right = isRight ? windowWidth - tapTargetLeft - tapTargetWidth : '';
|
|
|
|
+ tapTargetWrapperCssObj.bottom = isBottom ? windowHeight - tapTargetTop - tapTargetHeight : '';
|
|
|
|
+ tapTargetWrapperCssObj.left = isLeft ? tapTargetLeft : '';
|
|
|
|
+ tapTargetWrapperCssObj.position = tapTargetPosition;
|
|
|
|
+ tapTargetWrapper.css(tapTargetWrapperCssObj);
|
|
|
|
+
|
|
|
|
+ // Setting content
|
|
|
|
+ tapTargetContentEl.css({
|
|
|
|
+ width: tapTargetTextWidth,
|
|
|
|
+ height: tapTargetTextHeight,
|
|
|
|
+ top: tapTargetTextTop,
|
|
|
|
+ right: tapTargetTextRight,
|
|
|
|
+ bottom: tapTargetTextBottom,
|
|
|
|
+ left: tapTargetTextLeft,
|
|
|
|
+ padding: tapTargetTextPadding,
|
|
|
|
+ verticalAlign: tapTargetTextAlign
|
|
|
|
+ });
|
|
|
|
+
|
|
|
|
+ // Setting wave
|
|
|
|
+ tapTargetWave.css({
|
|
|
|
+ top: tapTargetWaveTop,
|
|
|
|
+ left: tapTargetWaveLeft,
|
|
|
|
+ width: tapTargetWaveWidth,
|
|
|
|
+ height: tapTargetWaveHeight
|
|
|
|
+ });
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ if (options == 'open') {
|
|
|
|
+ calculateTapTarget();
|
|
|
|
+ openTapTarget();
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ if (options == 'close') closeTapTarget();
|
|
|
|
+ });
|
|
|
|
+ },
|
|
|
|
+ open: function () {},
|
|
|
|
+ close: function () {}
|
|
|
|
+ };
|
|
|
|
+
|
|
|
|
+ $.fn.tapTarget = function (methodOrOptions) {
|
|
|
|
+ if (methods[methodOrOptions] || typeof methodOrOptions === 'object') return methods.init.apply(this, arguments);
|
|
|
|
+
|
|
|
|
+ $.error('Method ' + methodOrOptions + ' does not exist on jQuery.tap-target');
|
|
|
|
+ };
|
|
|
|
+})(jQuery);
|