Explorar el Código

Merge branch 'master' of https://git.cocorobo.cn/CocoRoboLabs/cocoroboBlockly

zengyicheng hace 4 años
padre
commit
f39037712f
Se han modificado 33 ficheros con 45080 adiciones y 33 borrados
  1. 0 1
      .gitignore
  2. 28 0
      dist/index.html
  3. 13944 0
      dist/static/bundle.js
  4. 5297 0
      dist/static/camera.283d5d54.js
  5. 0 0
      dist/static/css/app.74a90d89b0e3d28e4fab6a7fdd01f40b.css
  6. 0 0
      dist/static/css/app.74a90d89b0e3d28e4fab6a7fdd01f40b.css.map
  7. 7 0
      dist/static/face-min.js
  8. BIN
      dist/static/fonts/element-icons.535877f.woff
  9. BIN
      dist/static/fonts/element-icons.732389d.ttf
  10. BIN
      dist/static/img/ai.24b6338.png
  11. BIN
      dist/static/img/face_recognition_header.b94b5a4.png
  12. BIN
      dist/static/img/screen_init_header.f57793f.png
  13. BIN
      dist/static/img/tips.f61ca16.png
  14. 1 0
      dist/static/jquery-2.1.3.min.js
  15. 8 0
      dist/static/js/app.50e55d42ba5e2cd859db.js
  16. 0 0
      dist/static/js/app.50e55d42ba5e2cd859db.js.map
  17. 2 0
      dist/static/js/manifest.2ae2e69a05c33dfc65f8.js
  18. 0 0
      dist/static/js/manifest.2ae2e69a05c33dfc65f8.js.map
  19. 0 0
      dist/static/js/vendor.e92bfe0d59979c2fbfd8.js
  20. 0 0
      dist/static/js/vendor.e92bfe0d59979c2fbfd8.js.map
  21. 21 0
      dist/static/materialize/LICENSE
  22. 90 0
      dist/static/materialize/README.md
  23. 9389 0
      dist/static/materialize/css/materialize.css
  24. 5 0
      dist/static/materialize/css/materialize.min.css
  25. 1 0
      dist/static/materialize/jquery-2.1.3.min.js
  26. 10021 0
      dist/static/materialize/js/materialize.js
  27. 5 0
      dist/static/materialize/js/materialize.min.js
  28. 7 0
      dist/static/tracking-min.js
  29. 3111 0
      dist/static/tracking.js
  30. 18 32
      src/components/test.vue
  31. 7 0
      static/face-min.js
  32. 7 0
      static/tracking-min.js
  33. 3111 0
      static/tracking.js

+ 0 - 1
.gitignore

@@ -1,6 +1,5 @@
 .DS_Store
 node_modules/
-/dist/
 npm-debug.log*
 yarn-debug.log*
 yarn-error.log*

+ 28 - 0
dist/index.html

@@ -0,0 +1,28 @@
+<!DOCTYPE html><html><head><meta charset=utf-8><meta name=viewport content="width=device-width,initial-scale=1"><title>cocoroboblockly</title><link href=/static/css/app.74a90d89b0e3d28e4fab6a7fdd01f40b.css rel=stylesheet></head><style>@charset "utf-8";
+
+  div::-webkit-scrollbar {
+    /*滚动条整体样式*/
+    width: 6px;
+    /*高宽分别对应横竖滚动条的尺寸*/
+    height: 6px;
+  }
+
+  /*定义滚动条轨道 内阴影+圆角*/
+  div::-webkit-scrollbar-track {
+    border-radius: 10px;
+    background-color: rgba(0, 0, 0, 0.1);
+  }
+
+  /*定义滑块 内阴影+圆角*/
+  div::-webkit-scrollbar-thumb {
+    border-radius: 10px;
+    -webkit-box-shadow: inset 0 0 6px rgba(0, 0, 0, .3);
+    background-color: rgba(0, 0, 0, 0.1);
+  }
+
+  html,
+  body {
+    height: 100%;
+    width: 100%;
+    background: #e6eaf0;
+  }</style><body><div id=app></div><script type=text/javascript src=/static/js/manifest.2ae2e69a05c33dfc65f8.js></script><script type=text/javascript src=/static/js/vendor.e92bfe0d59979c2fbfd8.js></script><script type=text/javascript src=/static/js/app.50e55d42ba5e2cd859db.js></script></body></html>

La diferencia del archivo ha sido suprimido porque es demasiado grande
+ 13944 - 0
dist/static/bundle.js


La diferencia del archivo ha sido suprimido porque es demasiado grande
+ 5297 - 0
dist/static/camera.283d5d54.js


La diferencia del archivo ha sido suprimido porque es demasiado grande
+ 0 - 0
dist/static/css/app.74a90d89b0e3d28e4fab6a7fdd01f40b.css


La diferencia del archivo ha sido suprimido porque es demasiado grande
+ 0 - 0
dist/static/css/app.74a90d89b0e3d28e4fab6a7fdd01f40b.css.map


La diferencia del archivo ha sido suprimido porque es demasiado grande
+ 7 - 0
dist/static/face-min.js


BIN
dist/static/fonts/element-icons.535877f.woff


BIN
dist/static/fonts/element-icons.732389d.ttf


BIN
dist/static/img/ai.24b6338.png


BIN
dist/static/img/face_recognition_header.b94b5a4.png


BIN
dist/static/img/screen_init_header.f57793f.png


BIN
dist/static/img/tips.f61ca16.png


La diferencia del archivo ha sido suprimido porque es demasiado grande
+ 1 - 0
dist/static/jquery-2.1.3.min.js


La diferencia del archivo ha sido suprimido porque es demasiado grande
+ 8 - 0
dist/static/js/app.50e55d42ba5e2cd859db.js


La diferencia del archivo ha sido suprimido porque es demasiado grande
+ 0 - 0
dist/static/js/app.50e55d42ba5e2cd859db.js.map


+ 2 - 0
dist/static/js/manifest.2ae2e69a05c33dfc65f8.js

@@ -0,0 +1,2 @@
+!function(r){var n=window.webpackJsonp;window.webpackJsonp=function(e,u,c){for(var f,i,p,a=0,l=[];a<e.length;a++)i=e[a],o[i]&&l.push(o[i][0]),o[i]=0;for(f in u)Object.prototype.hasOwnProperty.call(u,f)&&(r[f]=u[f]);for(n&&n(e,u,c);l.length;)l.shift()();if(c)for(a=0;a<c.length;a++)p=t(t.s=c[a]);return p};var e={},o={2:0};function t(n){if(e[n])return e[n].exports;var o=e[n]={i:n,l:!1,exports:{}};return r[n].call(o.exports,o,o.exports,t),o.l=!0,o.exports}t.m=r,t.c=e,t.d=function(r,n,e){t.o(r,n)||Object.defineProperty(r,n,{configurable:!1,enumerable:!0,get:e})},t.n=function(r){var n=r&&r.__esModule?function(){return r.default}:function(){return r};return t.d(n,"a",n),n},t.o=function(r,n){return Object.prototype.hasOwnProperty.call(r,n)},t.p="/",t.oe=function(r){throw console.error(r),r}}([]);
+//# sourceMappingURL=manifest.2ae2e69a05c33dfc65f8.js.map

La diferencia del archivo ha sido suprimido porque es demasiado grande
+ 0 - 0
dist/static/js/manifest.2ae2e69a05c33dfc65f8.js.map


La diferencia del archivo ha sido suprimido porque es demasiado grande
+ 0 - 0
dist/static/js/vendor.e92bfe0d59979c2fbfd8.js


La diferencia del archivo ha sido suprimido porque es demasiado grande
+ 0 - 0
dist/static/js/vendor.e92bfe0d59979c2fbfd8.js.map


+ 21 - 0
dist/static/materialize/LICENSE

@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2014-2017 Materialize
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.

+ 90 - 0
dist/static/materialize/README.md

@@ -0,0 +1,90 @@
+<p align="center">
+  <a href="http://materializecss.com/">
+    <img src="http://materializecss.com/res/materialize.svg" width="150">
+  </a>
+
+  <h3 align="center">MaterializeCSS</h3>
+
+  <p align="center">
+    Materialize, a CSS Framework based on material design.
+    <br>
+    <a href="http://materializecss.com/"><strong>-- Browse the docs --</strong></a>
+    <br>
+    <br>
+    <a href="https://travis-ci.org/Dogfalo/materialize">
+      <img src="https://travis-ci.org/Dogfalo/materialize.svg?branch=master" alt="Travis CI badge">
+    </a>
+    <a href="https://badge.fury.io/js/materialize-css">
+      <img src="https://badge.fury.io/js/materialize-css.svg" alt="npm version badge">
+    </a>
+    <a href="https://cdnjs.com/libraries/materialize">
+      <img src="https://img.shields.io/cdnjs/v/materialize.svg" alt="CDNJS version badge">
+    </a>
+    <a href="https://david-dm.org/Dogfalo/materialize">
+      <img src="https://david-dm.org/Dogfalo/materialize/status.svg" alt="dependencies Status badge">
+      </a>
+    <a href="https://david-dm.org/Dogfalo/materialize#info=devDependencies">
+      <img src="https://david-dm.org/Dogfalo/materialize/dev-status.svg" alt="devDependency Status badge">
+    </a>
+    <a href="https://gitter.im/Dogfalo/materialize">
+      <img src="https://badges.gitter.im/Join%20Chat.svg" alt="Gitter badge">
+    </a>
+</p>
+
+## Table of Contents
+- [Quickstart](#quickstart)
+- [Documentation](#documentation)
+- [Supported Browsers](#supported-browsers)
+- [Changelog](#changelog)
+- [Testing](#testing)
+- [Contributing](#contributing)
+- [Copyright and license](#copyright-and-license)
+
+## Quickstart:
+Read the [getting started guide](http://materializecss.com/getting-started.html) for more information on how to use materialize.
+
+- [Download the latest release](https://github.com/Dogfalo/materialize/releases/latest) of materialize directly from GitHub.
+- Clone the repo: `git clone https://github.com/Dogfalo/materialize.git`
+- Include the files via [cdnjs](https://cdnjs.com/libraries/materialize). More [here](http://materializecss.com/getting-started.html).
+- Install with [npm](https://www.npmjs.com): `npm install materialize-css`
+- Install with [Bower](https://bower.io): `bower install materialize`
+- Install with [Atmosphere](https://atmospherejs.com): `meteor add materialize:materialize`
+
+## Documentation
+The documentation can be found at <http://materializecss.com>. To run the documentation locally on your machine, you need [Node.js](https://nodejs.org/en/) installed on your computer.
+
+### Running documentation locally
+Run these commands to set up the documentation:
+
+```bash
+git clone https://github.com/Dogfalo/materialize
+cd materialize
+npm install
+```
+
+Then run `grunt monitor` to compile the documentation. When it finishes, open a new browser window and navigate to `localhost:8000`. We use [BrowserSync](https://www.browsersync.io/) to display the documentation.
+
+### Documentation for previous releases
+Previous releases and their documentation are available for [download](https://github.com/Dogfalo/materialize/releases).
+
+## Supported Browsers:
+Materialize is compatible with:
+
+- Chrome 35+
+- Firefox 31+
+- Safari 7+
+- Opera
+- Edge
+- IE 10+
+
+## Changelog
+For changelogs, check out [the Releases section of materialize](https://github.com/Dogfalo/materialize/releases) or the [CHANGELOG.md](CHANGELOG.md).
+
+## Testing
+We use Jasmine as our testing framework and we're trying to write a robust test suite for our components. If you want to help, [here's a starting guide on how to write tests in Jasmine](CONTRIBUTING.md#jasmine-testing-guide).
+
+## Contributing
+Check out the [CONTRIBUTING document](CONTRIBUTING.md) in the root of the repository to learn how you can contribute. You can also browse the [help-wanted](https://github.com/Dogfalo/materialize/labels/help-wanted) tag in our issue tracker to find things to do.
+
+## Copyright and license
+Code copyright 2017 Materialize. Code released under the MIT license.

+ 9389 - 0
dist/static/materialize/css/materialize.css

@@ -0,0 +1,9389 @@
+/*!
+ * Materialize v0.100.2 (http://materializecss.com)
+ * Copyright 2014-2017 Materialize
+ * MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE)
+ */
+.materialize-red {
+  background-color: #e51c23 !important;
+}
+
+.materialize-red-text {
+  color: #e51c23 !important;
+}
+
+.materialize-red.lighten-5 {
+  background-color: #fdeaeb !important;
+}
+
+.materialize-red-text.text-lighten-5 {
+  color: #fdeaeb !important;
+}
+
+.materialize-red.lighten-4 {
+  background-color: #f8c1c3 !important;
+}
+
+.materialize-red-text.text-lighten-4 {
+  color: #f8c1c3 !important;
+}
+
+.materialize-red.lighten-3 {
+  background-color: #f3989b !important;
+}
+
+.materialize-red-text.text-lighten-3 {
+  color: #f3989b !important;
+}
+
+.materialize-red.lighten-2 {
+  background-color: #ee6e73 !important;
+}
+
+.materialize-red-text.text-lighten-2 {
+  color: #ee6e73 !important;
+}
+
+.materialize-red.lighten-1 {
+  background-color: #ea454b !important;
+}
+
+.materialize-red-text.text-lighten-1 {
+  color: #ea454b !important;
+}
+
+.materialize-red.darken-1 {
+  background-color: #d0181e !important;
+}
+
+.materialize-red-text.text-darken-1 {
+  color: #d0181e !important;
+}
+
+.materialize-red.darken-2 {
+  background-color: #b9151b !important;
+}
+
+.materialize-red-text.text-darken-2 {
+  color: #b9151b !important;
+}
+
+.materialize-red.darken-3 {
+  background-color: #a21318 !important;
+}
+
+.materialize-red-text.text-darken-3 {
+  color: #a21318 !important;
+}
+
+.materialize-red.darken-4 {
+  background-color: #8b1014 !important;
+}
+
+.materialize-red-text.text-darken-4 {
+  color: #8b1014 !important;
+}
+
+.red {
+  background-color: #F44336 !important;
+}
+
+.red-text {
+  color: #F44336 !important;
+}
+
+.red.lighten-5 {
+  background-color: #FFEBEE !important;
+}
+
+.red-text.text-lighten-5 {
+  color: #FFEBEE !important;
+}
+
+.red.lighten-4 {
+  background-color: #FFCDD2 !important;
+}
+
+.red-text.text-lighten-4 {
+  color: #FFCDD2 !important;
+}
+
+.red.lighten-3 {
+  background-color: #EF9A9A !important;
+}
+
+.red-text.text-lighten-3 {
+  color: #EF9A9A !important;
+}
+
+.red.lighten-2 {
+  background-color: #E57373 !important;
+}
+
+.red-text.text-lighten-2 {
+  color: #E57373 !important;
+}
+
+.red.lighten-1 {
+  background-color: #EF5350 !important;
+}
+
+.red-text.text-lighten-1 {
+  color: #EF5350 !important;
+}
+
+.red.darken-1 {
+  background-color: #E53935 !important;
+}
+
+.red-text.text-darken-1 {
+  color: #E53935 !important;
+}
+
+.red.darken-2 {
+  background-color: #D32F2F !important;
+}
+
+.red-text.text-darken-2 {
+  color: #D32F2F !important;
+}
+
+.red.darken-3 {
+  background-color: #C62828 !important;
+}
+
+.red-text.text-darken-3 {
+  color: #C62828 !important;
+}
+
+.red.darken-4 {
+  background-color: #B71C1C !important;
+}
+
+.red-text.text-darken-4 {
+  color: #B71C1C !important;
+}
+
+.red.accent-1 {
+  background-color: #FF8A80 !important;
+}
+
+.red-text.text-accent-1 {
+  color: #FF8A80 !important;
+}
+
+.red.accent-2 {
+  background-color: #FF5252 !important;
+}
+
+.red-text.text-accent-2 {
+  color: #FF5252 !important;
+}
+
+.red.accent-3 {
+  background-color: #FF1744 !important;
+}
+
+.red-text.text-accent-3 {
+  color: #FF1744 !important;
+}
+
+.red.accent-4 {
+  background-color: #D50000 !important;
+}
+
+.red-text.text-accent-4 {
+  color: #D50000 !important;
+}
+
+.pink {
+  background-color: #e91e63 !important;
+}
+
+.pink-text {
+  color: #e91e63 !important;
+}
+
+.pink.lighten-5 {
+  background-color: #fce4ec !important;
+}
+
+.pink-text.text-lighten-5 {
+  color: #fce4ec !important;
+}
+
+.pink.lighten-4 {
+  background-color: #f8bbd0 !important;
+}
+
+.pink-text.text-lighten-4 {
+  color: #f8bbd0 !important;
+}
+
+.pink.lighten-3 {
+  background-color: #f48fb1 !important;
+}
+
+.pink-text.text-lighten-3 {
+  color: #f48fb1 !important;
+}
+
+.pink.lighten-2 {
+  background-color: #f06292 !important;
+}
+
+.pink-text.text-lighten-2 {
+  color: #f06292 !important;
+}
+
+.pink.lighten-1 {
+  background-color: #ec407a !important;
+}
+
+.pink-text.text-lighten-1 {
+  color: #ec407a !important;
+}
+
+.pink.darken-1 {
+  background-color: #d81b60 !important;
+}
+
+.pink-text.text-darken-1 {
+  color: #d81b60 !important;
+}
+
+.pink.darken-2 {
+  background-color: #c2185b !important;
+}
+
+.pink-text.text-darken-2 {
+  color: #c2185b !important;
+}
+
+.pink.darken-3 {
+  background-color: #ad1457 !important;
+}
+
+.pink-text.text-darken-3 {
+  color: #ad1457 !important;
+}
+
+.pink.darken-4 {
+  background-color: #880e4f !important;
+}
+
+.pink-text.text-darken-4 {
+  color: #880e4f !important;
+}
+
+.pink.accent-1 {
+  background-color: #ff80ab !important;
+}
+
+.pink-text.text-accent-1 {
+  color: #ff80ab !important;
+}
+
+.pink.accent-2 {
+  background-color: #ff4081 !important;
+}
+
+.pink-text.text-accent-2 {
+  color: #ff4081 !important;
+}
+
+.pink.accent-3 {
+  background-color: #f50057 !important;
+}
+
+.pink-text.text-accent-3 {
+  color: #f50057 !important;
+}
+
+.pink.accent-4 {
+  background-color: #c51162 !important;
+}
+
+.pink-text.text-accent-4 {
+  color: #c51162 !important;
+}
+
+.purple {
+  background-color: #9c27b0 !important;
+}
+
+.purple-text {
+  color: #9c27b0 !important;
+}
+
+.purple.lighten-5 {
+  background-color: #f3e5f5 !important;
+}
+
+.purple-text.text-lighten-5 {
+  color: #f3e5f5 !important;
+}
+
+.purple.lighten-4 {
+  background-color: #e1bee7 !important;
+}
+
+.purple-text.text-lighten-4 {
+  color: #e1bee7 !important;
+}
+
+.purple.lighten-3 {
+  background-color: #ce93d8 !important;
+}
+
+.purple-text.text-lighten-3 {
+  color: #ce93d8 !important;
+}
+
+.purple.lighten-2 {
+  background-color: #ba68c8 !important;
+}
+
+.purple-text.text-lighten-2 {
+  color: #ba68c8 !important;
+}
+
+.purple.lighten-1 {
+  background-color: #ab47bc !important;
+}
+
+.purple-text.text-lighten-1 {
+  color: #ab47bc !important;
+}
+
+.purple.darken-1 {
+  background-color: #8e24aa !important;
+}
+
+.purple-text.text-darken-1 {
+  color: #8e24aa !important;
+}
+
+.purple.darken-2 {
+  background-color: #7b1fa2 !important;
+}
+
+.purple-text.text-darken-2 {
+  color: #7b1fa2 !important;
+}
+
+.purple.darken-3 {
+  background-color: #6a1b9a !important;
+}
+
+.purple-text.text-darken-3 {
+  color: #6a1b9a !important;
+}
+
+.purple.darken-4 {
+  background-color: #4a148c !important;
+}
+
+.purple-text.text-darken-4 {
+  color: #4a148c !important;
+}
+
+.purple.accent-1 {
+  background-color: #ea80fc !important;
+}
+
+.purple-text.text-accent-1 {
+  color: #ea80fc !important;
+}
+
+.purple.accent-2 {
+  background-color: #e040fb !important;
+}
+
+.purple-text.text-accent-2 {
+  color: #e040fb !important;
+}
+
+.purple.accent-3 {
+  background-color: #d500f9 !important;
+}
+
+.purple-text.text-accent-3 {
+  color: #d500f9 !important;
+}
+
+.purple.accent-4 {
+  background-color: #aa00ff !important;
+}
+
+.purple-text.text-accent-4 {
+  color: #aa00ff !important;
+}
+
+.deep-purple {
+  background-color: #673ab7 !important;
+}
+
+.deep-purple-text {
+  color: #673ab7 !important;
+}
+
+.deep-purple.lighten-5 {
+  background-color: #ede7f6 !important;
+}
+
+.deep-purple-text.text-lighten-5 {
+  color: #ede7f6 !important;
+}
+
+.deep-purple.lighten-4 {
+  background-color: #d1c4e9 !important;
+}
+
+.deep-purple-text.text-lighten-4 {
+  color: #d1c4e9 !important;
+}
+
+.deep-purple.lighten-3 {
+  background-color: #b39ddb !important;
+}
+
+.deep-purple-text.text-lighten-3 {
+  color: #b39ddb !important;
+}
+
+.deep-purple.lighten-2 {
+  background-color: #9575cd !important;
+}
+
+.deep-purple-text.text-lighten-2 {
+  color: #9575cd !important;
+}
+
+.deep-purple.lighten-1 {
+  background-color: #7e57c2 !important;
+}
+
+.deep-purple-text.text-lighten-1 {
+  color: #7e57c2 !important;
+}
+
+.deep-purple.darken-1 {
+  background-color: #5e35b1 !important;
+}
+
+.deep-purple-text.text-darken-1 {
+  color: #5e35b1 !important;
+}
+
+.deep-purple.darken-2 {
+  background-color: #512da8 !important;
+}
+
+.deep-purple-text.text-darken-2 {
+  color: #512da8 !important;
+}
+
+.deep-purple.darken-3 {
+  background-color: #4527a0 !important;
+}
+
+.deep-purple-text.text-darken-3 {
+  color: #4527a0 !important;
+}
+
+.deep-purple.darken-4 {
+  background-color: #311b92 !important;
+}
+
+.deep-purple-text.text-darken-4 {
+  color: #311b92 !important;
+}
+
+.deep-purple.accent-1 {
+  background-color: #b388ff !important;
+}
+
+.deep-purple-text.text-accent-1 {
+  color: #b388ff !important;
+}
+
+.deep-purple.accent-2 {
+  background-color: #7c4dff !important;
+}
+
+.deep-purple-text.text-accent-2 {
+  color: #7c4dff !important;
+}
+
+.deep-purple.accent-3 {
+  background-color: #651fff !important;
+}
+
+.deep-purple-text.text-accent-3 {
+  color: #651fff !important;
+}
+
+.deep-purple.accent-4 {
+  background-color: #6200ea !important;
+}
+
+.deep-purple-text.text-accent-4 {
+  color: #6200ea !important;
+}
+
+.indigo {
+  background-color: #3f51b5 !important;
+}
+
+.indigo-text {
+  color: #3f51b5 !important;
+}
+
+.indigo.lighten-5 {
+  background-color: #e8eaf6 !important;
+}
+
+.indigo-text.text-lighten-5 {
+  color: #e8eaf6 !important;
+}
+
+.indigo.lighten-4 {
+  background-color: #c5cae9 !important;
+}
+
+.indigo-text.text-lighten-4 {
+  color: #c5cae9 !important;
+}
+
+.indigo.lighten-3 {
+  background-color: #9fa8da !important;
+}
+
+.indigo-text.text-lighten-3 {
+  color: #9fa8da !important;
+}
+
+.indigo.lighten-2 {
+  background-color: #7986cb !important;
+}
+
+.indigo-text.text-lighten-2 {
+  color: #7986cb !important;
+}
+
+.indigo.lighten-1 {
+  background-color: #5c6bc0 !important;
+}
+
+.indigo-text.text-lighten-1 {
+  color: #5c6bc0 !important;
+}
+
+.indigo.darken-1 {
+  background-color: #3949ab !important;
+}
+
+.indigo-text.text-darken-1 {
+  color: #3949ab !important;
+}
+
+.indigo.darken-2 {
+  background-color: #303f9f !important;
+}
+
+.indigo-text.text-darken-2 {
+  color: #303f9f !important;
+}
+
+.indigo.darken-3 {
+  background-color: #283593 !important;
+}
+
+.indigo-text.text-darken-3 {
+  color: #283593 !important;
+}
+
+.indigo.darken-4 {
+  background-color: #1a237e !important;
+}
+
+.indigo-text.text-darken-4 {
+  color: #1a237e !important;
+}
+
+.indigo.accent-1 {
+  background-color: #8c9eff !important;
+}
+
+.indigo-text.text-accent-1 {
+  color: #8c9eff !important;
+}
+
+.indigo.accent-2 {
+  background-color: #536dfe !important;
+}
+
+.indigo-text.text-accent-2 {
+  color: #536dfe !important;
+}
+
+.indigo.accent-3 {
+  background-color: #3d5afe !important;
+}
+
+.indigo-text.text-accent-3 {
+  color: #3d5afe !important;
+}
+
+.indigo.accent-4 {
+  background-color: #304ffe !important;
+}
+
+.indigo-text.text-accent-4 {
+  color: #304ffe !important;
+}
+
+.blue {
+  background-color: #2196F3 !important;
+}
+
+.blue-text {
+  color: #2196F3 !important;
+}
+
+.blue.lighten-5 {
+  background-color: #E3F2FD !important;
+}
+
+.blue-text.text-lighten-5 {
+  color: #E3F2FD !important;
+}
+
+.blue.lighten-4 {
+  background-color: #BBDEFB !important;
+}
+
+.blue-text.text-lighten-4 {
+  color: #BBDEFB !important;
+}
+
+.blue.lighten-3 {
+  background-color: #90CAF9 !important;
+}
+
+.blue-text.text-lighten-3 {
+  color: #90CAF9 !important;
+}
+
+.blue.lighten-2 {
+  background-color: #64B5F6 !important;
+}
+
+.blue-text.text-lighten-2 {
+  color: #64B5F6 !important;
+}
+
+.blue.lighten-1 {
+  background-color: #42A5F5 !important;
+}
+
+.blue-text.text-lighten-1 {
+  color: #42A5F5 !important;
+}
+
+.blue.darken-1 {
+  background-color: #1E88E5 !important;
+}
+
+.blue-text.text-darken-1 {
+  color: #1E88E5 !important;
+}
+
+.blue.darken-2 {
+  background-color: #1976D2 !important;
+}
+
+.blue-text.text-darken-2 {
+  color: #1976D2 !important;
+}
+
+.blue.darken-3 {
+  background-color: #1565C0 !important;
+}
+
+.blue-text.text-darken-3 {
+  color: #1565C0 !important;
+}
+
+.blue.darken-4 {
+  background-color: #0D47A1 !important;
+}
+
+.blue-text.text-darken-4 {
+  color: #0D47A1 !important;
+}
+
+.blue.accent-1 {
+  background-color: #82B1FF !important;
+}
+
+.blue-text.text-accent-1 {
+  color: #82B1FF !important;
+}
+
+.blue.accent-2 {
+  background-color: #448AFF !important;
+}
+
+.blue-text.text-accent-2 {
+  color: #448AFF !important;
+}
+
+.blue.accent-3 {
+  background-color: #2979FF !important;
+}
+
+.blue-text.text-accent-3 {
+  color: #2979FF !important;
+}
+
+.blue.accent-4 {
+  background-color: #2962FF !important;
+}
+
+.blue-text.text-accent-4 {
+  color: #2962FF !important;
+}
+
+.light-blue {
+  background-color: #03a9f4 !important;
+}
+
+.light-blue-text {
+  color: #03a9f4 !important;
+}
+
+.light-blue.lighten-5 {
+  background-color: #e1f5fe !important;
+}
+
+.light-blue-text.text-lighten-5 {
+  color: #e1f5fe !important;
+}
+
+.light-blue.lighten-4 {
+  background-color: #b3e5fc !important;
+}
+
+.light-blue-text.text-lighten-4 {
+  color: #b3e5fc !important;
+}
+
+.light-blue.lighten-3 {
+  background-color: #81d4fa !important;
+}
+
+.light-blue-text.text-lighten-3 {
+  color: #81d4fa !important;
+}
+
+.light-blue.lighten-2 {
+  background-color: #4fc3f7 !important;
+}
+
+.light-blue-text.text-lighten-2 {
+  color: #4fc3f7 !important;
+}
+
+.light-blue.lighten-1 {
+  background-color: #29b6f6 !important;
+}
+
+.light-blue-text.text-lighten-1 {
+  color: #29b6f6 !important;
+}
+
+.light-blue.darken-1 {
+  background-color: #039be5 !important;
+}
+
+.light-blue-text.text-darken-1 {
+  color: #039be5 !important;
+}
+
+.light-blue.darken-2 {
+  background-color: #0288d1 !important;
+}
+
+.light-blue-text.text-darken-2 {
+  color: #0288d1 !important;
+}
+
+.light-blue.darken-3 {
+  background-color: #0277bd !important;
+}
+
+.light-blue-text.text-darken-3 {
+  color: #0277bd !important;
+}
+
+.light-blue.darken-4 {
+  background-color: #01579b !important;
+}
+
+.light-blue-text.text-darken-4 {
+  color: #01579b !important;
+}
+
+.light-blue.accent-1 {
+  background-color: #80d8ff !important;
+}
+
+.light-blue-text.text-accent-1 {
+  color: #80d8ff !important;
+}
+
+.light-blue.accent-2 {
+  background-color: #40c4ff !important;
+}
+
+.light-blue-text.text-accent-2 {
+  color: #40c4ff !important;
+}
+
+.light-blue.accent-3 {
+  background-color: #00b0ff !important;
+}
+
+.light-blue-text.text-accent-3 {
+  color: #00b0ff !important;
+}
+
+.light-blue.accent-4 {
+  background-color: #0091ea !important;
+}
+
+.light-blue-text.text-accent-4 {
+  color: #0091ea !important;
+}
+
+.cyan {
+  background-color: #00bcd4 !important;
+}
+
+.cyan-text {
+  color: #00bcd4 !important;
+}
+
+.cyan.lighten-5 {
+  background-color: #e0f7fa !important;
+}
+
+.cyan-text.text-lighten-5 {
+  color: #e0f7fa !important;
+}
+
+.cyan.lighten-4 {
+  background-color: #b2ebf2 !important;
+}
+
+.cyan-text.text-lighten-4 {
+  color: #b2ebf2 !important;
+}
+
+.cyan.lighten-3 {
+  background-color: #80deea !important;
+}
+
+.cyan-text.text-lighten-3 {
+  color: #80deea !important;
+}
+
+.cyan.lighten-2 {
+  background-color: #4dd0e1 !important;
+}
+
+.cyan-text.text-lighten-2 {
+  color: #4dd0e1 !important;
+}
+
+.cyan.lighten-1 {
+  background-color: #26c6da !important;
+}
+
+.cyan-text.text-lighten-1 {
+  color: #26c6da !important;
+}
+
+.cyan.darken-1 {
+  background-color: #00acc1 !important;
+}
+
+.cyan-text.text-darken-1 {
+  color: #00acc1 !important;
+}
+
+.cyan.darken-2 {
+  background-color: #0097a7 !important;
+}
+
+.cyan-text.text-darken-2 {
+  color: #0097a7 !important;
+}
+
+.cyan.darken-3 {
+  background-color: #00838f !important;
+}
+
+.cyan-text.text-darken-3 {
+  color: #00838f !important;
+}
+
+.cyan.darken-4 {
+  background-color: #006064 !important;
+}
+
+.cyan-text.text-darken-4 {
+  color: #006064 !important;
+}
+
+.cyan.accent-1 {
+  background-color: #84ffff !important;
+}
+
+.cyan-text.text-accent-1 {
+  color: #84ffff !important;
+}
+
+.cyan.accent-2 {
+  background-color: #18ffff !important;
+}
+
+.cyan-text.text-accent-2 {
+  color: #18ffff !important;
+}
+
+.cyan.accent-3 {
+  background-color: #00e5ff !important;
+}
+
+.cyan-text.text-accent-3 {
+  color: #00e5ff !important;
+}
+
+.cyan.accent-4 {
+  background-color: #00b8d4 !important;
+}
+
+.cyan-text.text-accent-4 {
+  color: #00b8d4 !important;
+}
+
+.teal {
+  background-color: #009688 !important;
+}
+
+.teal-text {
+  color: #009688 !important;
+}
+
+.teal.lighten-5 {
+  background-color: #e0f2f1 !important;
+}
+
+.teal-text.text-lighten-5 {
+  color: #e0f2f1 !important;
+}
+
+.teal.lighten-4 {
+  background-color: #b2dfdb !important;
+}
+
+.teal-text.text-lighten-4 {
+  color: #b2dfdb !important;
+}
+
+.teal.lighten-3 {
+  background-color: #80cbc4 !important;
+}
+
+.teal-text.text-lighten-3 {
+  color: #80cbc4 !important;
+}
+
+.teal.lighten-2 {
+  background-color: #4db6ac !important;
+}
+
+.teal-text.text-lighten-2 {
+  color: #4db6ac !important;
+}
+
+.teal.lighten-1 {
+  background-color: #26a69a !important;
+}
+
+.teal-text.text-lighten-1 {
+  color: #26a69a !important;
+}
+
+.teal.darken-1 {
+  background-color: #00897b !important;
+}
+
+.teal-text.text-darken-1 {
+  color: #00897b !important;
+}
+
+.teal.darken-2 {
+  background-color: #00796b !important;
+}
+
+.teal-text.text-darken-2 {
+  color: #00796b !important;
+}
+
+.teal.darken-3 {
+  background-color: #00695c !important;
+}
+
+.teal-text.text-darken-3 {
+  color: #00695c !important;
+}
+
+.teal.darken-4 {
+  background-color: #004d40 !important;
+}
+
+.teal-text.text-darken-4 {
+  color: #004d40 !important;
+}
+
+.teal.accent-1 {
+  background-color: #a7ffeb !important;
+}
+
+.teal-text.text-accent-1 {
+  color: #a7ffeb !important;
+}
+
+.teal.accent-2 {
+  background-color: #64ffda !important;
+}
+
+.teal-text.text-accent-2 {
+  color: #64ffda !important;
+}
+
+.teal.accent-3 {
+  background-color: #1de9b6 !important;
+}
+
+.teal-text.text-accent-3 {
+  color: #1de9b6 !important;
+}
+
+.teal.accent-4 {
+  background-color: #00bfa5 !important;
+}
+
+.teal-text.text-accent-4 {
+  color: #00bfa5 !important;
+}
+
+.green {
+  background-color: #4CAF50 !important;
+}
+
+.green-text {
+  color: #4CAF50 !important;
+}
+
+.green.lighten-5 {
+  background-color: #E8F5E9 !important;
+}
+
+.green-text.text-lighten-5 {
+  color: #E8F5E9 !important;
+}
+
+.green.lighten-4 {
+  background-color: #C8E6C9 !important;
+}
+
+.green-text.text-lighten-4 {
+  color: #C8E6C9 !important;
+}
+
+.green.lighten-3 {
+  background-color: #A5D6A7 !important;
+}
+
+.green-text.text-lighten-3 {
+  color: #A5D6A7 !important;
+}
+
+.green.lighten-2 {
+  background-color: #81C784 !important;
+}
+
+.green-text.text-lighten-2 {
+  color: #81C784 !important;
+}
+
+.green.lighten-1 {
+  background-color: #66BB6A !important;
+}
+
+.green-text.text-lighten-1 {
+  color: #66BB6A !important;
+}
+
+.green.darken-1 {
+  background-color: #43A047 !important;
+}
+
+.green-text.text-darken-1 {
+  color: #43A047 !important;
+}
+
+.green.darken-2 {
+  background-color: #388E3C !important;
+}
+
+.green-text.text-darken-2 {
+  color: #388E3C !important;
+}
+
+.green.darken-3 {
+  background-color: #2E7D32 !important;
+}
+
+.green-text.text-darken-3 {
+  color: #2E7D32 !important;
+}
+
+.green.darken-4 {
+  background-color: #1B5E20 !important;
+}
+
+.green-text.text-darken-4 {
+  color: #1B5E20 !important;
+}
+
+.green.accent-1 {
+  background-color: #B9F6CA !important;
+}
+
+.green-text.text-accent-1 {
+  color: #B9F6CA !important;
+}
+
+.green.accent-2 {
+  background-color: #69F0AE !important;
+}
+
+.green-text.text-accent-2 {
+  color: #69F0AE !important;
+}
+
+.green.accent-3 {
+  background-color: #00E676 !important;
+}
+
+.green-text.text-accent-3 {
+  color: #00E676 !important;
+}
+
+.green.accent-4 {
+  background-color: #00C853 !important;
+}
+
+.green-text.text-accent-4 {
+  color: #00C853 !important;
+}
+
+.light-green {
+  background-color: #8bc34a !important;
+}
+
+.light-green-text {
+  color: #8bc34a !important;
+}
+
+.light-green.lighten-5 {
+  background-color: #f1f8e9 !important;
+}
+
+.light-green-text.text-lighten-5 {
+  color: #f1f8e9 !important;
+}
+
+.light-green.lighten-4 {
+  background-color: #dcedc8 !important;
+}
+
+.light-green-text.text-lighten-4 {
+  color: #dcedc8 !important;
+}
+
+.light-green.lighten-3 {
+  background-color: #c5e1a5 !important;
+}
+
+.light-green-text.text-lighten-3 {
+  color: #c5e1a5 !important;
+}
+
+.light-green.lighten-2 {
+  background-color: #aed581 !important;
+}
+
+.light-green-text.text-lighten-2 {
+  color: #aed581 !important;
+}
+
+.light-green.lighten-1 {
+  background-color: #9ccc65 !important;
+}
+
+.light-green-text.text-lighten-1 {
+  color: #9ccc65 !important;
+}
+
+.light-green.darken-1 {
+  background-color: #7cb342 !important;
+}
+
+.light-green-text.text-darken-1 {
+  color: #7cb342 !important;
+}
+
+.light-green.darken-2 {
+  background-color: #689f38 !important;
+}
+
+.light-green-text.text-darken-2 {
+  color: #689f38 !important;
+}
+
+.light-green.darken-3 {
+  background-color: #558b2f !important;
+}
+
+.light-green-text.text-darken-3 {
+  color: #558b2f !important;
+}
+
+.light-green.darken-4 {
+  background-color: #33691e !important;
+}
+
+.light-green-text.text-darken-4 {
+  color: #33691e !important;
+}
+
+.light-green.accent-1 {
+  background-color: #ccff90 !important;
+}
+
+.light-green-text.text-accent-1 {
+  color: #ccff90 !important;
+}
+
+.light-green.accent-2 {
+  background-color: #b2ff59 !important;
+}
+
+.light-green-text.text-accent-2 {
+  color: #b2ff59 !important;
+}
+
+.light-green.accent-3 {
+  background-color: #76ff03 !important;
+}
+
+.light-green-text.text-accent-3 {
+  color: #76ff03 !important;
+}
+
+.light-green.accent-4 {
+  background-color: #64dd17 !important;
+}
+
+.light-green-text.text-accent-4 {
+  color: #64dd17 !important;
+}
+
+.lime {
+  background-color: #cddc39 !important;
+}
+
+.lime-text {
+  color: #cddc39 !important;
+}
+
+.lime.lighten-5 {
+  background-color: #f9fbe7 !important;
+}
+
+.lime-text.text-lighten-5 {
+  color: #f9fbe7 !important;
+}
+
+.lime.lighten-4 {
+  background-color: #f0f4c3 !important;
+}
+
+.lime-text.text-lighten-4 {
+  color: #f0f4c3 !important;
+}
+
+.lime.lighten-3 {
+  background-color: #e6ee9c !important;
+}
+
+.lime-text.text-lighten-3 {
+  color: #e6ee9c !important;
+}
+
+.lime.lighten-2 {
+  background-color: #dce775 !important;
+}
+
+.lime-text.text-lighten-2 {
+  color: #dce775 !important;
+}
+
+.lime.lighten-1 {
+  background-color: #d4e157 !important;
+}
+
+.lime-text.text-lighten-1 {
+  color: #d4e157 !important;
+}
+
+.lime.darken-1 {
+  background-color: #c0ca33 !important;
+}
+
+.lime-text.text-darken-1 {
+  color: #c0ca33 !important;
+}
+
+.lime.darken-2 {
+  background-color: #afb42b !important;
+}
+
+.lime-text.text-darken-2 {
+  color: #afb42b !important;
+}
+
+.lime.darken-3 {
+  background-color: #9e9d24 !important;
+}
+
+.lime-text.text-darken-3 {
+  color: #9e9d24 !important;
+}
+
+.lime.darken-4 {
+  background-color: #827717 !important;
+}
+
+.lime-text.text-darken-4 {
+  color: #827717 !important;
+}
+
+.lime.accent-1 {
+  background-color: #f4ff81 !important;
+}
+
+.lime-text.text-accent-1 {
+  color: #f4ff81 !important;
+}
+
+.lime.accent-2 {
+  background-color: #eeff41 !important;
+}
+
+.lime-text.text-accent-2 {
+  color: #eeff41 !important;
+}
+
+.lime.accent-3 {
+  background-color: #c6ff00 !important;
+}
+
+.lime-text.text-accent-3 {
+  color: #c6ff00 !important;
+}
+
+.lime.accent-4 {
+  background-color: #aeea00 !important;
+}
+
+.lime-text.text-accent-4 {
+  color: #aeea00 !important;
+}
+
+.yellow {
+  background-color: #ffeb3b !important;
+}
+
+.yellow-text {
+  color: #ffeb3b !important;
+}
+
+.yellow.lighten-5 {
+  background-color: #fffde7 !important;
+}
+
+.yellow-text.text-lighten-5 {
+  color: #fffde7 !important;
+}
+
+.yellow.lighten-4 {
+  background-color: #fff9c4 !important;
+}
+
+.yellow-text.text-lighten-4 {
+  color: #fff9c4 !important;
+}
+
+.yellow.lighten-3 {
+  background-color: #fff59d !important;
+}
+
+.yellow-text.text-lighten-3 {
+  color: #fff59d !important;
+}
+
+.yellow.lighten-2 {
+  background-color: #fff176 !important;
+}
+
+.yellow-text.text-lighten-2 {
+  color: #fff176 !important;
+}
+
+.yellow.lighten-1 {
+  background-color: #ffee58 !important;
+}
+
+.yellow-text.text-lighten-1 {
+  color: #ffee58 !important;
+}
+
+.yellow.darken-1 {
+  background-color: #fdd835 !important;
+}
+
+.yellow-text.text-darken-1 {
+  color: #fdd835 !important;
+}
+
+.yellow.darken-2 {
+  background-color: #fbc02d !important;
+}
+
+.yellow-text.text-darken-2 {
+  color: #fbc02d !important;
+}
+
+.yellow.darken-3 {
+  background-color: #f9a825 !important;
+}
+
+.yellow-text.text-darken-3 {
+  color: #f9a825 !important;
+}
+
+.yellow.darken-4 {
+  background-color: #f57f17 !important;
+}
+
+.yellow-text.text-darken-4 {
+  color: #f57f17 !important;
+}
+
+.yellow.accent-1 {
+  background-color: #ffff8d !important;
+}
+
+.yellow-text.text-accent-1 {
+  color: #ffff8d !important;
+}
+
+.yellow.accent-2 {
+  background-color: #ffff00 !important;
+}
+
+.yellow-text.text-accent-2 {
+  color: #ffff00 !important;
+}
+
+.yellow.accent-3 {
+  background-color: #ffea00 !important;
+}
+
+.yellow-text.text-accent-3 {
+  color: #ffea00 !important;
+}
+
+.yellow.accent-4 {
+  background-color: #ffd600 !important;
+}
+
+.yellow-text.text-accent-4 {
+  color: #ffd600 !important;
+}
+
+.amber {
+  background-color: #ffc107 !important;
+}
+
+.amber-text {
+  color: #ffc107 !important;
+}
+
+.amber.lighten-5 {
+  background-color: #fff8e1 !important;
+}
+
+.amber-text.text-lighten-5 {
+  color: #fff8e1 !important;
+}
+
+.amber.lighten-4 {
+  background-color: #ffecb3 !important;
+}
+
+.amber-text.text-lighten-4 {
+  color: #ffecb3 !important;
+}
+
+.amber.lighten-3 {
+  background-color: #ffe082 !important;
+}
+
+.amber-text.text-lighten-3 {
+  color: #ffe082 !important;
+}
+
+.amber.lighten-2 {
+  background-color: #ffd54f !important;
+}
+
+.amber-text.text-lighten-2 {
+  color: #ffd54f !important;
+}
+
+.amber.lighten-1 {
+  background-color: #ffca28 !important;
+}
+
+.amber-text.text-lighten-1 {
+  color: #ffca28 !important;
+}
+
+.amber.darken-1 {
+  background-color: #ffb300 !important;
+}
+
+.amber-text.text-darken-1 {
+  color: #ffb300 !important;
+}
+
+.amber.darken-2 {
+  background-color: #ffa000 !important;
+}
+
+.amber-text.text-darken-2 {
+  color: #ffa000 !important;
+}
+
+.amber.darken-3 {
+  background-color: #ff8f00 !important;
+}
+
+.amber-text.text-darken-3 {
+  color: #ff8f00 !important;
+}
+
+.amber.darken-4 {
+  background-color: #ff6f00 !important;
+}
+
+.amber-text.text-darken-4 {
+  color: #ff6f00 !important;
+}
+
+.amber.accent-1 {
+  background-color: #ffe57f !important;
+}
+
+.amber-text.text-accent-1 {
+  color: #ffe57f !important;
+}
+
+.amber.accent-2 {
+  background-color: #ffd740 !important;
+}
+
+.amber-text.text-accent-2 {
+  color: #ffd740 !important;
+}
+
+.amber.accent-3 {
+  background-color: #ffc400 !important;
+}
+
+.amber-text.text-accent-3 {
+  color: #ffc400 !important;
+}
+
+.amber.accent-4 {
+  background-color: #ffab00 !important;
+}
+
+.amber-text.text-accent-4 {
+  color: #ffab00 !important;
+}
+
+.orange {
+  background-color: #ff9800 !important;
+}
+
+.orange-text {
+  color: #ff9800 !important;
+}
+
+.orange.lighten-5 {
+  background-color: #fff3e0 !important;
+}
+
+.orange-text.text-lighten-5 {
+  color: #fff3e0 !important;
+}
+
+.orange.lighten-4 {
+  background-color: #ffe0b2 !important;
+}
+
+.orange-text.text-lighten-4 {
+  color: #ffe0b2 !important;
+}
+
+.orange.lighten-3 {
+  background-color: #ffcc80 !important;
+}
+
+.orange-text.text-lighten-3 {
+  color: #ffcc80 !important;
+}
+
+.orange.lighten-2 {
+  background-color: #ffb74d !important;
+}
+
+.orange-text.text-lighten-2 {
+  color: #ffb74d !important;
+}
+
+.orange.lighten-1 {
+  background-color: #ffa726 !important;
+}
+
+.orange-text.text-lighten-1 {
+  color: #ffa726 !important;
+}
+
+.orange.darken-1 {
+  background-color: #fb8c00 !important;
+}
+
+.orange-text.text-darken-1 {
+  color: #fb8c00 !important;
+}
+
+.orange.darken-2 {
+  background-color: #f57c00 !important;
+}
+
+.orange-text.text-darken-2 {
+  color: #f57c00 !important;
+}
+
+.orange.darken-3 {
+  background-color: #ef6c00 !important;
+}
+
+.orange-text.text-darken-3 {
+  color: #ef6c00 !important;
+}
+
+.orange.darken-4 {
+  background-color: #e65100 !important;
+}
+
+.orange-text.text-darken-4 {
+  color: #e65100 !important;
+}
+
+.orange.accent-1 {
+  background-color: #ffd180 !important;
+}
+
+.orange-text.text-accent-1 {
+  color: #ffd180 !important;
+}
+
+.orange.accent-2 {
+  background-color: #ffab40 !important;
+}
+
+.orange-text.text-accent-2 {
+  color: #ffab40 !important;
+}
+
+.orange.accent-3 {
+  background-color: #ff9100 !important;
+}
+
+.orange-text.text-accent-3 {
+  color: #ff9100 !important;
+}
+
+.orange.accent-4 {
+  background-color: #ff6d00 !important;
+}
+
+.orange-text.text-accent-4 {
+  color: #ff6d00 !important;
+}
+
+.deep-orange {
+  background-color: #ff5722 !important;
+}
+
+.deep-orange-text {
+  color: #ff5722 !important;
+}
+
+.deep-orange.lighten-5 {
+  background-color: #fbe9e7 !important;
+}
+
+.deep-orange-text.text-lighten-5 {
+  color: #fbe9e7 !important;
+}
+
+.deep-orange.lighten-4 {
+  background-color: #ffccbc !important;
+}
+
+.deep-orange-text.text-lighten-4 {
+  color: #ffccbc !important;
+}
+
+.deep-orange.lighten-3 {
+  background-color: #ffab91 !important;
+}
+
+.deep-orange-text.text-lighten-3 {
+  color: #ffab91 !important;
+}
+
+.deep-orange.lighten-2 {
+  background-color: #ff8a65 !important;
+}
+
+.deep-orange-text.text-lighten-2 {
+  color: #ff8a65 !important;
+}
+
+.deep-orange.lighten-1 {
+  background-color: #ff7043 !important;
+}
+
+.deep-orange-text.text-lighten-1 {
+  color: #ff7043 !important;
+}
+
+.deep-orange.darken-1 {
+  background-color: #f4511e !important;
+}
+
+.deep-orange-text.text-darken-1 {
+  color: #f4511e !important;
+}
+
+.deep-orange.darken-2 {
+  background-color: #e64a19 !important;
+}
+
+.deep-orange-text.text-darken-2 {
+  color: #e64a19 !important;
+}
+
+.deep-orange.darken-3 {
+  background-color: #d84315 !important;
+}
+
+.deep-orange-text.text-darken-3 {
+  color: #d84315 !important;
+}
+
+.deep-orange.darken-4 {
+  background-color: #bf360c !important;
+}
+
+.deep-orange-text.text-darken-4 {
+  color: #bf360c !important;
+}
+
+.deep-orange.accent-1 {
+  background-color: #ff9e80 !important;
+}
+
+.deep-orange-text.text-accent-1 {
+  color: #ff9e80 !important;
+}
+
+.deep-orange.accent-2 {
+  background-color: #ff6e40 !important;
+}
+
+.deep-orange-text.text-accent-2 {
+  color: #ff6e40 !important;
+}
+
+.deep-orange.accent-3 {
+  background-color: #ff3d00 !important;
+}
+
+.deep-orange-text.text-accent-3 {
+  color: #ff3d00 !important;
+}
+
+.deep-orange.accent-4 {
+  background-color: #dd2c00 !important;
+}
+
+.deep-orange-text.text-accent-4 {
+  color: #dd2c00 !important;
+}
+
+.brown {
+  background-color: #795548 !important;
+}
+
+.brown-text {
+  color: #795548 !important;
+}
+
+.brown.lighten-5 {
+  background-color: #efebe9 !important;
+}
+
+.brown-text.text-lighten-5 {
+  color: #efebe9 !important;
+}
+
+.brown.lighten-4 {
+  background-color: #d7ccc8 !important;
+}
+
+.brown-text.text-lighten-4 {
+  color: #d7ccc8 !important;
+}
+
+.brown.lighten-3 {
+  background-color: #bcaaa4 !important;
+}
+
+.brown-text.text-lighten-3 {
+  color: #bcaaa4 !important;
+}
+
+.brown.lighten-2 {
+  background-color: #a1887f !important;
+}
+
+.brown-text.text-lighten-2 {
+  color: #a1887f !important;
+}
+
+.brown.lighten-1 {
+  background-color: #8d6e63 !important;
+}
+
+.brown-text.text-lighten-1 {
+  color: #8d6e63 !important;
+}
+
+.brown.darken-1 {
+  background-color: #6d4c41 !important;
+}
+
+.brown-text.text-darken-1 {
+  color: #6d4c41 !important;
+}
+
+.brown.darken-2 {
+  background-color: #5d4037 !important;
+}
+
+.brown-text.text-darken-2 {
+  color: #5d4037 !important;
+}
+
+.brown.darken-3 {
+  background-color: #4e342e !important;
+}
+
+.brown-text.text-darken-3 {
+  color: #4e342e !important;
+}
+
+.brown.darken-4 {
+  background-color: #3e2723 !important;
+}
+
+.brown-text.text-darken-4 {
+  color: #3e2723 !important;
+}
+
+.blue-grey {
+  background-color: #607d8b !important;
+}
+
+.blue-grey-text {
+  color: #607d8b !important;
+}
+
+.blue-grey.lighten-5 {
+  background-color: #eceff1 !important;
+}
+
+.blue-grey-text.text-lighten-5 {
+  color: #eceff1 !important;
+}
+
+.blue-grey.lighten-4 {
+  background-color: #cfd8dc !important;
+}
+
+.blue-grey-text.text-lighten-4 {
+  color: #cfd8dc !important;
+}
+
+.blue-grey.lighten-3 {
+  background-color: #b0bec5 !important;
+}
+
+.blue-grey-text.text-lighten-3 {
+  color: #b0bec5 !important;
+}
+
+.blue-grey.lighten-2 {
+  background-color: #90a4ae !important;
+}
+
+.blue-grey-text.text-lighten-2 {
+  color: #90a4ae !important;
+}
+
+.blue-grey.lighten-1 {
+  background-color: #78909c !important;
+}
+
+.blue-grey-text.text-lighten-1 {
+  color: #78909c !important;
+}
+
+.blue-grey.darken-1 {
+  background-color: #546e7a !important;
+}
+
+.blue-grey-text.text-darken-1 {
+  color: #546e7a !important;
+}
+
+.blue-grey.darken-2 {
+  background-color: #455a64 !important;
+}
+
+.blue-grey-text.text-darken-2 {
+  color: #455a64 !important;
+}
+
+.blue-grey.darken-3 {
+  background-color: #37474f !important;
+}
+
+.blue-grey-text.text-darken-3 {
+  color: #37474f !important;
+}
+
+.blue-grey.darken-4 {
+  background-color: #263238 !important;
+}
+
+.blue-grey-text.text-darken-4 {
+  color: #263238 !important;
+}
+
+.grey {
+  background-color: #9e9e9e !important;
+}
+
+.grey-text {
+  color: #9e9e9e !important;
+}
+
+.grey.lighten-5 {
+  background-color: #fafafa !important;
+}
+
+.grey-text.text-lighten-5 {
+  color: #fafafa !important;
+}
+
+.grey.lighten-4 {
+  background-color: #f5f5f5 !important;
+}
+
+.grey-text.text-lighten-4 {
+  color: #f5f5f5 !important;
+}
+
+.grey.lighten-3 {
+  background-color: #eeeeee !important;
+}
+
+.grey-text.text-lighten-3 {
+  color: #eeeeee !important;
+}
+
+.grey.lighten-2 {
+  background-color: #e0e0e0 !important;
+}
+
+.grey-text.text-lighten-2 {
+  color: #e0e0e0 !important;
+}
+
+.grey.lighten-1 {
+  background-color: #bdbdbd !important;
+}
+
+.grey-text.text-lighten-1 {
+  color: #bdbdbd !important;
+}
+
+.grey.darken-1 {
+  background-color: #757575 !important;
+}
+
+.grey-text.text-darken-1 {
+  color: #757575 !important;
+}
+
+.grey.darken-2 {
+  background-color: #616161 !important;
+}
+
+.grey-text.text-darken-2 {
+  color: #616161 !important;
+}
+
+.grey.darken-3 {
+  background-color: #424242 !important;
+}
+
+.grey-text.text-darken-3 {
+  color: #424242 !important;
+}
+
+.grey.darken-4 {
+  background-color: #212121 !important;
+}
+
+.grey-text.text-darken-4 {
+  color: #212121 !important;
+}
+
+.black {
+  background-color: #000000 !important;
+}
+
+.black-text {
+  color: #000000 !important;
+}
+
+.white {
+  background-color: #FFFFFF !important;
+}
+
+.white-text {
+  color: #FFFFFF !important;
+}
+
+.transparent {
+  background-color: transparent !important;
+}
+
+.transparent-text {
+  color: transparent !important;
+}
+
+/*! normalize.css v3.0.3 | MIT License | github.com/necolas/normalize.css */
+/**
+ * 1. Set default font family to sans-serif.
+ * 2. Prevent iOS and IE text size adjust after device orientation change,
+ *    without disabling user zoom.
+ */
+html {
+  font-family: sans-serif;
+  /* 1 */
+  -ms-text-size-adjust: 100%;
+  /* 2 */
+  -webkit-text-size-adjust: 100%;
+  /* 2 */
+}
+
+/**
+ * Remove default margin.
+ */
+body {
+  margin: 0;
+}
+
+/* HTML5 display definitions
+   ========================================================================== */
+/**
+ * Correct `block` display not defined for any HTML5 element in IE 8/9.
+ * Correct `block` display not defined for `details` or `summary` in IE 10/11
+ * and Firefox.
+ * Correct `block` display not defined for `main` in IE 11.
+ */
+article,
+aside,
+details,
+figcaption,
+figure,
+footer,
+header,
+hgroup,
+main,
+menu,
+nav,
+section,
+summary {
+  display: block;
+}
+
+/**
+ * 1. Correct `inline-block` display not defined in IE 8/9.
+ * 2. Normalize vertical alignment of `progress` in Chrome, Firefox, and Opera.
+ */
+audio,
+canvas,
+progress,
+video {
+  display: inline-block;
+  /* 1 */
+  vertical-align: baseline;
+  /* 2 */
+}
+
+/**
+ * Prevent modern browsers from displaying `audio` without controls.
+ * Remove excess height in iOS 5 devices.
+ */
+audio:not([controls]) {
+  display: none;
+  height: 0;
+}
+
+/**
+ * Address `[hidden]` styling not present in IE 8/9/10.
+ * Hide the `template` element in IE 8/9/10/11, Safari, and Firefox < 22.
+ */
+[hidden],
+template {
+  display: none;
+}
+
+/* Links
+   ========================================================================== */
+/**
+ * Remove the gray background color from active links in IE 10.
+ */
+a {
+  background-color: transparent;
+}
+
+/**
+ * Improve readability of focused elements when they are also in an
+ * active/hover state.
+ */
+a:active,
+a:hover {
+  outline: 0;
+}
+
+/* Text-level semantics
+   ========================================================================== */
+/**
+ * Address styling not present in IE 8/9/10/11, Safari, and Chrome.
+ */
+abbr[title] {
+  border-bottom: 1px dotted;
+}
+
+/**
+ * Address style set to `bolder` in Firefox 4+, Safari, and Chrome.
+ */
+b,
+strong {
+  font-weight: bold;
+}
+
+/**
+ * Address styling not present in Safari and Chrome.
+ */
+dfn {
+  font-style: italic;
+}
+
+/**
+ * Address variable `h1` font-size and margin within `section` and `article`
+ * contexts in Firefox 4+, Safari, and Chrome.
+ */
+h1 {
+  font-size: 2em;
+  margin: 0.67em 0;
+}
+
+/**
+ * Address styling not present in IE 8/9.
+ */
+mark {
+  background: #ff0;
+  color: #000;
+}
+
+/**
+ * Address inconsistent and variable font size in all browsers.
+ */
+small {
+  font-size: 80%;
+}
+
+/**
+ * Prevent `sub` and `sup` affecting `line-height` in all browsers.
+ */
+sub,
+sup {
+  font-size: 75%;
+  line-height: 0;
+  position: relative;
+  vertical-align: baseline;
+}
+
+sup {
+  top: -0.5em;
+}
+
+sub {
+  bottom: -0.25em;
+}
+
+/* Embedded content
+   ========================================================================== */
+/**
+ * Remove border when inside `a` element in IE 8/9/10.
+ */
+img {
+  border: 0;
+}
+
+/**
+ * Correct overflow not hidden in IE 9/10/11.
+ */
+svg:not(:root) {
+  overflow: hidden;
+}
+
+/* Grouping content
+   ========================================================================== */
+/**
+ * Address margin not present in IE 8/9 and Safari.
+ */
+figure {
+  margin: 1em 40px;
+}
+
+/**
+ * Address differences between Firefox and other browsers.
+ */
+hr {
+  -webkit-box-sizing: content-box;
+          box-sizing: content-box;
+  height: 0;
+}
+
+/**
+ * Contain overflow in all browsers.
+ */
+pre {
+  overflow: auto;
+}
+
+/**
+ * Address odd `em`-unit font size rendering in all browsers.
+ */
+code,
+kbd,
+pre,
+samp {
+  font-family: monospace, monospace;
+  font-size: 1em;
+}
+
+/* Forms
+   ========================================================================== */
+/**
+ * Known limitation: by default, Chrome and Safari on OS X allow very limited
+ * styling of `select`, unless a `border` property is set.
+ */
+/**
+ * 1. Correct color not being inherited.
+ *    Known issue: affects color of disabled elements.
+ * 2. Correct font properties not being inherited.
+ * 3. Address margins set differently in Firefox 4+, Safari, and Chrome.
+ */
+button,
+input,
+optgroup,
+select,
+textarea {
+  color: inherit;
+  /* 1 */
+  font: inherit;
+  /* 2 */
+  margin: 0;
+  /* 3 */
+}
+
+/**
+ * Address `overflow` set to `hidden` in IE 8/9/10/11.
+ */
+button {
+  overflow: visible;
+}
+
+/**
+ * Address inconsistent `text-transform` inheritance for `button` and `select`.
+ * All other form control elements do not inherit `text-transform` values.
+ * Correct `button` style inheritance in Firefox, IE 8/9/10/11, and Opera.
+ * Correct `select` style inheritance in Firefox.
+ */
+button,
+select {
+  text-transform: none;
+}
+
+/**
+ * 1. Avoid the WebKit bug in Android 4.0.* where (2) destroys native `audio`
+ *    and `video` controls.
+ * 2. Correct inability to style clickable `input` types in iOS.
+ * 3. Improve usability and consistency of cursor style between image-type
+ *    `input` and others.
+ */
+button,
+html input[type="button"],
+input[type="reset"],
+input[type="submit"] {
+  -webkit-appearance: button;
+  /* 2 */
+  cursor: pointer;
+  /* 3 */
+}
+
+/**
+ * Re-set default cursor for disabled elements.
+ */
+button[disabled],
+html input[disabled] {
+  cursor: default;
+}
+
+/**
+ * Remove inner padding and border in Firefox 4+.
+ */
+button::-moz-focus-inner,
+input::-moz-focus-inner {
+  border: 0;
+  padding: 0;
+}
+
+/**
+ * Address Firefox 4+ setting `line-height` on `input` using `!important` in
+ * the UA stylesheet.
+ */
+input {
+  line-height: normal;
+}
+
+/**
+ * It's recommended that you don't attempt to style these elements.
+ * Firefox's implementation doesn't respect box-sizing, padding, or width.
+ *
+ * 1. Address box sizing set to `content-box` in IE 8/9/10.
+ * 2. Remove excess padding in IE 8/9/10.
+ */
+input[type="checkbox"],
+input[type="radio"] {
+  -webkit-box-sizing: border-box;
+          box-sizing: border-box;
+  /* 1 */
+  padding: 0;
+  /* 2 */
+}
+
+/**
+ * Fix the cursor style for Chrome's increment/decrement buttons. For certain
+ * `font-size` values of the `input`, it causes the cursor style of the
+ * decrement button to change from `default` to `text`.
+ */
+input[type="number"]::-webkit-inner-spin-button,
+input[type="number"]::-webkit-outer-spin-button {
+  height: auto;
+}
+
+/**
+ * 1. Address `appearance` set to `searchfield` in Safari and Chrome.
+ * 2. Address `box-sizing` set to `border-box` in Safari and Chrome.
+ */
+input[type="search"] {
+  -webkit-appearance: textfield;
+  /* 1 */
+  -webkit-box-sizing: content-box;
+          box-sizing: content-box;
+  /* 2 */
+}
+
+/**
+ * Remove inner padding and search cancel button in Safari and Chrome on OS X.
+ * Safari (but not Chrome) clips the cancel button when the search input has
+ * padding (and `textfield` appearance).
+ */
+input[type="search"]::-webkit-search-cancel-button,
+input[type="search"]::-webkit-search-decoration {
+  -webkit-appearance: none;
+}
+
+/**
+ * Define consistent border, margin, and padding.
+ */
+fieldset {
+  border: 1px solid #c0c0c0;
+  margin: 0 2px;
+  padding: 0.35em 0.625em 0.75em;
+}
+
+/**
+ * 1. Correct `color` not being inherited in IE 8/9/10/11.
+ * 2. Remove padding so people aren't caught out if they zero out fieldsets.
+ */
+legend {
+  border: 0;
+  /* 1 */
+  padding: 0;
+  /* 2 */
+}
+
+/**
+ * Remove default vertical scrollbar in IE 8/9/10/11.
+ */
+textarea {
+  overflow: auto;
+}
+
+/**
+ * Don't inherit the `font-weight` (applied by a rule above).
+ * NOTE: the default cannot safely be changed in Chrome and Safari on OS X.
+ */
+optgroup {
+  font-weight: bold;
+}
+
+/* Tables
+   ========================================================================== */
+/**
+ * Remove most spacing between table cells.
+ */
+table {
+  border-collapse: collapse;
+  border-spacing: 0;
+}
+
+td,
+th {
+  padding: 0;
+}
+
+html {
+  -webkit-box-sizing: border-box;
+          box-sizing: border-box;
+}
+
+*, *:before, *:after {
+  -webkit-box-sizing: inherit;
+          box-sizing: inherit;
+}
+
+ul:not(.browser-default) {
+  padding-left: 0;
+  list-style-type: none;
+}
+
+ul:not(.browser-default) > li {
+  list-style-type: none;
+}
+
+a {
+  color: #039be5;
+  text-decoration: none;
+  -webkit-tap-highlight-color: transparent;
+}
+
+.valign-wrapper {
+  display: -webkit-box;
+  display: -webkit-flex;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-align: center;
+  -webkit-align-items: center;
+      -ms-flex-align: center;
+          align-items: center;
+}
+
+.clearfix {
+  clear: both;
+}
+
+.z-depth-0 {
+  -webkit-box-shadow: none !important;
+          box-shadow: none !important;
+}
+
+.z-depth-1, nav, .card-panel, .card, .toast, .btn, .btn-large, .btn-floating, .dropdown-content, .collapsible, .side-nav {
+  -webkit-box-shadow: 0 2px 2px 0 rgba(0, 0, 0, 0.14), 0 1px 5px 0 rgba(0, 0, 0, 0.12), 0 3px 1px -2px rgba(0, 0, 0, 0.2);
+          box-shadow: 0 2px 2px 0 rgba(0, 0, 0, 0.14), 0 1px 5px 0 rgba(0, 0, 0, 0.12), 0 3px 1px -2px rgba(0, 0, 0, 0.2);
+}
+
+.z-depth-1-half, .btn:hover, .btn-large:hover, .btn-floating:hover {
+  -webkit-box-shadow: 0 3px 3px 0 rgba(0, 0, 0, 0.14), 0 1px 7px 0 rgba(0, 0, 0, 0.12), 0 3px 1px -1px rgba(0, 0, 0, 0.2);
+          box-shadow: 0 3px 3px 0 rgba(0, 0, 0, 0.14), 0 1px 7px 0 rgba(0, 0, 0, 0.12), 0 3px 1px -1px rgba(0, 0, 0, 0.2);
+}
+
+.z-depth-2 {
+  -webkit-box-shadow: 0 4px 5px 0 rgba(0, 0, 0, 0.14), 0 1px 10px 0 rgba(0, 0, 0, 0.12), 0 2px 4px -1px rgba(0, 0, 0, 0.3);
+          box-shadow: 0 4px 5px 0 rgba(0, 0, 0, 0.14), 0 1px 10px 0 rgba(0, 0, 0, 0.12), 0 2px 4px -1px rgba(0, 0, 0, 0.3);
+}
+
+.z-depth-3 {
+  -webkit-box-shadow: 0 6px 10px 0 rgba(0, 0, 0, 0.14), 0 1px 18px 0 rgba(0, 0, 0, 0.12), 0 3px 5px -1px rgba(0, 0, 0, 0.3);
+          box-shadow: 0 6px 10px 0 rgba(0, 0, 0, 0.14), 0 1px 18px 0 rgba(0, 0, 0, 0.12), 0 3px 5px -1px rgba(0, 0, 0, 0.3);
+}
+
+.z-depth-4, .modal {
+  -webkit-box-shadow: 0 8px 10px 1px rgba(0, 0, 0, 0.14), 0 3px 14px 2px rgba(0, 0, 0, 0.12), 0 5px 5px -3px rgba(0, 0, 0, 0.3);
+          box-shadow: 0 8px 10px 1px rgba(0, 0, 0, 0.14), 0 3px 14px 2px rgba(0, 0, 0, 0.12), 0 5px 5px -3px rgba(0, 0, 0, 0.3);
+}
+
+.z-depth-5 {
+  -webkit-box-shadow: 0 16px 24px 2px rgba(0, 0, 0, 0.14), 0 6px 30px 5px rgba(0, 0, 0, 0.12), 0 8px 10px -5px rgba(0, 0, 0, 0.3);
+          box-shadow: 0 16px 24px 2px rgba(0, 0, 0, 0.14), 0 6px 30px 5px rgba(0, 0, 0, 0.12), 0 8px 10px -5px rgba(0, 0, 0, 0.3);
+}
+
+.hoverable {
+  -webkit-transition: -webkit-box-shadow .25s;
+  transition: -webkit-box-shadow .25s;
+  transition: box-shadow .25s;
+  transition: box-shadow .25s, -webkit-box-shadow .25s;
+}
+
+.hoverable:hover {
+  -webkit-box-shadow: 0 8px 17px 0 rgba(0, 0, 0, 0.2), 0 6px 20px 0 rgba(0, 0, 0, 0.19);
+          box-shadow: 0 8px 17px 0 rgba(0, 0, 0, 0.2), 0 6px 20px 0 rgba(0, 0, 0, 0.19);
+}
+
+.divider {
+  height: 1px;
+  overflow: hidden;
+  background-color: #e0e0e0;
+}
+
+blockquote {
+  margin: 20px 0;
+  padding-left: 1.5rem;
+  border-left: 5px solid #ee6e73;
+}
+
+i {
+  line-height: inherit;
+}
+
+i.left {
+  float: left;
+  margin-right: 15px;
+}
+
+i.right {
+  float: right;
+  /* margin-left: 15px; */
+}
+
+i.tiny {
+  font-size: 1rem;
+}
+
+i.small {
+  font-size: 2rem;
+}
+
+i.medium {
+  font-size: 4rem;
+}
+
+i.large {
+  font-size: 6rem;
+}
+
+img.responsive-img,
+video.responsive-video {
+  max-width: 100%;
+  height: auto;
+}
+
+.pagination li {
+  display: inline-block;
+  border-radius: 2px;
+  text-align: center;
+  vertical-align: top;
+  height: 30px;
+}
+
+.pagination li a {
+  color: #444;
+  display: inline-block;
+  font-size: 1.2rem;
+  padding: 0 10px;
+  line-height: 30px;
+}
+
+.pagination li.active a {
+  color: #fff;
+}
+
+.pagination li.active {
+  background-color: #ee6e73;
+}
+
+.pagination li.disabled a {
+  cursor: default;
+  color: #999;
+}
+
+.pagination li i {
+  font-size: 2rem;
+}
+
+.pagination li.pages ul li {
+  display: inline-block;
+  float: none;
+}
+
+@media only screen and (max-width: 992px) {
+  .pagination {
+    width: 100%;
+  }
+  .pagination li.prev,
+  .pagination li.next {
+    width: 10%;
+  }
+  .pagination li.pages {
+    width: 80%;
+    overflow: hidden;
+    white-space: nowrap;
+  }
+}
+
+.breadcrumb {
+  font-size: 18px;
+  color: rgba(255, 255, 255, 0.7);
+}
+
+.breadcrumb i,
+.breadcrumb [class^="mdi-"], .breadcrumb [class*="mdi-"],
+.breadcrumb i.material-icons {
+  display: inline-block;
+  float: left;
+  font-size: 24px;
+}
+
+.breadcrumb:before {
+  content: '\E5CC';
+  color: rgba(255, 255, 255, 0.7);
+  vertical-align: top;
+  display: inline-block;
+  font-family: 'Material Icons';
+  font-weight: normal;
+  font-style: normal;
+  font-size: 25px;
+  margin: 0 10px 0 8px;
+  -webkit-font-smoothing: antialiased;
+}
+
+.breadcrumb:first-child:before {
+  display: none;
+}
+
+.breadcrumb:last-child {
+  color: #fff;
+}
+
+.parallax-container {
+  position: relative;
+  overflow: hidden;
+  height: 500px;
+}
+
+.parallax-container .parallax {
+  position: absolute;
+  top: 0;
+  left: 0;
+  right: 0;
+  bottom: 0;
+  z-index: -1;
+}
+
+.parallax-container .parallax img {
+  display: none;
+  position: absolute;
+  left: 50%;
+  bottom: 0;
+  min-width: 100%;
+  min-height: 100%;
+  -webkit-transform: translate3d(0, 0, 0);
+          transform: translate3d(0, 0, 0);
+  -webkit-transform: translateX(-50%);
+          transform: translateX(-50%);
+}
+
+.pin-top, .pin-bottom {
+  position: relative;
+}
+
+.pinned {
+  position: fixed !important;
+}
+
+/*********************
+  Transition Classes
+**********************/
+ul.staggered-list li {
+  opacity: 0;
+}
+
+.fade-in {
+  opacity: 0;
+  -webkit-transform-origin: 0 50%;
+          transform-origin: 0 50%;
+}
+
+/*********************
+  Media Query Classes
+**********************/
+@media only screen and (max-width: 600px) {
+  .hide-on-small-only, .hide-on-small-and-down {
+    display: none !important;
+  }
+}
+
+@media only screen and (max-width: 992px) {
+  .hide-on-med-and-down {
+    display: none !important;
+  }
+}
+
+@media only screen and (min-width: 601px) {
+  .hide-on-med-and-up {
+    display: none !important;
+  }
+}
+
+@media only screen and (min-width: 600px) and (max-width: 992px) {
+  .hide-on-med-only {
+    display: none !important;
+  }
+}
+
+@media only screen and (min-width: 993px) {
+  .hide-on-large-only {
+    display: none !important;
+  }
+}
+
+@media only screen and (min-width: 993px) {
+  .show-on-large {
+    display: block !important;
+  }
+}
+
+@media only screen and (min-width: 600px) and (max-width: 992px) {
+  .show-on-medium {
+    display: block !important;
+  }
+}
+
+@media only screen and (max-width: 600px) {
+  .show-on-small {
+    display: block !important;
+  }
+}
+
+@media only screen and (min-width: 601px) {
+  .show-on-medium-and-up {
+    display: block !important;
+  }
+}
+
+@media only screen and (max-width: 992px) {
+  .show-on-medium-and-down {
+    display: block !important;
+  }
+}
+
+@media only screen and (max-width: 600px) {
+  .center-on-small-only {
+    text-align: center;
+  }
+}
+
+.page-footer {
+  padding-top: 20px;
+  color: #fff;
+  background-color: #ee6e73;
+}
+
+.page-footer .footer-copyright {
+  overflow: hidden;
+  min-height: 47px;
+  display: -webkit-box;
+  display: -webkit-flex;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-align: center;
+  -webkit-align-items: center;
+      -ms-flex-align: center;
+          align-items: center;
+  padding: 10px 0px;
+  color: rgba(255, 255, 255, 0.8);
+  background-color: rgba(51, 51, 51, 0.08);
+}
+
+table, th, td {
+  border: none;
+}
+
+table {
+  width: 100%;
+  display: table;
+}
+
+table.bordered > thead > tr,
+table.bordered > tbody > tr {
+  border-bottom: 1px solid #d0d0d0;
+}
+
+table.striped > tbody > tr:nth-child(odd) {
+  background-color: #f2f2f2;
+}
+
+table.striped > tbody > tr > td {
+  border-radius: 0;
+}
+
+table.highlight > tbody > tr {
+  -webkit-transition: background-color .25s ease;
+  transition: background-color .25s ease;
+}
+
+table.highlight > tbody > tr:hover {
+  background-color: #f2f2f2;
+}
+
+table.centered thead tr th, table.centered tbody tr td {
+  text-align: center;
+}
+
+thead {
+  border-bottom: 1px solid #d0d0d0;
+}
+
+td, th {
+  padding: 15px 5px;
+  display: table-cell;
+  text-align: left;
+  vertical-align: middle;
+  border-radius: 2px;
+}
+
+@media only screen and (max-width: 992px) {
+  table.responsive-table {
+    width: 100%;
+    border-collapse: collapse;
+    border-spacing: 0;
+    display: block;
+    position: relative;
+    /* sort out borders */
+  }
+  table.responsive-table td:empty:before {
+    content: '\00a0';
+  }
+  table.responsive-table th,
+  table.responsive-table td {
+    margin: 0;
+    vertical-align: top;
+  }
+  table.responsive-table th {
+    text-align: left;
+  }
+  table.responsive-table thead {
+    display: block;
+    float: left;
+  }
+  table.responsive-table thead tr {
+    display: block;
+    padding: 0 10px 0 0;
+  }
+  table.responsive-table thead tr th::before {
+    content: "\00a0";
+  }
+  table.responsive-table tbody {
+    display: block;
+    width: auto;
+    position: relative;
+    overflow-x: auto;
+    white-space: nowrap;
+  }
+  table.responsive-table tbody tr {
+    display: inline-block;
+    vertical-align: top;
+  }
+  table.responsive-table th {
+    display: block;
+    text-align: right;
+  }
+  table.responsive-table td {
+    display: block;
+    min-height: 1.25em;
+    text-align: left;
+  }
+  table.responsive-table tr {
+    padding: 0 10px;
+  }
+  table.responsive-table thead {
+    border: 0;
+    border-right: 1px solid #d0d0d0;
+  }
+  table.responsive-table.bordered th {
+    border-bottom: 0;
+    border-left: 0;
+  }
+  table.responsive-table.bordered td {
+    border-left: 0;
+    border-right: 0;
+    border-bottom: 0;
+  }
+  table.responsive-table.bordered tr {
+    border: 0;
+  }
+  table.responsive-table.bordered tbody tr {
+    border-right: 1px solid #d0d0d0;
+  }
+}
+
+.collection {
+  margin: 0.5rem 0 1rem 0;
+  border: 1px solid #e0e0e0;
+  border-radius: 2px;
+  overflow: hidden;
+  position: relative;
+}
+
+.collection .collection-item {
+  background-color: #fff;
+  line-height: 1.5rem;
+  padding: 10px 20px;
+  margin: 0;
+  border-bottom: 1px solid #e0e0e0;
+}
+
+.collection .collection-item.avatar {
+  min-height: 84px;
+  padding-left: 72px;
+  position: relative;
+}
+
+.collection .collection-item.avatar:not(.circle-clipper) > .circle,
+.collection .collection-item.avatar :not(.circle-clipper) > .circle {
+  position: absolute;
+  width: 42px;
+  height: 42px;
+  overflow: hidden;
+  left: 15px;
+  display: inline-block;
+  vertical-align: middle;
+}
+
+.collection .collection-item.avatar i.circle {
+  font-size: 18px;
+  line-height: 42px;
+  color: #fff;
+  background-color: #999;
+  text-align: center;
+}
+
+.collection .collection-item.avatar .title {
+  font-size: 16px;
+}
+
+.collection .collection-item.avatar p {
+  margin: 0;
+}
+
+.collection .collection-item.avatar .secondary-content {
+  position: absolute;
+  top: 16px;
+  right: 16px;
+}
+
+.collection .collection-item:last-child {
+  border-bottom: none;
+}
+
+.collection .collection-item.active {
+  background-color: #26a69a;
+  color: #eafaf9;
+}
+
+.collection .collection-item.active .secondary-content {
+  color: #fff;
+}
+
+.collection a.collection-item {
+  display: block;
+  -webkit-transition: .25s;
+  transition: .25s;
+  color: #26a69a;
+}
+
+.collection a.collection-item:not(.active):hover {
+  background-color: #ddd;
+}
+
+.collection.with-header .collection-header {
+  background-color: #fff;
+  border-bottom: 1px solid #e0e0e0;
+  padding: 10px 20px;
+}
+
+.collection.with-header .collection-item {
+  padding-left: 30px;
+}
+
+.collection.with-header .collection-item.avatar {
+  padding-left: 72px;
+}
+
+.secondary-content {
+  float: right;
+  color: #26a69a;
+}
+
+.collapsible .collection {
+  margin: 0;
+  border: none;
+}
+
+.video-container {
+  position: relative;
+  padding-bottom: 56.25%;
+  height: 0;
+  overflow: hidden;
+}
+
+.video-container iframe, .video-container object, .video-container embed {
+  position: absolute;
+  top: 0;
+  left: 0;
+  width: 100%;
+  height: 100%;
+}
+
+.progress {
+  position: relative;
+  height: 4px;
+  display: block;
+  width: 100%;
+  background-color: #acece6;
+  border-radius: 2px;
+  margin: 0.5rem 0 1rem 0;
+  overflow: hidden;
+}
+
+.progress .determinate {
+  position: absolute;
+  top: 0;
+  left: 0;
+  bottom: 0;
+  background-color: #26a69a;
+  -webkit-transition: width .3s linear;
+  transition: width .3s linear;
+}
+
+.progress .indeterminate {
+  background-color: #26a69a;
+}
+
+.progress .indeterminate:before {
+  content: '';
+  position: absolute;
+  background-color: inherit;
+  top: 0;
+  left: 0;
+  bottom: 0;
+  will-change: left, right;
+  -webkit-animation: indeterminate 2.1s cubic-bezier(0.65, 0.815, 0.735, 0.395) infinite;
+          animation: indeterminate 2.1s cubic-bezier(0.65, 0.815, 0.735, 0.395) infinite;
+}
+
+.progress .indeterminate:after {
+  content: '';
+  position: absolute;
+  background-color: inherit;
+  top: 0;
+  left: 0;
+  bottom: 0;
+  will-change: left, right;
+  -webkit-animation: indeterminate-short 2.1s cubic-bezier(0.165, 0.84, 0.44, 1) infinite;
+          animation: indeterminate-short 2.1s cubic-bezier(0.165, 0.84, 0.44, 1) infinite;
+  -webkit-animation-delay: 1.15s;
+          animation-delay: 1.15s;
+}
+
+@-webkit-keyframes indeterminate {
+  0% {
+    left: -35%;
+    right: 100%;
+  }
+  60% {
+    left: 100%;
+    right: -90%;
+  }
+  100% {
+    left: 100%;
+    right: -90%;
+  }
+}
+
+@keyframes indeterminate {
+  0% {
+    left: -35%;
+    right: 100%;
+  }
+  60% {
+    left: 100%;
+    right: -90%;
+  }
+  100% {
+    left: 100%;
+    right: -90%;
+  }
+}
+
+@-webkit-keyframes indeterminate-short {
+  0% {
+    left: -200%;
+    right: 100%;
+  }
+  60% {
+    left: 107%;
+    right: -8%;
+  }
+  100% {
+    left: 107%;
+    right: -8%;
+  }
+}
+
+@keyframes indeterminate-short {
+  0% {
+    left: -200%;
+    right: 100%;
+  }
+  60% {
+    left: 107%;
+    right: -8%;
+  }
+  100% {
+    left: 107%;
+    right: -8%;
+  }
+}
+
+/*******************
+  Utility Classes
+*******************/
+.hide {
+  display: none !important;
+}
+
+.left-align {
+  text-align: left;
+}
+
+.right-align {
+  text-align: right;
+}
+
+.center, .center-align {
+  text-align: center;
+}
+
+.left {
+  float: left !important;
+}
+
+.right {
+  float: right !important;
+}
+
+.no-select, input[type=range],
+input[type=range] + .thumb {
+  -webkit-user-select: none;
+     -moz-user-select: none;
+      -ms-user-select: none;
+          user-select: none;
+}
+
+.circle {
+  border-radius: 50%;
+}
+
+.center-block {
+  display: block;
+  margin-left: auto;
+  margin-right: auto;
+}
+
+.truncate {
+  display: block;
+  white-space: nowrap;
+  overflow: hidden;
+  text-overflow: ellipsis;
+}
+
+.no-padding {
+  padding: 0 !important;
+}
+
+span.badge {
+  min-width: 3rem;
+  padding: 0 6px;
+  margin-left: 14px;
+  text-align: center;
+  font-size: 1rem;
+  line-height: 22px;
+  height: 22px;
+  color: #757575;
+  float: right;
+  -webkit-box-sizing: border-box;
+          box-sizing: border-box;
+}
+
+span.badge.new {
+  font-weight: 300;
+  font-size: 0.8rem;
+  color: #fff;
+  background-color: #26a69a;
+  border-radius: 2px;
+}
+
+span.badge.new:after {
+  content: " new";
+}
+
+span.badge[data-badge-caption]::after {
+  content: " " attr(data-badge-caption);
+}
+
+nav ul a span.badge {
+  display: inline-block;
+  float: none;
+  margin-left: 4px;
+  line-height: 22px;
+  height: 22px;
+  -webkit-font-smoothing: auto;
+}
+
+.collection-item span.badge {
+  margin-top: calc(0.75rem - 11px);
+}
+
+.collapsible span.badge {
+  margin-left: auto;
+}
+
+.side-nav span.badge {
+  margin-top: calc(24px - 11px);
+}
+
+/* This is needed for some mobile phones to display the Google Icon font properly */
+.material-icons {
+  text-rendering: optimizeLegibility;
+  -webkit-font-feature-settings: 'liga';
+     -moz-font-feature-settings: 'liga';
+          font-feature-settings: 'liga';
+}
+
+.container {
+  margin: 0 auto;
+  max-width: 1280px;
+  width: 90%;
+}
+
+@media only screen and (min-width: 601px) {
+  .container {
+    width: 85%;
+  }
+}
+
+@media only screen and (min-width: 993px) {
+  .container {
+    width: 70%;
+  }
+}
+
+.container .row {
+  margin-left: -0.75rem;
+  margin-right: -0.75rem;
+}
+
+.section {
+  padding-top: 1rem;
+  padding-bottom: 1rem;
+}
+
+.section.no-pad {
+  padding: 0;
+}
+
+.section.no-pad-bot {
+  padding-bottom: 0;
+}
+
+.section.no-pad-top {
+  padding-top: 0;
+}
+
+.row {
+  margin-left: auto;
+  margin-right: auto;
+  margin-bottom: 20px;
+}
+
+.row:after {
+  content: "";
+  display: table;
+  clear: both;
+}
+
+.row .col {
+  float: left;
+  -webkit-box-sizing: border-box;
+          box-sizing: border-box;
+  padding: 0 0.75rem;
+  min-height: 1px;
+}
+
+.row .col[class*="push-"], .row .col[class*="pull-"] {
+  position: relative;
+}
+
+.row .col.s1 {
+  width: 8.3333333333%;
+  margin-left: auto;
+  left: auto;
+  right: auto;
+}
+
+.row .col.s2 {
+  width: 16.6666666667%;
+  margin-left: auto;
+  left: auto;
+  right: auto;
+}
+
+.row .col.s3 {
+  width: 25%;
+  margin-left: auto;
+  left: auto;
+  right: auto;
+}
+
+.row .col.s4 {
+  width: 33.3333333333%;
+  margin-left: auto;
+  left: auto;
+  right: auto;
+}
+
+.row .col.s5 {
+  width: 41.6666666667%;
+  margin-left: auto;
+  left: auto;
+  right: auto;
+}
+
+.row .col.s6 {
+  width: 50%;
+  margin-left: auto;
+  left: auto;
+  right: auto;
+}
+
+.row .col.s7 {
+  width: 58.3333333333%;
+  margin-left: auto;
+  left: auto;
+  right: auto;
+}
+
+.row .col.s8 {
+  width: 66.6666666667%;
+  margin-left: auto;
+  left: auto;
+  right: auto;
+}
+
+.row .col.s9 {
+  width: 75%;
+  margin-left: auto;
+  left: auto;
+  right: auto;
+}
+
+.row .col.s10 {
+  width: 83.3333333333%;
+  margin-left: auto;
+  left: auto;
+  right: auto;
+}
+
+.row .col.s11 {
+  width: 91.6666666667%;
+  margin-left: auto;
+  left: auto;
+  right: auto;
+}
+
+.row .col.s12 {
+  width: 100%;
+  margin-left: auto;
+  left: auto;
+  right: auto;
+}
+
+.row .col.offset-s1 {
+  margin-left: 8.3333333333%;
+}
+
+.row .col.pull-s1 {
+  right: 8.3333333333%;
+}
+
+.row .col.push-s1 {
+  left: 8.3333333333%;
+}
+
+.row .col.offset-s2 {
+  margin-left: 16.6666666667%;
+}
+
+.row .col.pull-s2 {
+  right: 16.6666666667%;
+}
+
+.row .col.push-s2 {
+  left: 16.6666666667%;
+}
+
+.row .col.offset-s3 {
+  margin-left: 25%;
+}
+
+.row .col.pull-s3 {
+  right: 25%;
+}
+
+.row .col.push-s3 {
+  left: 25%;
+}
+
+.row .col.offset-s4 {
+  margin-left: 33.3333333333%;
+}
+
+.row .col.pull-s4 {
+  right: 33.3333333333%;
+}
+
+.row .col.push-s4 {
+  left: 33.3333333333%;
+}
+
+.row .col.offset-s5 {
+  margin-left: 41.6666666667%;
+}
+
+.row .col.pull-s5 {
+  right: 41.6666666667%;
+}
+
+.row .col.push-s5 {
+  left: 41.6666666667%;
+}
+
+.row .col.offset-s6 {
+  margin-left: 50%;
+}
+
+.row .col.pull-s6 {
+  right: 50%;
+}
+
+.row .col.push-s6 {
+  left: 50%;
+}
+
+.row .col.offset-s7 {
+  margin-left: 58.3333333333%;
+}
+
+.row .col.pull-s7 {
+  right: 58.3333333333%;
+}
+
+.row .col.push-s7 {
+  left: 58.3333333333%;
+}
+
+.row .col.offset-s8 {
+  margin-left: 66.6666666667%;
+}
+
+.row .col.pull-s8 {
+  right: 66.6666666667%;
+}
+
+.row .col.push-s8 {
+  left: 66.6666666667%;
+}
+
+.row .col.offset-s9 {
+  margin-left: 75%;
+}
+
+.row .col.pull-s9 {
+  right: 75%;
+}
+
+.row .col.push-s9 {
+  left: 75%;
+}
+
+.row .col.offset-s10 {
+  margin-left: 83.3333333333%;
+}
+
+.row .col.pull-s10 {
+  right: 83.3333333333%;
+}
+
+.row .col.push-s10 {
+  left: 83.3333333333%;
+}
+
+.row .col.offset-s11 {
+  margin-left: 91.6666666667%;
+}
+
+.row .col.pull-s11 {
+  right: 91.6666666667%;
+}
+
+.row .col.push-s11 {
+  left: 91.6666666667%;
+}
+
+.row .col.offset-s12 {
+  margin-left: 100%;
+}
+
+.row .col.pull-s12 {
+  right: 100%;
+}
+
+.row .col.push-s12 {
+  left: 100%;
+}
+
+@media only screen and (min-width: 601px) {
+  .row .col.m1 {
+    width: 8.3333333333%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.m2 {
+    width: 16.6666666667%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.m3 {
+    width: 25%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.m4 {
+    width: 33.3333333333%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.m5 {
+    width: 41.6666666667%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.m6 {
+    width: 50%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.m7 {
+    width: 58.3333333333%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.m8 {
+    width: 66.6666666667%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.m9 {
+    width: 75%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.m10 {
+    width: 83.3333333333%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.m11 {
+    width: 91.6666666667%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.m12 {
+    width: 100%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.offset-m1 {
+    margin-left: 8.3333333333%;
+  }
+  .row .col.pull-m1 {
+    right: 8.3333333333%;
+  }
+  .row .col.push-m1 {
+    left: 8.3333333333%;
+  }
+  .row .col.offset-m2 {
+    margin-left: 16.6666666667%;
+  }
+  .row .col.pull-m2 {
+    right: 16.6666666667%;
+  }
+  .row .col.push-m2 {
+    left: 16.6666666667%;
+  }
+  .row .col.offset-m3 {
+    margin-left: 25%;
+  }
+  .row .col.pull-m3 {
+    right: 25%;
+  }
+  .row .col.push-m3 {
+    left: 25%;
+  }
+  .row .col.offset-m4 {
+    margin-left: 33.3333333333%;
+  }
+  .row .col.pull-m4 {
+    right: 33.3333333333%;
+  }
+  .row .col.push-m4 {
+    left: 33.3333333333%;
+  }
+  .row .col.offset-m5 {
+    margin-left: 41.6666666667%;
+  }
+  .row .col.pull-m5 {
+    right: 41.6666666667%;
+  }
+  .row .col.push-m5 {
+    left: 41.6666666667%;
+  }
+  .row .col.offset-m6 {
+    margin-left: 50%;
+  }
+  .row .col.pull-m6 {
+    right: 50%;
+  }
+  .row .col.push-m6 {
+    left: 50%;
+  }
+  .row .col.offset-m7 {
+    margin-left: 58.3333333333%;
+  }
+  .row .col.pull-m7 {
+    right: 58.3333333333%;
+  }
+  .row .col.push-m7 {
+    left: 58.3333333333%;
+  }
+  .row .col.offset-m8 {
+    margin-left: 66.6666666667%;
+  }
+  .row .col.pull-m8 {
+    right: 66.6666666667%;
+  }
+  .row .col.push-m8 {
+    left: 66.6666666667%;
+  }
+  .row .col.offset-m9 {
+    margin-left: 75%;
+  }
+  .row .col.pull-m9 {
+    right: 75%;
+  }
+  .row .col.push-m9 {
+    left: 75%;
+  }
+  .row .col.offset-m10 {
+    margin-left: 83.3333333333%;
+  }
+  .row .col.pull-m10 {
+    right: 83.3333333333%;
+  }
+  .row .col.push-m10 {
+    left: 83.3333333333%;
+  }
+  .row .col.offset-m11 {
+    margin-left: 91.6666666667%;
+  }
+  .row .col.pull-m11 {
+    right: 91.6666666667%;
+  }
+  .row .col.push-m11 {
+    left: 91.6666666667%;
+  }
+  .row .col.offset-m12 {
+    margin-left: 100%;
+  }
+  .row .col.pull-m12 {
+    right: 100%;
+  }
+  .row .col.push-m12 {
+    left: 100%;
+  }
+}
+
+@media only screen and (min-width: 993px) {
+  .row .col.l1 {
+    width: 8.3333333333%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.l2 {
+    width: 16.6666666667%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.l3 {
+    width: 25%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.l4 {
+    width: 33.3333333333%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.l5 {
+    width: 41.6666666667%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.l6 {
+    width: 50%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.l7 {
+    width: 58.3333333333%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.l8 {
+    width: 66.6666666667%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.l9 {
+    width: 75%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.l10 {
+    width: 83.3333333333%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.l11 {
+    width: 91.6666666667%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.l12 {
+    width: 100%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.offset-l1 {
+    margin-left: 8.3333333333%;
+  }
+  .row .col.pull-l1 {
+    right: 8.3333333333%;
+  }
+  .row .col.push-l1 {
+    left: 8.3333333333%;
+  }
+  .row .col.offset-l2 {
+    margin-left: 16.6666666667%;
+  }
+  .row .col.pull-l2 {
+    right: 16.6666666667%;
+  }
+  .row .col.push-l2 {
+    left: 16.6666666667%;
+  }
+  .row .col.offset-l3 {
+    margin-left: 25%;
+  }
+  .row .col.pull-l3 {
+    right: 25%;
+  }
+  .row .col.push-l3 {
+    left: 25%;
+  }
+  .row .col.offset-l4 {
+    margin-left: 33.3333333333%;
+  }
+  .row .col.pull-l4 {
+    right: 33.3333333333%;
+  }
+  .row .col.push-l4 {
+    left: 33.3333333333%;
+  }
+  .row .col.offset-l5 {
+    margin-left: 41.6666666667%;
+  }
+  .row .col.pull-l5 {
+    right: 41.6666666667%;
+  }
+  .row .col.push-l5 {
+    left: 41.6666666667%;
+  }
+  .row .col.offset-l6 {
+    margin-left: 50%;
+  }
+  .row .col.pull-l6 {
+    right: 50%;
+  }
+  .row .col.push-l6 {
+    left: 50%;
+  }
+  .row .col.offset-l7 {
+    margin-left: 58.3333333333%;
+  }
+  .row .col.pull-l7 {
+    right: 58.3333333333%;
+  }
+  .row .col.push-l7 {
+    left: 58.3333333333%;
+  }
+  .row .col.offset-l8 {
+    margin-left: 66.6666666667%;
+  }
+  .row .col.pull-l8 {
+    right: 66.6666666667%;
+  }
+  .row .col.push-l8 {
+    left: 66.6666666667%;
+  }
+  .row .col.offset-l9 {
+    margin-left: 75%;
+  }
+  .row .col.pull-l9 {
+    right: 75%;
+  }
+  .row .col.push-l9 {
+    left: 75%;
+  }
+  .row .col.offset-l10 {
+    margin-left: 83.3333333333%;
+  }
+  .row .col.pull-l10 {
+    right: 83.3333333333%;
+  }
+  .row .col.push-l10 {
+    left: 83.3333333333%;
+  }
+  .row .col.offset-l11 {
+    margin-left: 91.6666666667%;
+  }
+  .row .col.pull-l11 {
+    right: 91.6666666667%;
+  }
+  .row .col.push-l11 {
+    left: 91.6666666667%;
+  }
+  .row .col.offset-l12 {
+    margin-left: 100%;
+  }
+  .row .col.pull-l12 {
+    right: 100%;
+  }
+  .row .col.push-l12 {
+    left: 100%;
+  }
+}
+
+@media only screen and (min-width: 1201px) {
+  .row .col.xl1 {
+    width: 8.3333333333%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.xl2 {
+    width: 16.6666666667%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.xl3 {
+    width: 25%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.xl4 {
+    width: 33.3333333333%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.xl5 {
+    width: 41.6666666667%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.xl6 {
+    width: 50%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.xl7 {
+    width: 58.3333333333%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.xl8 {
+    width: 66.6666666667%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.xl9 {
+    width: 75%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.xl10 {
+    width: 83.3333333333%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.xl11 {
+    width: 91.6666666667%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.xl12 {
+    width: 100%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.offset-xl1 {
+    margin-left: 8.3333333333%;
+  }
+  .row .col.pull-xl1 {
+    right: 8.3333333333%;
+  }
+  .row .col.push-xl1 {
+    left: 8.3333333333%;
+  }
+  .row .col.offset-xl2 {
+    margin-left: 16.6666666667%;
+  }
+  .row .col.pull-xl2 {
+    right: 16.6666666667%;
+  }
+  .row .col.push-xl2 {
+    left: 16.6666666667%;
+  }
+  .row .col.offset-xl3 {
+    margin-left: 25%;
+  }
+  .row .col.pull-xl3 {
+    right: 25%;
+  }
+  .row .col.push-xl3 {
+    left: 25%;
+  }
+  .row .col.offset-xl4 {
+    margin-left: 33.3333333333%;
+  }
+  .row .col.pull-xl4 {
+    right: 33.3333333333%;
+  }
+  .row .col.push-xl4 {
+    left: 33.3333333333%;
+  }
+  .row .col.offset-xl5 {
+    margin-left: 41.6666666667%;
+  }
+  .row .col.pull-xl5 {
+    right: 41.6666666667%;
+  }
+  .row .col.push-xl5 {
+    left: 41.6666666667%;
+  }
+  .row .col.offset-xl6 {
+    margin-left: 50%;
+  }
+  .row .col.pull-xl6 {
+    right: 50%;
+  }
+  .row .col.push-xl6 {
+    left: 50%;
+  }
+  .row .col.offset-xl7 {
+    margin-left: 58.3333333333%;
+  }
+  .row .col.pull-xl7 {
+    right: 58.3333333333%;
+  }
+  .row .col.push-xl7 {
+    left: 58.3333333333%;
+  }
+  .row .col.offset-xl8 {
+    margin-left: 66.6666666667%;
+  }
+  .row .col.pull-xl8 {
+    right: 66.6666666667%;
+  }
+  .row .col.push-xl8 {
+    left: 66.6666666667%;
+  }
+  .row .col.offset-xl9 {
+    margin-left: 75%;
+  }
+  .row .col.pull-xl9 {
+    right: 75%;
+  }
+  .row .col.push-xl9 {
+    left: 75%;
+  }
+  .row .col.offset-xl10 {
+    margin-left: 83.3333333333%;
+  }
+  .row .col.pull-xl10 {
+    right: 83.3333333333%;
+  }
+  .row .col.push-xl10 {
+    left: 83.3333333333%;
+  }
+  .row .col.offset-xl11 {
+    margin-left: 91.6666666667%;
+  }
+  .row .col.pull-xl11 {
+    right: 91.6666666667%;
+  }
+  .row .col.push-xl11 {
+    left: 91.6666666667%;
+  }
+  .row .col.offset-xl12 {
+    margin-left: 100%;
+  }
+  .row .col.pull-xl12 {
+    right: 100%;
+  }
+  .row .col.push-xl12 {
+    left: 100%;
+  }
+}
+
+nav {
+  color: #fff;
+  background-color: #ee6e73;
+  width: 100%;
+  height: 56px;
+  line-height: 56px;
+}
+
+nav.nav-extended {
+  height: auto;
+}
+
+nav.nav-extended .nav-wrapper {
+  min-height: 56px;
+  height: auto;
+}
+
+nav.nav-extended .nav-content {
+  position: relative;
+  line-height: normal;
+}
+
+nav a {
+  color: #fff;
+}
+
+nav i,
+nav [class^="mdi-"], nav [class*="mdi-"],
+nav i.material-icons {
+  display: block;
+  /* font-size: 24px; */
+  font-size: 2rem;
+  height: 56px;
+  line-height: 56px;
+}
+
+nav .nav-wrapper {
+  position: relative;
+  height: 100%;
+}
+
+@media only screen and (min-width: 993px) {
+  nav a.button-collapse {
+    display: none;
+  }
+}
+
+nav .button-collapse {
+  float: left;
+  position: relative;
+  z-index: 1;
+  height: 56px;
+  /* margin: 0 18px; */
+}
+
+nav .button-collapse i {
+  font-size: 2.7rem;
+  height: 56px;
+  line-height: 56px;
+}
+
+nav .brand-logo {
+  position: absolute;
+  color: #fff;
+  display: inline-block;
+  font-size: 2.1rem;
+  padding: 0;
+}
+
+nav .brand-logo.center {
+  left: 50%;
+  -webkit-transform: translateX(-50%);
+          transform: translateX(-50%);
+}
+
+@media only screen and (max-width: 992px) {
+  nav .brand-logo {
+    left: 50%;
+    -webkit-transform: translateX(-50%);
+            transform: translateX(-50%);
+  }
+  nav .brand-logo.left, nav .brand-logo.right {
+    padding: 0;
+    -webkit-transform: none;
+            transform: none;
+  }
+  nav .brand-logo.left {
+    left: 0.5rem;
+  }
+  nav .brand-logo.right {
+    right: 0.5rem;
+    left: auto;
+  }
+}
+
+nav .brand-logo.right {
+  right: 0.5rem;
+  padding: 0;
+}
+
+nav .brand-logo i,
+nav .brand-logo [class^="mdi-"], nav .brand-logo [class*="mdi-"],
+nav .brand-logo i.material-icons {
+  float: left;
+  /* margin-right: 15px; */
+}
+
+nav .nav-title {
+  display: inline-block;
+  font-size: 32px;
+  padding: 28px 0;
+}
+
+nav ul {
+  margin: 0;
+}
+
+nav ul li {
+  -webkit-transition: background-color .3s;
+  transition: background-color .3s;
+  float: left;
+  padding: 0;
+}
+
+nav ul li.active {
+  background-color: rgba(0, 0, 0, 0.1);
+}
+
+nav ul a {
+  -webkit-transition: background-color .3s;
+  transition: background-color .3s;
+  font-size: 1rem;
+  color: #fff;
+  display: block;
+  padding: 0 15px;
+  cursor: pointer;
+}
+
+nav ul a.btn, nav ul a.btn-large, nav ul a.btn-large, nav ul a.btn-flat, nav ul a.btn-floating {
+  margin-top: -2px;
+  margin-left: 15px;
+  margin-right: 15px;
+}
+
+nav ul a.btn > .material-icons, nav ul a.btn-large > .material-icons, nav ul a.btn-large > .material-icons, nav ul a.btn-flat > .material-icons, nav ul a.btn-floating > .material-icons {
+  height: inherit;
+  line-height: inherit;
+}
+
+nav ul a:hover {
+  background-color: rgba(0, 0, 0, 0.1);
+}
+
+nav ul.left {
+  float: left;
+}
+
+nav form {
+  height: 100%;
+}
+
+nav .input-field {
+  margin: 0;
+  height: 100%;
+}
+
+nav .input-field input {
+  height: 100%;
+  font-size: 1.2rem;
+  border: none;
+  padding-left: 2rem;
+}
+
+nav .input-field input:focus, nav .input-field input[type=text]:valid, nav .input-field input[type=password]:valid, nav .input-field input[type=email]:valid, nav .input-field input[type=url]:valid, nav .input-field input[type=date]:valid {
+  border: none;
+  -webkit-box-shadow: none;
+          box-shadow: none;
+}
+
+nav .input-field label {
+  top: 0;
+  left: 0;
+}
+
+nav .input-field label i {
+  color: rgba(255, 255, 255, 0.7);
+  -webkit-transition: color .3s;
+  transition: color .3s;
+}
+
+nav .input-field label.active i {
+  color: #fff;
+}
+
+.navbar-fixed {
+  position: relative;
+  height: 56px;
+  z-index: 997;
+}
+
+.navbar-fixed nav {
+  position: fixed;
+}
+
+@media only screen and (min-width: 601px) {
+  nav.nav-extended .nav-wrapper {
+    min-height: 64px;
+  }
+  nav, nav .nav-wrapper i, nav a.button-collapse, nav a.button-collapse i {
+    height: 64px;
+    line-height: 64px;
+  }
+  .navbar-fixed {
+    height: 64px;
+  }
+}
+
+a {
+  text-decoration: none;
+}
+
+html {
+  line-height: 1.5;
+  /* font-family: "Roboto", sans-serif; */
+  font-family: Nunito, sans-serif;
+  font-weight: normal;
+  color: rgba(0, 0, 0, 0.87);
+}
+
+@media only screen and (min-width: 0) {
+  html {
+    font-size: 14px;
+  }
+}
+
+@media only screen and (min-width: 992px) {
+  html {
+    font-size: 14.5px;
+  }
+}
+
+@media only screen and (min-width: 1200px) {
+  html {
+    font-size: 15px;
+  }
+}
+
+h1, h2, h3, h4, h5, h6 {
+  font-weight: 400;
+  line-height: 1.1;
+}
+
+h1 a, h2 a, h3 a, h4 a, h5 a, h6 a {
+  font-weight: inherit;
+}
+
+h1 {
+  font-size: 4.2rem;
+  line-height: 110%;
+  margin: 2.1rem 0 1.68rem 0;
+}
+
+h2 {
+  font-size: 3.56rem;
+  line-height: 110%;
+  margin: 1.78rem 0 1.424rem 0;
+}
+
+h3 {
+  font-size: 2.92rem;
+  line-height: 110%;
+  margin: 1.46rem 0 1.168rem 0;
+}
+
+h4 {
+  font-size: 2.28rem;
+  line-height: 110%;
+  margin: 1.14rem 0 0.912rem 0;
+}
+
+h5 {
+  font-size: 1.64rem;
+  line-height: 110%;
+  margin: 0.82rem 0 0.656rem 0;
+}
+
+h6 {
+  font-size: 1rem;
+  line-height: 110%;
+  margin: 0.5rem 0 0.4rem 0;
+}
+
+em {
+  font-style: italic;
+}
+
+strong {
+  font-weight: 500;
+}
+
+small {
+  font-size: 75%;
+}
+
+.light, .page-footer .footer-copyright {
+  font-weight: 300;
+}
+
+.thin {
+  font-weight: 200;
+}
+
+.flow-text {
+  font-weight: 300;
+}
+
+@media only screen and (min-width: 360px) {
+  .flow-text {
+    font-size: 1.2rem;
+  }
+}
+
+@media only screen and (min-width: 390px) {
+  .flow-text {
+    font-size: 1.224rem;
+  }
+}
+
+@media only screen and (min-width: 420px) {
+  .flow-text {
+    font-size: 1.248rem;
+  }
+}
+
+@media only screen and (min-width: 450px) {
+  .flow-text {
+    font-size: 1.272rem;
+  }
+}
+
+@media only screen and (min-width: 480px) {
+  .flow-text {
+    font-size: 1.296rem;
+  }
+}
+
+@media only screen and (min-width: 510px) {
+  .flow-text {
+    font-size: 1.32rem;
+  }
+}
+
+@media only screen and (min-width: 540px) {
+  .flow-text {
+    font-size: 1.344rem;
+  }
+}
+
+@media only screen and (min-width: 570px) {
+  .flow-text {
+    font-size: 1.368rem;
+  }
+}
+
+@media only screen and (min-width: 600px) {
+  .flow-text {
+    font-size: 1.392rem;
+  }
+}
+
+@media only screen and (min-width: 630px) {
+  .flow-text {
+    font-size: 1.416rem;
+  }
+}
+
+@media only screen and (min-width: 660px) {
+  .flow-text {
+    font-size: 1.44rem;
+  }
+}
+
+@media only screen and (min-width: 690px) {
+  .flow-text {
+    font-size: 1.464rem;
+  }
+}
+
+@media only screen and (min-width: 720px) {
+  .flow-text {
+    font-size: 1.488rem;
+  }
+}
+
+@media only screen and (min-width: 750px) {
+  .flow-text {
+    font-size: 1.512rem;
+  }
+}
+
+@media only screen and (min-width: 780px) {
+  .flow-text {
+    font-size: 1.536rem;
+  }
+}
+
+@media only screen and (min-width: 810px) {
+  .flow-text {
+    font-size: 1.56rem;
+  }
+}
+
+@media only screen and (min-width: 840px) {
+  .flow-text {
+    font-size: 1.584rem;
+  }
+}
+
+@media only screen and (min-width: 870px) {
+  .flow-text {
+    font-size: 1.608rem;
+  }
+}
+
+@media only screen and (min-width: 900px) {
+  .flow-text {
+    font-size: 1.632rem;
+  }
+}
+
+@media only screen and (min-width: 930px) {
+  .flow-text {
+    font-size: 1.656rem;
+  }
+}
+
+@media only screen and (min-width: 960px) {
+  .flow-text {
+    font-size: 1.68rem;
+  }
+}
+
+@media only screen and (max-width: 360px) {
+  .flow-text {
+    font-size: 1.2rem;
+  }
+}
+
+.scale-transition {
+  -webkit-transition: -webkit-transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63) !important;
+  transition: -webkit-transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63) !important;
+  transition: transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63) !important;
+  transition: transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63), -webkit-transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63) !important;
+}
+
+.scale-transition.scale-out {
+  -webkit-transform: scale(0);
+          transform: scale(0);
+  -webkit-transition: -webkit-transform .2s !important;
+  transition: -webkit-transform .2s !important;
+  transition: transform .2s !important;
+  transition: transform .2s, -webkit-transform .2s !important;
+}
+
+.scale-transition.scale-in {
+  -webkit-transform: scale(1);
+          transform: scale(1);
+}
+
+.card-panel {
+  -webkit-transition: -webkit-box-shadow .25s;
+  transition: -webkit-box-shadow .25s;
+  transition: box-shadow .25s;
+  transition: box-shadow .25s, -webkit-box-shadow .25s;
+  padding: 24px;
+  margin: 0.5rem 0 1rem 0;
+  border-radius: 2px;
+  background-color: #fff;
+}
+
+.card {
+  position: relative;
+  margin: 0.5rem 0 1rem 0;
+  background-color: #fff;
+  -webkit-transition: -webkit-box-shadow .25s;
+  transition: -webkit-box-shadow .25s;
+  transition: box-shadow .25s;
+  transition: box-shadow .25s, -webkit-box-shadow .25s;
+  border-radius: 2px;
+}
+
+.card .card-title {
+  font-size: 24px;
+  font-weight: 300;
+}
+
+.card .card-title.activator {
+  cursor: pointer;
+}
+
+.card.small, .card.medium, .card.large {
+  position: relative;
+}
+
+.card.small .card-image, .card.medium .card-image, .card.large .card-image {
+  max-height: 60%;
+  overflow: hidden;
+}
+
+.card.small .card-image + .card-content, .card.medium .card-image + .card-content, .card.large .card-image + .card-content {
+  max-height: 40%;
+}
+
+.card.small .card-content, .card.medium .card-content, .card.large .card-content {
+  max-height: 100%;
+  overflow: hidden;
+}
+
+.card.small .card-action, .card.medium .card-action, .card.large .card-action {
+  position: absolute;
+  bottom: 0;
+  left: 0;
+  right: 0;
+}
+
+.card.small {
+  height: 300px;
+}
+
+.card.medium {
+  height: 400px;
+}
+
+.card.large {
+  height: 500px;
+}
+
+.card.horizontal {
+  display: -webkit-box;
+  display: -webkit-flex;
+  display: -ms-flexbox;
+  display: flex;
+}
+
+.card.horizontal.small .card-image, .card.horizontal.medium .card-image, .card.horizontal.large .card-image {
+  height: 100%;
+  max-height: none;
+  overflow: visible;
+}
+
+.card.horizontal.small .card-image img, .card.horizontal.medium .card-image img, .card.horizontal.large .card-image img {
+  height: 100%;
+}
+
+.card.horizontal .card-image {
+  max-width: 50%;
+}
+
+.card.horizontal .card-image img {
+  border-radius: 2px 0 0 2px;
+  max-width: 100%;
+  width: auto;
+}
+
+.card.horizontal .card-stacked {
+  display: -webkit-box;
+  display: -webkit-flex;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-orient: vertical;
+  -webkit-box-direction: normal;
+  -webkit-flex-direction: column;
+      -ms-flex-direction: column;
+          flex-direction: column;
+  -webkit-box-flex: 1;
+  -webkit-flex: 1;
+      -ms-flex: 1;
+          flex: 1;
+  position: relative;
+}
+
+.card.horizontal .card-stacked .card-content {
+  -webkit-box-flex: 1;
+  -webkit-flex-grow: 1;
+      -ms-flex-positive: 1;
+          flex-grow: 1;
+}
+
+.card.sticky-action .card-action {
+  z-index: 2;
+}
+
+.card.sticky-action .card-reveal {
+  z-index: 1;
+  padding-bottom: 64px;
+}
+
+.card .card-image {
+  position: relative;
+}
+
+.card .card-image img {
+  display: block;
+  border-radius: 2px 2px 0 0;
+  position: relative;
+  left: 0;
+  right: 0;
+  top: 0;
+  bottom: 0;
+  width: 100%;
+}
+
+.card .card-image .card-title {
+  color: #fff;
+  position: absolute;
+  bottom: 0;
+  left: 0;
+  max-width: 100%;
+  padding: 24px;
+}
+
+.card .card-content {
+  padding: 24px;
+  border-radius: 0 0 2px 2px;
+}
+
+.card .card-content p {
+  margin: 0;
+  color: inherit;
+}
+
+.card .card-content .card-title {
+  display: block;
+  line-height: 32px;
+  margin-bottom: 8px;
+}
+
+.card .card-content .card-title i {
+  line-height: 32px;
+}
+
+.card .card-action {
+  position: relative;
+  background-color: inherit;
+  border-top: 1px solid rgba(160, 160, 160, 0.2);
+  padding: 16px 24px;
+}
+
+.card .card-action:last-child {
+  border-radius: 0 0 2px 2px;
+}
+
+.card .card-action a:not(.btn):not(.btn-large):not(.btn-large):not(.btn-floating) {
+  color: #ffab40;
+  margin-right: 24px;
+  -webkit-transition: color .3s ease;
+  transition: color .3s ease;
+  text-transform: uppercase;
+}
+
+.card .card-action a:not(.btn):not(.btn-large):not(.btn-large):not(.btn-floating):hover {
+  color: #ffd8a6;
+}
+
+.card .card-reveal {
+  padding: 24px;
+  position: absolute;
+  background-color: #fff;
+  width: 100%;
+  overflow-y: auto;
+  left: 0;
+  top: 100%;
+  height: 100%;
+  z-index: 3;
+  display: none;
+}
+
+.card .card-reveal .card-title {
+  /* cursor: pointer; */
+  display: block;
+}
+
+#toast-container {
+  display: block;
+  position: fixed;
+  z-index: 10000;
+}
+
+@media only screen and (max-width: 600px) {
+  #toast-container {
+    min-width: 100%;
+    bottom: 0%;
+  }
+}
+
+@media only screen and (min-width: 601px) and (max-width: 992px) {
+  #toast-container {
+    left: 5%;
+    bottom: 7%;
+    max-width: 90%;
+  }
+}
+
+@media only screen and (min-width: 993px) {
+  #toast-container {
+    top: 8%;
+    right: 6%;
+    max-width: 86%;
+  }
+}
+
+.toast {
+  border-radius: 2px;
+  top: 35px;
+  width: auto;
+  margin-top: 10px;
+  position: relative;
+  max-width: 100%;
+  height: auto;
+  min-height: 48px;
+  line-height: 1.5em;
+  word-break: break-all;
+  background-color: #323232;
+  padding: 10px 25px;
+  font-size: 1.1rem;
+  font-weight: 300;
+  color: #fff;
+  display: -webkit-box;
+  display: -webkit-flex;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-align: center;
+  -webkit-align-items: center;
+      -ms-flex-align: center;
+          align-items: center;
+  -webkit-box-pack: justify;
+  -webkit-justify-content: space-between;
+      -ms-flex-pack: justify;
+          justify-content: space-between;
+  cursor: default;
+}
+
+.toast .toast-action {
+  color: #eeff41;
+  font-weight: 500;
+  margin-right: -25px;
+  margin-left: 3rem;
+}
+
+.toast.rounded {
+  border-radius: 24px;
+}
+
+@media only screen and (max-width: 600px) {
+  .toast {
+    width: 100%;
+    border-radius: 0;
+  }
+}
+
+.tabs {
+  position: relative;
+  overflow-x: auto;
+  overflow-y: hidden;
+  height: 48px;
+  width: 100%;
+  background-color: #fff;
+  margin: 0 auto;
+  white-space: nowrap;
+}
+
+.tabs.tabs-transparent {
+  background-color: transparent;
+}
+
+.tabs.tabs-transparent .tab a,
+.tabs.tabs-transparent .tab.disabled a,
+.tabs.tabs-transparent .tab.disabled a:hover {
+  color: rgba(255, 255, 255, 0.7);
+}
+
+.tabs.tabs-transparent .tab a:hover,
+.tabs.tabs-transparent .tab a.active {
+  color: #fff;
+}
+
+.tabs.tabs-transparent .indicator {
+  background-color: #fff;
+}
+
+.tabs.tabs-fixed-width {
+  display: -webkit-box;
+  display: -webkit-flex;
+  display: -ms-flexbox;
+  display: flex;
+}
+
+.tabs.tabs-fixed-width .tab {
+  -webkit-box-flex: 1;
+  -webkit-flex-grow: 1;
+      -ms-flex-positive: 1;
+          flex-grow: 1;
+}
+
+.tabs .tab {
+  display: inline-block;
+  text-align: center;
+  line-height: 48px;
+  height: 48px;
+  padding: 0;
+  margin: 0;
+  text-transform: uppercase;
+}
+
+.tabs .tab a {
+  color: rgba(238, 110, 115, 0.7);
+  display: block;
+  width: 100%;
+  height: 100%;
+  padding: 0 24px;
+  font-size: 14px;
+  text-overflow: ellipsis;
+  overflow: hidden;
+  -webkit-transition: color .28s ease;
+  transition: color .28s ease;
+}
+
+.tabs .tab a:hover, .tabs .tab a.active {
+  background-color: transparent;
+  color: #ee6e73;
+}
+
+.tabs .tab.disabled a,
+.tabs .tab.disabled a:hover {
+  color: rgba(238, 110, 115, 0.7);
+  cursor: default;
+}
+
+.tabs .indicator {
+  position: absolute;
+  bottom: 0;
+  height: 2px;
+  background-color: #f6b2b5;
+  will-change: left, right;
+}
+
+@media only screen and (max-width: 992px) {
+  .tabs {
+    display: -webkit-box;
+    display: -webkit-flex;
+    display: -ms-flexbox;
+    display: flex;
+  }
+  .tabs .tab {
+    -webkit-box-flex: 1;
+    -webkit-flex-grow: 1;
+        -ms-flex-positive: 1;
+            flex-grow: 1;
+  }
+  .tabs .tab a {
+    padding: 0 12px;
+  }
+}
+
+.material-tooltip {
+  padding: 10px 8px;
+  font-size: 1rem;
+  z-index: 2000;
+  background-color: transparent;
+  border-radius: 2px;
+  color: #fff;
+  min-height: 36px;
+  line-height: 120%;
+  opacity: 0;
+  position: absolute;
+  text-align: center;
+  max-width: calc(100% - 4px);
+  overflow: hidden;
+  left: 0;
+  top: 0;
+  pointer-events: none;
+  visibility: hidden;
+}
+
+.backdrop {
+  position: absolute;
+  opacity: 0;
+  height: 7px;
+  width: 14px;
+  border-radius: 0 0 50% 50%;
+  background-color: #323232;
+  z-index: -1;
+  -webkit-transform-origin: 50% 0%;
+          transform-origin: 50% 0%;
+  visibility: hidden;
+}
+
+.btn, .btn-large,
+.btn-flat {
+  border: none;
+  border-radius: 2px;
+  display: inline-block;
+  height: 36px;
+  line-height: 36px;
+  padding: 0 2rem;
+  text-transform: uppercase;
+  vertical-align: middle;
+  -webkit-tap-highlight-color: transparent;
+}
+
+.btn.disabled, .disabled.btn-large,
+.btn-floating.disabled,
+.btn-large.disabled,
+.btn-flat.disabled,
+.btn:disabled,
+.btn-large:disabled,
+.btn-floating:disabled,
+.btn-large:disabled,
+.btn-flat:disabled,
+.btn[disabled],
+[disabled].btn-large,
+.btn-floating[disabled],
+.btn-large[disabled],
+.btn-flat[disabled] {
+  pointer-events: none;
+  background-color: #DFDFDF !important;
+  -webkit-box-shadow: none;
+          box-shadow: none;
+  color: #9F9F9F !important;
+  cursor: default;
+}
+
+.btn.disabled:hover, .disabled.btn-large:hover,
+.btn-floating.disabled:hover,
+.btn-large.disabled:hover,
+.btn-flat.disabled:hover,
+.btn:disabled:hover,
+.btn-large:disabled:hover,
+.btn-floating:disabled:hover,
+.btn-large:disabled:hover,
+.btn-flat:disabled:hover,
+.btn[disabled]:hover,
+[disabled].btn-large:hover,
+.btn-floating[disabled]:hover,
+.btn-large[disabled]:hover,
+.btn-flat[disabled]:hover {
+  background-color: #DFDFDF !important;
+  color: #9F9F9F !important;
+}
+
+.btn, .btn-large,
+.btn-floating,
+.btn-large,
+.btn-flat {
+  font-size: 1rem;
+  outline: 0;
+}
+
+.btn i, .btn-large i,
+.btn-floating i,
+.btn-large i,
+.btn-flat i {
+  font-size: 1.3rem;
+  line-height: inherit;
+}
+
+.btn:focus, .btn-large:focus,
+.btn-floating:focus {
+  background-color: #1d7d74;
+}
+
+.btn, .btn-large {
+  text-decoration: none;
+  color: #fff;
+  background-color: #26a69a;
+  text-align: center;
+  letter-spacing: .5px;
+  -webkit-transition: .2s ease-out;
+  transition: .2s ease-out;
+  cursor: pointer;
+}
+
+.btn:hover, .btn-large:hover {
+  background-color: #2bbbad;
+}
+
+.btn-floating {
+  display: inline-block;
+  color: #fff;
+  position: relative;
+  overflow: hidden;
+  z-index: 1;
+  width: 40px;
+  height: 40px;
+  line-height: 40px;
+  padding: 0;
+  background-color: #26a69a;
+  border-radius: 50%;
+  -webkit-transition: .3s;
+  transition: .3s;
+  cursor: pointer;
+  vertical-align: middle;
+}
+
+.btn-floating:hover {
+  background-color: #26a69a;
+}
+
+.btn-floating:before {
+  border-radius: 0;
+}
+
+.btn-floating.btn-large {
+  width: 56px;
+  height: 56px;
+}
+
+.btn-floating.btn-large.halfway-fab {
+  bottom: -28px;
+}
+
+.btn-floating.btn-large i {
+  line-height: 56px;
+}
+
+.btn-floating.halfway-fab {
+  position: absolute;
+  right: 24px;
+  bottom: -20px;
+}
+
+.btn-floating.halfway-fab.left {
+  right: auto;
+  left: 24px;
+}
+
+.btn-floating i {
+  width: inherit;
+  display: inline-block;
+  text-align: center;
+  color: #fff;
+  font-size: 1.6rem;
+  line-height: 40px;
+}
+
+button.btn-floating {
+  border: none;
+}
+
+.fixed-action-btn {
+  position: fixed;
+  right: 23px;
+  bottom: 23px;
+  padding-top: 15px;
+  margin-bottom: 0;
+  z-index: 997;
+}
+
+.fixed-action-btn.active ul {
+  visibility: visible;
+}
+
+.fixed-action-btn.horizontal {
+  padding: 0 0 0 15px;
+}
+
+.fixed-action-btn.horizontal ul {
+  text-align: right;
+  right: 64px;
+  top: 50%;
+  -webkit-transform: translateY(-50%);
+          transform: translateY(-50%);
+  height: 100%;
+  left: auto;
+  width: 500px;
+  /*width 100% only goes to width of button container */
+}
+
+.fixed-action-btn.horizontal ul li {
+  display: inline-block;
+  margin: 15px 15px 0 0;
+}
+
+.fixed-action-btn.toolbar {
+  padding: 0;
+  height: 56px;
+}
+
+.fixed-action-btn.toolbar.active > a i {
+  opacity: 0;
+}
+
+.fixed-action-btn.toolbar ul {
+  display: -webkit-box;
+  display: -webkit-flex;
+  display: -ms-flexbox;
+  display: flex;
+  top: 0;
+  bottom: 0;
+  z-index: 1;
+}
+
+.fixed-action-btn.toolbar ul li {
+  -webkit-box-flex: 1;
+  -webkit-flex: 1;
+      -ms-flex: 1;
+          flex: 1;
+  display: inline-block;
+  margin: 0;
+  height: 100%;
+  -webkit-transition: none;
+  transition: none;
+}
+
+.fixed-action-btn.toolbar ul li a {
+  display: block;
+  overflow: hidden;
+  position: relative;
+  width: 100%;
+  height: 100%;
+  background-color: transparent;
+  -webkit-box-shadow: none;
+          box-shadow: none;
+  color: #fff;
+  line-height: 56px;
+  z-index: 1;
+}
+
+.fixed-action-btn.toolbar ul li a i {
+  line-height: inherit;
+}
+
+.fixed-action-btn ul {
+  left: 0;
+  right: 0;
+  text-align: center;
+  position: absolute;
+  bottom: 64px;
+  margin: 0;
+  visibility: hidden;
+}
+
+.fixed-action-btn ul li {
+  margin-bottom: 15px;
+}
+
+.fixed-action-btn ul a.btn-floating {
+  opacity: 0;
+}
+
+.fixed-action-btn .fab-backdrop {
+  position: absolute;
+  top: 0;
+  left: 0;
+  z-index: -1;
+  width: 40px;
+  height: 40px;
+  background-color: #26a69a;
+  border-radius: 50%;
+  -webkit-transform: scale(0);
+          transform: scale(0);
+}
+
+.btn-flat {
+  -webkit-box-shadow: none;
+          box-shadow: none;
+  background-color: transparent;
+  color: #343434;
+  cursor: pointer;
+  -webkit-transition: background-color .2s;
+  transition: background-color .2s;
+}
+
+.btn-flat:focus, .btn-flat:hover {
+  -webkit-box-shadow: none;
+          box-shadow: none;
+}
+
+.btn-flat:focus {
+  background-color: rgba(0, 0, 0, 0.1);
+}
+
+.btn-flat.disabled {
+  background-color: transparent !important;
+  color: #b3b2b2 !important;
+  cursor: default;
+}
+
+.btn-large {
+  height: 54px;
+  line-height: 54px;
+}
+
+.btn-large i {
+  font-size: 1.6rem;
+}
+
+.btn-block {
+  display: block;
+}
+
+.dropdown-content {
+  background-color: #fff;
+  margin: 0;
+  display: none;
+  min-width: 100px;
+  max-height: 650px;
+  overflow-y: auto;
+  opacity: 0;
+  position: absolute;
+  z-index: 999;
+  will-change: width, height;
+}
+
+.dropdown-content li {
+  clear: both;
+  color: rgba(0, 0, 0, 0.87);
+  cursor: pointer;
+  min-height: 50px;
+  line-height: 1.5rem;
+  width: 100%;
+  text-align: left;
+  text-transform: none;
+}
+
+.dropdown-content li:hover, .dropdown-content li.active, .dropdown-content li.selected {
+  background-color: #eee;
+}
+
+.dropdown-content li.active.selected {
+  background-color: #e1e1e1;
+}
+
+.dropdown-content li.divider {
+  min-height: 0;
+  height: 1px;
+}
+
+.dropdown-content li > a, .dropdown-content li > span {
+  font-size: 16px;
+  color: #26a69a;
+  display: block;
+  line-height: 22px;
+  padding: 14px 16px;
+}
+
+.dropdown-content li > span > label {
+  top: 1px;
+  left: 0;
+  height: 18px;
+}
+
+.dropdown-content li > a > i {
+  height: inherit;
+  line-height: inherit;
+  float: left;
+  margin: 0 24px 0 0;
+  width: 24px;
+}
+
+.input-field.col .dropdown-content [type="checkbox"] + label {
+  top: 1px;
+  left: 0;
+  height: 18px;
+}
+
+/*!
+ * Waves v0.6.0
+ * http://fian.my.id/Waves
+ *
+ * Copyright 2014 Alfiana E. Sibuea and other contributors
+ * Released under the MIT license
+ * https://github.com/fians/Waves/blob/master/LICENSE
+ */
+.waves-effect {
+  position: relative;
+  cursor: pointer;
+  display: inline-block;
+  overflow: hidden;
+  -webkit-user-select: none;
+     -moz-user-select: none;
+      -ms-user-select: none;
+          user-select: none;
+  -webkit-tap-highlight-color: transparent;
+  vertical-align: middle;
+  z-index: 1;
+  -webkit-transition: .3s ease-out;
+  transition: .3s ease-out;
+}
+
+.waves-effect .waves-ripple {
+  position: absolute;
+  border-radius: 50%;
+  width: 20px;
+  height: 20px;
+  margin-top: -10px;
+  margin-left: -10px;
+  opacity: 0;
+  background: rgba(0, 0, 0, 0.2);
+  -webkit-transition: all 0.7s ease-out;
+  transition: all 0.7s ease-out;
+  -webkit-transition-property: opacity, -webkit-transform;
+  transition-property: opacity, -webkit-transform;
+  transition-property: transform, opacity;
+  transition-property: transform, opacity, -webkit-transform;
+  -webkit-transform: scale(0);
+          transform: scale(0);
+  pointer-events: none;
+}
+
+.waves-effect.waves-light .waves-ripple {
+  background-color: rgba(255, 255, 255, 0.45);
+}
+
+.waves-effect.waves-red .waves-ripple {
+  background-color: rgba(244, 67, 54, 0.7);
+}
+
+.waves-effect.waves-yellow .waves-ripple {
+  background-color: rgba(255, 235, 59, 0.7);
+}
+
+.waves-effect.waves-orange .waves-ripple {
+  background-color: rgba(255, 152, 0, 0.7);
+}
+
+.waves-effect.waves-purple .waves-ripple {
+  background-color: rgba(156, 39, 176, 0.7);
+}
+
+.waves-effect.waves-green .waves-ripple {
+  background-color: rgba(76, 175, 80, 0.7);
+}
+
+.waves-effect.waves-teal .waves-ripple {
+  background-color: rgba(0, 150, 136, 0.7);
+}
+
+.waves-effect input[type="button"], .waves-effect input[type="reset"], .waves-effect input[type="submit"] {
+  border: 0;
+  font-style: normal;
+  font-size: inherit;
+  text-transform: inherit;
+  background: none;
+}
+
+.waves-effect img {
+  position: relative;
+  z-index: -1;
+}
+
+.waves-notransition {
+  -webkit-transition: none !important;
+  transition: none !important;
+}
+
+.waves-circle {
+  -webkit-transform: translateZ(0);
+          transform: translateZ(0);
+  -webkit-mask-image: -webkit-radial-gradient(circle, white 100%, black 100%);
+}
+
+.waves-input-wrapper {
+  border-radius: 0.2em;
+  vertical-align: bottom;
+}
+
+.waves-input-wrapper .waves-button-input {
+  position: relative;
+  top: 0;
+  left: 0;
+  z-index: 1;
+}
+
+.waves-circle {
+  text-align: center;
+  width: 2.5em;
+  height: 2.5em;
+  line-height: 2.5em;
+  border-radius: 50%;
+  -webkit-mask-image: none;
+}
+
+.waves-block {
+  display: block;
+}
+
+/* Firefox Bug: link not triggered */
+.waves-effect .waves-ripple {
+  z-index: -1;
+}
+
+.modal {
+  display: none;
+  position: fixed;
+  left: 0;
+  right: 0;
+  background-color: #fafafa;
+  padding: 0;
+  max-height: 70%;
+  width: 55%;
+  margin: auto;
+  overflow-y: auto;
+  border-radius: 2px;
+  will-change: top, opacity;
+}
+
+@media only screen and (max-width: 992px) {
+  .modal {
+    width: 80%;
+  }
+}
+
+.modal h1, .modal h2, .modal h3, .modal h4 {
+  margin-top: 0;
+}
+
+.modal .modal-content {
+  padding: 24px;
+}
+
+.modal .modal-close {
+  cursor: pointer;
+}
+
+.modal .modal-footer {
+  border-radius: 0 0 2px 2px;
+  background-color: #fafafa;
+  padding: 4px 6px;
+  height: 56px;
+  width: 100%;
+  text-align: right;
+}
+
+.modal .modal-footer .btn, .modal .modal-footer .btn-large, .modal .modal-footer .btn-flat {
+  margin: 6px 0;
+}
+
+.modal-overlay {
+  position: fixed;
+  z-index: 999;
+  top: -25%;
+  left: 0;
+  bottom: 0;
+  right: 0;
+  height: 125%;
+  width: 100%;
+  background: #000;
+  display: none;
+  will-change: opacity;
+}
+
+.modal.modal-fixed-footer {
+  padding: 0;
+  height: 70%;
+}
+
+.modal.modal-fixed-footer .modal-content {
+  position: absolute;
+  height: calc(100% - 56px);
+  max-height: 100%;
+  width: 100%;
+  overflow-y: auto;
+}
+
+.modal.modal-fixed-footer .modal-footer {
+  border-top: 1px solid rgba(0, 0, 0, 0.1);
+  position: absolute;
+  bottom: 0;
+}
+
+.modal.bottom-sheet {
+  top: auto;
+  bottom: -100%;
+  margin: 0;
+  width: 100%;
+  max-height: 45%;
+  border-radius: 0;
+  will-change: bottom, opacity;
+}
+
+.collapsible {
+  border-top: 1px solid #ddd;
+  border-right: 1px solid #ddd;
+  border-left: 1px solid #ddd;
+  margin: 0.5rem 0 1rem 0;
+}
+
+.collapsible-header {
+  /* display: -webkit-box;
+  display: -webkit-flex;
+  display: -ms-flexbox;
+  display: flex; */
+  display: block;
+  cursor: pointer;
+  -webkit-tap-highlight-color: transparent;
+  /* line-height: 1.5; */
+  line-height: 3rem;
+  /* padding: 1rem; */
+  padding: 0px 1rem;
+  background-color: #fff;
+  border-bottom: 1px solid #ddd;
+}
+
+.collapsible-header i {
+  width: 2rem;
+  font-size: 1.6rem;
+  display: block;
+  text-align: center;
+  margin-right: 1rem;
+  line-height: 3rem;
+  float: left;
+}
+
+.collapsible-body {
+  display: none;
+  border-bottom: 1px solid #ddd;
+  -webkit-box-sizing: border-box;
+          box-sizing: border-box;
+  /* padding: 2rem; */
+}
+
+.side-nav .collapsible,
+.side-nav.fixed .collapsible {
+  border: none;
+  -webkit-box-shadow: none;
+          box-shadow: none;
+}
+
+.side-nav .collapsible li,
+.side-nav.fixed .collapsible li {
+  padding: 0;
+}
+
+.side-nav .collapsible-header,
+.side-nav.fixed .collapsible-header {
+  background-color: transparent;
+  border: none;
+  line-height: inherit;
+  height: inherit;
+  /* padding: 0 16px; */
+  padding: 0 30px;
+}
+
+.side-nav .collapsible-header:hover,
+.side-nav.fixed .collapsible-header:hover {
+  background-color: rgba(0, 0, 0, 0.05);
+}
+
+.side-nav .collapsible-header i,
+.side-nav.fixed .collapsible-header i {
+  line-height: inherit;
+}
+
+.side-nav .collapsible-body,
+.side-nav.fixed .collapsible-body {
+  border: 0;
+  background-color: #fff;
+}
+
+.side-nav .collapsible-body li a,
+.side-nav.fixed .collapsible-body li a {
+  padding: 0 37.5px 0 45px;
+}
+
+.collapsible.popout {
+  border: none;
+  -webkit-box-shadow: none;
+          box-shadow: none;
+}
+
+.collapsible.popout > li {
+  -webkit-box-shadow: 0 2px 5px 0 rgba(0, 0, 0, 0.16), 0 2px 10px 0 rgba(0, 0, 0, 0.12);
+          box-shadow: 0 2px 5px 0 rgba(0, 0, 0, 0.16), 0 2px 10px 0 rgba(0, 0, 0, 0.12);
+  margin: 0 24px;
+  -webkit-transition: margin 0.35s cubic-bezier(0.25, 0.46, 0.45, 0.94);
+  transition: margin 0.35s cubic-bezier(0.25, 0.46, 0.45, 0.94);
+}
+
+.collapsible.popout > li.active {
+  -webkit-box-shadow: 0 5px 11px 0 rgba(0, 0, 0, 0.18), 0 4px 15px 0 rgba(0, 0, 0, 0.15);
+          box-shadow: 0 5px 11px 0 rgba(0, 0, 0, 0.18), 0 4px 15px 0 rgba(0, 0, 0, 0.15);
+  margin: 16px 0;
+}
+
+.chip {
+  display: inline-block;
+  height: 32px;
+  font-size: 13px;
+  font-weight: 500;
+  color: rgba(0, 0, 0, 0.6);
+  line-height: 32px;
+  padding: 0 12px;
+  border-radius: 16px;
+  background-color: #e4e4e4;
+  margin-bottom: 5px;
+  margin-right: 5px;
+}
+
+.chip > img {
+  float: left;
+  margin: 0 8px 0 -12px;
+  height: 32px;
+  width: 32px;
+  border-radius: 50%;
+}
+
+.chip .close {
+  cursor: pointer;
+  float: right;
+  font-size: 16px;
+  line-height: 32px;
+  padding-left: 8px;
+}
+
+.chips {
+  border: none;
+  border-bottom: 1px solid #9e9e9e;
+  -webkit-box-shadow: none;
+          box-shadow: none;
+  margin: 0 0 20px 0;
+  min-height: 45px;
+  outline: none;
+  -webkit-transition: all .3s;
+  transition: all .3s;
+}
+
+.chips.focus {
+  border-bottom: 1px solid #26a69a;
+  -webkit-box-shadow: 0 1px 0 0 #26a69a;
+          box-shadow: 0 1px 0 0 #26a69a;
+}
+
+.chips:hover {
+  cursor: text;
+}
+
+.chips .chip.selected {
+  background-color: #26a69a;
+  color: #fff;
+}
+
+.chips .input {
+  background: none;
+  border: 0;
+  color: rgba(0, 0, 0, 0.6);
+  display: inline-block;
+  font-size: 1rem;
+  height: 3rem;
+  line-height: 32px;
+  outline: 0;
+  margin: 0;
+  padding: 0 !important;
+  width: 120px !important;
+}
+
+.chips .input:focus {
+  border: 0 !important;
+  -webkit-box-shadow: none !important;
+          box-shadow: none !important;
+}
+
+.chips .autocomplete-content {
+  margin-top: 0;
+  margin-bottom: 0;
+}
+
+.prefix ~ .chips {
+  margin-left: 3rem;
+  width: 92%;
+  width: calc(100% - 3rem);
+}
+
+.chips:empty ~ label {
+  font-size: 0.8rem;
+  -webkit-transform: translateY(-140%);
+          transform: translateY(-140%);
+}
+
+.materialboxed {
+  display: block;
+  cursor: -webkit-zoom-in;
+  cursor: zoom-in;
+  position: relative;
+  -webkit-transition: opacity .4s;
+  transition: opacity .4s;
+  -webkit-backface-visibility: hidden;
+}
+
+.materialboxed:hover:not(.active) {
+  opacity: .8;
+}
+
+.materialboxed.active {
+  cursor: -webkit-zoom-out;
+  cursor: zoom-out;
+}
+
+#materialbox-overlay {
+  position: fixed;
+  top: 0;
+  right: 0;
+  bottom: 0;
+  left: 0;
+  background-color: #292929;
+  z-index: 1000;
+  will-change: opacity;
+}
+
+.materialbox-caption {
+  position: fixed;
+  display: none;
+  color: #fff;
+  line-height: 50px;
+  bottom: 0;
+  left: 0;
+  width: 100%;
+  text-align: center;
+  padding: 0% 15%;
+  height: 50px;
+  z-index: 1000;
+  -webkit-font-smoothing: antialiased;
+}
+
+select:focus {
+  outline: 1px solid #c9f3ef;
+}
+
+button:focus {
+  outline: none;
+  background-color: #2ab7a9;
+}
+
+label {
+  font-size: 0.8rem;
+  color: #9e9e9e;
+}
+
+/* Text Inputs + Textarea
+   ========================================================================== */
+/* Style Placeholders */
+::-webkit-input-placeholder {
+  color: #d1d1d1;
+}
+::-moz-placeholder {
+  color: #d1d1d1;
+}
+:-ms-input-placeholder {
+  color: #d1d1d1;
+}
+::placeholder {
+  color: #d1d1d1;
+}
+
+/* Text inputs */
+input:not([type]),
+input[type=text]:not(.browser-default),
+input[type=password]:not(.browser-default),
+input[type=email]:not(.browser-default),
+input[type=url]:not(.browser-default),
+input[type=time]:not(.browser-default),
+input[type=date]:not(.browser-default),
+input[type=datetime]:not(.browser-default),
+input[type=datetime-local]:not(.browser-default),
+input[type=tel]:not(.browser-default),
+input[type=number]:not(.browser-default),
+input[type=search]:not(.browser-default),
+textarea.materialize-textarea {
+  background-color: transparent;
+  border: none;
+  border-bottom: 1px solid #9e9e9e;
+  border-radius: 0;
+  outline: none;
+  height: 3rem;
+  width: 100%;
+  font-size: 1rem;
+  margin: 0 0 20px 0;
+  padding: 0;
+  -webkit-box-shadow: none;
+          box-shadow: none;
+  -webkit-box-sizing: content-box;
+          box-sizing: content-box;
+  -webkit-transition: all 0.3s;
+  transition: all 0.3s;
+}
+
+input:not([type]):disabled, input:not([type])[readonly="readonly"],
+input[type=text]:not(.browser-default):disabled,
+input[type=text]:not(.browser-default)[readonly="readonly"],
+input[type=password]:not(.browser-default):disabled,
+input[type=password]:not(.browser-default)[readonly="readonly"],
+input[type=email]:not(.browser-default):disabled,
+input[type=email]:not(.browser-default)[readonly="readonly"],
+input[type=url]:not(.browser-default):disabled,
+input[type=url]:not(.browser-default)[readonly="readonly"],
+input[type=time]:not(.browser-default):disabled,
+input[type=time]:not(.browser-default)[readonly="readonly"],
+input[type=date]:not(.browser-default):disabled,
+input[type=date]:not(.browser-default)[readonly="readonly"],
+input[type=datetime]:not(.browser-default):disabled,
+input[type=datetime]:not(.browser-default)[readonly="readonly"],
+input[type=datetime-local]:not(.browser-default):disabled,
+input[type=datetime-local]:not(.browser-default)[readonly="readonly"],
+input[type=tel]:not(.browser-default):disabled,
+input[type=tel]:not(.browser-default)[readonly="readonly"],
+input[type=number]:not(.browser-default):disabled,
+input[type=number]:not(.browser-default)[readonly="readonly"],
+input[type=search]:not(.browser-default):disabled,
+input[type=search]:not(.browser-default)[readonly="readonly"],
+textarea.materialize-textarea:disabled,
+textarea.materialize-textarea[readonly="readonly"] {
+  color: rgba(0, 0, 0, 0.42);
+  border-bottom: 1px dotted rgba(0, 0, 0, 0.42);
+}
+
+input:not([type]):disabled + label,
+input:not([type])[readonly="readonly"] + label,
+input[type=text]:not(.browser-default):disabled + label,
+input[type=text]:not(.browser-default)[readonly="readonly"] + label,
+input[type=password]:not(.browser-default):disabled + label,
+input[type=password]:not(.browser-default)[readonly="readonly"] + label,
+input[type=email]:not(.browser-default):disabled + label,
+input[type=email]:not(.browser-default)[readonly="readonly"] + label,
+input[type=url]:not(.browser-default):disabled + label,
+input[type=url]:not(.browser-default)[readonly="readonly"] + label,
+input[type=time]:not(.browser-default):disabled + label,
+input[type=time]:not(.browser-default)[readonly="readonly"] + label,
+input[type=date]:not(.browser-default):disabled + label,
+input[type=date]:not(.browser-default)[readonly="readonly"] + label,
+input[type=datetime]:not(.browser-default):disabled + label,
+input[type=datetime]:not(.browser-default)[readonly="readonly"] + label,
+input[type=datetime-local]:not(.browser-default):disabled + label,
+input[type=datetime-local]:not(.browser-default)[readonly="readonly"] + label,
+input[type=tel]:not(.browser-default):disabled + label,
+input[type=tel]:not(.browser-default)[readonly="readonly"] + label,
+input[type=number]:not(.browser-default):disabled + label,
+input[type=number]:not(.browser-default)[readonly="readonly"] + label,
+input[type=search]:not(.browser-default):disabled + label,
+input[type=search]:not(.browser-default)[readonly="readonly"] + label,
+textarea.materialize-textarea:disabled + label,
+textarea.materialize-textarea[readonly="readonly"] + label {
+  color: rgba(0, 0, 0, 0.42);
+}
+
+input:not([type]):focus:not([readonly]),
+input[type=text]:not(.browser-default):focus:not([readonly]),
+input[type=password]:not(.browser-default):focus:not([readonly]),
+input[type=email]:not(.browser-default):focus:not([readonly]),
+input[type=url]:not(.browser-default):focus:not([readonly]),
+input[type=time]:not(.browser-default):focus:not([readonly]),
+input[type=date]:not(.browser-default):focus:not([readonly]),
+input[type=datetime]:not(.browser-default):focus:not([readonly]),
+input[type=datetime-local]:not(.browser-default):focus:not([readonly]),
+input[type=tel]:not(.browser-default):focus:not([readonly]),
+input[type=number]:not(.browser-default):focus:not([readonly]),
+input[type=search]:not(.browser-default):focus:not([readonly]),
+textarea.materialize-textarea:focus:not([readonly]) {
+  border-bottom: 1px solid #26a69a;
+  -webkit-box-shadow: 0 1px 0 0 #26a69a;
+          box-shadow: 0 1px 0 0 #26a69a;
+}
+
+input:not([type]):focus:not([readonly]) + label,
+input[type=text]:not(.browser-default):focus:not([readonly]) + label,
+input[type=password]:not(.browser-default):focus:not([readonly]) + label,
+input[type=email]:not(.browser-default):focus:not([readonly]) + label,
+input[type=url]:not(.browser-default):focus:not([readonly]) + label,
+input[type=time]:not(.browser-default):focus:not([readonly]) + label,
+input[type=date]:not(.browser-default):focus:not([readonly]) + label,
+input[type=datetime]:not(.browser-default):focus:not([readonly]) + label,
+input[type=datetime-local]:not(.browser-default):focus:not([readonly]) + label,
+input[type=tel]:not(.browser-default):focus:not([readonly]) + label,
+input[type=number]:not(.browser-default):focus:not([readonly]) + label,
+input[type=search]:not(.browser-default):focus:not([readonly]) + label,
+textarea.materialize-textarea:focus:not([readonly]) + label {
+  color: #26a69a;
+}
+
+input:not([type]).validate + label,
+input[type=text]:not(.browser-default).validate + label,
+input[type=password]:not(.browser-default).validate + label,
+input[type=email]:not(.browser-default).validate + label,
+input[type=url]:not(.browser-default).validate + label,
+input[type=time]:not(.browser-default).validate + label,
+input[type=date]:not(.browser-default).validate + label,
+input[type=datetime]:not(.browser-default).validate + label,
+input[type=datetime-local]:not(.browser-default).validate + label,
+input[type=tel]:not(.browser-default).validate + label,
+input[type=number]:not(.browser-default).validate + label,
+input[type=search]:not(.browser-default).validate + label,
+textarea.materialize-textarea.validate + label {
+  width: 100%;
+}
+
+input:not([type]).invalid + label:after,
+input:not([type]).valid + label:after,
+input[type=text]:not(.browser-default).invalid + label:after,
+input[type=text]:not(.browser-default).valid + label:after,
+input[type=password]:not(.browser-default).invalid + label:after,
+input[type=password]:not(.browser-default).valid + label:after,
+input[type=email]:not(.browser-default).invalid + label:after,
+input[type=email]:not(.browser-default).valid + label:after,
+input[type=url]:not(.browser-default).invalid + label:after,
+input[type=url]:not(.browser-default).valid + label:after,
+input[type=time]:not(.browser-default).invalid + label:after,
+input[type=time]:not(.browser-default).valid + label:after,
+input[type=date]:not(.browser-default).invalid + label:after,
+input[type=date]:not(.browser-default).valid + label:after,
+input[type=datetime]:not(.browser-default).invalid + label:after,
+input[type=datetime]:not(.browser-default).valid + label:after,
+input[type=datetime-local]:not(.browser-default).invalid + label:after,
+input[type=datetime-local]:not(.browser-default).valid + label:after,
+input[type=tel]:not(.browser-default).invalid + label:after,
+input[type=tel]:not(.browser-default).valid + label:after,
+input[type=number]:not(.browser-default).invalid + label:after,
+input[type=number]:not(.browser-default).valid + label:after,
+input[type=search]:not(.browser-default).invalid + label:after,
+input[type=search]:not(.browser-default).valid + label:after,
+textarea.materialize-textarea.invalid + label:after,
+textarea.materialize-textarea.valid + label:after {
+  display: none;
+}
+
+input:not([type]).invalid + label.active:after,
+input:not([type]).valid + label.active:after,
+input[type=text]:not(.browser-default).invalid + label.active:after,
+input[type=text]:not(.browser-default).valid + label.active:after,
+input[type=password]:not(.browser-default).invalid + label.active:after,
+input[type=password]:not(.browser-default).valid + label.active:after,
+input[type=email]:not(.browser-default).invalid + label.active:after,
+input[type=email]:not(.browser-default).valid + label.active:after,
+input[type=url]:not(.browser-default).invalid + label.active:after,
+input[type=url]:not(.browser-default).valid + label.active:after,
+input[type=time]:not(.browser-default).invalid + label.active:after,
+input[type=time]:not(.browser-default).valid + label.active:after,
+input[type=date]:not(.browser-default).invalid + label.active:after,
+input[type=date]:not(.browser-default).valid + label.active:after,
+input[type=datetime]:not(.browser-default).invalid + label.active:after,
+input[type=datetime]:not(.browser-default).valid + label.active:after,
+input[type=datetime-local]:not(.browser-default).invalid + label.active:after,
+input[type=datetime-local]:not(.browser-default).valid + label.active:after,
+input[type=tel]:not(.browser-default).invalid + label.active:after,
+input[type=tel]:not(.browser-default).valid + label.active:after,
+input[type=number]:not(.browser-default).invalid + label.active:after,
+input[type=number]:not(.browser-default).valid + label.active:after,
+input[type=search]:not(.browser-default).invalid + label.active:after,
+input[type=search]:not(.browser-default).valid + label.active:after,
+textarea.materialize-textarea.invalid + label.active:after,
+textarea.materialize-textarea.valid + label.active:after {
+  display: block;
+}
+
+/* Validation Sass Placeholders */
+input.valid:not([type]), input.valid:not([type]):focus,
+input[type=text].valid:not(.browser-default),
+input[type=text].valid:not(.browser-default):focus,
+input[type=password].valid:not(.browser-default),
+input[type=password].valid:not(.browser-default):focus,
+input[type=email].valid:not(.browser-default),
+input[type=email].valid:not(.browser-default):focus,
+input[type=url].valid:not(.browser-default),
+input[type=url].valid:not(.browser-default):focus,
+input[type=time].valid:not(.browser-default),
+input[type=time].valid:not(.browser-default):focus,
+input[type=date].valid:not(.browser-default),
+input[type=date].valid:not(.browser-default):focus,
+input[type=datetime].valid:not(.browser-default),
+input[type=datetime].valid:not(.browser-default):focus,
+input[type=datetime-local].valid:not(.browser-default),
+input[type=datetime-local].valid:not(.browser-default):focus,
+input[type=tel].valid:not(.browser-default),
+input[type=tel].valid:not(.browser-default):focus,
+input[type=number].valid:not(.browser-default),
+input[type=number].valid:not(.browser-default):focus,
+input[type=search].valid:not(.browser-default),
+input[type=search].valid:not(.browser-default):focus,
+textarea.materialize-textarea.valid,
+textarea.materialize-textarea.valid:focus, .select-wrapper.valid > input.select-dropdown {
+  border-bottom: 1px solid #4CAF50;
+  -webkit-box-shadow: 0 1px 0 0 #4CAF50;
+          box-shadow: 0 1px 0 0 #4CAF50;
+}
+
+input.invalid:not([type]), input.invalid:not([type]):focus,
+input[type=text].invalid:not(.browser-default),
+input[type=text].invalid:not(.browser-default):focus,
+input[type=password].invalid:not(.browser-default),
+input[type=password].invalid:not(.browser-default):focus,
+input[type=email].invalid:not(.browser-default),
+input[type=email].invalid:not(.browser-default):focus,
+input[type=url].invalid:not(.browser-default),
+input[type=url].invalid:not(.browser-default):focus,
+input[type=time].invalid:not(.browser-default),
+input[type=time].invalid:not(.browser-default):focus,
+input[type=date].invalid:not(.browser-default),
+input[type=date].invalid:not(.browser-default):focus,
+input[type=datetime].invalid:not(.browser-default),
+input[type=datetime].invalid:not(.browser-default):focus,
+input[type=datetime-local].invalid:not(.browser-default),
+input[type=datetime-local].invalid:not(.browser-default):focus,
+input[type=tel].invalid:not(.browser-default),
+input[type=tel].invalid:not(.browser-default):focus,
+input[type=number].invalid:not(.browser-default),
+input[type=number].invalid:not(.browser-default):focus,
+input[type=search].invalid:not(.browser-default),
+input[type=search].invalid:not(.browser-default):focus,
+textarea.materialize-textarea.invalid,
+textarea.materialize-textarea.invalid:focus, .select-wrapper.invalid > input.select-dropdown {
+  border-bottom: 1px solid #F44336;
+  -webkit-box-shadow: 0 1px 0 0 #F44336;
+          box-shadow: 0 1px 0 0 #F44336;
+}
+
+input:not([type]).valid + label:after,
+input:not([type]):focus.valid + label:after,
+input[type=text]:not(.browser-default).valid + label:after,
+input[type=text]:not(.browser-default):focus.valid + label:after,
+input[type=password]:not(.browser-default).valid + label:after,
+input[type=password]:not(.browser-default):focus.valid + label:after,
+input[type=email]:not(.browser-default).valid + label:after,
+input[type=email]:not(.browser-default):focus.valid + label:after,
+input[type=url]:not(.browser-default).valid + label:after,
+input[type=url]:not(.browser-default):focus.valid + label:after,
+input[type=time]:not(.browser-default).valid + label:after,
+input[type=time]:not(.browser-default):focus.valid + label:after,
+input[type=date]:not(.browser-default).valid + label:after,
+input[type=date]:not(.browser-default):focus.valid + label:after,
+input[type=datetime]:not(.browser-default).valid + label:after,
+input[type=datetime]:not(.browser-default):focus.valid + label:after,
+input[type=datetime-local]:not(.browser-default).valid + label:after,
+input[type=datetime-local]:not(.browser-default):focus.valid + label:after,
+input[type=tel]:not(.browser-default).valid + label:after,
+input[type=tel]:not(.browser-default):focus.valid + label:after,
+input[type=number]:not(.browser-default).valid + label:after,
+input[type=number]:not(.browser-default):focus.valid + label:after,
+input[type=search]:not(.browser-default).valid + label:after,
+input[type=search]:not(.browser-default):focus.valid + label:after,
+textarea.materialize-textarea.valid + label:after,
+textarea.materialize-textarea:focus.valid + label:after, .select-wrapper.valid + label:after {
+  content: attr(data-success);
+  color: #4CAF50;
+  opacity: 1;
+  -webkit-transform: translateY(9px);
+          transform: translateY(9px);
+}
+
+input:not([type]).invalid + label:after,
+input:not([type]):focus.invalid + label:after,
+input[type=text]:not(.browser-default).invalid + label:after,
+input[type=text]:not(.browser-default):focus.invalid + label:after,
+input[type=password]:not(.browser-default).invalid + label:after,
+input[type=password]:not(.browser-default):focus.invalid + label:after,
+input[type=email]:not(.browser-default).invalid + label:after,
+input[type=email]:not(.browser-default):focus.invalid + label:after,
+input[type=url]:not(.browser-default).invalid + label:after,
+input[type=url]:not(.browser-default):focus.invalid + label:after,
+input[type=time]:not(.browser-default).invalid + label:after,
+input[type=time]:not(.browser-default):focus.invalid + label:after,
+input[type=date]:not(.browser-default).invalid + label:after,
+input[type=date]:not(.browser-default):focus.invalid + label:after,
+input[type=datetime]:not(.browser-default).invalid + label:after,
+input[type=datetime]:not(.browser-default):focus.invalid + label:after,
+input[type=datetime-local]:not(.browser-default).invalid + label:after,
+input[type=datetime-local]:not(.browser-default):focus.invalid + label:after,
+input[type=tel]:not(.browser-default).invalid + label:after,
+input[type=tel]:not(.browser-default):focus.invalid + label:after,
+input[type=number]:not(.browser-default).invalid + label:after,
+input[type=number]:not(.browser-default):focus.invalid + label:after,
+input[type=search]:not(.browser-default).invalid + label:after,
+input[type=search]:not(.browser-default):focus.invalid + label:after,
+textarea.materialize-textarea.invalid + label:after,
+textarea.materialize-textarea:focus.invalid + label:after, .select-wrapper.invalid + label:after {
+  content: attr(data-error);
+  color: #F44336;
+  opacity: 1;
+  -webkit-transform: translateY(9px);
+          transform: translateY(9px);
+}
+
+input:not([type]) + label:after,
+input[type=text]:not(.browser-default) + label:after,
+input[type=password]:not(.browser-default) + label:after,
+input[type=email]:not(.browser-default) + label:after,
+input[type=url]:not(.browser-default) + label:after,
+input[type=time]:not(.browser-default) + label:after,
+input[type=date]:not(.browser-default) + label:after,
+input[type=datetime]:not(.browser-default) + label:after,
+input[type=datetime-local]:not(.browser-default) + label:after,
+input[type=tel]:not(.browser-default) + label:after,
+input[type=number]:not(.browser-default) + label:after,
+input[type=search]:not(.browser-default) + label:after,
+textarea.materialize-textarea + label:after, .select-wrapper + label:after {
+  display: block;
+  content: "";
+  position: absolute;
+  top: 100%;
+  left: 0;
+  opacity: 0;
+  -webkit-transition: .2s opacity ease-out, .2s color ease-out;
+  transition: .2s opacity ease-out, .2s color ease-out;
+}
+
+.input-field {
+  position: relative;
+  margin-top: 1rem;
+}
+
+.input-field.inline {
+  display: inline-block;
+  vertical-align: middle;
+  margin-left: 5px;
+}
+
+.input-field.inline input,
+.input-field.inline .select-dropdown {
+  margin-bottom: 1rem;
+}
+
+.input-field.col label {
+  left: 0.75rem;
+}
+
+.input-field.col .prefix ~ label,
+.input-field.col .prefix ~ .validate ~ label {
+  width: calc(100% - 3rem - 1.5rem);
+}
+
+.input-field label {
+  color: #9e9e9e;
+  position: absolute;
+  top: 0;
+  left: 0;
+  height: 100%;
+  font-size: 1rem;
+  cursor: text;
+  -webkit-transition: -webkit-transform .2s ease-out;
+  transition: -webkit-transform .2s ease-out;
+  transition: transform .2s ease-out;
+  transition: transform .2s ease-out, -webkit-transform .2s ease-out;
+  -webkit-transform-origin: 0% 100%;
+          transform-origin: 0% 100%;
+  text-align: initial;
+  -webkit-transform: translateY(12px);
+          transform: translateY(12px);
+  pointer-events: none;
+}
+
+.input-field label:not(.label-icon).active {
+  -webkit-transform: translateY(-14px) scale(0.8);
+          transform: translateY(-14px) scale(0.8);
+  -webkit-transform-origin: 0 0;
+          transform-origin: 0 0;
+}
+
+.input-field .prefix {
+  position: absolute;
+  width: 3rem;
+  font-size: 2rem;
+  -webkit-transition: color .2s;
+  transition: color .2s;
+}
+
+.input-field .prefix.active {
+  color: #26a69a;
+}
+
+.input-field .prefix ~ input,
+.input-field .prefix ~ textarea,
+.input-field .prefix ~ label,
+.input-field .prefix ~ .validate ~ label,
+.input-field .prefix ~ .autocomplete-content {
+  margin-left: 3rem;
+  width: 92%;
+  width: calc(100% - 3rem);
+}
+
+.input-field .prefix ~ label {
+  margin-left: 3rem;
+}
+
+@media only screen and (max-width: 992px) {
+  .input-field .prefix ~ input {
+    width: 86%;
+    width: calc(100% - 3rem);
+  }
+}
+
+@media only screen and (max-width: 600px) {
+  .input-field .prefix ~ input {
+    width: 80%;
+    width: calc(100% - 3rem);
+  }
+}
+
+/* Search Field */
+.input-field input[type=search] {
+  display: block;
+  line-height: inherit;
+}
+
+.nav-wrapper .input-field input[type=search] {
+  height: inherit;
+  padding-left: 4rem;
+  width: calc(100% - 4rem);
+  border: 0;
+  -webkit-box-shadow: none;
+          box-shadow: none;
+}
+
+.input-field input[type=search]:focus {
+  background-color: #fff;
+  border: 0;
+  -webkit-box-shadow: none;
+          box-shadow: none;
+  color: #444;
+}
+
+.input-field input[type=search]:focus + label i,
+.input-field input[type=search]:focus ~ .mdi-navigation-close,
+.input-field input[type=search]:focus ~ .material-icons {
+  color: #444;
+}
+
+.input-field input[type=search] + label {
+  left: 1rem;
+}
+
+.input-field input[type=search] ~ .mdi-navigation-close,
+.input-field input[type=search] ~ .material-icons {
+  position: absolute;
+  top: 0;
+  right: 1rem;
+  color: transparent;
+  cursor: pointer;
+  font-size: 2rem;
+  -webkit-transition: .3s color;
+  transition: .3s color;
+}
+
+/* Textarea */
+textarea {
+  width: 100%;
+  height: 3rem;
+  background-color: transparent;
+}
+
+textarea.materialize-textarea {
+  overflow-y: hidden;
+  /* prevents scroll bar flash */
+  padding: .8rem 0 1.6rem 0;
+  /* prevents text jump on Enter keypress */
+  resize: none;
+  min-height: 3rem;
+}
+
+textarea.materialize-textarea.validate + label {
+  height: 100%;
+}
+
+textarea.materialize-textarea.validate + label::after {
+  top: calc(100% - 12px);
+}
+
+textarea.materialize-textarea.validate + label:not(.label-icon).active {
+  -webkit-transform: translateY(-25px);
+          transform: translateY(-25px);
+}
+
+.hiddendiv {
+  display: none;
+  white-space: pre-wrap;
+  word-wrap: break-word;
+  overflow-wrap: break-word;
+  /* future version of deprecated 'word-wrap' */
+  padding-top: 1.2rem;
+  /* prevents text jump on Enter keypress */
+  position: absolute;
+  top: 0;
+}
+
+/* Autocomplete */
+.autocomplete-content {
+  margin-top: -20px;
+  margin-bottom: 20px;
+  display: block;
+  opacity: 1;
+  position: static;
+}
+
+.autocomplete-content li .highlight {
+  color: #444;
+}
+
+.autocomplete-content li img {
+  height: 40px;
+  width: 40px;
+  margin: 5px 15px;
+}
+
+/* Radio Buttons
+   ========================================================================== */
+[type="radio"]:not(:checked),
+[type="radio"]:checked {
+  position: absolute;
+  opacity: 0;
+  pointer-events: none;
+}
+
+[type="radio"]:not(:checked) + label,
+[type="radio"]:checked + label {
+  position: relative;
+  padding-left: 35px;
+  cursor: pointer;
+  display: inline-block;
+  height: 25px;
+  line-height: 25px;
+  font-size: 1rem;
+  -webkit-transition: .28s ease;
+  transition: .28s ease;
+  -webkit-user-select: none;
+     -moz-user-select: none;
+      -ms-user-select: none;
+          user-select: none;
+}
+
+[type="radio"] + label:before,
+[type="radio"] + label:after {
+  content: '';
+  position: absolute;
+  left: 0;
+  top: 0;
+  margin: 4px;
+  width: 16px;
+  height: 16px;
+  z-index: 0;
+  -webkit-transition: .28s ease;
+  transition: .28s ease;
+}
+
+/* Unchecked styles */
+[type="radio"]:not(:checked) + label:before,
+[type="radio"]:not(:checked) + label:after,
+[type="radio"]:checked + label:before,
+[type="radio"]:checked + label:after,
+[type="radio"].with-gap:checked + label:before,
+[type="radio"].with-gap:checked + label:after {
+  border-radius: 50%;
+}
+
+[type="radio"]:not(:checked) + label:before,
+[type="radio"]:not(:checked) + label:after {
+  border: 2px solid #5a5a5a;
+}
+
+[type="radio"]:not(:checked) + label:after {
+  -webkit-transform: scale(0);
+          transform: scale(0);
+}
+
+/* Checked styles */
+[type="radio"]:checked + label:before {
+  border: 2px solid transparent;
+}
+
+[type="radio"]:checked + label:after,
+[type="radio"].with-gap:checked + label:before,
+[type="radio"].with-gap:checked + label:after {
+  border: 2px solid #26a69a;
+}
+
+[type="radio"]:checked + label:after,
+[type="radio"].with-gap:checked + label:after {
+  background-color: #26a69a;
+}
+
+[type="radio"]:checked + label:after {
+  -webkit-transform: scale(1.02);
+          transform: scale(1.02);
+}
+
+/* Radio With gap */
+[type="radio"].with-gap:checked + label:after {
+  -webkit-transform: scale(0.5);
+          transform: scale(0.5);
+}
+
+/* Focused styles */
+[type="radio"].tabbed:focus + label:before {
+  -webkit-box-shadow: 0 0 0 10px rgba(0, 0, 0, 0.1);
+          box-shadow: 0 0 0 10px rgba(0, 0, 0, 0.1);
+}
+
+/* Disabled Radio With gap */
+[type="radio"].with-gap:disabled:checked + label:before {
+  border: 2px solid rgba(0, 0, 0, 0.42);
+}
+
+[type="radio"].with-gap:disabled:checked + label:after {
+  border: none;
+  background-color: rgba(0, 0, 0, 0.42);
+}
+
+/* Disabled style */
+[type="radio"]:disabled:not(:checked) + label:before,
+[type="radio"]:disabled:checked + label:before {
+  background-color: transparent;
+  border-color: rgba(0, 0, 0, 0.42);
+}
+
+[type="radio"]:disabled + label {
+  color: rgba(0, 0, 0, 0.42);
+}
+
+[type="radio"]:disabled:not(:checked) + label:before {
+  border-color: rgba(0, 0, 0, 0.42);
+}
+
+[type="radio"]:disabled:checked + label:after {
+  background-color: rgba(0, 0, 0, 0.42);
+  border-color: #949494;
+}
+
+/* Checkboxes
+   ========================================================================== */
+/* CUSTOM CSS CHECKBOXES */
+form p {
+  margin-bottom: 10px;
+  text-align: left;
+}
+
+form p:last-child {
+  margin-bottom: 0;
+}
+
+/* Remove default checkbox */
+[type="checkbox"]:not(:checked),
+[type="checkbox"]:checked {
+  position: absolute;
+  opacity: 0;
+  pointer-events: none;
+}
+
+[type="checkbox"] {
+  /* checkbox aspect */
+}
+
+[type="checkbox"] + label {
+  position: relative;
+  padding-left: 35px;
+  cursor: pointer;
+  display: inline-block;
+  height: 25px;
+  line-height: 25px;
+  font-size: 1rem;
+  -webkit-user-select: none;
+     -moz-user-select: none;
+      -ms-user-select: none;
+          user-select: none;
+}
+
+[type="checkbox"] + label:before,
+[type="checkbox"]:not(.filled-in) + label:after {
+  content: '';
+  position: absolute;
+  top: 0;
+  left: 0;
+  width: 18px;
+  height: 18px;
+  z-index: 0;
+  border: 2px solid #5a5a5a;
+  border-radius: 1px;
+  margin-top: 2px;
+  -webkit-transition: .2s;
+  transition: .2s;
+}
+
+[type="checkbox"]:not(.filled-in) + label:after {
+  border: 0;
+  -webkit-transform: scale(0);
+          transform: scale(0);
+}
+
+[type="checkbox"]:not(:checked):disabled + label:before {
+  border: none;
+  background-color: rgba(0, 0, 0, 0.42);
+}
+
+[type="checkbox"].tabbed:focus + label:after {
+  -webkit-transform: scale(1);
+          transform: scale(1);
+  border: 0;
+  border-radius: 50%;
+  -webkit-box-shadow: 0 0 0 10px rgba(0, 0, 0, 0.1);
+          box-shadow: 0 0 0 10px rgba(0, 0, 0, 0.1);
+  background-color: rgba(0, 0, 0, 0.1);
+}
+
+[type="checkbox"]:checked + label:before {
+  top: -4px;
+  left: -5px;
+  width: 12px;
+  height: 22px;
+  border-top: 2px solid transparent;
+  border-left: 2px solid transparent;
+  border-right: 2px solid #26a69a;
+  border-bottom: 2px solid #26a69a;
+  -webkit-transform: rotate(40deg);
+          transform: rotate(40deg);
+  -webkit-backface-visibility: hidden;
+          backface-visibility: hidden;
+  -webkit-transform-origin: 100% 100%;
+          transform-origin: 100% 100%;
+}
+
+[type="checkbox"]:checked:disabled + label:before {
+  border-right: 2px solid rgba(0, 0, 0, 0.42);
+  border-bottom: 2px solid rgba(0, 0, 0, 0.42);
+}
+
+/* Indeterminate checkbox */
+[type="checkbox"]:indeterminate + label:before {
+  top: -11px;
+  left: -12px;
+  width: 10px;
+  height: 22px;
+  border-top: none;
+  border-left: none;
+  border-right: 2px solid #26a69a;
+  border-bottom: none;
+  -webkit-transform: rotate(90deg);
+          transform: rotate(90deg);
+  -webkit-backface-visibility: hidden;
+          backface-visibility: hidden;
+  -webkit-transform-origin: 100% 100%;
+          transform-origin: 100% 100%;
+}
+
+[type="checkbox"]:indeterminate:disabled + label:before {
+  border-right: 2px solid rgba(0, 0, 0, 0.42);
+  background-color: transparent;
+}
+
+[type="checkbox"].filled-in + label:after {
+  border-radius: 2px;
+}
+
+[type="checkbox"].filled-in + label:before,
+[type="checkbox"].filled-in + label:after {
+  content: '';
+  left: 0;
+  position: absolute;
+  /* .1s delay is for check animation */
+  -webkit-transition: border .25s, background-color .25s, width .20s .1s, height .20s .1s, top .20s .1s, left .20s .1s;
+  transition: border .25s, background-color .25s, width .20s .1s, height .20s .1s, top .20s .1s, left .20s .1s;
+  z-index: 1;
+}
+
+[type="checkbox"].filled-in:not(:checked) + label:before {
+  width: 0;
+  height: 0;
+  border: 3px solid transparent;
+  left: 6px;
+  top: 10px;
+  -webkit-transform: rotateZ(37deg);
+          transform: rotateZ(37deg);
+  -webkit-transform-origin: 100% 100%;
+          transform-origin: 100% 100%;
+}
+
+[type="checkbox"].filled-in:not(:checked) + label:after {
+  height: 20px;
+  width: 20px;
+  background-color: transparent;
+  border: 2px solid #5a5a5a;
+  top: 0px;
+  z-index: 0;
+}
+
+[type="checkbox"].filled-in:checked + label:before {
+  top: 0;
+  left: 1px;
+  width: 8px;
+  height: 13px;
+  border-top: 2px solid transparent;
+  border-left: 2px solid transparent;
+  border-right: 2px solid #fff;
+  border-bottom: 2px solid #fff;
+  -webkit-transform: rotateZ(37deg);
+          transform: rotateZ(37deg);
+  -webkit-transform-origin: 100% 100%;
+          transform-origin: 100% 100%;
+}
+
+[type="checkbox"].filled-in:checked + label:after {
+  top: 0;
+  width: 20px;
+  height: 20px;
+  border: 2px solid #26a69a;
+  background-color: #26a69a;
+  z-index: 0;
+}
+
+[type="checkbox"].filled-in.tabbed:focus + label:after {
+  border-radius: 2px;
+  border-color: #5a5a5a;
+  background-color: rgba(0, 0, 0, 0.1);
+}
+
+[type="checkbox"].filled-in.tabbed:checked:focus + label:after {
+  border-radius: 2px;
+  background-color: #26a69a;
+  border-color: #26a69a;
+}
+
+[type="checkbox"].filled-in:disabled:not(:checked) + label:before {
+  background-color: transparent;
+  border: 2px solid transparent;
+}
+
+[type="checkbox"].filled-in:disabled:not(:checked) + label:after {
+  border-color: transparent;
+  background-color: #949494;
+}
+
+[type="checkbox"].filled-in:disabled:checked + label:before {
+  background-color: transparent;
+}
+
+[type="checkbox"].filled-in:disabled:checked + label:after {
+  background-color: #949494;
+  border-color: #949494;
+}
+
+/* Switch
+   ========================================================================== */
+.switch,
+.switch * {
+  -webkit-tap-highlight-color: transparent;
+  -webkit-user-select: none;
+     -moz-user-select: none;
+      -ms-user-select: none;
+          user-select: none;
+}
+
+.switch label {
+  cursor: pointer;
+}
+
+.switch label input[type=checkbox] {
+  opacity: 0;
+  width: 0;
+  height: 0;
+}
+
+.switch label input[type=checkbox]:checked + .lever {
+  background-color: #84c7c1;
+}
+
+.switch label input[type=checkbox]:checked + .lever:before, .switch label input[type=checkbox]:checked + .lever:after {
+  left: 18px;
+}
+
+.switch label input[type=checkbox]:checked + .lever:after {
+  background-color: #26a69a;
+}
+
+.switch label .lever {
+  content: "";
+  display: inline-block;
+  position: relative;
+  width: 36px;
+  height: 14px;
+  background-color: rgba(0, 0, 0, 0.38);
+  border-radius: 15px;
+  margin-right: 10px;
+  -webkit-transition: background 0.3s ease;
+  transition: background 0.3s ease;
+  vertical-align: middle;
+  margin: 0 16px;
+}
+
+.switch label .lever:before, .switch label .lever:after {
+  content: "";
+  position: absolute;
+  display: inline-block;
+  width: 20px;
+  height: 20px;
+  border-radius: 50%;
+  left: 0;
+  top: -3px;
+  -webkit-transition: left 0.3s ease, background .3s ease, -webkit-box-shadow 0.1s ease, -webkit-transform .1s ease;
+  transition: left 0.3s ease, background .3s ease, -webkit-box-shadow 0.1s ease, -webkit-transform .1s ease;
+  transition: left 0.3s ease, background .3s ease, box-shadow 0.1s ease, transform .1s ease;
+  transition: left 0.3s ease, background .3s ease, box-shadow 0.1s ease, transform .1s ease, -webkit-box-shadow 0.1s ease, -webkit-transform .1s ease;
+}
+
+.switch label .lever:before {
+  background-color: rgba(38, 166, 154, 0.15);
+}
+
+.switch label .lever:after {
+  background-color: #F1F1F1;
+  -webkit-box-shadow: 0px 3px 1px -2px rgba(0, 0, 0, 0.2), 0px 2px 2px 0px rgba(0, 0, 0, 0.14), 0px 1px 5px 0px rgba(0, 0, 0, 0.12);
+          box-shadow: 0px 3px 1px -2px rgba(0, 0, 0, 0.2), 0px 2px 2px 0px rgba(0, 0, 0, 0.14), 0px 1px 5px 0px rgba(0, 0, 0, 0.12);
+}
+
+input[type=checkbox]:checked:not(:disabled) ~ .lever:active::before,
+input[type=checkbox]:checked:not(:disabled).tabbed:focus ~ .lever::before {
+  -webkit-transform: scale(2.4);
+          transform: scale(2.4);
+  background-color: rgba(38, 166, 154, 0.15);
+}
+
+input[type=checkbox]:not(:disabled) ~ .lever:active:before,
+input[type=checkbox]:not(:disabled).tabbed:focus ~ .lever::before {
+  -webkit-transform: scale(2.4);
+          transform: scale(2.4);
+  background-color: rgba(0, 0, 0, 0.08);
+}
+
+.switch input[type=checkbox][disabled] + .lever {
+  cursor: default;
+  background-color: rgba(0, 0, 0, 0.12);
+}
+
+.switch label input[type=checkbox][disabled] + .lever:after,
+.switch label input[type=checkbox][disabled]:checked + .lever:after {
+  background-color: #949494;
+}
+
+/* Select Field
+   ========================================================================== */
+select {
+  display: none;
+}
+
+select.browser-default {
+  display: block;
+}
+
+select {
+  background-color: rgba(255, 255, 255, 0.9);
+  width: 100%;
+  padding: 5px;
+  border: 1px solid #f2f2f2;
+  border-radius: 2px;
+  height: 3rem;
+}
+
+.input-field > select {
+  display: block;
+  position: absolute;
+  width: 0;
+  pointer-events: none;
+  height: 0;
+  top: 0;
+  left: 0;
+  opacity: 0;
+}
+
+.select-label {
+  position: absolute;
+}
+
+.select-wrapper {
+  position: relative;
+}
+
+.select-wrapper.valid + label,
+.select-wrapper.invalid + label {
+  width: 100%;
+  pointer-events: none;
+}
+
+.select-wrapper input.select-dropdown {
+  position: relative;
+  cursor: pointer;
+  background-color: transparent;
+  border: none;
+  border-bottom: 1px solid #9e9e9e;
+  outline: none;
+  height: 3rem;
+  line-height: 3rem;
+  width: 100%;
+  font-size: 1rem;
+  margin: 0 0 20px 0;
+  padding: 0;
+  display: block;
+  -webkit-user-select: none;
+     -moz-user-select: none;
+      -ms-user-select: none;
+          user-select: none;
+}
+
+.select-wrapper span.caret {
+  color: initial;
+  position: absolute;
+  right: 0;
+  top: 0;
+  bottom: 0;
+  height: 10px;
+  margin: auto 0;
+  font-size: 10px;
+  line-height: 10px;
+}
+
+.select-wrapper + label {
+  position: absolute;
+  top: -26px;
+  font-size: 0.8rem;
+}
+
+select:disabled {
+  color: rgba(0, 0, 0, 0.42);
+}
+
+.select-wrapper.disabled span.caret,
+.select-wrapper.disabled + label {
+  color: rgba(0, 0, 0, 0.42);
+}
+
+.select-wrapper input.select-dropdown:disabled {
+  color: rgba(0, 0, 0, 0.42);
+  cursor: default;
+  -webkit-user-select: none;
+     -moz-user-select: none;
+      -ms-user-select: none;
+          user-select: none;
+}
+
+.select-wrapper i {
+  color: rgba(0, 0, 0, 0.3);
+}
+
+.select-dropdown li.disabled,
+.select-dropdown li.disabled > span,
+.select-dropdown li.optgroup {
+  color: rgba(0, 0, 0, 0.3);
+  background-color: transparent;
+}
+
+.select-dropdown.dropdown-content li.active {
+  background-color: transparent;
+}
+
+.select-dropdown.dropdown-content li:hover {
+  background-color: rgba(0, 0, 0, 0.06);
+}
+
+.select-dropdown.dropdown-content li.selected {
+  background-color: rgba(0, 0, 0, 0.03);
+}
+
+.prefix ~ .select-wrapper {
+  margin-left: 3rem;
+  width: 92%;
+  width: calc(100% - 3rem);
+}
+
+.prefix ~ label {
+  margin-left: 3rem;
+}
+
+.select-dropdown li img {
+  height: 40px;
+  width: 40px;
+  margin: 5px 15px;
+  float: right;
+}
+
+.select-dropdown li.optgroup {
+  border-top: 1px solid #eee;
+}
+
+.select-dropdown li.optgroup.selected > span {
+  color: rgba(0, 0, 0, 0.7);
+}
+
+.select-dropdown li.optgroup > span {
+  color: rgba(0, 0, 0, 0.4);
+}
+
+.select-dropdown li.optgroup ~ li.optgroup-option {
+  padding-left: 1rem;
+}
+
+/* File Input
+   ========================================================================== */
+.file-field {
+  position: relative;
+}
+
+.file-field .file-path-wrapper {
+  overflow: hidden;
+  padding-left: 10px;
+}
+
+.file-field input.file-path {
+  width: 100%;
+}
+
+.file-field .btn, .file-field .btn-large {
+  float: left;
+  height: 3rem;
+  line-height: 3rem;
+}
+
+.file-field span {
+  cursor: pointer;
+}
+
+.file-field input[type=file] {
+  position: absolute;
+  top: 0;
+  right: 0;
+  left: 0;
+  bottom: 0;
+  width: 100%;
+  margin: 0;
+  padding: 0;
+  font-size: 20px;
+  cursor: pointer;
+  opacity: 0;
+  filter: alpha(opacity=0);
+}
+
+.file-field input[type=file]::-webkit-file-upload-button {
+  display: none;
+}
+
+/* Range
+   ========================================================================== */
+.range-field {
+  position: relative;
+}
+
+input[type=range],
+input[type=range] + .thumb {
+  cursor: pointer;
+}
+
+input[type=range] {
+  position: relative;
+  background-color: transparent;
+  border: none;
+  outline: none;
+  width: 100%;
+  margin: 15px 0;
+  padding: 0;
+}
+
+input[type=range]:focus {
+  outline: none;
+}
+
+input[type=range] + .thumb {
+  position: absolute;
+  top: 10px;
+  left: 0;
+  border: none;
+  height: 0;
+  width: 0;
+  border-radius: 50%;
+  background-color: #26a69a;
+  margin-left: 7px;
+  -webkit-transform-origin: 50% 50%;
+          transform-origin: 50% 50%;
+  -webkit-transform: rotate(-45deg);
+          transform: rotate(-45deg);
+}
+
+input[type=range] + .thumb .value {
+  display: block;
+  width: 30px;
+  text-align: center;
+  color: #26a69a;
+  font-size: 0;
+  -webkit-transform: rotate(45deg);
+          transform: rotate(45deg);
+}
+
+input[type=range] + .thumb.active {
+  border-radius: 50% 50% 50% 0;
+}
+
+input[type=range] + .thumb.active .value {
+  color: #fff;
+  margin-left: -1px;
+  margin-top: 8px;
+  font-size: 10px;
+}
+
+input[type=range] {
+  -webkit-appearance: none;
+}
+
+input[type=range]::-webkit-slider-runnable-track {
+  height: 3px;
+  background: #c2c0c2;
+  border: none;
+}
+
+input[type=range]::-webkit-slider-thumb {
+  -webkit-appearance: none;
+  border: none;
+  height: 14px;
+  width: 14px;
+  border-radius: 50%;
+  background-color: #26a69a;
+  -webkit-transform-origin: 50% 50%;
+          transform-origin: 50% 50%;
+  margin: -5px 0 0 0;
+  -webkit-transition: .3s;
+  transition: .3s;
+}
+
+input[type=range]:focus::-webkit-slider-runnable-track {
+  background: #ccc;
+}
+
+input[type=range] {
+  /* fix for FF unable to apply focus style bug  */
+  border: 1px solid white;
+  /*required for proper track sizing in FF*/
+}
+
+input[type=range]::-moz-range-track {
+  height: 3px;
+  background: #ddd;
+  border: none;
+}
+
+input[type=range]::-moz-range-thumb {
+  border: none;
+  height: 14px;
+  width: 14px;
+  border-radius: 50%;
+  background: #26a69a;
+  margin-top: -5px;
+}
+
+input[type=range]:-moz-focusring {
+  outline: 1px solid #fff;
+  outline-offset: -1px;
+}
+
+input[type=range]:focus::-moz-range-track {
+  background: #ccc;
+}
+
+input[type=range]::-ms-track {
+  height: 3px;
+  background: transparent;
+  border-color: transparent;
+  border-width: 6px 0;
+  /*remove default tick marks*/
+  color: transparent;
+}
+
+input[type=range]::-ms-fill-lower {
+  background: #777;
+}
+
+input[type=range]::-ms-fill-upper {
+  background: #ddd;
+}
+
+input[type=range]::-ms-thumb {
+  border: none;
+  height: 14px;
+  width: 14px;
+  border-radius: 50%;
+  background: #26a69a;
+}
+
+input[type=range]:focus::-ms-fill-lower {
+  background: #888;
+}
+
+input[type=range]:focus::-ms-fill-upper {
+  background: #ccc;
+}
+
+/***************
+    Nav List
+***************/
+.table-of-contents.fixed {
+  position: fixed;
+}
+
+.table-of-contents li {
+  padding: 2px 0;
+}
+
+.table-of-contents a {
+  display: inline-block;
+  font-weight: 300;
+  color: #757575;
+  padding-left: 20px;
+  height: 1.5rem;
+  line-height: 1.5rem;
+  letter-spacing: .4;
+  display: inline-block;
+}
+
+.table-of-contents a:hover {
+  color: #a8a8a8;
+  padding-left: 19px;
+  border-left: 1px solid #ee6e73;
+}
+
+.table-of-contents a.active {
+  font-weight: 500;
+  padding-left: 18px;
+  border-left: 2px solid #ee6e73;
+}
+
+.side-nav {
+  position: fixed;
+  width: 300px;
+  left: 0;
+  top: 0;
+  margin: 0;
+  -webkit-transform: translateX(-100%);
+          transform: translateX(-100%);
+  height: 100%;
+  height: calc(100% + 60px);
+  height: -moz-calc(100%);
+  padding-bottom: 60px;
+  background-color: #fff;
+  z-index: 999;
+  overflow-y: auto;
+  will-change: transform;
+  -webkit-backface-visibility: hidden;
+          backface-visibility: hidden;
+  -webkit-transform: translateX(-105%);
+          transform: translateX(-105%);
+}
+
+.side-nav.right-aligned {
+  right: 0;
+  -webkit-transform: translateX(105%);
+          transform: translateX(105%);
+  left: auto;
+  -webkit-transform: translateX(100%);
+          transform: translateX(100%);
+}
+
+.side-nav .collapsible {
+  margin: 0;
+}
+
+.side-nav li {
+  float: none;
+  line-height: 64px;
+}
+
+.side-nav li.active {
+  background-color: rgba(0, 0, 0, 0.05);
+}
+
+.side-nav li > a {
+  /* color: rgba(0, 0, 0, 0.87); */
+  color: rgb(68, 68, 68);
+  display: block;
+  /* font-size: 14px; */
+  font-size: 1rem;
+  /* font-weight: 500; */
+  height: 64px;
+  line-height: 64px;
+  /* padding: 0 32px; */
+  padding: 0 30px;
+}
+
+.side-nav li > a:hover {
+  background-color: rgba(0, 0, 0, 0.05);
+}
+
+.side-nav li > a.btn, .side-nav li > a.btn-large, .side-nav li > a.btn-large, .side-nav li > a.btn-flat, .side-nav li > a.btn-floating {
+  margin: 10px 15px;
+}
+
+.side-nav li > a.btn, .side-nav li > a.btn-large, .side-nav li > a.btn-large, .side-nav li > a.btn-floating {
+  color: #fff;
+}
+
+.side-nav li > a.btn-flat {
+  color: #343434;
+}
+
+.side-nav li > a.btn:hover, .side-nav li > a.btn-large:hover, .side-nav li > a.btn-large:hover {
+  background-color: #2bbbad;
+}
+
+.side-nav li > a.btn-floating:hover {
+  background-color: #26a69a;
+}
+
+.side-nav li > a > i,
+.side-nav li > a > [class^="mdi-"], .side-nav li > a li > a > [class*="mdi-"],
+.side-nav li > a > i.material-icons {
+  float: left;
+  /* height: 48px; */
+  line-height: 64px;
+  /* margin: 0 32px 0 0; */
+  /* width: 24px; */
+  /* color: rgba(0, 0, 0, 0.54); */
+}
+
+.side-nav .divider {
+  margin: 8px 0 0 0;
+}
+
+.side-nav .subheader {
+  cursor: initial;
+  pointer-events: none;
+  color: rgba(0, 0, 0, 0.54);
+  font-size: 14px;
+  font-weight: 500;
+  line-height: 48px;
+}
+
+.side-nav .subheader:hover {
+  background-color: transparent;
+}
+
+.side-nav .user-view,
+.side-nav .userView {
+  position: relative;
+  padding: 32px 32px 0;
+  margin-bottom: 8px;
+}
+
+.side-nav .user-view > a,
+.side-nav .userView > a {
+  height: auto;
+  padding: 0;
+}
+
+.side-nav .user-view > a:hover,
+.side-nav .userView > a:hover {
+  background-color: transparent;
+}
+
+.side-nav .user-view .background,
+.side-nav .userView .background {
+  overflow: hidden;
+  position: absolute;
+  top: 0;
+  right: 0;
+  bottom: 0;
+  left: 0;
+  z-index: -1;
+}
+
+.side-nav .user-view .circle, .side-nav .user-view .name, .side-nav .user-view .email,
+.side-nav .userView .circle,
+.side-nav .userView .name,
+.side-nav .userView .email {
+  display: block;
+}
+
+.side-nav .user-view .circle,
+.side-nav .userView .circle {
+  height: 64px;
+  width: 64px;
+}
+
+.side-nav .user-view .name,
+.side-nav .user-view .email,
+.side-nav .userView .name,
+.side-nav .userView .email {
+  font-size: 14px;
+  line-height: 24px;
+}
+
+.side-nav .user-view .name,
+.side-nav .userView .name {
+  margin-top: 16px;
+  font-weight: 500;
+}
+
+.side-nav .user-view .email,
+.side-nav .userView .email {
+  padding-bottom: 16px;
+  font-weight: 400;
+}
+
+.drag-target {
+  height: 100%;
+  width: 10px;
+  position: fixed;
+  top: 0;
+  z-index: 998;
+}
+
+.side-nav.fixed {
+  left: 0;
+  -webkit-transform: translateX(0);
+          transform: translateX(0);
+  position: fixed;
+}
+
+.side-nav.fixed.right-aligned {
+  right: 0;
+  left: auto;
+}
+
+@media only screen and (max-width: 992px) {
+  .side-nav.fixed {
+    -webkit-transform: translateX(-105%);
+            transform: translateX(-105%);
+  }
+  .side-nav.fixed.right-aligned {
+    -webkit-transform: translateX(105%);
+            transform: translateX(105%);
+  }
+  .side-nav a {
+    padding: 0 16px;
+  }
+  .side-nav .user-view,
+  .side-nav .userView {
+    padding: 16px 16px 0;
+  }
+}
+
+.side-nav .collapsible-body > ul:not(.collapsible) > li.active,
+.side-nav.fixed .collapsible-body > ul:not(.collapsible) > li.active {
+  background-color: #ee6e73;
+}
+
+.side-nav .collapsible-body > ul:not(.collapsible) > li.active a,
+.side-nav.fixed .collapsible-body > ul:not(.collapsible) > li.active a {
+  color: #fff;
+}
+
+.side-nav .collapsible-body {
+  padding: 0;
+}
+
+#sidenav-overlay {
+  position: fixed;
+  top: 0;
+  left: 0;
+  right: 0;
+  height: 120vh;
+  background-color: rgba(0, 0, 0, 0.5);
+  z-index: 997;
+  will-change: opacity;
+}
+
+/*
+    @license
+    Copyright (c) 2014 The Polymer Project Authors. All rights reserved.
+    This code may only be used under the BSD style license found at http://polymer.github.io/LICENSE.txt
+    The complete set of authors may be found at http://polymer.github.io/AUTHORS.txt
+    The complete set of contributors may be found at http://polymer.github.io/CONTRIBUTORS.txt
+    Code distributed by Google as part of the polymer project is also
+    subject to an additional IP rights grant found at http://polymer.github.io/PATENTS.txt
+ */
+/**************************/
+/* STYLES FOR THE SPINNER */
+/**************************/
+/*
+ * Constants:
+ *      STROKEWIDTH = 3px
+ *      ARCSIZE     = 270 degrees (amount of circle the arc takes up)
+ *      ARCTIME     = 1333ms (time it takes to expand and contract arc)
+ *      ARCSTARTROT = 216 degrees (how much the start location of the arc
+ *                                should rotate each time, 216 gives us a
+ *                                5 pointed star shape (it's 360/5 * 3).
+ *                                For a 7 pointed star, we might do
+ *                                360/7 * 3 = 154.286)
+ *      CONTAINERWIDTH = 28px
+ *      SHRINK_TIME = 400ms
+ */
+.preloader-wrapper {
+  display: inline-block;
+  position: relative;
+  width: 50px;
+  height: 50px;
+}
+
+.preloader-wrapper.small {
+  width: 36px;
+  height: 36px;
+}
+
+.preloader-wrapper.big {
+  width: 64px;
+  height: 64px;
+}
+
+.preloader-wrapper.active {
+  /* duration: 360 * ARCTIME / (ARCSTARTROT + (360-ARCSIZE)) */
+  -webkit-animation: container-rotate 1568ms linear infinite;
+  animation: container-rotate 1568ms linear infinite;
+}
+
+@-webkit-keyframes container-rotate {
+  to {
+    -webkit-transform: rotate(360deg);
+  }
+}
+
+@keyframes container-rotate {
+  to {
+    -webkit-transform: rotate(360deg);
+            transform: rotate(360deg);
+  }
+}
+
+.spinner-layer {
+  position: absolute;
+  width: 100%;
+  height: 100%;
+  opacity: 0;
+  border-color: #26a69a;
+}
+
+.spinner-blue,
+.spinner-blue-only {
+  border-color: #4285f4;
+}
+
+.spinner-red,
+.spinner-red-only {
+  border-color: #db4437;
+}
+
+.spinner-yellow,
+.spinner-yellow-only {
+  border-color: #f4b400;
+}
+
+.spinner-green,
+.spinner-green-only {
+  border-color: #0f9d58;
+}
+
+/**
+ * IMPORTANT NOTE ABOUT CSS ANIMATION PROPERTIES (keanulee):
+ *
+ * iOS Safari (tested on iOS 8.1) does not handle animation-delay very well - it doesn't
+ * guarantee that the animation will start _exactly_ after that value. So we avoid using
+ * animation-delay and instead set custom keyframes for each color (as redundant as it
+ * seems).
+ *
+ * We write out each animation in full (instead of separating animation-name,
+ * animation-duration, etc.) because under the polyfill, Safari does not recognize those
+ * specific properties properly, treats them as -webkit-animation, and overrides the
+ * other animation rules. See https://github.com/Polymer/platform/issues/53.
+ */
+.active .spinner-layer.spinner-blue {
+  /* durations: 4 * ARCTIME */
+  -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, blue-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+  animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, blue-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+}
+
+.active .spinner-layer.spinner-red {
+  /* durations: 4 * ARCTIME */
+  -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, red-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+  animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, red-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+}
+
+.active .spinner-layer.spinner-yellow {
+  /* durations: 4 * ARCTIME */
+  -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, yellow-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+  animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, yellow-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+}
+
+.active .spinner-layer.spinner-green {
+  /* durations: 4 * ARCTIME */
+  -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, green-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+  animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, green-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+}
+
+.active .spinner-layer,
+.active .spinner-layer.spinner-blue-only,
+.active .spinner-layer.spinner-red-only,
+.active .spinner-layer.spinner-yellow-only,
+.active .spinner-layer.spinner-green-only {
+  /* durations: 4 * ARCTIME */
+  opacity: 1;
+  -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+  animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+}
+
+@-webkit-keyframes fill-unfill-rotate {
+  12.5% {
+    -webkit-transform: rotate(135deg);
+  }
+  /* 0.5 * ARCSIZE */
+  25% {
+    -webkit-transform: rotate(270deg);
+  }
+  /* 1   * ARCSIZE */
+  37.5% {
+    -webkit-transform: rotate(405deg);
+  }
+  /* 1.5 * ARCSIZE */
+  50% {
+    -webkit-transform: rotate(540deg);
+  }
+  /* 2   * ARCSIZE */
+  62.5% {
+    -webkit-transform: rotate(675deg);
+  }
+  /* 2.5 * ARCSIZE */
+  75% {
+    -webkit-transform: rotate(810deg);
+  }
+  /* 3   * ARCSIZE */
+  87.5% {
+    -webkit-transform: rotate(945deg);
+  }
+  /* 3.5 * ARCSIZE */
+  to {
+    -webkit-transform: rotate(1080deg);
+  }
+  /* 4   * ARCSIZE */
+}
+
+@keyframes fill-unfill-rotate {
+  12.5% {
+    -webkit-transform: rotate(135deg);
+            transform: rotate(135deg);
+  }
+  /* 0.5 * ARCSIZE */
+  25% {
+    -webkit-transform: rotate(270deg);
+            transform: rotate(270deg);
+  }
+  /* 1   * ARCSIZE */
+  37.5% {
+    -webkit-transform: rotate(405deg);
+            transform: rotate(405deg);
+  }
+  /* 1.5 * ARCSIZE */
+  50% {
+    -webkit-transform: rotate(540deg);
+            transform: rotate(540deg);
+  }
+  /* 2   * ARCSIZE */
+  62.5% {
+    -webkit-transform: rotate(675deg);
+            transform: rotate(675deg);
+  }
+  /* 2.5 * ARCSIZE */
+  75% {
+    -webkit-transform: rotate(810deg);
+            transform: rotate(810deg);
+  }
+  /* 3   * ARCSIZE */
+  87.5% {
+    -webkit-transform: rotate(945deg);
+            transform: rotate(945deg);
+  }
+  /* 3.5 * ARCSIZE */
+  to {
+    -webkit-transform: rotate(1080deg);
+            transform: rotate(1080deg);
+  }
+  /* 4   * ARCSIZE */
+}
+
+@-webkit-keyframes blue-fade-in-out {
+  from {
+    opacity: 1;
+  }
+  25% {
+    opacity: 1;
+  }
+  26% {
+    opacity: 0;
+  }
+  89% {
+    opacity: 0;
+  }
+  90% {
+    opacity: 1;
+  }
+  100% {
+    opacity: 1;
+  }
+}
+
+@keyframes blue-fade-in-out {
+  from {
+    opacity: 1;
+  }
+  25% {
+    opacity: 1;
+  }
+  26% {
+    opacity: 0;
+  }
+  89% {
+    opacity: 0;
+  }
+  90% {
+    opacity: 1;
+  }
+  100% {
+    opacity: 1;
+  }
+}
+
+@-webkit-keyframes red-fade-in-out {
+  from {
+    opacity: 0;
+  }
+  15% {
+    opacity: 0;
+  }
+  25% {
+    opacity: 1;
+  }
+  50% {
+    opacity: 1;
+  }
+  51% {
+    opacity: 0;
+  }
+}
+
+@keyframes red-fade-in-out {
+  from {
+    opacity: 0;
+  }
+  15% {
+    opacity: 0;
+  }
+  25% {
+    opacity: 1;
+  }
+  50% {
+    opacity: 1;
+  }
+  51% {
+    opacity: 0;
+  }
+}
+
+@-webkit-keyframes yellow-fade-in-out {
+  from {
+    opacity: 0;
+  }
+  40% {
+    opacity: 0;
+  }
+  50% {
+    opacity: 1;
+  }
+  75% {
+    opacity: 1;
+  }
+  76% {
+    opacity: 0;
+  }
+}
+
+@keyframes yellow-fade-in-out {
+  from {
+    opacity: 0;
+  }
+  40% {
+    opacity: 0;
+  }
+  50% {
+    opacity: 1;
+  }
+  75% {
+    opacity: 1;
+  }
+  76% {
+    opacity: 0;
+  }
+}
+
+@-webkit-keyframes green-fade-in-out {
+  from {
+    opacity: 0;
+  }
+  65% {
+    opacity: 0;
+  }
+  75% {
+    opacity: 1;
+  }
+  90% {
+    opacity: 1;
+  }
+  100% {
+    opacity: 0;
+  }
+}
+
+@keyframes green-fade-in-out {
+  from {
+    opacity: 0;
+  }
+  65% {
+    opacity: 0;
+  }
+  75% {
+    opacity: 1;
+  }
+  90% {
+    opacity: 1;
+  }
+  100% {
+    opacity: 0;
+  }
+}
+
+/**
+ * Patch the gap that appear between the two adjacent div.circle-clipper while the
+ * spinner is rotating (appears on Chrome 38, Safari 7.1, and IE 11).
+ */
+.gap-patch {
+  position: absolute;
+  top: 0;
+  left: 45%;
+  width: 10%;
+  height: 100%;
+  overflow: hidden;
+  border-color: inherit;
+}
+
+.gap-patch .circle {
+  width: 1000%;
+  left: -450%;
+}
+
+.circle-clipper {
+  display: inline-block;
+  position: relative;
+  width: 50%;
+  height: 100%;
+  overflow: hidden;
+  border-color: inherit;
+}
+
+.circle-clipper .circle {
+  width: 200%;
+  height: 100%;
+  border-width: 3px;
+  /* STROKEWIDTH */
+  border-style: solid;
+  border-color: inherit;
+  border-bottom-color: transparent !important;
+  border-radius: 50%;
+  -webkit-animation: none;
+  animation: none;
+  position: absolute;
+  top: 0;
+  right: 0;
+  bottom: 0;
+}
+
+.circle-clipper.left .circle {
+  left: 0;
+  border-right-color: transparent !important;
+  -webkit-transform: rotate(129deg);
+  transform: rotate(129deg);
+}
+
+.circle-clipper.right .circle {
+  left: -100%;
+  border-left-color: transparent !important;
+  -webkit-transform: rotate(-129deg);
+  transform: rotate(-129deg);
+}
+
+.active .circle-clipper.left .circle {
+  /* duration: ARCTIME */
+  -webkit-animation: left-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+  animation: left-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+}
+
+.active .circle-clipper.right .circle {
+  /* duration: ARCTIME */
+  -webkit-animation: right-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+  animation: right-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+}
+
+@-webkit-keyframes left-spin {
+  from {
+    -webkit-transform: rotate(130deg);
+  }
+  50% {
+    -webkit-transform: rotate(-5deg);
+  }
+  to {
+    -webkit-transform: rotate(130deg);
+  }
+}
+
+@keyframes left-spin {
+  from {
+    -webkit-transform: rotate(130deg);
+            transform: rotate(130deg);
+  }
+  50% {
+    -webkit-transform: rotate(-5deg);
+            transform: rotate(-5deg);
+  }
+  to {
+    -webkit-transform: rotate(130deg);
+            transform: rotate(130deg);
+  }
+}
+
+@-webkit-keyframes right-spin {
+  from {
+    -webkit-transform: rotate(-130deg);
+  }
+  50% {
+    -webkit-transform: rotate(5deg);
+  }
+  to {
+    -webkit-transform: rotate(-130deg);
+  }
+}
+
+@keyframes right-spin {
+  from {
+    -webkit-transform: rotate(-130deg);
+            transform: rotate(-130deg);
+  }
+  50% {
+    -webkit-transform: rotate(5deg);
+            transform: rotate(5deg);
+  }
+  to {
+    -webkit-transform: rotate(-130deg);
+            transform: rotate(-130deg);
+  }
+}
+
+#spinnerContainer.cooldown {
+  /* duration: SHRINK_TIME */
+  -webkit-animation: container-rotate 1568ms linear infinite, fade-out 400ms cubic-bezier(0.4, 0, 0.2, 1);
+  animation: container-rotate 1568ms linear infinite, fade-out 400ms cubic-bezier(0.4, 0, 0.2, 1);
+}
+
+@-webkit-keyframes fade-out {
+  from {
+    opacity: 1;
+  }
+  to {
+    opacity: 0;
+  }
+}
+
+@keyframes fade-out {
+  from {
+    opacity: 1;
+  }
+  to {
+    opacity: 0;
+  }
+}
+
+.slider {
+  position: relative;
+  height: 400px;
+  width: 100%;
+}
+
+.slider.fullscreen {
+  height: 100%;
+  width: 100%;
+  position: absolute;
+  top: 0;
+  left: 0;
+  right: 0;
+  bottom: 0;
+}
+
+.slider.fullscreen ul.slides {
+  height: 100%;
+}
+
+.slider.fullscreen ul.indicators {
+  z-index: 2;
+  bottom: 30px;
+}
+
+.slider .slides {
+  background-color: #9e9e9e;
+  margin: 0;
+  height: 400px;
+}
+
+.slider .slides li {
+  opacity: 0;
+  position: absolute;
+  top: 0;
+  left: 0;
+  z-index: 1;
+  width: 100%;
+  height: inherit;
+  overflow: hidden;
+}
+
+.slider .slides li img {
+  height: 100%;
+  width: 100%;
+  background-size: cover;
+  background-position: center;
+}
+
+.slider .slides li .caption {
+  color: #fff;
+  position: absolute;
+  top: 15%;
+  left: 15%;
+  width: 70%;
+  opacity: 0;
+}
+
+.slider .slides li .caption p {
+  color: #e0e0e0;
+}
+
+.slider .slides li.active {
+  z-index: 2;
+}
+
+.slider .indicators {
+  position: absolute;
+  text-align: center;
+  left: 0;
+  right: 0;
+  bottom: 0;
+  margin: 0;
+}
+
+.slider .indicators .indicator-item {
+  display: inline-block;
+  position: relative;
+  cursor: pointer;
+  height: 16px;
+  width: 16px;
+  margin: 0 12px;
+  background-color: #e0e0e0;
+  -webkit-transition: background-color .3s;
+  transition: background-color .3s;
+  border-radius: 50%;
+}
+
+.slider .indicators .indicator-item.active {
+  background-color: #4CAF50;
+}
+
+.carousel {
+  overflow: hidden;
+  position: relative;
+  width: 100%;
+  height: 400px;
+  -webkit-perspective: 500px;
+          perspective: 500px;
+  -webkit-transform-style: preserve-3d;
+          transform-style: preserve-3d;
+  -webkit-transform-origin: 0% 50%;
+          transform-origin: 0% 50%;
+}
+
+.carousel.carousel-slider {
+  top: 0;
+  left: 0;
+}
+
+.carousel.carousel-slider .carousel-fixed-item {
+  position: absolute;
+  left: 0;
+  right: 0;
+  bottom: 20px;
+  z-index: 1;
+}
+
+.carousel.carousel-slider .carousel-fixed-item.with-indicators {
+  bottom: 68px;
+}
+
+.carousel.carousel-slider .carousel-item {
+  width: 100%;
+  height: 100%;
+  min-height: 400px;
+  position: absolute;
+  top: 0;
+  left: 0;
+}
+
+.carousel.carousel-slider .carousel-item h2 {
+  font-size: 24px;
+  font-weight: 500;
+  line-height: 32px;
+}
+
+.carousel.carousel-slider .carousel-item p {
+  font-size: 15px;
+}
+
+.carousel .carousel-item {
+  display: none;
+  width: 200px;
+  height: 200px;
+  position: absolute;
+  top: 0;
+  left: 0;
+}
+
+.carousel .carousel-item > img {
+  width: 100%;
+}
+
+.carousel .indicators {
+  position: absolute;
+  text-align: center;
+  left: 0;
+  right: 0;
+  bottom: 0;
+  margin: 0;
+}
+
+.carousel .indicators .indicator-item {
+  display: inline-block;
+  position: relative;
+  cursor: pointer;
+  height: 8px;
+  width: 8px;
+  margin: 24px 4px;
+  background-color: rgba(255, 255, 255, 0.5);
+  -webkit-transition: background-color .3s;
+  transition: background-color .3s;
+  border-radius: 50%;
+}
+
+.carousel .indicators .indicator-item.active {
+  background-color: #fff;
+}
+
+.carousel.scrolling .carousel-item .materialboxed,
+.carousel .carousel-item:not(.active) .materialboxed {
+  pointer-events: none;
+}
+
+.tap-target-wrapper {
+  width: 800px;
+  height: 800px;
+  position: fixed;
+  z-index: 1000;
+  visibility: hidden;
+  -webkit-transition: visibility 0s .3s;
+  transition: visibility 0s .3s;
+}
+
+.tap-target-wrapper.open {
+  visibility: visible;
+  -webkit-transition: visibility 0s;
+  transition: visibility 0s;
+}
+
+.tap-target-wrapper.open .tap-target {
+  -webkit-transform: scale(1);
+          transform: scale(1);
+  opacity: .95;
+  -webkit-transition: opacity 0.3s cubic-bezier(0.42, 0, 0.58, 1), -webkit-transform 0.3s cubic-bezier(0.42, 0, 0.58, 1);
+  transition: opacity 0.3s cubic-bezier(0.42, 0, 0.58, 1), -webkit-transform 0.3s cubic-bezier(0.42, 0, 0.58, 1);
+  transition: transform 0.3s cubic-bezier(0.42, 0, 0.58, 1), opacity 0.3s cubic-bezier(0.42, 0, 0.58, 1);
+  transition: transform 0.3s cubic-bezier(0.42, 0, 0.58, 1), opacity 0.3s cubic-bezier(0.42, 0, 0.58, 1), -webkit-transform 0.3s cubic-bezier(0.42, 0, 0.58, 1);
+}
+
+.tap-target-wrapper.open .tap-target-wave::before {
+  -webkit-transform: scale(1);
+          transform: scale(1);
+}
+
+.tap-target-wrapper.open .tap-target-wave::after {
+  visibility: visible;
+  -webkit-animation: pulse-animation 1s cubic-bezier(0.24, 0, 0.38, 1) infinite;
+          animation: pulse-animation 1s cubic-bezier(0.24, 0, 0.38, 1) infinite;
+  -webkit-transition: opacity .3s,
+ visibility 0s 1s,
+ -webkit-transform .3s;
+  transition: opacity .3s,
+ visibility 0s 1s,
+ -webkit-transform .3s;
+  transition: opacity .3s,
+ transform .3s,
+ visibility 0s 1s;
+  transition: opacity .3s,
+ transform .3s,
+ visibility 0s 1s,
+ -webkit-transform .3s;
+}
+
+.tap-target {
+  position: absolute;
+  font-size: 1rem;
+  border-radius: 50%;
+  background-color: #ee6e73;
+  -webkit-box-shadow: 0 20px 20px 0 rgba(0, 0, 0, 0.14), 0 10px 50px 0 rgba(0, 0, 0, 0.12), 0 30px 10px -20px rgba(0, 0, 0, 0.2);
+          box-shadow: 0 20px 20px 0 rgba(0, 0, 0, 0.14), 0 10px 50px 0 rgba(0, 0, 0, 0.12), 0 30px 10px -20px rgba(0, 0, 0, 0.2);
+  width: 100%;
+  height: 100%;
+  opacity: 0;
+  -webkit-transform: scale(0);
+          transform: scale(0);
+  -webkit-transition: opacity 0.3s cubic-bezier(0.42, 0, 0.58, 1), -webkit-transform 0.3s cubic-bezier(0.42, 0, 0.58, 1);
+  transition: opacity 0.3s cubic-bezier(0.42, 0, 0.58, 1), -webkit-transform 0.3s cubic-bezier(0.42, 0, 0.58, 1);
+  transition: transform 0.3s cubic-bezier(0.42, 0, 0.58, 1), opacity 0.3s cubic-bezier(0.42, 0, 0.58, 1);
+  transition: transform 0.3s cubic-bezier(0.42, 0, 0.58, 1), opacity 0.3s cubic-bezier(0.42, 0, 0.58, 1), -webkit-transform 0.3s cubic-bezier(0.42, 0, 0.58, 1);
+}
+
+.tap-target-content {
+  position: relative;
+  display: table-cell;
+}
+
+.tap-target-wave {
+  position: absolute;
+  border-radius: 50%;
+  z-index: 10001;
+}
+
+.tap-target-wave::before, .tap-target-wave::after {
+  content: '';
+  display: block;
+  position: absolute;
+  width: 100%;
+  height: 100%;
+  border-radius: 50%;
+  background-color: #ffffff;
+}
+
+.tap-target-wave::before {
+  -webkit-transform: scale(0);
+          transform: scale(0);
+  -webkit-transition: -webkit-transform .3s;
+  transition: -webkit-transform .3s;
+  transition: transform .3s;
+  transition: transform .3s, -webkit-transform .3s;
+}
+
+.tap-target-wave::after {
+  visibility: hidden;
+  -webkit-transition: opacity .3s,
+ visibility 0s,
+ -webkit-transform .3s;
+  transition: opacity .3s,
+ visibility 0s,
+ -webkit-transform .3s;
+  transition: opacity .3s,
+ transform .3s,
+ visibility 0s;
+  transition: opacity .3s,
+ transform .3s,
+ visibility 0s,
+ -webkit-transform .3s;
+  z-index: -1;
+}
+
+.tap-target-origin {
+  top: 50%;
+  left: 50%;
+  -webkit-transform: translate(-50%, -50%);
+          transform: translate(-50%, -50%);
+  z-index: 10002;
+  position: absolute !important;
+}
+
+.tap-target-origin:not(.btn):not(.btn-large), .tap-target-origin:not(.btn):not(.btn-large):hover {
+  background: none;
+}
+
+@media only screen and (max-width: 600px) {
+  .tap-target, .tap-target-wrapper {
+    width: 600px;
+    height: 600px;
+  }
+}
+
+.pulse {
+  overflow: initial;
+  position: relative;
+}
+
+.pulse::before {
+  content: '';
+  display: block;
+  position: absolute;
+  width: 100%;
+  height: 100%;
+  top: 0;
+  left: 0;
+  background-color: inherit;
+  border-radius: inherit;
+  -webkit-transition: opacity .3s, -webkit-transform .3s;
+  transition: opacity .3s, -webkit-transform .3s;
+  transition: opacity .3s, transform .3s;
+  transition: opacity .3s, transform .3s, -webkit-transform .3s;
+  -webkit-animation: pulse-animation 1s cubic-bezier(0.24, 0, 0.38, 1) infinite;
+          animation: pulse-animation 1s cubic-bezier(0.24, 0, 0.38, 1) infinite;
+  z-index: -1;
+}
+
+@-webkit-keyframes pulse-animation {
+  0% {
+    opacity: 1;
+    -webkit-transform: scale(1);
+            transform: scale(1);
+  }
+  50% {
+    opacity: 0;
+    -webkit-transform: scale(1.5);
+            transform: scale(1.5);
+  }
+  100% {
+    opacity: 0;
+    -webkit-transform: scale(1.5);
+            transform: scale(1.5);
+  }
+}
+
+@keyframes pulse-animation {
+  0% {
+    opacity: 1;
+    -webkit-transform: scale(1);
+            transform: scale(1);
+  }
+  50% {
+    opacity: 0;
+    -webkit-transform: scale(1.5);
+            transform: scale(1.5);
+  }
+  100% {
+    opacity: 0;
+    -webkit-transform: scale(1.5);
+            transform: scale(1.5);
+  }
+}
+
+/* ==========================================================================
+   $BASE-PICKER
+   ========================================================================== */
+/**
+ * Note: the root picker element should *NOT* be styled more than what's here.
+ */
+.picker {
+  font-size: 16px;
+  text-align: left;
+  line-height: 1.2;
+  color: #000000;
+  position: absolute;
+  z-index: 10000;
+  -webkit-user-select: none;
+  -moz-user-select: none;
+  -ms-user-select: none;
+  user-select: none;
+  outline: none;
+}
+
+/**
+ * The picker input element.
+ */
+.picker__input {
+  cursor: default;
+}
+
+/**
+ * When the picker is opened, the input element is "activated".
+ */
+.picker__input.picker__input--active {
+  border-color: #0089ec;
+}
+
+/**
+ * The holder is the only "scrollable" top-level container element.
+ */
+.picker__holder {
+  width: 100%;
+  overflow-y: auto;
+  -webkit-overflow-scrolling: touch;
+}
+
+/*!
+ * Default mobile-first, responsive styling for pickadate.js
+ * Demo: http://amsul.github.io/pickadate.js
+ */
+/**
+ * Note: the root picker element should *NOT* be styled more than what's here.
+ */
+/**
+ * Make the holder and frame fullscreen.
+ */
+.picker__holder,
+.picker__frame {
+  bottom: 0;
+  left: 0;
+  right: 0;
+  top: 100%;
+}
+
+/**
+ * The holder should overlay the entire screen.
+ */
+.picker__holder {
+  position: fixed;
+  -webkit-transition: background 0.15s ease-out, top 0s 0.15s;
+  transition: background 0.15s ease-out, top 0s 0.15s;
+  -webkit-backface-visibility: hidden;
+}
+
+/**
+ * The frame that bounds the box contents of the picker.
+ */
+.picker__frame {
+  position: absolute;
+  margin: 0 auto;
+  min-width: 256px;
+  width: 300px;
+  max-height: 350px;
+  -ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=0)";
+  filter: alpha(opacity=0);
+  -moz-opacity: 0;
+  opacity: 0;
+  -webkit-transition: all 0.15s ease-out;
+  transition: all 0.15s ease-out;
+}
+
+@media (min-height: 28.875em) {
+  .picker__frame {
+    overflow: visible;
+    top: auto;
+    bottom: -100%;
+    max-height: 80%;
+  }
+}
+
+@media (min-height: 40.125em) {
+  .picker__frame {
+    margin-bottom: 7.5%;
+  }
+}
+
+/**
+ * The wrapper sets the stage to vertically align the box contents.
+ */
+.picker__wrap {
+  display: table;
+  width: 100%;
+  height: 100%;
+}
+
+@media (min-height: 28.875em) {
+  .picker__wrap {
+    display: block;
+  }
+}
+
+/**
+ * The box contains all the picker contents.
+ */
+.picker__box {
+  background: #ffffff;
+  display: table-cell;
+  vertical-align: middle;
+}
+
+@media (min-height: 28.875em) {
+  .picker__box {
+    display: block;
+    border: 1px solid #777777;
+    border-top-color: #898989;
+    border-bottom-width: 0;
+    border-radius: 5px 5px 0 0;
+    -webkit-box-shadow: 0 12px 36px 16px rgba(0, 0, 0, 0.24);
+    box-shadow: 0 12px 36px 16px rgba(0, 0, 0, 0.24);
+  }
+}
+
+/**
+ * When the picker opens...
+ */
+.picker--opened .picker__holder {
+  top: 0;
+  background: transparent;
+  -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorstr=#1E000000,endColorstr=#1E000000)";
+  zoom: 1;
+  background: rgba(0, 0, 0, 0.32);
+  -webkit-transition: background 0.15s ease-out;
+  transition: background 0.15s ease-out;
+}
+
+.picker--opened .picker__frame {
+  top: 0;
+  -ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=100)";
+  filter: alpha(opacity=100);
+  -moz-opacity: 1;
+  opacity: 1;
+}
+
+@media (min-height: 35.875em) {
+  .picker--opened .picker__frame {
+    top: 10%;
+    bottom: auto;
+  }
+}
+
+/**
+ * For `large` screens, transform into an inline picker.
+ */
+/* ==========================================================================
+   CUSTOM MATERIALIZE STYLES
+   ========================================================================== */
+.picker__input.picker__input--active {
+  border-color: #E3F2FD;
+}
+
+.picker__frame {
+  margin: 0 auto;
+  max-width: 325px;
+}
+
+@media (min-height: 38.875em) {
+  .picker--opened .picker__frame {
+    top: 10%;
+    bottom: auto;
+  }
+}
+
+@media only screen and (min-width: 601px) {
+  .picker__box {
+    display: -webkit-box;
+    display: -webkit-flex;
+    display: -ms-flexbox;
+    display: flex;
+  }
+  .picker__frame {
+    width: 80%;
+    max-width: 600px;
+  }
+}
+
+/* ==========================================================================
+   $BASE-DATE-PICKER
+   ========================================================================== */
+/**
+ * The picker box.
+ */
+.picker__box {
+  padding: 0;
+  border-radius: 2px;
+  overflow: hidden;
+}
+
+/**
+ * The header containing the month and year stuff.
+ */
+.picker__header {
+  text-align: center;
+  position: relative;
+  margin-top: .75em;
+}
+
+/**
+ * The month and year labels.
+ */
+.picker__month,
+.picker__year {
+  display: inline-block;
+  margin-left: .25em;
+  margin-right: .25em;
+}
+
+/**
+ * The month and year selectors.
+ */
+.picker__select--month,
+.picker__select--year {
+  height: 2em;
+  padding: 0;
+  margin-left: .25em;
+  margin-right: .25em;
+}
+
+.picker__select--month.browser-default {
+  display: inline;
+  background-color: #FFFFFF;
+  width: 40%;
+}
+
+.picker__select--year.browser-default {
+  display: inline;
+  background-color: #FFFFFF;
+  width: 26%;
+}
+
+.picker__select--month:focus,
+.picker__select--year:focus {
+  border-color: rgba(0, 0, 0, 0.05);
+}
+
+/**
+ * The month navigation buttons.
+ */
+.picker__nav--prev,
+.picker__nav--next {
+  position: absolute;
+  padding: .5em 1.25em;
+  width: 1em;
+  height: 1em;
+  -webkit-box-sizing: content-box;
+          box-sizing: content-box;
+  top: -0.25em;
+}
+
+.picker__nav--prev {
+  left: -1em;
+  padding-right: 1.25em;
+}
+
+.picker__nav--next {
+  right: -1em;
+  padding-left: 1.25em;
+}
+
+.picker__nav--disabled,
+.picker__nav--disabled:hover,
+.picker__nav--disabled:before,
+.picker__nav--disabled:before:hover {
+  cursor: default;
+  background: none;
+  border-right-color: #f5f5f5;
+  border-left-color: #f5f5f5;
+}
+
+/**
+ * The calendar table of dates
+ */
+.picker__table {
+  text-align: center;
+  border-collapse: collapse;
+  border-spacing: 0;
+  table-layout: fixed;
+  font-size: 1rem;
+  width: 100%;
+  margin-top: .75em;
+  margin-bottom: .5em;
+}
+
+.picker__table th, .picker__table td {
+  text-align: center;
+}
+
+.picker__table td {
+  margin: 0;
+  padding: 0;
+}
+
+/**
+ * The weekday labels
+ */
+.picker__weekday {
+  width: 14.285714286%;
+  font-size: .75em;
+  padding-bottom: .25em;
+  color: #999999;
+  font-weight: 500;
+  /* Increase the spacing a tad */
+}
+
+@media (min-height: 33.875em) {
+  .picker__weekday {
+    padding-bottom: .5em;
+  }
+}
+
+/**
+ * The days on the calendar
+ */
+.picker__day--today {
+  position: relative;
+  color: #595959;
+  letter-spacing: -.3;
+  padding: .75rem 0;
+  font-weight: 400;
+  border: 1px solid transparent;
+}
+
+.picker__day--disabled:before {
+  border-top-color: #aaaaaa;
+}
+
+.picker__day--infocus:hover {
+  cursor: pointer;
+  color: #000;
+  font-weight: 500;
+}
+
+.picker__day--outfocus {
+  display: none;
+  padding: .75rem 0;
+  color: #fff;
+}
+
+.picker__day--outfocus:hover {
+  cursor: pointer;
+  color: #dddddd;
+  font-weight: 500;
+}
+
+.picker__day--highlighted:hover,
+.picker--focused .picker__day--highlighted {
+  cursor: pointer;
+}
+
+.picker__day--selected,
+.picker__day--selected:hover,
+.picker--focused .picker__day--selected {
+  border-radius: 50%;
+  -webkit-transform: scale(0.75);
+          transform: scale(0.75);
+  background: #0089ec;
+  color: #ffffff;
+}
+
+.picker__day--disabled,
+.picker__day--disabled:hover,
+.picker--focused .picker__day--disabled {
+  background: #f5f5f5;
+  border-color: #f5f5f5;
+  color: #dddddd;
+  cursor: default;
+}
+
+.picker__day--highlighted.picker__day--disabled,
+.picker__day--highlighted.picker__day--disabled:hover {
+  background: #bbbbbb;
+}
+
+/**
+ * The footer containing the "today", "clear", and "close" buttons.
+ */
+.picker__footer {
+  text-align: right;
+}
+
+.picker__button--today,
+.picker__button--clear,
+.picker__button--close {
+  border: 1px solid #ffffff;
+  background: #ffffff;
+  font-size: .8em;
+  padding: .66em 0;
+  font-weight: bold;
+  width: 33%;
+  display: inline-block;
+  vertical-align: bottom;
+}
+
+.picker__button--today:hover,
+.picker__button--clear:hover,
+.picker__button--close:hover {
+  cursor: pointer;
+  color: #000000;
+  background: #b1dcfb;
+  border-bottom-color: #b1dcfb;
+}
+
+.picker__button--today:focus,
+.picker__button--clear:focus,
+.picker__button--close:focus {
+  background: #b1dcfb;
+  border-color: rgba(0, 0, 0, 0.05);
+  outline: none;
+}
+
+.picker__button--today:before,
+.picker__button--clear:before,
+.picker__button--close:before {
+  position: relative;
+  display: inline-block;
+  height: 0;
+}
+
+.picker__button--today:before,
+.picker__button--clear:before {
+  content: " ";
+  margin-right: .45em;
+}
+
+.picker__button--today:before {
+  top: -0.05em;
+  width: 0;
+  border-top: 0.66em solid #0059bc;
+  border-left: .66em solid transparent;
+}
+
+.picker__button--clear:before {
+  top: -0.25em;
+  width: .66em;
+  border-top: 3px solid #ee2200;
+}
+
+.picker__button--close:before {
+  content: "\D7";
+  top: -0.1em;
+  vertical-align: top;
+  font-size: 1.1em;
+  margin-right: .35em;
+  color: #777777;
+}
+
+.picker__button--today[disabled],
+.picker__button--today[disabled]:hover {
+  background: #f5f5f5;
+  border-color: #f5f5f5;
+  color: #dddddd;
+  cursor: default;
+}
+
+.picker__button--today[disabled]:before {
+  border-top-color: #aaaaaa;
+}
+
+/* ==========================================================================
+   CUSTOM MATERIALIZE STYLES
+   ========================================================================== */
+/*.picker__box {
+  border-radius: 2px;
+  overflow: hidden;
+}*/
+.picker__date-display {
+  text-align: left;
+  background-color: #26a69a;
+  color: #fff;
+  padding: 18px;
+  font-weight: 300;
+}
+
+@media only screen and (min-width: 601px) {
+  .picker__date-display {
+    -webkit-box-flex: 1;
+    -webkit-flex: 1;
+        -ms-flex: 1;
+            flex: 1;
+  }
+  .picker__weekday-display {
+    display: block;
+  }
+  .picker__container__wrapper {
+    -webkit-box-flex: 2;
+    -webkit-flex: 2;
+        -ms-flex: 2;
+            flex: 2;
+  }
+}
+
+.picker__nav--prev:hover,
+.picker__nav--next:hover {
+  cursor: pointer;
+  color: #000000;
+  background: #a1ded8;
+}
+
+.picker__weekday-display {
+  font-weight: 500;
+  font-size: 2.8rem;
+  margin-right: 5px;
+  margin-top: 4px;
+}
+
+.picker__month-display {
+  font-size: 2.8rem;
+  font-weight: 500;
+}
+
+.picker__day-display {
+  font-size: 2.8rem;
+  font-weight: 500;
+  margin-right: 5px;
+}
+
+.picker__year-display {
+  font-size: 1.5rem;
+  font-weight: 500;
+  color: rgba(255, 255, 255, 0.7);
+}
+
+/*.picker__box {
+  padding: 0;
+}*/
+.picker__calendar-container {
+  padding: 0 1rem;
+}
+
+.picker__calendar-container thead {
+  border: none;
+}
+
+.picker__table {
+  margin-top: 0;
+  margin-bottom: .5em;
+}
+
+.picker__day--infocus {
+  color: rgba(0, 0, 0, 0.87);
+  letter-spacing: -.3px;
+  padding: 0.75rem 0;
+  font-weight: 400;
+  border: 1px solid transparent;
+}
+
+@media only screen and (min-width: 601px) {
+  .picker__day--infocus {
+    padding: 1.1rem 0;
+  }
+}
+
+.picker__day.picker__day--today {
+  color: #26a69a;
+}
+
+.picker__day.picker__day--today.picker__day--selected {
+  color: #fff;
+}
+
+.picker__weekday {
+  font-size: .9rem;
+}
+
+.picker__day--selected,
+.picker__day--selected:hover,
+.picker--focused .picker__day--selected {
+  border-radius: 50%;
+  -webkit-transform: scale(0.9);
+          transform: scale(0.9);
+  background-color: #26a69a;
+  color: #ffffff;
+}
+
+.picker__day--selected.picker__day--outfocus,
+.picker__day--selected:hover.picker__day--outfocus,
+.picker--focused .picker__day--selected.picker__day--outfocus {
+  background-color: #a1ded8;
+}
+
+.picker__footer {
+  text-align: right;
+  padding: 5px 10px;
+}
+
+.picker__close, .picker__today, .picker__clear {
+  font-size: 1.1rem;
+  padding: 0 1rem;
+  color: #26a69a;
+}
+
+.picker__clear {
+  color: #f44336;
+  float: left;
+}
+
+.picker__nav--prev:before,
+.picker__nav--next:before {
+  content: " ";
+  border-top: .5em solid transparent;
+  border-bottom: .5em solid transparent;
+  border-right: 0.75em solid #676767;
+  width: 0;
+  height: 0;
+  display: block;
+  margin: 0 auto;
+}
+
+.picker__nav--next:before {
+  border-right: 0;
+  border-left: 0.75em solid #676767;
+}
+
+button.picker__today:focus, button.picker__clear:focus, button.picker__close:focus {
+  background-color: #a1ded8;
+}
+
+/* ==========================================================================
+   $BASE-TIME-PICKER
+   ========================================================================== */
+/**
+ * The list of times.
+ */
+.picker__list {
+  list-style: none;
+  padding: 0.75em 0 4.2em;
+  margin: 0;
+}
+
+/**
+ * The times on the clock.
+ */
+.picker__list-item {
+  border-bottom: 1px solid #ddd;
+  border-top: 1px solid #ddd;
+  margin-bottom: -1px;
+  position: relative;
+  background: #fff;
+  padding: .75em 1.25em;
+}
+
+@media (min-height: 46.75em) {
+  .picker__list-item {
+    padding: .5em 1em;
+  }
+}
+
+/* Hovered time */
+.picker__list-item:hover {
+  cursor: pointer;
+  color: #000;
+  background: #b1dcfb;
+  border-color: #0089ec;
+  z-index: 10;
+}
+
+/* Highlighted and hovered/focused time */
+.picker__list-item--highlighted {
+  border-color: #0089ec;
+  z-index: 10;
+}
+
+.picker__list-item--highlighted:hover,
+.picker--focused .picker__list-item--highlighted {
+  cursor: pointer;
+  color: #000;
+  background: #b1dcfb;
+}
+
+/* Selected and hovered/focused time */
+.picker__list-item--selected,
+.picker__list-item--selected:hover,
+.picker--focused .picker__list-item--selected {
+  background: #0089ec;
+  color: #fff;
+  z-index: 10;
+}
+
+/* Disabled time */
+.picker__list-item--disabled,
+.picker__list-item--disabled:hover,
+.picker--focused .picker__list-item--disabled {
+  background: #f5f5f5;
+  border-color: #f5f5f5;
+  color: #ddd;
+  cursor: default;
+  border-color: #ddd;
+  z-index: auto;
+}
+
+/**
+ * The clear button
+ */
+.picker--time .picker__button--clear {
+  display: block;
+  width: 80%;
+  margin: 1em auto 0;
+  padding: 1em 1.25em;
+  background: none;
+  border: 0;
+  font-weight: 500;
+  font-size: .67em;
+  text-align: center;
+  text-transform: uppercase;
+  color: rgba(0, 0, 0, 0.87);
+}
+
+.picker--time .picker__button--clear:hover,
+.picker--time .picker__button--clear:focus {
+  color: #000;
+  background: #b1dcfb;
+  background: #ee2200;
+  border-color: #ee2200;
+  cursor: pointer;
+  color: #fff;
+  outline: none;
+}
+
+.picker--time .picker__button--clear:before {
+  top: -0.25em;
+  color: rgba(0, 0, 0, 0.87);
+  font-size: 1.25em;
+  font-weight: bold;
+}
+
+.picker--time .picker__button--clear:hover:before,
+.picker--time .picker__button--clear:focus:before {
+  color: #fff;
+}
+
+/* ==========================================================================
+   $DEFAULT-TIME-PICKER
+   ========================================================================== */
+/**
+ * The frame the bounds the time picker.
+ */
+.picker--time .picker__frame {
+  min-width: 256px;
+  max-width: 320px;
+}
+
+/**
+ * The picker box.
+ */
+.picker--time .picker__box {
+  font-size: 1em;
+  background: #f2f2f2;
+  padding: 0;
+}
+
+@media (min-height: 40.125em) {
+  .picker--time .picker__box {
+    margin-bottom: 5em;
+  }
+}
+
+/* ==========================================================================
+   $DEFAULT-TIME-PICKER
+   ========================================================================== */
+.clockpicker-display {
+  font-size: 4rem;
+  font-weight: bold;
+  text-align: center;
+  color: rgba(255, 255, 255, 0.6);
+  font-weight: 400;
+  clear: both;
+  position: relative;
+}
+
+.clockpicker-span-am-pm {
+  font-size: 1.3rem;
+  position: absolute;
+  right: 1rem;
+  bottom: 0.3rem;
+  line-height: 2rem;
+  font-weight: 500;
+}
+
+@media only screen and (min-width: 601px) {
+  .clockpicker-display {
+    top: 32%;
+  }
+  .clockpicker-span-am-pm {
+    position: relative;
+    right: auto;
+    bottom: auto;
+    text-align: center;
+    margin-top: 1.2rem;
+  }
+}
+
+.text-primary {
+  color: white;
+}
+
+.clockpicker-span-hours {
+  margin-right: 3px;
+}
+
+.clockpicker-span-minutes {
+  margin-left: 3px;
+}
+
+.clockpicker-span-hours,
+.clockpicker-span-minutes,
+.clockpicker-span-am-pm div {
+  cursor: pointer;
+}
+
+.clockpicker-moving {
+  cursor: move;
+}
+
+.clockpicker-plate {
+  background-color: #eee;
+  border-radius: 50%;
+  width: 270px;
+  height: 270px;
+  overflow: visible;
+  position: relative;
+  margin: auto;
+  margin-top: 25px;
+  margin-bottom: 5px;
+  -webkit-user-select: none;
+     -moz-user-select: none;
+      -ms-user-select: none;
+          user-select: none;
+}
+
+.clockpicker-canvas,
+.clockpicker-dial {
+  width: 270px;
+  height: 270px;
+  position: absolute;
+  left: -1px;
+  top: -1px;
+}
+
+.clockpicker-minutes {
+  visibility: hidden;
+}
+
+.clockpicker-tick {
+  border-radius: 50%;
+  color: rgba(0, 0, 0, 0.87);
+  line-height: 40px;
+  text-align: center;
+  width: 40px;
+  height: 40px;
+  position: absolute;
+  cursor: pointer;
+}
+
+.clockpicker-tick.active,
+.clockpicker-tick:hover {
+  background-color: rgba(38, 166, 154, 0.25);
+}
+
+.clockpicker-dial {
+  -webkit-transition: -webkit-transform 350ms, opacity 350ms;
+  -webkit-transition: opacity 350ms, -webkit-transform 350ms;
+  transition: opacity 350ms, -webkit-transform 350ms;
+  transition: transform 350ms, opacity 350ms;
+  transition: transform 350ms, opacity 350ms, -webkit-transform 350ms;
+}
+
+.clockpicker-dial-out {
+  opacity: 0;
+}
+
+.clockpicker-hours.clockpicker-dial-out {
+  -webkit-transform: scale(1.2, 1.2);
+  transform: scale(1.2, 1.2);
+}
+
+.clockpicker-minutes.clockpicker-dial-out {
+  -webkit-transform: scale(0.8, 0.8);
+  transform: scale(0.8, 0.8);
+}
+
+.clockpicker-canvas {
+  -webkit-transition: opacity 175ms;
+  transition: opacity 175ms;
+}
+
+.clockpicker-canvas-out {
+  opacity: 0.25;
+}
+
+.clockpicker-canvas-bearing {
+  stroke: none;
+  fill: #26a69a;
+}
+
+.clockpicker-canvas-bg {
+  stroke: none;
+  fill: #26a69a;
+}
+
+.clockpicker-canvas-bg-trans {
+  fill: #26a69a;
+}
+
+.clockpicker-canvas line {
+  stroke: #26a69a;
+  stroke-width: 4;
+  stroke-linecap: round;
+  /*shape-rendering: crispEdges;*/
+}

La diferencia del archivo ha sido suprimido porque es demasiado grande
+ 5 - 0
dist/static/materialize/css/materialize.min.css


La diferencia del archivo ha sido suprimido porque es demasiado grande
+ 1 - 0
dist/static/materialize/jquery-2.1.3.min.js


+ 10021 - 0
dist/static/materialize/js/materialize.js

@@ -0,0 +1,10021 @@
+/*!
+ * Materialize v0.100.2 (http://materializecss.com)
+ * Copyright 2014-2017 Materialize
+ * MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE)
+ */
+var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }();
+
+function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } }
+
+// Check for jQuery.
+if (typeof jQuery === 'undefined') {
+  // Check if require is a defined function.
+  if (typeof require === 'function') {
+    jQuery = $ = require('jquery');
+    // Else use the dollar sign alias.
+  } else {
+    jQuery = $;
+  }
+}
+; /*
+  * jQuery Easing v1.4.0 - http://gsgd.co.uk/sandbox/jquery/easing/
+  * Open source under the BSD License.
+  * Copyright © 2008 George McGinley Smith
+  * All rights reserved.
+  * https://raw.github.com/gdsmith/jquery-easing/master/LICENSE
+  */
+
+(function (factory) {
+  if (typeof define === "function" && define.amd) {
+    define(['jquery'], function ($) {
+      return factory($);
+    });
+  } else if (typeof module === "object" && typeof module.exports === "object") {
+    exports = factory(require('jquery'));
+  } else {
+    factory(jQuery);
+  }
+})(function ($) {
+
+  // Preserve the original jQuery "swing" easing as "jswing"
+  $.easing['jswing'] = $.easing['swing'];
+
+  var pow = Math.pow,
+      sqrt = Math.sqrt,
+      sin = Math.sin,
+      cos = Math.cos,
+      PI = Math.PI,
+      c1 = 1.70158,
+      c2 = c1 * 1.525,
+      c3 = c1 + 1,
+      c4 = 2 * PI / 3,
+      c5 = 2 * PI / 4.5;
+
+  // x is the fraction of animation progress, in the range 0..1
+  function bounceOut(x) {
+    var n1 = 7.5625,
+        d1 = 2.75;
+    if (x < 1 / d1) {
+      return n1 * x * x;
+    } else if (x < 2 / d1) {
+      return n1 * (x -= 1.5 / d1) * x + .75;
+    } else if (x < 2.5 / d1) {
+      return n1 * (x -= 2.25 / d1) * x + .9375;
+    } else {
+      return n1 * (x -= 2.625 / d1) * x + .984375;
+    }
+  }
+
+  $.extend($.easing, {
+    def: 'easeOutQuad',
+    swing: function (x) {
+      return $.easing[$.easing.def](x);
+    },
+    easeInQuad: function (x) {
+      return x * x;
+    },
+    easeOutQuad: function (x) {
+      return 1 - (1 - x) * (1 - x);
+    },
+    easeInOutQuad: function (x) {
+      return x < 0.5 ? 2 * x * x : 1 - pow(-2 * x + 2, 2) / 2;
+    },
+    easeInCubic: function (x) {
+      return x * x * x;
+    },
+    easeOutCubic: function (x) {
+      return 1 - pow(1 - x, 3);
+    },
+    easeInOutCubic: function (x) {
+      return x < 0.5 ? 4 * x * x * x : 1 - pow(-2 * x + 2, 3) / 2;
+    },
+    easeInQuart: function (x) {
+      return x * x * x * x;
+    },
+    easeOutQuart: function (x) {
+      return 1 - pow(1 - x, 4);
+    },
+    easeInOutQuart: function (x) {
+      return x < 0.5 ? 8 * x * x * x * x : 1 - pow(-2 * x + 2, 4) / 2;
+    },
+    easeInQuint: function (x) {
+      return x * x * x * x * x;
+    },
+    easeOutQuint: function (x) {
+      return 1 - pow(1 - x, 5);
+    },
+    easeInOutQuint: function (x) {
+      return x < 0.5 ? 16 * x * x * x * x * x : 1 - pow(-2 * x + 2, 5) / 2;
+    },
+    easeInSine: function (x) {
+      return 1 - cos(x * PI / 2);
+    },
+    easeOutSine: function (x) {
+      return sin(x * PI / 2);
+    },
+    easeInOutSine: function (x) {
+      return -(cos(PI * x) - 1) / 2;
+    },
+    easeInExpo: function (x) {
+      return x === 0 ? 0 : pow(2, 10 * x - 10);
+    },
+    easeOutExpo: function (x) {
+      return x === 1 ? 1 : 1 - pow(2, -10 * x);
+    },
+    easeInOutExpo: function (x) {
+      return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ? pow(2, 20 * x - 10) / 2 : (2 - pow(2, -20 * x + 10)) / 2;
+    },
+    easeInCirc: function (x) {
+      return 1 - sqrt(1 - pow(x, 2));
+    },
+    easeOutCirc: function (x) {
+      return sqrt(1 - pow(x - 1, 2));
+    },
+    easeInOutCirc: function (x) {
+      return x < 0.5 ? (1 - sqrt(1 - pow(2 * x, 2))) / 2 : (sqrt(1 - pow(-2 * x + 2, 2)) + 1) / 2;
+    },
+    easeInElastic: function (x) {
+      return x === 0 ? 0 : x === 1 ? 1 : -pow(2, 10 * x - 10) * sin((x * 10 - 10.75) * c4);
+    },
+    easeOutElastic: function (x) {
+      return x === 0 ? 0 : x === 1 ? 1 : pow(2, -10 * x) * sin((x * 10 - 0.75) * c4) + 1;
+    },
+    easeInOutElastic: function (x) {
+      return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ? -(pow(2, 20 * x - 10) * sin((20 * x - 11.125) * c5)) / 2 : pow(2, -20 * x + 10) * sin((20 * x - 11.125) * c5) / 2 + 1;
+    },
+    easeInBack: function (x) {
+      return c3 * x * x * x - c1 * x * x;
+    },
+    easeOutBack: function (x) {
+      return 1 + c3 * pow(x - 1, 3) + c1 * pow(x - 1, 2);
+    },
+    easeInOutBack: function (x) {
+      return x < 0.5 ? pow(2 * x, 2) * ((c2 + 1) * 2 * x - c2) / 2 : (pow(2 * x - 2, 2) * ((c2 + 1) * (x * 2 - 2) + c2) + 2) / 2;
+    },
+    easeInBounce: function (x) {
+      return 1 - bounceOut(1 - x);
+    },
+    easeOutBounce: bounceOut,
+    easeInOutBounce: function (x) {
+      return x < 0.5 ? (1 - bounceOut(1 - 2 * x)) / 2 : (1 + bounceOut(2 * x - 1)) / 2;
+    }
+  });
+});; // Custom Easing
+jQuery.extend(jQuery.easing, {
+  easeInOutMaterial: function (x, t, b, c, d) {
+    if ((t /= d / 2) < 1) return c / 2 * t * t + b;
+    return c / 4 * ((t -= 2) * t * t + 2) + b;
+  }
+});; /*! VelocityJS.org (1.2.3). (C) 2014 Julian Shapiro. MIT @license: en.wikipedia.org/wiki/MIT_License */
+/*! VelocityJS.org jQuery Shim (1.0.1). (C) 2014 The jQuery Foundation. MIT @license: en.wikipedia.org/wiki/MIT_License. */
+/*! Note that this has been modified by Materialize to confirm that Velocity is not already being imported. */
+jQuery.Velocity ? console.log("Velocity is already loaded. You may be needlessly importing Velocity again; note that Materialize includes Velocity.") : (!function (e) {
+  function t(e) {
+    var t = e.length,
+        a = r.type(e);return "function" === a || r.isWindow(e) ? !1 : 1 === e.nodeType && t ? !0 : "array" === a || 0 === t || "number" == typeof t && t > 0 && t - 1 in e;
+  }if (!e.jQuery) {
+    var r = function (e, t) {
+      return new r.fn.init(e, t);
+    };r.isWindow = function (e) {
+      return null != e && e == e.window;
+    }, r.type = function (e) {
+      return null == e ? e + "" : "object" == typeof e || "function" == typeof e ? n[i.call(e)] || "object" : typeof e;
+    }, r.isArray = Array.isArray || function (e) {
+      return "array" === r.type(e);
+    }, r.isPlainObject = function (e) {
+      var t;if (!e || "object" !== r.type(e) || e.nodeType || r.isWindow(e)) return !1;try {
+        if (e.constructor && !o.call(e, "constructor") && !o.call(e.constructor.prototype, "isPrototypeOf")) return !1;
+      } catch (a) {
+        return !1;
+      }for (t in e) {}return void 0 === t || o.call(e, t);
+    }, r.each = function (e, r, a) {
+      var n,
+          o = 0,
+          i = e.length,
+          s = t(e);if (a) {
+        if (s) for (; i > o && (n = r.apply(e[o], a), n !== !1); o++) {} else for (o in e) {
+          if (n = r.apply(e[o], a), n === !1) break;
+        }
+      } else if (s) for (; i > o && (n = r.call(e[o], o, e[o]), n !== !1); o++) {} else for (o in e) {
+        if (n = r.call(e[o], o, e[o]), n === !1) break;
+      }return e;
+    }, r.data = function (e, t, n) {
+      if (void 0 === n) {
+        var o = e[r.expando],
+            i = o && a[o];if (void 0 === t) return i;if (i && t in i) return i[t];
+      } else if (void 0 !== t) {
+        var o = e[r.expando] || (e[r.expando] = ++r.uuid);return a[o] = a[o] || {}, a[o][t] = n, n;
+      }
+    }, r.removeData = function (e, t) {
+      var n = e[r.expando],
+          o = n && a[n];o && r.each(t, function (e, t) {
+        delete o[t];
+      });
+    }, r.extend = function () {
+      var e,
+          t,
+          a,
+          n,
+          o,
+          i,
+          s = arguments[0] || {},
+          l = 1,
+          u = arguments.length,
+          c = !1;for ("boolean" == typeof s && (c = s, s = arguments[l] || {}, l++), "object" != typeof s && "function" !== r.type(s) && (s = {}), l === u && (s = this, l--); u > l; l++) {
+        if (null != (o = arguments[l])) for (n in o) {
+          e = s[n], a = o[n], s !== a && (c && a && (r.isPlainObject(a) || (t = r.isArray(a))) ? (t ? (t = !1, i = e && r.isArray(e) ? e : []) : i = e && r.isPlainObject(e) ? e : {}, s[n] = r.extend(c, i, a)) : void 0 !== a && (s[n] = a));
+        }
+      }return s;
+    }, r.queue = function (e, a, n) {
+      function o(e, r) {
+        var a = r || [];return null != e && (t(Object(e)) ? !function (e, t) {
+          for (var r = +t.length, a = 0, n = e.length; r > a;) {
+            e[n++] = t[a++];
+          }if (r !== r) for (; void 0 !== t[a];) {
+            e[n++] = t[a++];
+          }return e.length = n, e;
+        }(a, "string" == typeof e ? [e] : e) : [].push.call(a, e)), a;
+      }if (e) {
+        a = (a || "fx") + "queue";var i = r.data(e, a);return n ? (!i || r.isArray(n) ? i = r.data(e, a, o(n)) : i.push(n), i) : i || [];
+      }
+    }, r.dequeue = function (e, t) {
+      r.each(e.nodeType ? [e] : e, function (e, a) {
+        t = t || "fx";var n = r.queue(a, t),
+            o = n.shift();"inprogress" === o && (o = n.shift()), o && ("fx" === t && n.unshift("inprogress"), o.call(a, function () {
+          r.dequeue(a, t);
+        }));
+      });
+    }, r.fn = r.prototype = { init: function (e) {
+        if (e.nodeType) return this[0] = e, this;throw new Error("Not a DOM node.");
+      }, offset: function () {
+        var t = this[0].getBoundingClientRect ? this[0].getBoundingClientRect() : { top: 0, left: 0 };return { top: t.top + (e.pageYOffset || document.scrollTop || 0) - (document.clientTop || 0), left: t.left + (e.pageXOffset || document.scrollLeft || 0) - (document.clientLeft || 0) };
+      }, position: function () {
+        function e() {
+          for (var e = this.offsetParent || document; e && "html" === !e.nodeType.toLowerCase && "static" === e.style.position;) {
+            e = e.offsetParent;
+          }return e || document;
+        }var t = this[0],
+            e = e.apply(t),
+            a = this.offset(),
+            n = /^(?:body|html)$/i.test(e.nodeName) ? { top: 0, left: 0 } : r(e).offset();return a.top -= parseFloat(t.style.marginTop) || 0, a.left -= parseFloat(t.style.marginLeft) || 0, e.style && (n.top += parseFloat(e.style.borderTopWidth) || 0, n.left += parseFloat(e.style.borderLeftWidth) || 0), { top: a.top - n.top, left: a.left - n.left };
+      } };var a = {};r.expando = "velocity" + new Date().getTime(), r.uuid = 0;for (var n = {}, o = n.hasOwnProperty, i = n.toString, s = "Boolean Number String Function Array Date RegExp Object Error".split(" "), l = 0; l < s.length; l++) {
+      n["[object " + s[l] + "]"] = s[l].toLowerCase();
+    }r.fn.init.prototype = r.fn, e.Velocity = { Utilities: r };
+  }
+}(window), function (e) {
+  "object" == typeof module && "object" == typeof module.exports ? module.exports = e() : "function" == typeof define && define.amd ? define(e) : e();
+}(function () {
+  return function (e, t, r, a) {
+    function n(e) {
+      for (var t = -1, r = e ? e.length : 0, a = []; ++t < r;) {
+        var n = e[t];n && a.push(n);
+      }return a;
+    }function o(e) {
+      return m.isWrapped(e) ? e = [].slice.call(e) : m.isNode(e) && (e = [e]), e;
+    }function i(e) {
+      var t = f.data(e, "velocity");return null === t ? a : t;
+    }function s(e) {
+      return function (t) {
+        return Math.round(t * e) * (1 / e);
+      };
+    }function l(e, r, a, n) {
+      function o(e, t) {
+        return 1 - 3 * t + 3 * e;
+      }function i(e, t) {
+        return 3 * t - 6 * e;
+      }function s(e) {
+        return 3 * e;
+      }function l(e, t, r) {
+        return ((o(t, r) * e + i(t, r)) * e + s(t)) * e;
+      }function u(e, t, r) {
+        return 3 * o(t, r) * e * e + 2 * i(t, r) * e + s(t);
+      }function c(t, r) {
+        for (var n = 0; m > n; ++n) {
+          var o = u(r, e, a);if (0 === o) return r;var i = l(r, e, a) - t;r -= i / o;
+        }return r;
+      }function p() {
+        for (var t = 0; b > t; ++t) {
+          w[t] = l(t * x, e, a);
+        }
+      }function f(t, r, n) {
+        var o,
+            i,
+            s = 0;do {
+          i = r + (n - r) / 2, o = l(i, e, a) - t, o > 0 ? n = i : r = i;
+        } while (Math.abs(o) > h && ++s < v);return i;
+      }function d(t) {
+        for (var r = 0, n = 1, o = b - 1; n != o && w[n] <= t; ++n) {
+          r += x;
+        }--n;var i = (t - w[n]) / (w[n + 1] - w[n]),
+            s = r + i * x,
+            l = u(s, e, a);return l >= y ? c(t, s) : 0 == l ? s : f(t, r, r + x);
+      }function g() {
+        V = !0, (e != r || a != n) && p();
+      }var m = 4,
+          y = .001,
+          h = 1e-7,
+          v = 10,
+          b = 11,
+          x = 1 / (b - 1),
+          S = "Float32Array" in t;if (4 !== arguments.length) return !1;for (var P = 0; 4 > P; ++P) {
+        if ("number" != typeof arguments[P] || isNaN(arguments[P]) || !isFinite(arguments[P])) return !1;
+      }e = Math.min(e, 1), a = Math.min(a, 1), e = Math.max(e, 0), a = Math.max(a, 0);var w = S ? new Float32Array(b) : new Array(b),
+          V = !1,
+          C = function (t) {
+        return V || g(), e === r && a === n ? t : 0 === t ? 0 : 1 === t ? 1 : l(d(t), r, n);
+      };C.getControlPoints = function () {
+        return [{ x: e, y: r }, { x: a, y: n }];
+      };var T = "generateBezier(" + [e, r, a, n] + ")";return C.toString = function () {
+        return T;
+      }, C;
+    }function u(e, t) {
+      var r = e;return m.isString(e) ? b.Easings[e] || (r = !1) : r = m.isArray(e) && 1 === e.length ? s.apply(null, e) : m.isArray(e) && 2 === e.length ? x.apply(null, e.concat([t])) : m.isArray(e) && 4 === e.length ? l.apply(null, e) : !1, r === !1 && (r = b.Easings[b.defaults.easing] ? b.defaults.easing : v), r;
+    }function c(e) {
+      if (e) {
+        var t = new Date().getTime(),
+            r = b.State.calls.length;r > 1e4 && (b.State.calls = n(b.State.calls));for (var o = 0; r > o; o++) {
+          if (b.State.calls[o]) {
+            var s = b.State.calls[o],
+                l = s[0],
+                u = s[2],
+                d = s[3],
+                g = !!d,
+                y = null;d || (d = b.State.calls[o][3] = t - 16);for (var h = Math.min((t - d) / u.duration, 1), v = 0, x = l.length; x > v; v++) {
+              var P = l[v],
+                  V = P.element;if (i(V)) {
+                var C = !1;if (u.display !== a && null !== u.display && "none" !== u.display) {
+                  if ("flex" === u.display) {
+                    var T = ["-webkit-box", "-moz-box", "-ms-flexbox", "-webkit-flex"];f.each(T, function (e, t) {
+                      S.setPropertyValue(V, "display", t);
+                    });
+                  }S.setPropertyValue(V, "display", u.display);
+                }u.visibility !== a && "hidden" !== u.visibility && S.setPropertyValue(V, "visibility", u.visibility);for (var k in P) {
+                  if ("element" !== k) {
+                    var A,
+                        F = P[k],
+                        j = m.isString(F.easing) ? b.Easings[F.easing] : F.easing;if (1 === h) A = F.endValue;else {
+                      var E = F.endValue - F.startValue;if (A = F.startValue + E * j(h, u, E), !g && A === F.currentValue) continue;
+                    }if (F.currentValue = A, "tween" === k) y = A;else {
+                      if (S.Hooks.registered[k]) {
+                        var H = S.Hooks.getRoot(k),
+                            N = i(V).rootPropertyValueCache[H];N && (F.rootPropertyValue = N);
+                      }var L = S.setPropertyValue(V, k, F.currentValue + (0 === parseFloat(A) ? "" : F.unitType), F.rootPropertyValue, F.scrollData);S.Hooks.registered[k] && (i(V).rootPropertyValueCache[H] = S.Normalizations.registered[H] ? S.Normalizations.registered[H]("extract", null, L[1]) : L[1]), "transform" === L[0] && (C = !0);
+                    }
+                  }
+                }u.mobileHA && i(V).transformCache.translate3d === a && (i(V).transformCache.translate3d = "(0px, 0px, 0px)", C = !0), C && S.flushTransformCache(V);
+              }
+            }u.display !== a && "none" !== u.display && (b.State.calls[o][2].display = !1), u.visibility !== a && "hidden" !== u.visibility && (b.State.calls[o][2].visibility = !1), u.progress && u.progress.call(s[1], s[1], h, Math.max(0, d + u.duration - t), d, y), 1 === h && p(o);
+          }
+        }
+      }b.State.isTicking && w(c);
+    }function p(e, t) {
+      if (!b.State.calls[e]) return !1;for (var r = b.State.calls[e][0], n = b.State.calls[e][1], o = b.State.calls[e][2], s = b.State.calls[e][4], l = !1, u = 0, c = r.length; c > u; u++) {
+        var p = r[u].element;if (t || o.loop || ("none" === o.display && S.setPropertyValue(p, "display", o.display), "hidden" === o.visibility && S.setPropertyValue(p, "visibility", o.visibility)), o.loop !== !0 && (f.queue(p)[1] === a || !/\.velocityQueueEntryFlag/i.test(f.queue(p)[1])) && i(p)) {
+          i(p).isAnimating = !1, i(p).rootPropertyValueCache = {};var d = !1;f.each(S.Lists.transforms3D, function (e, t) {
+            var r = /^scale/.test(t) ? 1 : 0,
+                n = i(p).transformCache[t];i(p).transformCache[t] !== a && new RegExp("^\\(" + r + "[^.]").test(n) && (d = !0, delete i(p).transformCache[t]);
+          }), o.mobileHA && (d = !0, delete i(p).transformCache.translate3d), d && S.flushTransformCache(p), S.Values.removeClass(p, "velocity-animating");
+        }if (!t && o.complete && !o.loop && u === c - 1) try {
+          o.complete.call(n, n);
+        } catch (g) {
+          setTimeout(function () {
+            throw g;
+          }, 1);
+        }s && o.loop !== !0 && s(n), i(p) && o.loop === !0 && !t && (f.each(i(p).tweensContainer, function (e, t) {
+          /^rotate/.test(e) && 360 === parseFloat(t.endValue) && (t.endValue = 0, t.startValue = 360), /^backgroundPosition/.test(e) && 100 === parseFloat(t.endValue) && "%" === t.unitType && (t.endValue = 0, t.startValue = 100);
+        }), b(p, "reverse", { loop: !0, delay: o.delay })), o.queue !== !1 && f.dequeue(p, o.queue);
+      }b.State.calls[e] = !1;for (var m = 0, y = b.State.calls.length; y > m; m++) {
+        if (b.State.calls[m] !== !1) {
+          l = !0;break;
+        }
+      }l === !1 && (b.State.isTicking = !1, delete b.State.calls, b.State.calls = []);
+    }var f,
+        d = function () {
+      if (r.documentMode) return r.documentMode;for (var e = 7; e > 4; e--) {
+        var t = r.createElement("div");if (t.innerHTML = "<!--[if IE " + e + "]><span></span><![endif]-->", t.getElementsByTagName("span").length) return t = null, e;
+      }return a;
+    }(),
+        g = function () {
+      var e = 0;return t.webkitRequestAnimationFrame || t.mozRequestAnimationFrame || function (t) {
+        var r,
+            a = new Date().getTime();return r = Math.max(0, 16 - (a - e)), e = a + r, setTimeout(function () {
+          t(a + r);
+        }, r);
+      };
+    }(),
+        m = { isString: function (e) {
+        return "string" == typeof e;
+      }, isArray: Array.isArray || function (e) {
+        return "[object Array]" === Object.prototype.toString.call(e);
+      }, isFunction: function (e) {
+        return "[object Function]" === Object.prototype.toString.call(e);
+      }, isNode: function (e) {
+        return e && e.nodeType;
+      }, isNodeList: function (e) {
+        return "object" == typeof e && /^\[object (HTMLCollection|NodeList|Object)\]$/.test(Object.prototype.toString.call(e)) && e.length !== a && (0 === e.length || "object" == typeof e[0] && e[0].nodeType > 0);
+      }, isWrapped: function (e) {
+        return e && (e.jquery || t.Zepto && t.Zepto.zepto.isZ(e));
+      }, isSVG: function (e) {
+        return t.SVGElement && e instanceof t.SVGElement;
+      }, isEmptyObject: function (e) {
+        for (var t in e) {
+          return !1;
+        }return !0;
+      } },
+        y = !1;if (e.fn && e.fn.jquery ? (f = e, y = !0) : f = t.Velocity.Utilities, 8 >= d && !y) throw new Error("Velocity: IE8 and below require jQuery to be loaded before Velocity.");if (7 >= d) return void (jQuery.fn.velocity = jQuery.fn.animate);var h = 400,
+        v = "swing",
+        b = { State: { isMobile: /Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent), isAndroid: /Android/i.test(navigator.userAgent), isGingerbread: /Android 2\.3\.[3-7]/i.test(navigator.userAgent), isChrome: t.chrome, isFirefox: /Firefox/i.test(navigator.userAgent), prefixElement: r.createElement("div"), prefixMatches: {}, scrollAnchor: null, scrollPropertyLeft: null, scrollPropertyTop: null, isTicking: !1, calls: [] }, CSS: {}, Utilities: f, Redirects: {}, Easings: {}, Promise: t.Promise, defaults: { queue: "", duration: h, easing: v, begin: a, complete: a, progress: a, display: a, visibility: a, loop: !1, delay: !1, mobileHA: !0, _cacheValues: !0 }, init: function (e) {
+        f.data(e, "velocity", { isSVG: m.isSVG(e), isAnimating: !1, computedStyle: null, tweensContainer: null, rootPropertyValueCache: {}, transformCache: {} });
+      }, hook: null, mock: !1, version: { major: 1, minor: 2, patch: 2 }, debug: !1 };t.pageYOffset !== a ? (b.State.scrollAnchor = t, b.State.scrollPropertyLeft = "pageXOffset", b.State.scrollPropertyTop = "pageYOffset") : (b.State.scrollAnchor = r.documentElement || r.body.parentNode || r.body, b.State.scrollPropertyLeft = "scrollLeft", b.State.scrollPropertyTop = "scrollTop");var x = function () {
+      function e(e) {
+        return -e.tension * e.x - e.friction * e.v;
+      }function t(t, r, a) {
+        var n = { x: t.x + a.dx * r, v: t.v + a.dv * r, tension: t.tension, friction: t.friction };return { dx: n.v, dv: e(n) };
+      }function r(r, a) {
+        var n = { dx: r.v, dv: e(r) },
+            o = t(r, .5 * a, n),
+            i = t(r, .5 * a, o),
+            s = t(r, a, i),
+            l = 1 / 6 * (n.dx + 2 * (o.dx + i.dx) + s.dx),
+            u = 1 / 6 * (n.dv + 2 * (o.dv + i.dv) + s.dv);return r.x = r.x + l * a, r.v = r.v + u * a, r;
+      }return function a(e, t, n) {
+        var o,
+            i,
+            s,
+            l = { x: -1, v: 0, tension: null, friction: null },
+            u = [0],
+            c = 0,
+            p = 1e-4,
+            f = .016;for (e = parseFloat(e) || 500, t = parseFloat(t) || 20, n = n || null, l.tension = e, l.friction = t, o = null !== n, o ? (c = a(e, t), i = c / n * f) : i = f; s = r(s || l, i), u.push(1 + s.x), c += 16, Math.abs(s.x) > p && Math.abs(s.v) > p;) {}return o ? function (e) {
+          return u[e * (u.length - 1) | 0];
+        } : c;
+      };
+    }();b.Easings = { linear: function (e) {
+        return e;
+      }, swing: function (e) {
+        return .5 - Math.cos(e * Math.PI) / 2;
+      }, spring: function (e) {
+        return 1 - Math.cos(4.5 * e * Math.PI) * Math.exp(6 * -e);
+      } }, f.each([["ease", [.25, .1, .25, 1]], ["ease-in", [.42, 0, 1, 1]], ["ease-out", [0, 0, .58, 1]], ["ease-in-out", [.42, 0, .58, 1]], ["easeInSine", [.47, 0, .745, .715]], ["easeOutSine", [.39, .575, .565, 1]], ["easeInOutSine", [.445, .05, .55, .95]], ["easeInQuad", [.55, .085, .68, .53]], ["easeOutQuad", [.25, .46, .45, .94]], ["easeInOutQuad", [.455, .03, .515, .955]], ["easeInCubic", [.55, .055, .675, .19]], ["easeOutCubic", [.215, .61, .355, 1]], ["easeInOutCubic", [.645, .045, .355, 1]], ["easeInQuart", [.895, .03, .685, .22]], ["easeOutQuart", [.165, .84, .44, 1]], ["easeInOutQuart", [.77, 0, .175, 1]], ["easeInQuint", [.755, .05, .855, .06]], ["easeOutQuint", [.23, 1, .32, 1]], ["easeInOutQuint", [.86, 0, .07, 1]], ["easeInExpo", [.95, .05, .795, .035]], ["easeOutExpo", [.19, 1, .22, 1]], ["easeInOutExpo", [1, 0, 0, 1]], ["easeInCirc", [.6, .04, .98, .335]], ["easeOutCirc", [.075, .82, .165, 1]], ["easeInOutCirc", [.785, .135, .15, .86]]], function (e, t) {
+      b.Easings[t[0]] = l.apply(null, t[1]);
+    });var S = b.CSS = { RegEx: { isHex: /^#([A-f\d]{3}){1,2}$/i, valueUnwrap: /^[A-z]+\((.*)\)$/i, wrappedValueAlreadyExtracted: /[0-9.]+ [0-9.]+ [0-9.]+( [0-9.]+)?/, valueSplit: /([A-z]+\(.+\))|(([A-z0-9#-.]+?)(?=\s|$))/gi }, Lists: { colors: ["fill", "stroke", "stopColor", "color", "backgroundColor", "borderColor", "borderTopColor", "borderRightColor", "borderBottomColor", "borderLeftColor", "outlineColor"], transformsBase: ["translateX", "translateY", "scale", "scaleX", "scaleY", "skewX", "skewY", "rotateZ"], transforms3D: ["transformPerspective", "translateZ", "scaleZ", "rotateX", "rotateY"] }, Hooks: { templates: { textShadow: ["Color X Y Blur", "black 0px 0px 0px"], boxShadow: ["Color X Y Blur Spread", "black 0px 0px 0px 0px"], clip: ["Top Right Bottom Left", "0px 0px 0px 0px"], backgroundPosition: ["X Y", "0% 0%"], transformOrigin: ["X Y Z", "50% 50% 0px"], perspectiveOrigin: ["X Y", "50% 50%"] }, registered: {}, register: function () {
+          for (var e = 0; e < S.Lists.colors.length; e++) {
+            var t = "color" === S.Lists.colors[e] ? "0 0 0 1" : "255 255 255 1";S.Hooks.templates[S.Lists.colors[e]] = ["Red Green Blue Alpha", t];
+          }var r, a, n;if (d) for (r in S.Hooks.templates) {
+            a = S.Hooks.templates[r], n = a[0].split(" ");var o = a[1].match(S.RegEx.valueSplit);"Color" === n[0] && (n.push(n.shift()), o.push(o.shift()), S.Hooks.templates[r] = [n.join(" "), o.join(" ")]);
+          }for (r in S.Hooks.templates) {
+            a = S.Hooks.templates[r], n = a[0].split(" ");for (var e in n) {
+              var i = r + n[e],
+                  s = e;S.Hooks.registered[i] = [r, s];
+            }
+          }
+        }, getRoot: function (e) {
+          var t = S.Hooks.registered[e];return t ? t[0] : e;
+        }, cleanRootPropertyValue: function (e, t) {
+          return S.RegEx.valueUnwrap.test(t) && (t = t.match(S.RegEx.valueUnwrap)[1]), S.Values.isCSSNullValue(t) && (t = S.Hooks.templates[e][1]), t;
+        }, extractValue: function (e, t) {
+          var r = S.Hooks.registered[e];if (r) {
+            var a = r[0],
+                n = r[1];return t = S.Hooks.cleanRootPropertyValue(a, t), t.toString().match(S.RegEx.valueSplit)[n];
+          }return t;
+        }, injectValue: function (e, t, r) {
+          var a = S.Hooks.registered[e];if (a) {
+            var n,
+                o,
+                i = a[0],
+                s = a[1];return r = S.Hooks.cleanRootPropertyValue(i, r), n = r.toString().match(S.RegEx.valueSplit), n[s] = t, o = n.join(" ");
+          }return r;
+        } }, Normalizations: { registered: { clip: function (e, t, r) {
+            switch (e) {case "name":
+                return "clip";case "extract":
+                var a;return S.RegEx.wrappedValueAlreadyExtracted.test(r) ? a = r : (a = r.toString().match(S.RegEx.valueUnwrap), a = a ? a[1].replace(/,(\s+)?/g, " ") : r), a;case "inject":
+                return "rect(" + r + ")";}
+          }, blur: function (e, t, r) {
+            switch (e) {case "name":
+                return b.State.isFirefox ? "filter" : "-webkit-filter";case "extract":
+                var a = parseFloat(r);if (!a && 0 !== a) {
+                  var n = r.toString().match(/blur\(([0-9]+[A-z]+)\)/i);a = n ? n[1] : 0;
+                }return a;case "inject":
+                return parseFloat(r) ? "blur(" + r + ")" : "none";}
+          }, opacity: function (e, t, r) {
+            if (8 >= d) switch (e) {case "name":
+                return "filter";case "extract":
+                var a = r.toString().match(/alpha\(opacity=(.*)\)/i);return r = a ? a[1] / 100 : 1;case "inject":
+                return t.style.zoom = 1, parseFloat(r) >= 1 ? "" : "alpha(opacity=" + parseInt(100 * parseFloat(r), 10) + ")";} else switch (e) {case "name":
+                return "opacity";case "extract":
+                return r;case "inject":
+                return r;}
+          } }, register: function () {
+          9 >= d || b.State.isGingerbread || (S.Lists.transformsBase = S.Lists.transformsBase.concat(S.Lists.transforms3D));for (var e = 0; e < S.Lists.transformsBase.length; e++) {
+            !function () {
+              var t = S.Lists.transformsBase[e];S.Normalizations.registered[t] = function (e, r, n) {
+                switch (e) {case "name":
+                    return "transform";case "extract":
+                    return i(r) === a || i(r).transformCache[t] === a ? /^scale/i.test(t) ? 1 : 0 : i(r).transformCache[t].replace(/[()]/g, "");case "inject":
+                    var o = !1;switch (t.substr(0, t.length - 1)) {case "translate":
+                        o = !/(%|px|em|rem|vw|vh|\d)$/i.test(n);break;case "scal":case "scale":
+                        b.State.isAndroid && i(r).transformCache[t] === a && 1 > n && (n = 1), o = !/(\d)$/i.test(n);break;case "skew":
+                        o = !/(deg|\d)$/i.test(n);break;case "rotate":
+                        o = !/(deg|\d)$/i.test(n);}return o || (i(r).transformCache[t] = "(" + n + ")"), i(r).transformCache[t];}
+              };
+            }();
+          }for (var e = 0; e < S.Lists.colors.length; e++) {
+            !function () {
+              var t = S.Lists.colors[e];S.Normalizations.registered[t] = function (e, r, n) {
+                switch (e) {case "name":
+                    return t;case "extract":
+                    var o;if (S.RegEx.wrappedValueAlreadyExtracted.test(n)) o = n;else {
+                      var i,
+                          s = { black: "rgb(0, 0, 0)", blue: "rgb(0, 0, 255)", gray: "rgb(128, 128, 128)", green: "rgb(0, 128, 0)", red: "rgb(255, 0, 0)", white: "rgb(255, 255, 255)" };/^[A-z]+$/i.test(n) ? i = s[n] !== a ? s[n] : s.black : S.RegEx.isHex.test(n) ? i = "rgb(" + S.Values.hexToRgb(n).join(" ") + ")" : /^rgba?\(/i.test(n) || (i = s.black), o = (i || n).toString().match(S.RegEx.valueUnwrap)[1].replace(/,(\s+)?/g, " ");
+                    }return 8 >= d || 3 !== o.split(" ").length || (o += " 1"), o;case "inject":
+                    return 8 >= d ? 4 === n.split(" ").length && (n = n.split(/\s+/).slice(0, 3).join(" ")) : 3 === n.split(" ").length && (n += " 1"), (8 >= d ? "rgb" : "rgba") + "(" + n.replace(/\s+/g, ",").replace(/\.(\d)+(?=,)/g, "") + ")";}
+              };
+            }();
+          }
+        } }, Names: { camelCase: function (e) {
+          return e.replace(/-(\w)/g, function (e, t) {
+            return t.toUpperCase();
+          });
+        }, SVGAttribute: function (e) {
+          var t = "width|height|x|y|cx|cy|r|rx|ry|x1|x2|y1|y2";return (d || b.State.isAndroid && !b.State.isChrome) && (t += "|transform"), new RegExp("^(" + t + ")$", "i").test(e);
+        }, prefixCheck: function (e) {
+          if (b.State.prefixMatches[e]) return [b.State.prefixMatches[e], !0];for (var t = ["", "Webkit", "Moz", "ms", "O"], r = 0, a = t.length; a > r; r++) {
+            var n;if (n = 0 === r ? e : t[r] + e.replace(/^\w/, function (e) {
+              return e.toUpperCase();
+            }), m.isString(b.State.prefixElement.style[n])) return b.State.prefixMatches[e] = n, [n, !0];
+          }return [e, !1];
+        } }, Values: { hexToRgb: function (e) {
+          var t,
+              r = /^#?([a-f\d])([a-f\d])([a-f\d])$/i,
+              a = /^#?([a-f\d]{2})([a-f\d]{2})([a-f\d]{2})$/i;return e = e.replace(r, function (e, t, r, a) {
+            return t + t + r + r + a + a;
+          }), t = a.exec(e), t ? [parseInt(t[1], 16), parseInt(t[2], 16), parseInt(t[3], 16)] : [0, 0, 0];
+        }, isCSSNullValue: function (e) {
+          return 0 == e || /^(none|auto|transparent|(rgba\(0, ?0, ?0, ?0\)))$/i.test(e);
+        }, getUnitType: function (e) {
+          return (/^(rotate|skew)/i.test(e) ? "deg" : /(^(scale|scaleX|scaleY|scaleZ|alpha|flexGrow|flexHeight|zIndex|fontWeight)$)|((opacity|red|green|blue|alpha)$)/i.test(e) ? "" : "px"
+          );
+        }, getDisplayType: function (e) {
+          var t = e && e.tagName.toString().toLowerCase();return (/^(b|big|i|small|tt|abbr|acronym|cite|code|dfn|em|kbd|strong|samp|var|a|bdo|br|img|map|object|q|script|span|sub|sup|button|input|label|select|textarea)$/i.test(t) ? "inline" : /^(li)$/i.test(t) ? "list-item" : /^(tr)$/i.test(t) ? "table-row" : /^(table)$/i.test(t) ? "table" : /^(tbody)$/i.test(t) ? "table-row-group" : "block"
+          );
+        }, addClass: function (e, t) {
+          e.classList ? e.classList.add(t) : e.className += (e.className.length ? " " : "") + t;
+        }, removeClass: function (e, t) {
+          e.classList ? e.classList.remove(t) : e.className = e.className.toString().replace(new RegExp("(^|\\s)" + t.split(" ").join("|") + "(\\s|$)", "gi"), " ");
+        } }, getPropertyValue: function (e, r, n, o) {
+        function s(e, r) {
+          function n() {
+            u && S.setPropertyValue(e, "display", "none");
+          }var l = 0;if (8 >= d) l = f.css(e, r);else {
+            var u = !1;if (/^(width|height)$/.test(r) && 0 === S.getPropertyValue(e, "display") && (u = !0, S.setPropertyValue(e, "display", S.Values.getDisplayType(e))), !o) {
+              if ("height" === r && "border-box" !== S.getPropertyValue(e, "boxSizing").toString().toLowerCase()) {
+                var c = e.offsetHeight - (parseFloat(S.getPropertyValue(e, "borderTopWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "borderBottomWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingTop")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingBottom")) || 0);return n(), c;
+              }if ("width" === r && "border-box" !== S.getPropertyValue(e, "boxSizing").toString().toLowerCase()) {
+                var p = e.offsetWidth - (parseFloat(S.getPropertyValue(e, "borderLeftWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "borderRightWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingLeft")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingRight")) || 0);return n(), p;
+              }
+            }var g;g = i(e) === a ? t.getComputedStyle(e, null) : i(e).computedStyle ? i(e).computedStyle : i(e).computedStyle = t.getComputedStyle(e, null), "borderColor" === r && (r = "borderTopColor"), l = 9 === d && "filter" === r ? g.getPropertyValue(r) : g[r], ("" === l || null === l) && (l = e.style[r]), n();
+          }if ("auto" === l && /^(top|right|bottom|left)$/i.test(r)) {
+            var m = s(e, "position");("fixed" === m || "absolute" === m && /top|left/i.test(r)) && (l = f(e).position()[r] + "px");
+          }return l;
+        }var l;if (S.Hooks.registered[r]) {
+          var u = r,
+              c = S.Hooks.getRoot(u);n === a && (n = S.getPropertyValue(e, S.Names.prefixCheck(c)[0])), S.Normalizations.registered[c] && (n = S.Normalizations.registered[c]("extract", e, n)), l = S.Hooks.extractValue(u, n);
+        } else if (S.Normalizations.registered[r]) {
+          var p, g;p = S.Normalizations.registered[r]("name", e), "transform" !== p && (g = s(e, S.Names.prefixCheck(p)[0]), S.Values.isCSSNullValue(g) && S.Hooks.templates[r] && (g = S.Hooks.templates[r][1])), l = S.Normalizations.registered[r]("extract", e, g);
+        }if (!/^[\d-]/.test(l)) if (i(e) && i(e).isSVG && S.Names.SVGAttribute(r)) {
+          if (/^(height|width)$/i.test(r)) try {
+            l = e.getBBox()[r];
+          } catch (m) {
+            l = 0;
+          } else l = e.getAttribute(r);
+        } else l = s(e, S.Names.prefixCheck(r)[0]);return S.Values.isCSSNullValue(l) && (l = 0), b.debug >= 2 && console.log("Get " + r + ": " + l), l;
+      }, setPropertyValue: function (e, r, a, n, o) {
+        var s = r;if ("scroll" === r) o.container ? o.container["scroll" + o.direction] = a : "Left" === o.direction ? t.scrollTo(a, o.alternateValue) : t.scrollTo(o.alternateValue, a);else if (S.Normalizations.registered[r] && "transform" === S.Normalizations.registered[r]("name", e)) S.Normalizations.registered[r]("inject", e, a), s = "transform", a = i(e).transformCache[r];else {
+          if (S.Hooks.registered[r]) {
+            var l = r,
+                u = S.Hooks.getRoot(r);n = n || S.getPropertyValue(e, u), a = S.Hooks.injectValue(l, a, n), r = u;
+          }if (S.Normalizations.registered[r] && (a = S.Normalizations.registered[r]("inject", e, a), r = S.Normalizations.registered[r]("name", e)), s = S.Names.prefixCheck(r)[0], 8 >= d) try {
+            e.style[s] = a;
+          } catch (c) {
+            b.debug && console.log("Browser does not support [" + a + "] for [" + s + "]");
+          } else i(e) && i(e).isSVG && S.Names.SVGAttribute(r) ? e.setAttribute(r, a) : e.style[s] = a;b.debug >= 2 && console.log("Set " + r + " (" + s + "): " + a);
+        }return [s, a];
+      }, flushTransformCache: function (e) {
+        function t(t) {
+          return parseFloat(S.getPropertyValue(e, t));
+        }var r = "";if ((d || b.State.isAndroid && !b.State.isChrome) && i(e).isSVG) {
+          var a = { translate: [t("translateX"), t("translateY")], skewX: [t("skewX")], skewY: [t("skewY")], scale: 1 !== t("scale") ? [t("scale"), t("scale")] : [t("scaleX"), t("scaleY")], rotate: [t("rotateZ"), 0, 0] };f.each(i(e).transformCache, function (e) {
+            /^translate/i.test(e) ? e = "translate" : /^scale/i.test(e) ? e = "scale" : /^rotate/i.test(e) && (e = "rotate"), a[e] && (r += e + "(" + a[e].join(" ") + ") ", delete a[e]);
+          });
+        } else {
+          var n, o;f.each(i(e).transformCache, function (t) {
+            return n = i(e).transformCache[t], "transformPerspective" === t ? (o = n, !0) : (9 === d && "rotateZ" === t && (t = "rotate"), void (r += t + n + " "));
+          }), o && (r = "perspective" + o + " " + r);
+        }S.setPropertyValue(e, "transform", r);
+      } };S.Hooks.register(), S.Normalizations.register(), b.hook = function (e, t, r) {
+      var n = a;return e = o(e), f.each(e, function (e, o) {
+        if (i(o) === a && b.init(o), r === a) n === a && (n = b.CSS.getPropertyValue(o, t));else {
+          var s = b.CSS.setPropertyValue(o, t, r);"transform" === s[0] && b.CSS.flushTransformCache(o), n = s;
+        }
+      }), n;
+    };var P = function () {
+      function e() {
+        return s ? k.promise || null : l;
+      }function n() {
+        function e(e) {
+          function p(e, t) {
+            var r = a,
+                n = a,
+                i = a;return m.isArray(e) ? (r = e[0], !m.isArray(e[1]) && /^[\d-]/.test(e[1]) || m.isFunction(e[1]) || S.RegEx.isHex.test(e[1]) ? i = e[1] : (m.isString(e[1]) && !S.RegEx.isHex.test(e[1]) || m.isArray(e[1])) && (n = t ? e[1] : u(e[1], s.duration), e[2] !== a && (i = e[2]))) : r = e, t || (n = n || s.easing), m.isFunction(r) && (r = r.call(o, V, w)), m.isFunction(i) && (i = i.call(o, V, w)), [r || 0, n, i];
+          }function d(e, t) {
+            var r, a;return a = (t || "0").toString().toLowerCase().replace(/[%A-z]+$/, function (e) {
+              return r = e, "";
+            }), r || (r = S.Values.getUnitType(e)), [a, r];
+          }function h() {
+            var e = { myParent: o.parentNode || r.body, position: S.getPropertyValue(o, "position"), fontSize: S.getPropertyValue(o, "fontSize") },
+                a = e.position === L.lastPosition && e.myParent === L.lastParent,
+                n = e.fontSize === L.lastFontSize;L.lastParent = e.myParent, L.lastPosition = e.position, L.lastFontSize = e.fontSize;var s = 100,
+                l = {};if (n && a) l.emToPx = L.lastEmToPx, l.percentToPxWidth = L.lastPercentToPxWidth, l.percentToPxHeight = L.lastPercentToPxHeight;else {
+              var u = i(o).isSVG ? r.createElementNS("http://www.w3.org/2000/svg", "rect") : r.createElement("div");b.init(u), e.myParent.appendChild(u), f.each(["overflow", "overflowX", "overflowY"], function (e, t) {
+                b.CSS.setPropertyValue(u, t, "hidden");
+              }), b.CSS.setPropertyValue(u, "position", e.position), b.CSS.setPropertyValue(u, "fontSize", e.fontSize), b.CSS.setPropertyValue(u, "boxSizing", "content-box"), f.each(["minWidth", "maxWidth", "width", "minHeight", "maxHeight", "height"], function (e, t) {
+                b.CSS.setPropertyValue(u, t, s + "%");
+              }), b.CSS.setPropertyValue(u, "paddingLeft", s + "em"), l.percentToPxWidth = L.lastPercentToPxWidth = (parseFloat(S.getPropertyValue(u, "width", null, !0)) || 1) / s, l.percentToPxHeight = L.lastPercentToPxHeight = (parseFloat(S.getPropertyValue(u, "height", null, !0)) || 1) / s, l.emToPx = L.lastEmToPx = (parseFloat(S.getPropertyValue(u, "paddingLeft")) || 1) / s, e.myParent.removeChild(u);
+            }return null === L.remToPx && (L.remToPx = parseFloat(S.getPropertyValue(r.body, "fontSize")) || 16), null === L.vwToPx && (L.vwToPx = parseFloat(t.innerWidth) / 100, L.vhToPx = parseFloat(t.innerHeight) / 100), l.remToPx = L.remToPx, l.vwToPx = L.vwToPx, l.vhToPx = L.vhToPx, b.debug >= 1 && console.log("Unit ratios: " + JSON.stringify(l), o), l;
+          }if (s.begin && 0 === V) try {
+            s.begin.call(g, g);
+          } catch (x) {
+            setTimeout(function () {
+              throw x;
+            }, 1);
+          }if ("scroll" === A) {
+            var P,
+                C,
+                T,
+                F = /^x$/i.test(s.axis) ? "Left" : "Top",
+                j = parseFloat(s.offset) || 0;s.container ? m.isWrapped(s.container) || m.isNode(s.container) ? (s.container = s.container[0] || s.container, P = s.container["scroll" + F], T = P + f(o).position()[F.toLowerCase()] + j) : s.container = null : (P = b.State.scrollAnchor[b.State["scrollProperty" + F]], C = b.State.scrollAnchor[b.State["scrollProperty" + ("Left" === F ? "Top" : "Left")]], T = f(o).offset()[F.toLowerCase()] + j), l = { scroll: { rootPropertyValue: !1, startValue: P, currentValue: P, endValue: T, unitType: "", easing: s.easing, scrollData: { container: s.container, direction: F, alternateValue: C } }, element: o }, b.debug && console.log("tweensContainer (scroll): ", l.scroll, o);
+          } else if ("reverse" === A) {
+            if (!i(o).tweensContainer) return void f.dequeue(o, s.queue);"none" === i(o).opts.display && (i(o).opts.display = "auto"), "hidden" === i(o).opts.visibility && (i(o).opts.visibility = "visible"), i(o).opts.loop = !1, i(o).opts.begin = null, i(o).opts.complete = null, v.easing || delete s.easing, v.duration || delete s.duration, s = f.extend({}, i(o).opts, s);var E = f.extend(!0, {}, i(o).tweensContainer);for (var H in E) {
+              if ("element" !== H) {
+                var N = E[H].startValue;E[H].startValue = E[H].currentValue = E[H].endValue, E[H].endValue = N, m.isEmptyObject(v) || (E[H].easing = s.easing), b.debug && console.log("reverse tweensContainer (" + H + "): " + JSON.stringify(E[H]), o);
+              }
+            }l = E;
+          } else if ("start" === A) {
+            var E;i(o).tweensContainer && i(o).isAnimating === !0 && (E = i(o).tweensContainer), f.each(y, function (e, t) {
+              if (RegExp("^" + S.Lists.colors.join("$|^") + "$").test(e)) {
+                var r = p(t, !0),
+                    n = r[0],
+                    o = r[1],
+                    i = r[2];if (S.RegEx.isHex.test(n)) {
+                  for (var s = ["Red", "Green", "Blue"], l = S.Values.hexToRgb(n), u = i ? S.Values.hexToRgb(i) : a, c = 0; c < s.length; c++) {
+                    var f = [l[c]];o && f.push(o), u !== a && f.push(u[c]), y[e + s[c]] = f;
+                  }delete y[e];
+                }
+              }
+            });for (var z in y) {
+              var O = p(y[z]),
+                  q = O[0],
+                  $ = O[1],
+                  M = O[2];z = S.Names.camelCase(z);var I = S.Hooks.getRoot(z),
+                  B = !1;if (i(o).isSVG || "tween" === I || S.Names.prefixCheck(I)[1] !== !1 || S.Normalizations.registered[I] !== a) {
+                (s.display !== a && null !== s.display && "none" !== s.display || s.visibility !== a && "hidden" !== s.visibility) && /opacity|filter/.test(z) && !M && 0 !== q && (M = 0), s._cacheValues && E && E[z] ? (M === a && (M = E[z].endValue + E[z].unitType), B = i(o).rootPropertyValueCache[I]) : S.Hooks.registered[z] ? M === a ? (B = S.getPropertyValue(o, I), M = S.getPropertyValue(o, z, B)) : B = S.Hooks.templates[I][1] : M === a && (M = S.getPropertyValue(o, z));var W,
+                    G,
+                    Y,
+                    D = !1;if (W = d(z, M), M = W[0], Y = W[1], W = d(z, q), q = W[0].replace(/^([+-\/*])=/, function (e, t) {
+                  return D = t, "";
+                }), G = W[1], M = parseFloat(M) || 0, q = parseFloat(q) || 0, "%" === G && (/^(fontSize|lineHeight)$/.test(z) ? (q /= 100, G = "em") : /^scale/.test(z) ? (q /= 100, G = "") : /(Red|Green|Blue)$/i.test(z) && (q = q / 100 * 255, G = "")), /[\/*]/.test(D)) G = Y;else if (Y !== G && 0 !== M) if (0 === q) G = Y;else {
+                  n = n || h();var Q = /margin|padding|left|right|width|text|word|letter/i.test(z) || /X$/.test(z) || "x" === z ? "x" : "y";switch (Y) {case "%":
+                      M *= "x" === Q ? n.percentToPxWidth : n.percentToPxHeight;break;case "px":
+                      break;default:
+                      M *= n[Y + "ToPx"];}switch (G) {case "%":
+                      M *= 1 / ("x" === Q ? n.percentToPxWidth : n.percentToPxHeight);break;case "px":
+                      break;default:
+                      M *= 1 / n[G + "ToPx"];}
+                }switch (D) {case "+":
+                    q = M + q;break;case "-":
+                    q = M - q;break;case "*":
+                    q = M * q;break;case "/":
+                    q = M / q;}l[z] = { rootPropertyValue: B, startValue: M, currentValue: M, endValue: q, unitType: G, easing: $ }, b.debug && console.log("tweensContainer (" + z + "): " + JSON.stringify(l[z]), o);
+              } else b.debug && console.log("Skipping [" + I + "] due to a lack of browser support.");
+            }l.element = o;
+          }l.element && (S.Values.addClass(o, "velocity-animating"), R.push(l), "" === s.queue && (i(o).tweensContainer = l, i(o).opts = s), i(o).isAnimating = !0, V === w - 1 ? (b.State.calls.push([R, g, s, null, k.resolver]), b.State.isTicking === !1 && (b.State.isTicking = !0, c())) : V++);
+        }var n,
+            o = this,
+            s = f.extend({}, b.defaults, v),
+            l = {};switch (i(o) === a && b.init(o), parseFloat(s.delay) && s.queue !== !1 && f.queue(o, s.queue, function (e) {
+          b.velocityQueueEntryFlag = !0, i(o).delayTimer = { setTimeout: setTimeout(e, parseFloat(s.delay)), next: e };
+        }), s.duration.toString().toLowerCase()) {case "fast":
+            s.duration = 200;break;case "normal":
+            s.duration = h;break;case "slow":
+            s.duration = 600;break;default:
+            s.duration = parseFloat(s.duration) || 1;}b.mock !== !1 && (b.mock === !0 ? s.duration = s.delay = 1 : (s.duration *= parseFloat(b.mock) || 1, s.delay *= parseFloat(b.mock) || 1)), s.easing = u(s.easing, s.duration), s.begin && !m.isFunction(s.begin) && (s.begin = null), s.progress && !m.isFunction(s.progress) && (s.progress = null), s.complete && !m.isFunction(s.complete) && (s.complete = null), s.display !== a && null !== s.display && (s.display = s.display.toString().toLowerCase(), "auto" === s.display && (s.display = b.CSS.Values.getDisplayType(o))), s.visibility !== a && null !== s.visibility && (s.visibility = s.visibility.toString().toLowerCase()), s.mobileHA = s.mobileHA && b.State.isMobile && !b.State.isGingerbread, s.queue === !1 ? s.delay ? setTimeout(e, s.delay) : e() : f.queue(o, s.queue, function (t, r) {
+          return r === !0 ? (k.promise && k.resolver(g), !0) : (b.velocityQueueEntryFlag = !0, void e(t));
+        }), "" !== s.queue && "fx" !== s.queue || "inprogress" === f.queue(o)[0] || f.dequeue(o);
+      }var s,
+          l,
+          d,
+          g,
+          y,
+          v,
+          x = arguments[0] && (arguments[0].p || f.isPlainObject(arguments[0].properties) && !arguments[0].properties.names || m.isString(arguments[0].properties));if (m.isWrapped(this) ? (s = !1, d = 0, g = this, l = this) : (s = !0, d = 1, g = x ? arguments[0].elements || arguments[0].e : arguments[0]), g = o(g)) {
+        x ? (y = arguments[0].properties || arguments[0].p, v = arguments[0].options || arguments[0].o) : (y = arguments[d], v = arguments[d + 1]);var w = g.length,
+            V = 0;if (!/^(stop|finish)$/i.test(y) && !f.isPlainObject(v)) {
+          var C = d + 1;v = {};for (var T = C; T < arguments.length; T++) {
+            m.isArray(arguments[T]) || !/^(fast|normal|slow)$/i.test(arguments[T]) && !/^\d/.test(arguments[T]) ? m.isString(arguments[T]) || m.isArray(arguments[T]) ? v.easing = arguments[T] : m.isFunction(arguments[T]) && (v.complete = arguments[T]) : v.duration = arguments[T];
+          }
+        }var k = { promise: null, resolver: null, rejecter: null };s && b.Promise && (k.promise = new b.Promise(function (e, t) {
+          k.resolver = e, k.rejecter = t;
+        }));var A;switch (y) {case "scroll":
+            A = "scroll";break;case "reverse":
+            A = "reverse";break;case "finish":case "stop":
+            f.each(g, function (e, t) {
+              i(t) && i(t).delayTimer && (clearTimeout(i(t).delayTimer.setTimeout), i(t).delayTimer.next && i(t).delayTimer.next(), delete i(t).delayTimer);
+            });var F = [];return f.each(b.State.calls, function (e, t) {
+              t && f.each(t[1], function (r, n) {
+                var o = v === a ? "" : v;return o === !0 || t[2].queue === o || v === a && t[2].queue === !1 ? void f.each(g, function (r, a) {
+                  a === n && ((v === !0 || m.isString(v)) && (f.each(f.queue(a, m.isString(v) ? v : ""), function (e, t) {
+                    m.isFunction(t) && t(null, !0);
+                  }), f.queue(a, m.isString(v) ? v : "", [])), "stop" === y ? (i(a) && i(a).tweensContainer && o !== !1 && f.each(i(a).tweensContainer, function (e, t) {
+                    t.endValue = t.currentValue;
+                  }), F.push(e)) : "finish" === y && (t[2].duration = 1));
+                }) : !0;
+              });
+            }), "stop" === y && (f.each(F, function (e, t) {
+              p(t, !0);
+            }), k.promise && k.resolver(g)), e();default:
+            if (!f.isPlainObject(y) || m.isEmptyObject(y)) {
+              if (m.isString(y) && b.Redirects[y]) {
+                var j = f.extend({}, v),
+                    E = j.duration,
+                    H = j.delay || 0;return j.backwards === !0 && (g = f.extend(!0, [], g).reverse()), f.each(g, function (e, t) {
+                  parseFloat(j.stagger) ? j.delay = H + parseFloat(j.stagger) * e : m.isFunction(j.stagger) && (j.delay = H + j.stagger.call(t, e, w)), j.drag && (j.duration = parseFloat(E) || (/^(callout|transition)/.test(y) ? 1e3 : h), j.duration = Math.max(j.duration * (j.backwards ? 1 - e / w : (e + 1) / w), .75 * j.duration, 200)), b.Redirects[y].call(t, t, j || {}, e, w, g, k.promise ? k : a);
+                }), e();
+              }var N = "Velocity: First argument (" + y + ") was not a property map, a known action, or a registered redirect. Aborting.";return k.promise ? k.rejecter(new Error(N)) : console.log(N), e();
+            }A = "start";}var L = { lastParent: null, lastPosition: null, lastFontSize: null, lastPercentToPxWidth: null, lastPercentToPxHeight: null, lastEmToPx: null, remToPx: null, vwToPx: null, vhToPx: null },
+            R = [];f.each(g, function (e, t) {
+          m.isNode(t) && n.call(t);
+        });var z,
+            j = f.extend({}, b.defaults, v);if (j.loop = parseInt(j.loop), z = 2 * j.loop - 1, j.loop) for (var O = 0; z > O; O++) {
+          var q = { delay: j.delay, progress: j.progress };O === z - 1 && (q.display = j.display, q.visibility = j.visibility, q.complete = j.complete), P(g, "reverse", q);
+        }return e();
+      }
+    };b = f.extend(P, b), b.animate = P;var w = t.requestAnimationFrame || g;return b.State.isMobile || r.hidden === a || r.addEventListener("visibilitychange", function () {
+      r.hidden ? (w = function (e) {
+        return setTimeout(function () {
+          e(!0);
+        }, 16);
+      }, c()) : w = t.requestAnimationFrame || g;
+    }), e.Velocity = b, e !== t && (e.fn.velocity = P, e.fn.velocity.defaults = b.defaults), f.each(["Down", "Up"], function (e, t) {
+      b.Redirects["slide" + t] = function (e, r, n, o, i, s) {
+        var l = f.extend({}, r),
+            u = l.begin,
+            c = l.complete,
+            p = { height: "", marginTop: "", marginBottom: "", paddingTop: "", paddingBottom: "" },
+            d = {};l.display === a && (l.display = "Down" === t ? "inline" === b.CSS.Values.getDisplayType(e) ? "inline-block" : "block" : "none"), l.begin = function () {
+          u && u.call(i, i);for (var r in p) {
+            d[r] = e.style[r];var a = b.CSS.getPropertyValue(e, r);p[r] = "Down" === t ? [a, 0] : [0, a];
+          }d.overflow = e.style.overflow, e.style.overflow = "hidden";
+        }, l.complete = function () {
+          for (var t in d) {
+            e.style[t] = d[t];
+          }c && c.call(i, i), s && s.resolver(i);
+        }, b(e, p, l);
+      };
+    }), f.each(["In", "Out"], function (e, t) {
+      b.Redirects["fade" + t] = function (e, r, n, o, i, s) {
+        var l = f.extend({}, r),
+            u = { opacity: "In" === t ? 1 : 0 },
+            c = l.complete;l.complete = n !== o - 1 ? l.begin = null : function () {
+          c && c.call(i, i), s && s.resolver(i);
+        }, l.display === a && (l.display = "In" === t ? "auto" : "none"), b(this, u, l);
+      };
+    }), b;
+  }(window.jQuery || window.Zepto || window, window, document);
+}));
+;!function (a, b, c, d) {
+  "use strict";
+  function k(a, b, c) {
+    return setTimeout(q(a, c), b);
+  }function l(a, b, c) {
+    return Array.isArray(a) ? (m(a, c[b], c), !0) : !1;
+  }function m(a, b, c) {
+    var e;if (a) if (a.forEach) a.forEach(b, c);else if (a.length !== d) for (e = 0; e < a.length;) {
+      b.call(c, a[e], e, a), e++;
+    } else for (e in a) {
+      a.hasOwnProperty(e) && b.call(c, a[e], e, a);
+    }
+  }function n(a, b, c) {
+    for (var e = Object.keys(b), f = 0; f < e.length;) {
+      (!c || c && a[e[f]] === d) && (a[e[f]] = b[e[f]]), f++;
+    }return a;
+  }function o(a, b) {
+    return n(a, b, !0);
+  }function p(a, b, c) {
+    var e,
+        d = b.prototype;e = a.prototype = Object.create(d), e.constructor = a, e._super = d, c && n(e, c);
+  }function q(a, b) {
+    return function () {
+      return a.apply(b, arguments);
+    };
+  }function r(a, b) {
+    return typeof a == g ? a.apply(b ? b[0] || d : d, b) : a;
+  }function s(a, b) {
+    return a === d ? b : a;
+  }function t(a, b, c) {
+    m(x(b), function (b) {
+      a.addEventListener(b, c, !1);
+    });
+  }function u(a, b, c) {
+    m(x(b), function (b) {
+      a.removeEventListener(b, c, !1);
+    });
+  }function v(a, b) {
+    for (; a;) {
+      if (a == b) return !0;a = a.parentNode;
+    }return !1;
+  }function w(a, b) {
+    return a.indexOf(b) > -1;
+  }function x(a) {
+    return a.trim().split(/\s+/g);
+  }function y(a, b, c) {
+    if (a.indexOf && !c) return a.indexOf(b);for (var d = 0; d < a.length;) {
+      if (c && a[d][c] == b || !c && a[d] === b) return d;d++;
+    }return -1;
+  }function z(a) {
+    return Array.prototype.slice.call(a, 0);
+  }function A(a, b, c) {
+    for (var d = [], e = [], f = 0; f < a.length;) {
+      var g = b ? a[f][b] : a[f];y(e, g) < 0 && d.push(a[f]), e[f] = g, f++;
+    }return c && (d = b ? d.sort(function (a, c) {
+      return a[b] > c[b];
+    }) : d.sort()), d;
+  }function B(a, b) {
+    for (var c, f, g = b[0].toUpperCase() + b.slice(1), h = 0; h < e.length;) {
+      if (c = e[h], f = c ? c + g : b, f in a) return f;h++;
+    }return d;
+  }function D() {
+    return C++;
+  }function E(a) {
+    var b = a.ownerDocument;return b.defaultView || b.parentWindow;
+  }function ab(a, b) {
+    var c = this;this.manager = a, this.callback = b, this.element = a.element, this.target = a.options.inputTarget, this.domHandler = function (b) {
+      r(a.options.enable, [a]) && c.handler(b);
+    }, this.init();
+  }function bb(a) {
+    var b,
+        c = a.options.inputClass;return b = c ? c : H ? wb : I ? Eb : G ? Gb : rb, new b(a, cb);
+  }function cb(a, b, c) {
+    var d = c.pointers.length,
+        e = c.changedPointers.length,
+        f = b & O && 0 === d - e,
+        g = b & (Q | R) && 0 === d - e;c.isFirst = !!f, c.isFinal = !!g, f && (a.session = {}), c.eventType = b, db(a, c), a.emit("hammer.input", c), a.recognize(c), a.session.prevInput = c;
+  }function db(a, b) {
+    var c = a.session,
+        d = b.pointers,
+        e = d.length;c.firstInput || (c.firstInput = gb(b)), e > 1 && !c.firstMultiple ? c.firstMultiple = gb(b) : 1 === e && (c.firstMultiple = !1);var f = c.firstInput,
+        g = c.firstMultiple,
+        h = g ? g.center : f.center,
+        i = b.center = hb(d);b.timeStamp = j(), b.deltaTime = b.timeStamp - f.timeStamp, b.angle = lb(h, i), b.distance = kb(h, i), eb(c, b), b.offsetDirection = jb(b.deltaX, b.deltaY), b.scale = g ? nb(g.pointers, d) : 1, b.rotation = g ? mb(g.pointers, d) : 0, fb(c, b);var k = a.element;v(b.srcEvent.target, k) && (k = b.srcEvent.target), b.target = k;
+  }function eb(a, b) {
+    var c = b.center,
+        d = a.offsetDelta || {},
+        e = a.prevDelta || {},
+        f = a.prevInput || {};(b.eventType === O || f.eventType === Q) && (e = a.prevDelta = { x: f.deltaX || 0, y: f.deltaY || 0 }, d = a.offsetDelta = { x: c.x, y: c.y }), b.deltaX = e.x + (c.x - d.x), b.deltaY = e.y + (c.y - d.y);
+  }function fb(a, b) {
+    var f,
+        g,
+        h,
+        j,
+        c = a.lastInterval || b,
+        e = b.timeStamp - c.timeStamp;if (b.eventType != R && (e > N || c.velocity === d)) {
+      var k = c.deltaX - b.deltaX,
+          l = c.deltaY - b.deltaY,
+          m = ib(e, k, l);g = m.x, h = m.y, f = i(m.x) > i(m.y) ? m.x : m.y, j = jb(k, l), a.lastInterval = b;
+    } else f = c.velocity, g = c.velocityX, h = c.velocityY, j = c.direction;b.velocity = f, b.velocityX = g, b.velocityY = h, b.direction = j;
+  }function gb(a) {
+    for (var b = [], c = 0; c < a.pointers.length;) {
+      b[c] = { clientX: h(a.pointers[c].clientX), clientY: h(a.pointers[c].clientY) }, c++;
+    }return { timeStamp: j(), pointers: b, center: hb(b), deltaX: a.deltaX, deltaY: a.deltaY };
+  }function hb(a) {
+    var b = a.length;if (1 === b) return { x: h(a[0].clientX), y: h(a[0].clientY) };for (var c = 0, d = 0, e = 0; b > e;) {
+      c += a[e].clientX, d += a[e].clientY, e++;
+    }return { x: h(c / b), y: h(d / b) };
+  }function ib(a, b, c) {
+    return { x: b / a || 0, y: c / a || 0 };
+  }function jb(a, b) {
+    return a === b ? S : i(a) >= i(b) ? a > 0 ? T : U : b > 0 ? V : W;
+  }function kb(a, b, c) {
+    c || (c = $);var d = b[c[0]] - a[c[0]],
+        e = b[c[1]] - a[c[1]];return Math.sqrt(d * d + e * e);
+  }function lb(a, b, c) {
+    c || (c = $);var d = b[c[0]] - a[c[0]],
+        e = b[c[1]] - a[c[1]];return 180 * Math.atan2(e, d) / Math.PI;
+  }function mb(a, b) {
+    return lb(b[1], b[0], _) - lb(a[1], a[0], _);
+  }function nb(a, b) {
+    return kb(b[0], b[1], _) / kb(a[0], a[1], _);
+  }function rb() {
+    this.evEl = pb, this.evWin = qb, this.allow = !0, this.pressed = !1, ab.apply(this, arguments);
+  }function wb() {
+    this.evEl = ub, this.evWin = vb, ab.apply(this, arguments), this.store = this.manager.session.pointerEvents = [];
+  }function Ab() {
+    this.evTarget = yb, this.evWin = zb, this.started = !1, ab.apply(this, arguments);
+  }function Bb(a, b) {
+    var c = z(a.touches),
+        d = z(a.changedTouches);return b & (Q | R) && (c = A(c.concat(d), "identifier", !0)), [c, d];
+  }function Eb() {
+    this.evTarget = Db, this.targetIds = {}, ab.apply(this, arguments);
+  }function Fb(a, b) {
+    var c = z(a.touches),
+        d = this.targetIds;if (b & (O | P) && 1 === c.length) return d[c[0].identifier] = !0, [c, c];var e,
+        f,
+        g = z(a.changedTouches),
+        h = [],
+        i = this.target;if (f = c.filter(function (a) {
+      return v(a.target, i);
+    }), b === O) for (e = 0; e < f.length;) {
+      d[f[e].identifier] = !0, e++;
+    }for (e = 0; e < g.length;) {
+      d[g[e].identifier] && h.push(g[e]), b & (Q | R) && delete d[g[e].identifier], e++;
+    }return h.length ? [A(f.concat(h), "identifier", !0), h] : void 0;
+  }function Gb() {
+    ab.apply(this, arguments);var a = q(this.handler, this);this.touch = new Eb(this.manager, a), this.mouse = new rb(this.manager, a);
+  }function Pb(a, b) {
+    this.manager = a, this.set(b);
+  }function Qb(a) {
+    if (w(a, Mb)) return Mb;var b = w(a, Nb),
+        c = w(a, Ob);return b && c ? Nb + " " + Ob : b || c ? b ? Nb : Ob : w(a, Lb) ? Lb : Kb;
+  }function Yb(a) {
+    this.id = D(), this.manager = null, this.options = o(a || {}, this.defaults), this.options.enable = s(this.options.enable, !0), this.state = Rb, this.simultaneous = {}, this.requireFail = [];
+  }function Zb(a) {
+    return a & Wb ? "cancel" : a & Ub ? "end" : a & Tb ? "move" : a & Sb ? "start" : "";
+  }function $b(a) {
+    return a == W ? "down" : a == V ? "up" : a == T ? "left" : a == U ? "right" : "";
+  }function _b(a, b) {
+    var c = b.manager;return c ? c.get(a) : a;
+  }function ac() {
+    Yb.apply(this, arguments);
+  }function bc() {
+    ac.apply(this, arguments), this.pX = null, this.pY = null;
+  }function cc() {
+    ac.apply(this, arguments);
+  }function dc() {
+    Yb.apply(this, arguments), this._timer = null, this._input = null;
+  }function ec() {
+    ac.apply(this, arguments);
+  }function fc() {
+    ac.apply(this, arguments);
+  }function gc() {
+    Yb.apply(this, arguments), this.pTime = !1, this.pCenter = !1, this._timer = null, this._input = null, this.count = 0;
+  }function hc(a, b) {
+    return b = b || {}, b.recognizers = s(b.recognizers, hc.defaults.preset), new kc(a, b);
+  }function kc(a, b) {
+    b = b || {}, this.options = o(b, hc.defaults), this.options.inputTarget = this.options.inputTarget || a, this.handlers = {}, this.session = {}, this.recognizers = [], this.element = a, this.input = bb(this), this.touchAction = new Pb(this, this.options.touchAction), lc(this, !0), m(b.recognizers, function (a) {
+      var b = this.add(new a[0](a[1]));a[2] && b.recognizeWith(a[2]), a[3] && b.requireFailure(a[3]);
+    }, this);
+  }function lc(a, b) {
+    var c = a.element;m(a.options.cssProps, function (a, d) {
+      c.style[B(c.style, d)] = b ? a : "";
+    });
+  }function mc(a, c) {
+    var d = b.createEvent("Event");d.initEvent(a, !0, !0), d.gesture = c, c.target.dispatchEvent(d);
+  }var e = ["", "webkit", "moz", "MS", "ms", "o"],
+      f = b.createElement("div"),
+      g = "function",
+      h = Math.round,
+      i = Math.abs,
+      j = Date.now,
+      C = 1,
+      F = /mobile|tablet|ip(ad|hone|od)|android/i,
+      G = "ontouchstart" in a,
+      H = B(a, "PointerEvent") !== d,
+      I = G && F.test(navigator.userAgent),
+      J = "touch",
+      K = "pen",
+      L = "mouse",
+      M = "kinect",
+      N = 25,
+      O = 1,
+      P = 2,
+      Q = 4,
+      R = 8,
+      S = 1,
+      T = 2,
+      U = 4,
+      V = 8,
+      W = 16,
+      X = T | U,
+      Y = V | W,
+      Z = X | Y,
+      $ = ["x", "y"],
+      _ = ["clientX", "clientY"];ab.prototype = { handler: function () {}, init: function () {
+      this.evEl && t(this.element, this.evEl, this.domHandler), this.evTarget && t(this.target, this.evTarget, this.domHandler), this.evWin && t(E(this.element), this.evWin, this.domHandler);
+    }, destroy: function () {
+      this.evEl && u(this.element, this.evEl, this.domHandler), this.evTarget && u(this.target, this.evTarget, this.domHandler), this.evWin && u(E(this.element), this.evWin, this.domHandler);
+    } };var ob = { mousedown: O, mousemove: P, mouseup: Q },
+      pb = "mousedown",
+      qb = "mousemove mouseup";p(rb, ab, { handler: function (a) {
+      var b = ob[a.type];b & O && 0 === a.button && (this.pressed = !0), b & P && 1 !== a.which && (b = Q), this.pressed && this.allow && (b & Q && (this.pressed = !1), this.callback(this.manager, b, { pointers: [a], changedPointers: [a], pointerType: L, srcEvent: a }));
+    } });var sb = { pointerdown: O, pointermove: P, pointerup: Q, pointercancel: R, pointerout: R },
+      tb = { 2: J, 3: K, 4: L, 5: M },
+      ub = "pointerdown",
+      vb = "pointermove pointerup pointercancel";a.MSPointerEvent && (ub = "MSPointerDown", vb = "MSPointerMove MSPointerUp MSPointerCancel"), p(wb, ab, { handler: function (a) {
+      var b = this.store,
+          c = !1,
+          d = a.type.toLowerCase().replace("ms", ""),
+          e = sb[d],
+          f = tb[a.pointerType] || a.pointerType,
+          g = f == J,
+          h = y(b, a.pointerId, "pointerId");e & O && (0 === a.button || g) ? 0 > h && (b.push(a), h = b.length - 1) : e & (Q | R) && (c = !0), 0 > h || (b[h] = a, this.callback(this.manager, e, { pointers: b, changedPointers: [a], pointerType: f, srcEvent: a }), c && b.splice(h, 1));
+    } });var xb = { touchstart: O, touchmove: P, touchend: Q, touchcancel: R },
+      yb = "touchstart",
+      zb = "touchstart touchmove touchend touchcancel";p(Ab, ab, { handler: function (a) {
+      var b = xb[a.type];if (b === O && (this.started = !0), this.started) {
+        var c = Bb.call(this, a, b);b & (Q | R) && 0 === c[0].length - c[1].length && (this.started = !1), this.callback(this.manager, b, { pointers: c[0], changedPointers: c[1], pointerType: J, srcEvent: a });
+      }
+    } });var Cb = { touchstart: O, touchmove: P, touchend: Q, touchcancel: R },
+      Db = "touchstart touchmove touchend touchcancel";p(Eb, ab, { handler: function (a) {
+      var b = Cb[a.type],
+          c = Fb.call(this, a, b);c && this.callback(this.manager, b, { pointers: c[0], changedPointers: c[1], pointerType: J, srcEvent: a });
+    } }), p(Gb, ab, { handler: function (a, b, c) {
+      var d = c.pointerType == J,
+          e = c.pointerType == L;if (d) this.mouse.allow = !1;else if (e && !this.mouse.allow) return;b & (Q | R) && (this.mouse.allow = !0), this.callback(a, b, c);
+    }, destroy: function () {
+      this.touch.destroy(), this.mouse.destroy();
+    } });var Hb = B(f.style, "touchAction"),
+      Ib = Hb !== d,
+      Jb = "compute",
+      Kb = "auto",
+      Lb = "manipulation",
+      Mb = "none",
+      Nb = "pan-x",
+      Ob = "pan-y";Pb.prototype = { set: function (a) {
+      a == Jb && (a = this.compute()), Ib && (this.manager.element.style[Hb] = a), this.actions = a.toLowerCase().trim();
+    }, update: function () {
+      this.set(this.manager.options.touchAction);
+    }, compute: function () {
+      var a = [];return m(this.manager.recognizers, function (b) {
+        r(b.options.enable, [b]) && (a = a.concat(b.getTouchAction()));
+      }), Qb(a.join(" "));
+    }, preventDefaults: function (a) {
+      if (!Ib) {
+        var b = a.srcEvent,
+            c = a.offsetDirection;if (this.manager.session.prevented) return b.preventDefault(), void 0;var d = this.actions,
+            e = w(d, Mb),
+            f = w(d, Ob),
+            g = w(d, Nb);return e || f && c & X || g && c & Y ? this.preventSrc(b) : void 0;
+      }
+    }, preventSrc: function (a) {
+      this.manager.session.prevented = !0, a.preventDefault();
+    } };var Rb = 1,
+      Sb = 2,
+      Tb = 4,
+      Ub = 8,
+      Vb = Ub,
+      Wb = 16,
+      Xb = 32;Yb.prototype = { defaults: {}, set: function (a) {
+      return n(this.options, a), this.manager && this.manager.touchAction.update(), this;
+    }, recognizeWith: function (a) {
+      if (l(a, "recognizeWith", this)) return this;var b = this.simultaneous;return a = _b(a, this), b[a.id] || (b[a.id] = a, a.recognizeWith(this)), this;
+    }, dropRecognizeWith: function (a) {
+      return l(a, "dropRecognizeWith", this) ? this : (a = _b(a, this), delete this.simultaneous[a.id], this);
+    }, requireFailure: function (a) {
+      if (l(a, "requireFailure", this)) return this;var b = this.requireFail;return a = _b(a, this), -1 === y(b, a) && (b.push(a), a.requireFailure(this)), this;
+    }, dropRequireFailure: function (a) {
+      if (l(a, "dropRequireFailure", this)) return this;a = _b(a, this);var b = y(this.requireFail, a);return b > -1 && this.requireFail.splice(b, 1), this;
+    }, hasRequireFailures: function () {
+      return this.requireFail.length > 0;
+    }, canRecognizeWith: function (a) {
+      return !!this.simultaneous[a.id];
+    }, emit: function (a) {
+      function d(d) {
+        b.manager.emit(b.options.event + (d ? Zb(c) : ""), a);
+      }var b = this,
+          c = this.state;Ub > c && d(!0), d(), c >= Ub && d(!0);
+    }, tryEmit: function (a) {
+      return this.canEmit() ? this.emit(a) : (this.state = Xb, void 0);
+    }, canEmit: function () {
+      for (var a = 0; a < this.requireFail.length;) {
+        if (!(this.requireFail[a].state & (Xb | Rb))) return !1;a++;
+      }return !0;
+    }, recognize: function (a) {
+      var b = n({}, a);return r(this.options.enable, [this, b]) ? (this.state & (Vb | Wb | Xb) && (this.state = Rb), this.state = this.process(b), this.state & (Sb | Tb | Ub | Wb) && this.tryEmit(b), void 0) : (this.reset(), this.state = Xb, void 0);
+    }, process: function () {}, getTouchAction: function () {}, reset: function () {} }, p(ac, Yb, { defaults: { pointers: 1 }, attrTest: function (a) {
+      var b = this.options.pointers;return 0 === b || a.pointers.length === b;
+    }, process: function (a) {
+      var b = this.state,
+          c = a.eventType,
+          d = b & (Sb | Tb),
+          e = this.attrTest(a);return d && (c & R || !e) ? b | Wb : d || e ? c & Q ? b | Ub : b & Sb ? b | Tb : Sb : Xb;
+    } }), p(bc, ac, { defaults: { event: "pan", threshold: 10, pointers: 1, direction: Z }, getTouchAction: function () {
+      var a = this.options.direction,
+          b = [];return a & X && b.push(Ob), a & Y && b.push(Nb), b;
+    }, directionTest: function (a) {
+      var b = this.options,
+          c = !0,
+          d = a.distance,
+          e = a.direction,
+          f = a.deltaX,
+          g = a.deltaY;return e & b.direction || (b.direction & X ? (e = 0 === f ? S : 0 > f ? T : U, c = f != this.pX, d = Math.abs(a.deltaX)) : (e = 0 === g ? S : 0 > g ? V : W, c = g != this.pY, d = Math.abs(a.deltaY))), a.direction = e, c && d > b.threshold && e & b.direction;
+    }, attrTest: function (a) {
+      return ac.prototype.attrTest.call(this, a) && (this.state & Sb || !(this.state & Sb) && this.directionTest(a));
+    }, emit: function (a) {
+      this.pX = a.deltaX, this.pY = a.deltaY;var b = $b(a.direction);b && this.manager.emit(this.options.event + b, a), this._super.emit.call(this, a);
+    } }), p(cc, ac, { defaults: { event: "pinch", threshold: 0, pointers: 2 }, getTouchAction: function () {
+      return [Mb];
+    }, attrTest: function (a) {
+      return this._super.attrTest.call(this, a) && (Math.abs(a.scale - 1) > this.options.threshold || this.state & Sb);
+    }, emit: function (a) {
+      if (this._super.emit.call(this, a), 1 !== a.scale) {
+        var b = a.scale < 1 ? "in" : "out";this.manager.emit(this.options.event + b, a);
+      }
+    } }), p(dc, Yb, { defaults: { event: "press", pointers: 1, time: 500, threshold: 5 }, getTouchAction: function () {
+      return [Kb];
+    }, process: function (a) {
+      var b = this.options,
+          c = a.pointers.length === b.pointers,
+          d = a.distance < b.threshold,
+          e = a.deltaTime > b.time;if (this._input = a, !d || !c || a.eventType & (Q | R) && !e) this.reset();else if (a.eventType & O) this.reset(), this._timer = k(function () {
+        this.state = Vb, this.tryEmit();
+      }, b.time, this);else if (a.eventType & Q) return Vb;return Xb;
+    }, reset: function () {
+      clearTimeout(this._timer);
+    }, emit: function (a) {
+      this.state === Vb && (a && a.eventType & Q ? this.manager.emit(this.options.event + "up", a) : (this._input.timeStamp = j(), this.manager.emit(this.options.event, this._input)));
+    } }), p(ec, ac, { defaults: { event: "rotate", threshold: 0, pointers: 2 }, getTouchAction: function () {
+      return [Mb];
+    }, attrTest: function (a) {
+      return this._super.attrTest.call(this, a) && (Math.abs(a.rotation) > this.options.threshold || this.state & Sb);
+    } }), p(fc, ac, { defaults: { event: "swipe", threshold: 10, velocity: .65, direction: X | Y, pointers: 1 }, getTouchAction: function () {
+      return bc.prototype.getTouchAction.call(this);
+    }, attrTest: function (a) {
+      var c,
+          b = this.options.direction;return b & (X | Y) ? c = a.velocity : b & X ? c = a.velocityX : b & Y && (c = a.velocityY), this._super.attrTest.call(this, a) && b & a.direction && a.distance > this.options.threshold && i(c) > this.options.velocity && a.eventType & Q;
+    }, emit: function (a) {
+      var b = $b(a.direction);b && this.manager.emit(this.options.event + b, a), this.manager.emit(this.options.event, a);
+    } }), p(gc, Yb, { defaults: { event: "tap", pointers: 1, taps: 1, interval: 300, time: 250, threshold: 2, posThreshold: 10 }, getTouchAction: function () {
+      return [Lb];
+    }, process: function (a) {
+      var b = this.options,
+          c = a.pointers.length === b.pointers,
+          d = a.distance < b.threshold,
+          e = a.deltaTime < b.time;if (this.reset(), a.eventType & O && 0 === this.count) return this.failTimeout();if (d && e && c) {
+        if (a.eventType != Q) return this.failTimeout();var f = this.pTime ? a.timeStamp - this.pTime < b.interval : !0,
+            g = !this.pCenter || kb(this.pCenter, a.center) < b.posThreshold;this.pTime = a.timeStamp, this.pCenter = a.center, g && f ? this.count += 1 : this.count = 1, this._input = a;var h = this.count % b.taps;if (0 === h) return this.hasRequireFailures() ? (this._timer = k(function () {
+          this.state = Vb, this.tryEmit();
+        }, b.interval, this), Sb) : Vb;
+      }return Xb;
+    }, failTimeout: function () {
+      return this._timer = k(function () {
+        this.state = Xb;
+      }, this.options.interval, this), Xb;
+    }, reset: function () {
+      clearTimeout(this._timer);
+    }, emit: function () {
+      this.state == Vb && (this._input.tapCount = this.count, this.manager.emit(this.options.event, this._input));
+    } }), hc.VERSION = "2.0.4", hc.defaults = { domEvents: !1, touchAction: Jb, enable: !0, inputTarget: null, inputClass: null, preset: [[ec, { enable: !1 }], [cc, { enable: !1 }, ["rotate"]], [fc, { direction: X }], [bc, { direction: X }, ["swipe"]], [gc], [gc, { event: "doubletap", taps: 2 }, ["tap"]], [dc]], cssProps: { userSelect: "default", touchSelect: "none", touchCallout: "none", contentZooming: "none", userDrag: "none", tapHighlightColor: "rgba(0,0,0,0)" } };var ic = 1,
+      jc = 2;kc.prototype = { set: function (a) {
+      return n(this.options, a), a.touchAction && this.touchAction.update(), a.inputTarget && (this.input.destroy(), this.input.target = a.inputTarget, this.input.init()), this;
+    }, stop: function (a) {
+      this.session.stopped = a ? jc : ic;
+    }, recognize: function (a) {
+      var b = this.session;if (!b.stopped) {
+        this.touchAction.preventDefaults(a);var c,
+            d = this.recognizers,
+            e = b.curRecognizer;(!e || e && e.state & Vb) && (e = b.curRecognizer = null);for (var f = 0; f < d.length;) {
+          c = d[f], b.stopped === jc || e && c != e && !c.canRecognizeWith(e) ? c.reset() : c.recognize(a), !e && c.state & (Sb | Tb | Ub) && (e = b.curRecognizer = c), f++;
+        }
+      }
+    }, get: function (a) {
+      if (a instanceof Yb) return a;for (var b = this.recognizers, c = 0; c < b.length; c++) {
+        if (b[c].options.event == a) return b[c];
+      }return null;
+    }, add: function (a) {
+      if (l(a, "add", this)) return this;var b = this.get(a.options.event);return b && this.remove(b), this.recognizers.push(a), a.manager = this, this.touchAction.update(), a;
+    }, remove: function (a) {
+      if (l(a, "remove", this)) return this;var b = this.recognizers;return a = this.get(a), b.splice(y(b, a), 1), this.touchAction.update(), this;
+    }, on: function (a, b) {
+      var c = this.handlers;return m(x(a), function (a) {
+        c[a] = c[a] || [], c[a].push(b);
+      }), this;
+    }, off: function (a, b) {
+      var c = this.handlers;return m(x(a), function (a) {
+        b ? c[a].splice(y(c[a], b), 1) : delete c[a];
+      }), this;
+    }, emit: function (a, b) {
+      this.options.domEvents && mc(a, b);var c = this.handlers[a] && this.handlers[a].slice();if (c && c.length) {
+        b.type = a, b.preventDefault = function () {
+          b.srcEvent.preventDefault();
+        };for (var d = 0; d < c.length;) {
+          c[d](b), d++;
+        }
+      }
+    }, destroy: function () {
+      this.element && lc(this, !1), this.handlers = {}, this.session = {}, this.input.destroy(), this.element = null;
+    } }, n(hc, { INPUT_START: O, INPUT_MOVE: P, INPUT_END: Q, INPUT_CANCEL: R, STATE_POSSIBLE: Rb, STATE_BEGAN: Sb, STATE_CHANGED: Tb, STATE_ENDED: Ub, STATE_RECOGNIZED: Vb, STATE_CANCELLED: Wb, STATE_FAILED: Xb, DIRECTION_NONE: S, DIRECTION_LEFT: T, DIRECTION_RIGHT: U, DIRECTION_UP: V, DIRECTION_DOWN: W, DIRECTION_HORIZONTAL: X, DIRECTION_VERTICAL: Y, DIRECTION_ALL: Z, Manager: kc, Input: ab, TouchAction: Pb, TouchInput: Eb, MouseInput: rb, PointerEventInput: wb, TouchMouseInput: Gb, SingleTouchInput: Ab, Recognizer: Yb, AttrRecognizer: ac, Tap: gc, Pan: bc, Swipe: fc, Pinch: cc, Rotate: ec, Press: dc, on: t, off: u, each: m, merge: o, extend: n, inherit: p, bindFn: q, prefixed: B }), typeof define == g && define.amd ? define(function () {
+    return hc;
+  }) : "undefined" != typeof module && module.exports ? module.exports = hc : a[c] = hc;
+}(window, document, "Hammer");;(function (factory) {
+  if (typeof define === 'function' && define.amd) {
+    define(['jquery', 'hammerjs'], factory);
+  } else if (typeof exports === 'object') {
+    factory(require('jquery'), require('hammerjs'));
+  } else {
+    factory(jQuery, Hammer);
+  }
+})(function ($, Hammer) {
+  function hammerify(el, options) {
+    var $el = $(el);
+    if (!$el.data("hammer")) {
+      $el.data("hammer", new Hammer($el[0], options));
+    }
+  }
+
+  $.fn.hammer = function (options) {
+    return this.each(function () {
+      hammerify(this, options);
+    });
+  };
+
+  // extend the emit method to also trigger jQuery events
+  Hammer.Manager.prototype.emit = function (originalEmit) {
+    return function (type, data) {
+      originalEmit.call(this, type, data);
+      $(this.element).trigger({
+        type: type,
+        gesture: data
+      });
+    };
+  }(Hammer.Manager.prototype.emit);
+});
+; // Required for Meteor package, the use of window prevents export by Meteor
+(function (window) {
+  if (window.Package) {
+    Materialize = {};
+  } else {
+    window.Materialize = {};
+  }
+})(window);
+
+if (typeof exports !== 'undefined' && !exports.nodeType) {
+  if (typeof module !== 'undefined' && !module.nodeType && module.exports) {
+    exports = module.exports = Materialize;
+  }
+  exports.default = Materialize;
+}
+
+/*
+ * raf.js
+ * https://github.com/ngryman/raf.js
+ *
+ * original requestAnimationFrame polyfill by Erik Möller
+ * inspired from paul_irish gist and post
+ *
+ * Copyright (c) 2013 ngryman
+ * Licensed under the MIT license.
+ */
+(function (window) {
+  var lastTime = 0,
+      vendors = ['webkit', 'moz'],
+      requestAnimationFrame = window.requestAnimationFrame,
+      cancelAnimationFrame = window.cancelAnimationFrame,
+      i = vendors.length;
+
+  // try to un-prefix existing raf
+  while (--i >= 0 && !requestAnimationFrame) {
+    requestAnimationFrame = window[vendors[i] + 'RequestAnimationFrame'];
+    cancelAnimationFrame = window[vendors[i] + 'CancelRequestAnimationFrame'];
+  }
+
+  // polyfill with setTimeout fallback
+  // heavily inspired from @darius gist mod: https://gist.github.com/paulirish/1579671#comment-837945
+  if (!requestAnimationFrame || !cancelAnimationFrame) {
+    requestAnimationFrame = function (callback) {
+      var now = +Date.now(),
+          nextTime = Math.max(lastTime + 16, now);
+      return setTimeout(function () {
+        callback(lastTime = nextTime);
+      }, nextTime - now);
+    };
+
+    cancelAnimationFrame = clearTimeout;
+  }
+
+  // export to window
+  window.requestAnimationFrame = requestAnimationFrame;
+  window.cancelAnimationFrame = cancelAnimationFrame;
+})(window);
+
+/**
+ * Generate approximated selector string for a jQuery object
+ * @param {jQuery} obj  jQuery object to be parsed
+ * @returns {string}
+ */
+Materialize.objectSelectorString = function (obj) {
+  var tagStr = obj.prop('tagName') || '';
+  var idStr = obj.attr('id') || '';
+  var classStr = obj.attr('class') || '';
+  return (tagStr + idStr + classStr).replace(/\s/g, '');
+};
+
+// Unique Random ID
+Materialize.guid = function () {
+  function s4() {
+    return Math.floor((1 + Math.random()) * 0x10000).toString(16).substring(1);
+  }
+  return function () {
+    return s4() + s4() + '-' + s4() + '-' + s4() + '-' + s4() + '-' + s4() + s4() + s4();
+  };
+}();
+
+/**
+ * Escapes hash from special characters
+ * @param {string} hash  String returned from this.hash
+ * @returns {string}
+ */
+Materialize.escapeHash = function (hash) {
+  return hash.replace(/(:|\.|\[|\]|,|=)/g, "\\$1");
+};
+
+Materialize.elementOrParentIsFixed = function (element) {
+  var $element = $(element);
+  var $checkElements = $element.add($element.parents());
+  var isFixed = false;
+  $checkElements.each(function () {
+    if ($(this).css("position") === "fixed") {
+      isFixed = true;
+      return false;
+    }
+  });
+  return isFixed;
+};
+
+/**
+ * Get time in ms
+ * @license https://raw.github.com/jashkenas/underscore/master/LICENSE
+ * @type {function}
+ * @return {number}
+ */
+var getTime = Date.now || function () {
+  return new Date().getTime();
+};
+
+/**
+ * Returns a function, that, when invoked, will only be triggered at most once
+ * during a given window of time. Normally, the throttled function will run
+ * as much as it can, without ever going more than once per `wait` duration;
+ * but if you'd like to disable the execution on the leading edge, pass
+ * `{leading: false}`. To disable execution on the trailing edge, ditto.
+ * @license https://raw.github.com/jashkenas/underscore/master/LICENSE
+ * @param {function} func
+ * @param {number} wait
+ * @param {Object=} options
+ * @returns {Function}
+ */
+Materialize.throttle = function (func, wait, options) {
+  var context, args, result;
+  var timeout = null;
+  var previous = 0;
+  options || (options = {});
+  var later = function () {
+    previous = options.leading === false ? 0 : getTime();
+    timeout = null;
+    result = func.apply(context, args);
+    context = args = null;
+  };
+  return function () {
+    var now = getTime();
+    if (!previous && options.leading === false) previous = now;
+    var remaining = wait - (now - previous);
+    context = this;
+    args = arguments;
+    if (remaining <= 0) {
+      clearTimeout(timeout);
+      timeout = null;
+      previous = now;
+      result = func.apply(context, args);
+      context = args = null;
+    } else if (!timeout && options.trailing !== false) {
+      timeout = setTimeout(later, remaining);
+    }
+    return result;
+  };
+};
+
+// Velocity has conflicts when loaded with jQuery, this will check for it
+// First, check if in noConflict mode
+var Vel;
+if (jQuery) {
+  Vel = jQuery.Velocity;
+} else if ($) {
+  Vel = $.Velocity;
+} else {
+  Vel = Velocity;
+}
+
+if (Vel) {
+  Materialize.Vel = Vel;
+} else {
+  Materialize.Vel = Velocity;
+}
+;(function ($) {
+  $.fn.collapsible = function (options, methodParam) {
+    var defaults = {
+      accordion: undefined,
+      onOpen: undefined,
+      onClose: undefined
+    };
+
+    var methodName = options;
+    options = $.extend(defaults, options);
+
+    return this.each(function () {
+
+      var $this = $(this);
+
+      var $panel_headers = $(this).find('> li > .collapsible-header');
+
+      var collapsible_type = $this.data("collapsible");
+
+      /****************
+      Helper Functions
+      ****************/
+
+      // Accordion Open
+      function accordionOpen(object) {
+        $panel_headers = $this.find('> li > .collapsible-header');
+        if (object.hasClass('active')) {
+          object.parent().addClass('active');
+        } else {
+          object.parent().removeClass('active');
+        }
+        if (object.parent().hasClass('active')) {
+          object.siblings('.collapsible-body').stop(true, false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () {
+              $(this).css('height', '');
+            } });
+        } else {
+          object.siblings('.collapsible-body').stop(true, false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () {
+              $(this).css('height', '');
+            } });
+        }
+
+        $panel_headers.not(object).removeClass('active').parent().removeClass('active');
+
+        // Close previously open accordion elements.
+        $panel_headers.not(object).parent().children('.collapsible-body').stop(true, false).each(function () {
+          if ($(this).is(':visible')) {
+            $(this).slideUp({
+              duration: 350,
+              easing: "easeOutQuart",
+              queue: false,
+              complete: function () {
+                $(this).css('height', '');
+                execCallbacks($(this).siblings('.collapsible-header'));
+              }
+            });
+          }
+        });
+      }
+
+      // Expandable Open
+      function expandableOpen(object) {
+        if (object.hasClass('active')) {
+          object.parent().addClass('active');
+        } else {
+          object.parent().removeClass('active');
+        }
+        if (object.parent().hasClass('active')) {
+          object.siblings('.collapsible-body').stop(true, false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () {
+              $(this).css('height', '');
+            } });
+        } else {
+          object.siblings('.collapsible-body').stop(true, false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () {
+              $(this).css('height', '');
+            } });
+        }
+      }
+
+      // Open collapsible. object: .collapsible-header
+      function collapsibleOpen(object, noToggle) {
+        if (!noToggle) {
+          object.toggleClass('active');
+        }
+
+        if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) {
+          // Handle Accordion
+          accordionOpen(object);
+        } else {
+          // Handle Expandables
+          expandableOpen(object);
+        }
+
+        execCallbacks(object);
+      }
+
+      // Handle callbacks
+      function execCallbacks(object) {
+        if (object.hasClass('active')) {
+          if (typeof options.onOpen === "function") {
+            options.onOpen.call(this, object.parent());
+          }
+        } else {
+          if (typeof options.onClose === "function") {
+            options.onClose.call(this, object.parent());
+          }
+        }
+      }
+
+      /**
+       * Check if object is children of panel header
+       * @param  {Object}  object Jquery object
+       * @return {Boolean} true if it is children
+       */
+      function isChildrenOfPanelHeader(object) {
+
+        var panelHeader = getPanelHeader(object);
+
+        return panelHeader.length > 0;
+      }
+
+      /**
+       * Get panel header from a children element
+       * @param  {Object} object Jquery object
+       * @return {Object} panel header object
+       */
+      function getPanelHeader(object) {
+
+        return object.closest('li > .collapsible-header');
+      }
+
+      // Turn off any existing event handlers
+      function removeEventHandlers() {
+        $this.off('click.collapse', '> li > .collapsible-header');
+      }
+
+      /*****  End Helper Functions  *****/
+
+      // Methods
+      if (methodName === 'destroy') {
+        removeEventHandlers();
+        return;
+      } else if (methodParam >= 0 && methodParam < $panel_headers.length) {
+        var $curr_header = $panel_headers.eq(methodParam);
+        if ($curr_header.length && (methodName === 'open' || methodName === 'close' && $curr_header.hasClass('active'))) {
+          collapsibleOpen($curr_header);
+        }
+        return;
+      }
+
+      removeEventHandlers();
+
+      // Add click handler to only direct collapsible header children
+      $this.on('click.collapse', '> li > .collapsible-header', function (e) {
+        var element = $(e.target);
+
+        if (isChildrenOfPanelHeader(element)) {
+          element = getPanelHeader(element);
+        }
+
+        collapsibleOpen(element);
+      });
+
+      // Open first active
+      if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) {
+        // Handle Accordion
+        collapsibleOpen($panel_headers.filter('.active').first(), true);
+      } else {
+        // Handle Expandables
+        $panel_headers.filter('.active').each(function () {
+          collapsibleOpen($(this), true);
+        });
+      }
+    });
+  };
+
+  $(document).ready(function () {
+    $('.collapsible').collapsible();
+  });
+})(jQuery);;(function ($) {
+
+  // Add posibility to scroll to selected option
+  // usefull for select for example
+  $.fn.scrollTo = function (elem) {
+    $(this).scrollTop($(this).scrollTop() - $(this).offset().top + $(elem).offset().top);
+    return this;
+  };
+
+  $.fn.dropdown = function (options) {
+    var defaults = {
+      inDuration: 300,
+      outDuration: 225,
+      constrainWidth: true, // Constrains width of dropdown to the activator
+      hover: false,
+      gutter: 0, // Spacing from edge
+      belowOrigin: false,
+      alignment: 'left',
+      stopPropagation: false
+    };
+
+    // Open dropdown.
+    if (options === "open") {
+      this.each(function () {
+        $(this).trigger('open');
+      });
+      return false;
+    }
+
+    // Close dropdown.
+    if (options === "close") {
+      this.each(function () {
+        $(this).trigger('close');
+      });
+      return false;
+    }
+
+    this.each(function () {
+      var origin = $(this);
+      var curr_options = $.extend({}, defaults, options);
+      var isFocused = false;
+
+      // Dropdown menu
+      var activates = $("#" + origin.attr('data-activates'));
+
+      function updateOptions() {
+        if (origin.data('induration') !== undefined) curr_options.inDuration = origin.data('induration');
+        if (origin.data('outduration') !== undefined) curr_options.outDuration = origin.data('outduration');
+        if (origin.data('constrainwidth') !== undefined) curr_options.constrainWidth = origin.data('constrainwidth');
+        if (origin.data('hover') !== undefined) curr_options.hover = origin.data('hover');
+        if (origin.data('gutter') !== undefined) curr_options.gutter = origin.data('gutter');
+        if (origin.data('beloworigin') !== undefined) curr_options.belowOrigin = origin.data('beloworigin');
+        if (origin.data('alignment') !== undefined) curr_options.alignment = origin.data('alignment');
+        if (origin.data('stoppropagation') !== undefined) curr_options.stopPropagation = origin.data('stoppropagation');
+      }
+
+      updateOptions();
+
+      // Attach dropdown to its activator
+      origin.after(activates);
+
+      /*
+        Helper function to position and resize dropdown.
+        Used in hover and click handler.
+      */
+      function placeDropdown(eventType) {
+        // Check for simultaneous focus and click events.
+        if (eventType === 'focus') {
+          isFocused = true;
+        }
+
+        // Check html data attributes
+        updateOptions();
+
+        // Set Dropdown state
+        activates.addClass('active');
+        origin.addClass('active');
+
+        var originWidth = origin[0].getBoundingClientRect().width;
+
+        // Constrain width
+        if (curr_options.constrainWidth === true) {
+          activates.css('width', originWidth);
+        } else {
+          activates.css('white-space', 'nowrap');
+        }
+
+        // Offscreen detection
+        var windowHeight = window.innerHeight;
+        var originHeight = origin.innerHeight();
+        var offsetLeft = origin.offset().left;
+        var offsetTop = origin.offset().top - $(window).scrollTop();
+        var currAlignment = curr_options.alignment;
+        var gutterSpacing = 0;
+        var leftPosition = 0;
+
+        // Below Origin
+        var verticalOffset = 0;
+        if (curr_options.belowOrigin === true) {
+          verticalOffset = originHeight;
+        }
+
+        // Check for scrolling positioned container.
+        var scrollYOffset = 0;
+        var scrollXOffset = 0;
+        var wrapper = origin.parent();
+        if (!wrapper.is('body')) {
+          if (wrapper[0].scrollHeight > wrapper[0].clientHeight) {
+            scrollYOffset = wrapper[0].scrollTop;
+          }
+          if (wrapper[0].scrollWidth > wrapper[0].clientWidth) {
+            scrollXOffset = wrapper[0].scrollLeft;
+          }
+        }
+
+        if (offsetLeft + activates.innerWidth() > $(window).width()) {
+          // Dropdown goes past screen on right, force right alignment
+          currAlignment = 'right';
+        } else if (offsetLeft - activates.innerWidth() + origin.innerWidth() < 0) {
+          // Dropdown goes past screen on left, force left alignment
+          currAlignment = 'left';
+        }
+        // Vertical bottom offscreen detection
+        if (offsetTop + activates.innerHeight() > windowHeight) {
+          // If going upwards still goes offscreen, just crop height of dropdown.
+          if (offsetTop + originHeight - activates.innerHeight() < 0) {
+            var adjustedHeight = windowHeight - offsetTop - verticalOffset;
+            activates.css('max-height', adjustedHeight);
+          } else {
+            // Flow upwards.
+            if (!verticalOffset) {
+              verticalOffset += originHeight;
+            }
+            verticalOffset -= activates.innerHeight();
+          }
+        }
+
+        // Handle edge alignment
+        if (currAlignment === 'left') {
+          gutterSpacing = curr_options.gutter;
+          leftPosition = origin.position().left + gutterSpacing;
+        } else if (currAlignment === 'right') {
+          // Material icons fix
+          activates.stop(true, true).css({
+            opacity: 0,
+            left: 0
+          });
+
+          var offsetRight = origin.position().left + originWidth - activates.width();
+          gutterSpacing = -curr_options.gutter;
+          leftPosition = offsetRight + gutterSpacing;
+        }
+
+        // Position dropdown
+        activates.css({
+          position: 'absolute',
+          top: origin.position().top + verticalOffset + scrollYOffset,
+          left: leftPosition + scrollXOffset
+        });
+
+        // Show dropdown
+        activates.slideDown({
+          queue: false,
+          duration: curr_options.inDuration,
+          easing: 'easeOutCubic',
+          complete: function () {
+            $(this).css('height', '');
+          }
+        }).animate({ opacity: 1 }, { queue: false, duration: curr_options.inDuration, easing: 'easeOutSine' });
+
+        // Add click close handler to document
+        setTimeout(function () {
+          $(document).on('click.' + activates.attr('id'), function (e) {
+            hideDropdown();
+            $(document).off('click.' + activates.attr('id'));
+          });
+        }, 0);
+      }
+
+      function hideDropdown() {
+        // Check for simultaneous focus and click events.
+        isFocused = false;
+        activates.fadeOut(curr_options.outDuration);
+        activates.removeClass('active');
+        origin.removeClass('active');
+        $(document).off('click.' + activates.attr('id'));
+        setTimeout(function () {
+          activates.css('max-height', '');
+        }, curr_options.outDuration);
+      }
+
+      // Hover
+      if (curr_options.hover) {
+        var open = false;
+        origin.off('click.' + origin.attr('id'));
+        // Hover handler to show dropdown
+        origin.on('mouseenter', function (e) {
+          // Mouse over
+          if (open === false) {
+            placeDropdown();
+            open = true;
+          }
+        });
+        origin.on('mouseleave', function (e) {
+          // If hover on origin then to something other than dropdown content, then close
+          var toEl = e.toElement || e.relatedTarget; // added browser compatibility for target element
+          if (!$(toEl).closest('.dropdown-content').is(activates)) {
+            activates.stop(true, true);
+            hideDropdown();
+            open = false;
+          }
+        });
+
+        activates.on('mouseleave', function (e) {
+          // Mouse out
+          var toEl = e.toElement || e.relatedTarget;
+          if (!$(toEl).closest('.dropdown-button').is(origin)) {
+            activates.stop(true, true);
+            hideDropdown();
+            open = false;
+          }
+        });
+
+        // Click
+      } else {
+        // Click handler to show dropdown
+        origin.off('click.' + origin.attr('id'));
+        origin.on('click.' + origin.attr('id'), function (e) {
+          if (!isFocused) {
+            if (origin[0] == e.currentTarget && !origin.hasClass('active') && $(e.target).closest('.dropdown-content').length === 0) {
+              e.preventDefault(); // Prevents button click from moving window
+              if (curr_options.stopPropagation) {
+                e.stopPropagation();
+              }
+              placeDropdown('click');
+            }
+            // If origin is clicked and menu is open, close menu
+            else if (origin.hasClass('active')) {
+                hideDropdown();
+                $(document).off('click.' + activates.attr('id'));
+              }
+          }
+        });
+      } // End else
+
+      // Listen to open and close event - useful for select component
+      origin.on('open', function (e, eventType) {
+        placeDropdown(eventType);
+      });
+      origin.on('close', hideDropdown);
+    });
+  }; // End dropdown plugin
+
+  $(document).ready(function () {
+    $('.dropdown-button').dropdown();
+  });
+})(jQuery);
+;(function ($, Vel) {
+  'use strict';
+
+  var _defaults = {
+    opacity: 0.5,
+    inDuration: 250,
+    outDuration: 250,
+    ready: undefined,
+    complete: undefined,
+    dismissible: true,
+    startingTop: '4%',
+    endingTop: '10%'
+  };
+
+  /**
+   * @class
+   *
+   */
+
+  var Modal = function () {
+    /**
+     * Construct Modal instance and set up overlay
+     * @constructor
+     * @param {jQuery} $el
+     * @param {Object} options
+     */
+    function Modal($el, options) {
+      _classCallCheck(this, Modal);
+
+      // If exists, destroy and reinitialize
+      if (!!$el[0].M_Modal) {
+        $el[0].M_Modal.destroy();
+      }
+
+      /**
+       * The jQuery element
+       * @type {jQuery}
+       */
+      this.$el = $el;
+
+      /**
+       * Options for the modal
+       * @member Modal#options
+       * @prop {Number} [opacity=0.5] - Opacity of the modal overlay
+       * @prop {Number} [inDuration=250] - Length in ms of enter transition
+       * @prop {Number} [outDuration=250] - Length in ms of exit transition
+       * @prop {Function} ready - Callback function called when modal is finished entering
+       * @prop {Function} complete - Callback function called when modal is finished exiting
+       * @prop {Boolean} [dismissible=true] - Allow modal to be dismissed by keyboard or overlay click
+       * @prop {String} [startingTop='4%'] - startingTop
+       * @prop {String} [endingTop='10%'] - endingTop
+       */
+      this.options = $.extend({}, Modal.defaults, options);
+
+      /**
+       * Describes open/close state of modal
+       * @type {Boolean}
+       */
+      this.isOpen = false;
+
+      this.$el[0].M_Modal = this;
+      this.id = $el.attr('id');
+      this.openingTrigger = undefined;
+      this.$overlay = $('<div class="modal-overlay"></div>');
+
+      Modal._increment++;
+      Modal._count++;
+      this.$overlay[0].style.zIndex = 1000 + Modal._increment * 2;
+      this.$el[0].style.zIndex = 1000 + Modal._increment * 2 + 1;
+      this.setupEventHandlers();
+    }
+
+    _createClass(Modal, [{
+      key: 'getInstance',
+
+
+      /**
+       * Get Instance
+       */
+      value: function getInstance() {
+        return this;
+      }
+
+      /**
+       * Teardown component
+       */
+
+    }, {
+      key: 'destroy',
+      value: function destroy() {
+        this.removeEventHandlers();
+        this.$el[0].removeAttribute('style');
+        if (!!this.$overlay[0].parentNode) {
+          this.$overlay[0].parentNode.removeChild(this.$overlay[0]);
+        }
+        this.$el[0].M_Modal = undefined;
+        Modal._count--;
+      }
+
+      /**
+       * Setup Event Handlers
+       */
+
+    }, {
+      key: 'setupEventHandlers',
+      value: function setupEventHandlers() {
+        this.handleOverlayClickBound = this.handleOverlayClick.bind(this);
+        this.handleModalCloseClickBound = this.handleModalCloseClick.bind(this);
+
+        if (Modal._count === 1) {
+          document.body.addEventListener('click', this.handleTriggerClick);
+        }
+        this.$overlay[0].addEventListener('click', this.handleOverlayClickBound);
+        this.$el[0].addEventListener('click', this.handleModalCloseClickBound);
+      }
+
+      /**
+       * Remove Event Handlers
+       */
+
+    }, {
+      key: 'removeEventHandlers',
+      value: function removeEventHandlers() {
+        if (Modal._count === 0) {
+          document.body.removeEventListener('click', this.handleTriggerClick);
+        }
+        this.$overlay[0].removeEventListener('click', this.handleOverlayClickBound);
+        this.$el[0].removeEventListener('click', this.handleModalCloseClickBound);
+      }
+
+      /**
+       * Handle Trigger Click
+       * @param {Event} e
+       */
+
+    }, {
+      key: 'handleTriggerClick',
+      value: function handleTriggerClick(e) {
+        var $trigger = $(e.target).closest('.modal-trigger');
+        if (e.target && $trigger.length) {
+          var modalId = $trigger[0].getAttribute('href');
+          if (modalId) {
+            modalId = modalId.slice(1);
+          } else {
+            modalId = $trigger[0].getAttribute('data-target');
+          }
+          var modalInstance = document.getElementById(modalId).M_Modal;
+          if (modalInstance) {
+            modalInstance.open($trigger);
+          }
+          e.preventDefault();
+        }
+      }
+
+      /**
+       * Handle Overlay Click
+       */
+
+    }, {
+      key: 'handleOverlayClick',
+      value: function handleOverlayClick() {
+        if (this.options.dismissible) {
+          this.close();
+        }
+      }
+
+      /**
+       * Handle Modal Close Click
+       * @param {Event} e
+       */
+
+    }, {
+      key: 'handleModalCloseClick',
+      value: function handleModalCloseClick(e) {
+        var $closeTrigger = $(e.target).closest('.modal-close');
+        if (e.target && $closeTrigger.length) {
+          this.close();
+        }
+      }
+
+      /**
+       * Handle Keydown
+       * @param {Event} e
+       */
+
+    }, {
+      key: 'handleKeydown',
+      value: function handleKeydown(e) {
+        // ESC key
+        if (e.keyCode === 27 && this.options.dismissible) {
+          this.close();
+        }
+      }
+
+      /**
+       * Animate in modal
+       */
+
+    }, {
+      key: 'animateIn',
+      value: function animateIn() {
+        var _this = this;
+
+        // Set initial styles
+        $.extend(this.$el[0].style, {
+          display: 'block',
+          opacity: 0
+        });
+        $.extend(this.$overlay[0].style, {
+          display: 'block',
+          opacity: 0
+        });
+
+        // Animate overlay
+        Vel(this.$overlay[0], { opacity: this.options.opacity }, { duration: this.options.inDuration, queue: false, ease: 'easeOutCubic' });
+
+        // Define modal animation options
+        var enterVelocityOptions = {
+          duration: this.options.inDuration,
+          queue: false,
+          ease: 'easeOutCubic',
+          // Handle modal ready callback
+          complete: function () {
+            if (typeof _this.options.ready === 'function') {
+              _this.options.ready.call(_this, _this.$el, _this.openingTrigger);
+            }
+          }
+        };
+
+        // Bottom sheet animation
+        if (this.$el[0].classList.contains('bottom-sheet')) {
+          Vel(this.$el[0], { bottom: 0, opacity: 1 }, enterVelocityOptions);
+
+          // Normal modal animation
+        } else {
+          Vel.hook(this.$el[0], 'scaleX', 0.7);
+          this.$el[0].style.top = this.options.startingTop;
+          Vel(this.$el[0], { top: this.options.endingTop, opacity: 1, scaleX: 1 }, enterVelocityOptions);
+        }
+      }
+
+      /**
+       * Animate out modal
+       */
+
+    }, {
+      key: 'animateOut',
+      value: function animateOut() {
+        var _this2 = this;
+
+        // Animate overlay
+        Vel(this.$overlay[0], { opacity: 0 }, { duration: this.options.outDuration, queue: false, ease: 'easeOutQuart' });
+
+        // Define modal animation options
+        var exitVelocityOptions = {
+          duration: this.options.outDuration,
+          queue: false,
+          ease: 'easeOutCubic',
+          // Handle modal ready callback
+          complete: function () {
+            _this2.$el[0].style.display = 'none';
+            // Call complete callback
+            if (typeof _this2.options.complete === 'function') {
+              _this2.options.complete.call(_this2, _this2.$el);
+            }
+            _this2.$overlay[0].parentNode.removeChild(_this2.$overlay[0]);
+          }
+        };
+
+        // Bottom sheet animation
+        if (this.$el[0].classList.contains('bottom-sheet')) {
+          Vel(this.$el[0], { bottom: '-100%', opacity: 0 }, exitVelocityOptions);
+
+          // Normal modal animation
+        } else {
+          Vel(this.$el[0], { top: this.options.startingTop, opacity: 0, scaleX: 0.7 }, exitVelocityOptions);
+        }
+      }
+
+      /**
+       * Open Modal
+       * @param {jQuery} [$trigger]
+       */
+
+    }, {
+      key: 'open',
+      value: function open($trigger) {
+        if (this.isOpen) {
+          return;
+        }
+
+        this.isOpen = true;
+        var body = document.body;
+        body.style.overflow = 'hidden';
+        this.$el[0].classList.add('open');
+        body.appendChild(this.$overlay[0]);
+
+        // Set opening trigger, undefined indicates modal was opened by javascript
+        this.openingTrigger = !!$trigger ? $trigger : undefined;
+
+        if (this.options.dismissible) {
+          this.handleKeydownBound = this.handleKeydown.bind(this);
+          document.addEventListener('keydown', this.handleKeydownBound);
+        }
+
+        this.animateIn();
+
+        return this;
+      }
+
+      /**
+       * Close Modal
+       */
+
+    }, {
+      key: 'close',
+      value: function close() {
+        if (!this.isOpen) {
+          return;
+        }
+
+        this.isOpen = false;
+        this.$el[0].classList.remove('open');
+        document.body.style.overflow = '';
+
+        if (this.options.dismissible) {
+          document.removeEventListener('keydown', this.handleKeydownBound);
+        }
+
+        this.animateOut();
+
+        return this;
+      }
+    }], [{
+      key: 'init',
+      value: function init($els, options) {
+        var arr = [];
+        $els.each(function () {
+          arr.push(new Modal($(this), options));
+        });
+        return arr;
+      }
+    }, {
+      key: 'defaults',
+      get: function () {
+        return _defaults;
+      }
+    }]);
+
+    return Modal;
+  }();
+
+  /**
+   * @static
+   * @memberof Modal
+   */
+
+
+  Modal._increment = 0;
+
+  /**
+   * @static
+   * @memberof Modal
+   */
+  Modal._count = 0;
+
+  Materialize.Modal = Modal;
+
+  $.fn.modal = function (methodOrOptions) {
+    // Call plugin method if valid method name is passed in
+    if (Modal.prototype[methodOrOptions]) {
+      // Getter methods
+      if (methodOrOptions.slice(0, 3) === 'get') {
+        return this.first()[0].M_Modal[methodOrOptions]();
+
+        // Void methods
+      } else {
+        return this.each(function () {
+          this.M_Modal[methodOrOptions]();
+        });
+      }
+
+      // Initialize plugin if options or no argument is passed in
+    } else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
+      Modal.init(this, arguments[0]);
+      return this;
+
+      // Return error if an unrecognized  method name is passed in
+    } else {
+      $.error('Method ' + methodOrOptions + ' does not exist on jQuery.modal');
+    }
+  };
+})(jQuery, Materialize.Vel);
+;(function ($) {
+
+  $.fn.materialbox = function () {
+
+    return this.each(function () {
+
+      if ($(this).hasClass('initialized')) {
+        return;
+      }
+
+      $(this).addClass('initialized');
+
+      var overlayActive = false;
+      var doneAnimating = true;
+      var inDuration = 275;
+      var outDuration = 200;
+      var origin = $(this);
+      var placeholder = $('<div></div>').addClass('material-placeholder');
+      var originalWidth = 0;
+      var originalHeight = 0;
+      var ancestorsChanged;
+      var ancestor;
+      var originInlineStyles = origin.attr('style');
+      origin.wrap(placeholder);
+
+      // Start click handler
+      origin.on('click', function () {
+        var placeholder = origin.parent('.material-placeholder');
+        var windowWidth = window.innerWidth;
+        var windowHeight = window.innerHeight;
+        var originalWidth = origin.width();
+        var originalHeight = origin.height();
+
+        // If already modal, return to original
+        if (doneAnimating === false) {
+          returnToOriginal();
+          return false;
+        } else if (overlayActive && doneAnimating === true) {
+          returnToOriginal();
+          return false;
+        }
+
+        // Set states
+        doneAnimating = false;
+        origin.addClass('active');
+        overlayActive = true;
+
+        // Set positioning for placeholder
+        placeholder.css({
+          width: placeholder[0].getBoundingClientRect().width,
+          height: placeholder[0].getBoundingClientRect().height,
+          position: 'relative',
+          top: 0,
+          left: 0
+        });
+
+        // Find ancestor with overflow: hidden; and remove it
+        ancestorsChanged = undefined;
+        ancestor = placeholder[0].parentNode;
+        var count = 0;
+        while (ancestor !== null && !$(ancestor).is(document)) {
+          var curr = $(ancestor);
+          if (curr.css('overflow') !== 'visible') {
+            curr.css('overflow', 'visible');
+            if (ancestorsChanged === undefined) {
+              ancestorsChanged = curr;
+            } else {
+              ancestorsChanged = ancestorsChanged.add(curr);
+            }
+          }
+          ancestor = ancestor.parentNode;
+        }
+
+        // Set css on origin
+        origin.css({
+          position: 'absolute',
+          'z-index': 1000,
+          'will-change': 'left, top, width, height'
+        }).data('width', originalWidth).data('height', originalHeight);
+
+        // Add overlay
+        var overlay = $('<div id="materialbox-overlay"></div>').css({
+          opacity: 0
+        }).click(function () {
+          if (doneAnimating === true) returnToOriginal();
+        });
+
+        // Put before in origin image to preserve z-index layering.
+        origin.before(overlay);
+
+        // Set dimensions if needed
+        var overlayOffset = overlay[0].getBoundingClientRect();
+        overlay.css({
+          width: windowWidth,
+          height: windowHeight,
+          left: -1 * overlayOffset.left,
+          top: -1 * overlayOffset.top
+        });
+
+        // Animate Overlay
+        overlay.velocity({ opacity: 1 }, { duration: inDuration, queue: false, easing: 'easeOutQuad' });
+
+        // Add and animate caption if it exists
+        if (origin.data('caption') !== "") {
+          var $photo_caption = $('<div class="materialbox-caption"></div>');
+          $photo_caption.text(origin.data('caption'));
+          $('body').append($photo_caption);
+          $photo_caption.css({ "display": "inline" });
+          $photo_caption.velocity({ opacity: 1 }, { duration: inDuration, queue: false, easing: 'easeOutQuad' });
+        }
+
+        // Resize Image
+        var ratio = 0;
+        var widthPercent = originalWidth / windowWidth;
+        var heightPercent = originalHeight / windowHeight;
+        var newWidth = 0;
+        var newHeight = 0;
+
+        if (widthPercent > heightPercent) {
+          ratio = originalHeight / originalWidth;
+          newWidth = windowWidth * 0.9;
+          newHeight = windowWidth * 0.9 * ratio;
+        } else {
+          ratio = originalWidth / originalHeight;
+          newWidth = windowHeight * 0.9 * ratio;
+          newHeight = windowHeight * 0.9;
+        }
+
+        // Animate image + set z-index
+        if (origin.hasClass('responsive-img')) {
+          origin.velocity({ 'max-width': newWidth, 'width': originalWidth }, { duration: 0, queue: false,
+            complete: function () {
+              origin.css({ left: 0, top: 0 }).velocity({
+                height: newHeight,
+                width: newWidth,
+                left: $(document).scrollLeft() + windowWidth / 2 - origin.parent('.material-placeholder').offset().left - newWidth / 2,
+                top: $(document).scrollTop() + windowHeight / 2 - origin.parent('.material-placeholder').offset().top - newHeight / 2
+              }, {
+                duration: inDuration,
+                queue: false,
+                easing: 'easeOutQuad',
+                complete: function () {
+                  doneAnimating = true;
+                }
+              });
+            } // End Complete
+          }); // End Velocity
+        } else {
+          origin.css('left', 0).css('top', 0).velocity({
+            height: newHeight,
+            width: newWidth,
+            left: $(document).scrollLeft() + windowWidth / 2 - origin.parent('.material-placeholder').offset().left - newWidth / 2,
+            top: $(document).scrollTop() + windowHeight / 2 - origin.parent('.material-placeholder').offset().top - newHeight / 2
+          }, {
+            duration: inDuration,
+            queue: false,
+            easing: 'easeOutQuad',
+            complete: function () {
+              doneAnimating = true;
+            }
+          }); // End Velocity
+        }
+
+        // Handle Exit triggers
+        $(window).on('scroll.materialbox', function () {
+          if (overlayActive) {
+            returnToOriginal();
+          }
+        });
+
+        $(window).on('resize.materialbox', function () {
+          if (overlayActive) {
+            returnToOriginal();
+          }
+        });
+
+        $(document).on('keyup.materialbox', function (e) {
+          // ESC key
+          if (e.keyCode === 27 && doneAnimating === true && overlayActive) {
+            returnToOriginal();
+          }
+        });
+      }); // End click handler
+
+
+      // This function returns the modaled image to the original spot
+      function returnToOriginal() {
+
+        doneAnimating = false;
+
+        var placeholder = origin.parent('.material-placeholder');
+        var windowWidth = window.innerWidth;
+        var windowHeight = window.innerHeight;
+        var originalWidth = origin.data('width');
+        var originalHeight = origin.data('height');
+
+        origin.velocity("stop", true);
+        $('#materialbox-overlay').velocity("stop", true);
+        $('.materialbox-caption').velocity("stop", true);
+
+        // disable exit handlers
+        $(window).off('scroll.materialbox');
+        $(document).off('keyup.materialbox');
+        $(window).off('resize.materialbox');
+
+        $('#materialbox-overlay').velocity({ opacity: 0 }, {
+          duration: outDuration, // Delay prevents animation overlapping
+          queue: false, easing: 'easeOutQuad',
+          complete: function () {
+            // Remove Overlay
+            overlayActive = false;
+            $(this).remove();
+          }
+        });
+
+        // Resize Image
+        origin.velocity({
+          width: originalWidth,
+          height: originalHeight,
+          left: 0,
+          top: 0
+        }, {
+          duration: outDuration,
+          queue: false, easing: 'easeOutQuad',
+          complete: function () {
+            placeholder.css({
+              height: '',
+              width: '',
+              position: '',
+              top: '',
+              left: ''
+            });
+
+            origin.removeAttr('style');
+            origin.attr('style', originInlineStyles);
+
+            // Remove class
+            origin.removeClass('active');
+            doneAnimating = true;
+
+            // Remove overflow overrides on ancestors
+            if (ancestorsChanged) {
+              ancestorsChanged.css('overflow', '');
+            }
+          }
+        });
+
+        // Remove Caption + reset css settings on image
+        $('.materialbox-caption').velocity({ opacity: 0 }, {
+          duration: outDuration, // Delay prevents animation overlapping
+          queue: false, easing: 'easeOutQuad',
+          complete: function () {
+            $(this).remove();
+          }
+        });
+      }
+    });
+  };
+
+  $(document).ready(function () {
+    $('.materialboxed').materialbox();
+  });
+})(jQuery);
+;(function ($) {
+
+  $.fn.parallax = function () {
+    var window_width = $(window).width();
+    // Parallax Scripts
+    return this.each(function (i) {
+      var $this = $(this);
+      $this.addClass('parallax');
+
+      function updateParallax(initial) {
+        var container_height;
+        if (window_width < 601) {
+          container_height = $this.height() > 0 ? $this.height() : $this.children("img").height();
+        } else {
+          container_height = $this.height() > 0 ? $this.height() : 500;
+        }
+        var $img = $this.children("img").first();
+        var img_height = $img.height();
+        var parallax_dist = img_height - container_height;
+        var bottom = $this.offset().top + container_height;
+        var top = $this.offset().top;
+        var scrollTop = $(window).scrollTop();
+        var windowHeight = window.innerHeight;
+        var windowBottom = scrollTop + windowHeight;
+        var percentScrolled = (windowBottom - top) / (container_height + windowHeight);
+        var parallax = Math.round(parallax_dist * percentScrolled);
+
+        if (initial) {
+          $img.css('display', 'block');
+        }
+        if (bottom > scrollTop && top < scrollTop + windowHeight) {
+          $img.css('transform', "translate3D(-50%," + parallax + "px, 0)");
+        }
+      }
+
+      // Wait for image load
+      $this.children("img").one("load", function () {
+        updateParallax(true);
+      }).each(function () {
+        if (this.complete) $(this).trigger("load");
+      });
+
+      $(window).scroll(function () {
+        window_width = $(window).width();
+        updateParallax(false);
+      });
+
+      $(window).resize(function () {
+        window_width = $(window).width();
+        updateParallax(false);
+      });
+    });
+  };
+})(jQuery);
+;(function ($) {
+
+  var methods = {
+    init: function (options) {
+      var defaults = {
+        onShow: null,
+        swipeable: false,
+        responsiveThreshold: Infinity // breakpoint for swipeable
+      };
+      options = $.extend(defaults, options);
+      var namespace = Materialize.objectSelectorString($(this));
+
+      return this.each(function (i) {
+
+        var uniqueNamespace = namespace + i;
+
+        // For each set of tabs, we want to keep track of
+        // which tab is active and its associated content
+        var $this = $(this),
+            window_width = $(window).width();
+
+        var $active,
+            $content,
+            $links = $this.find('li.tab a'),
+            $tabs_width = $this.width(),
+            $tabs_content = $(),
+            $tabs_wrapper,
+            $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length,
+            $indicator,
+            index = 0,
+            prev_index = 0,
+            clicked = false,
+            clickedTimeout,
+            transition = 300;
+
+        // Finds right attribute for indicator based on active tab.
+        // el: jQuery Object
+        var calcRightPos = function (el) {
+          return Math.ceil($tabs_width - el.position().left - el[0].getBoundingClientRect().width - $this.scrollLeft());
+        };
+
+        // Finds left attribute for indicator based on active tab.
+        // el: jQuery Object
+        var calcLeftPos = function (el) {
+          return Math.floor(el.position().left + $this.scrollLeft());
+        };
+
+        // Animates Indicator to active tab.
+        // prev_index: Number
+        var animateIndicator = function (prev_index) {
+          if (index - prev_index >= 0) {
+            $indicator.velocity({ "right": calcRightPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad' });
+            $indicator.velocity({ "left": calcLeftPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad', delay: 90 });
+          } else {
+            $indicator.velocity({ "left": calcLeftPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad' });
+            $indicator.velocity({ "right": calcRightPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad', delay: 90 });
+          }
+        };
+
+        // Change swipeable according to responsive threshold
+        if (options.swipeable) {
+          if (window_width > options.responsiveThreshold) {
+            options.swipeable = false;
+          }
+        }
+
+        // If the location.hash matches one of the links, use that as the active tab.
+        $active = $($links.filter('[href="' + location.hash + '"]'));
+
+        // If no match is found, use the first link or any with class 'active' as the initial active tab.
+        if ($active.length === 0) {
+          $active = $(this).find('li.tab a.active').first();
+        }
+        if ($active.length === 0) {
+          $active = $(this).find('li.tab a').first();
+        }
+
+        $active.addClass('active');
+        index = $links.index($active);
+        if (index < 0) {
+          index = 0;
+        }
+
+        if ($active[0] !== undefined) {
+          $content = $($active[0].hash);
+          $content.addClass('active');
+        }
+
+        // append indicator then set indicator width to tab width
+        if (!$this.find('.indicator').length) {
+          $this.append('<li class="indicator"></li>');
+        }
+        $indicator = $this.find('.indicator');
+
+        // we make sure that the indicator is at the end of the tabs
+        $this.append($indicator);
+
+        if ($this.is(":visible")) {
+          // $indicator.css({"right": $tabs_width - ((index + 1) * $tab_width)});
+          // $indicator.css({"left": index * $tab_width});
+          setTimeout(function () {
+            $indicator.css({ "right": calcRightPos($active) });
+            $indicator.css({ "left": calcLeftPos($active) });
+          }, 0);
+        }
+        $(window).off('resize.tabs-' + uniqueNamespace).on('resize.tabs-' + uniqueNamespace, function () {
+          $tabs_width = $this.width();
+          $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length;
+          if (index < 0) {
+            index = 0;
+          }
+          if ($tab_width !== 0 && $tabs_width !== 0) {
+            $indicator.css({ "right": calcRightPos($active) });
+            $indicator.css({ "left": calcLeftPos($active) });
+          }
+        });
+
+        // Initialize Tabs Content.
+        if (options.swipeable) {
+          // TODO: Duplicate calls with swipeable? handle multiple div wrapping.
+          $links.each(function () {
+            var $curr_content = $(Materialize.escapeHash(this.hash));
+            $curr_content.addClass('carousel-item');
+            $tabs_content = $tabs_content.add($curr_content);
+          });
+          $tabs_wrapper = $tabs_content.wrapAll('<div class="tabs-content carousel"></div>');
+          $tabs_content.css('display', '');
+          $('.tabs-content.carousel').carousel({
+            fullWidth: true,
+            noWrap: true,
+            onCycleTo: function (item) {
+              if (!clicked) {
+                var prev_index = index;
+                index = $tabs_wrapper.index(item);
+                $active.removeClass('active');
+                $active = $links.eq(index);
+                $active.addClass('active');
+                animateIndicator(prev_index);
+                if (typeof options.onShow === "function") {
+                  options.onShow.call($this[0], $content);
+                }
+              }
+            }
+          });
+        } else {
+          // Hide the remaining content
+          $links.not($active).each(function () {
+            $(Materialize.escapeHash(this.hash)).hide();
+          });
+        }
+
+        // Bind the click event handler
+        $this.off('click.tabs').on('click.tabs', 'a', function (e) {
+          if ($(this).parent().hasClass('disabled')) {
+            e.preventDefault();
+            return;
+          }
+
+          // Act as regular link if target attribute is specified.
+          if (!!$(this).attr("target")) {
+            return;
+          }
+
+          clicked = true;
+          $tabs_width = $this.width();
+          $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length;
+
+          // Make the old tab inactive.
+          $active.removeClass('active');
+          var $oldContent = $content;
+
+          // Update the variables with the new link and content
+          $active = $(this);
+          $content = $(Materialize.escapeHash(this.hash));
+          $links = $this.find('li.tab a');
+          var activeRect = $active.position();
+
+          // Make the tab active.
+          $active.addClass('active');
+          prev_index = index;
+          index = $links.index($(this));
+          if (index < 0) {
+            index = 0;
+          }
+          // Change url to current tab
+          // window.location.hash = $active.attr('href');
+
+          // Swap content
+          if (options.swipeable) {
+            if ($tabs_content.length) {
+              $tabs_content.carousel('set', index, function () {
+                if (typeof options.onShow === "function") {
+                  options.onShow.call($this[0], $content);
+                }
+              });
+            }
+          } else {
+            if ($content !== undefined) {
+              $content.show();
+              $content.addClass('active');
+              if (typeof options.onShow === "function") {
+                options.onShow.call(this, $content);
+              }
+            }
+
+            if ($oldContent !== undefined && !$oldContent.is($content)) {
+              $oldContent.hide();
+              $oldContent.removeClass('active');
+            }
+          }
+
+          // Reset clicked state
+          clickedTimeout = setTimeout(function () {
+            clicked = false;
+          }, transition);
+
+          // Update indicator
+          animateIndicator(prev_index);
+
+          // Prevent the anchor's default click action
+          e.preventDefault();
+        });
+      });
+    },
+    select_tab: function (id) {
+      this.find('a[href="#' + id + '"]').trigger('click');
+    }
+  };
+
+  $.fn.tabs = function (methodOrOptions) {
+    if (methods[methodOrOptions]) {
+      return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
+    } else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
+      // Default to "init"
+      return methods.init.apply(this, arguments);
+    } else {
+      $.error('Method ' + methodOrOptions + ' does not exist on jQuery.tabs');
+    }
+  };
+
+  $(document).ready(function () {
+    $('ul.tabs').tabs();
+  });
+})(jQuery);
+;(function ($) {
+  $.fn.tooltip = function (options) {
+    var timeout = null,
+        margin = 5;
+
+    // Defaults
+    var defaults = {
+      delay: 350,
+      tooltip: '',
+      position: 'bottom',
+      html: false
+    };
+
+    // Remove tooltip from the activator
+    if (options === "remove") {
+      this.each(function () {
+        $('#' + $(this).attr('data-tooltip-id')).remove();
+        $(this).removeAttr('data-tooltip-id');
+        $(this).off('mouseenter.tooltip mouseleave.tooltip');
+      });
+      return false;
+    }
+
+    options = $.extend(defaults, options);
+
+    return this.each(function () {
+      var tooltipId = Materialize.guid();
+      var origin = $(this);
+
+      // Destroy old tooltip
+      if (origin.attr('data-tooltip-id')) {
+        $('#' + origin.attr('data-tooltip-id')).remove();
+      }
+
+      origin.attr('data-tooltip-id', tooltipId);
+
+      // Get attributes.
+      var allowHtml, tooltipDelay, tooltipPosition, tooltipText, tooltipEl, backdrop;
+      var setAttributes = function () {
+        allowHtml = origin.attr('data-html') ? origin.attr('data-html') === 'true' : options.html;
+        tooltipDelay = origin.attr('data-delay');
+        tooltipDelay = tooltipDelay === undefined || tooltipDelay === '' ? options.delay : tooltipDelay;
+        tooltipPosition = origin.attr('data-position');
+        tooltipPosition = tooltipPosition === undefined || tooltipPosition === '' ? options.position : tooltipPosition;
+        tooltipText = origin.attr('data-tooltip');
+        tooltipText = tooltipText === undefined || tooltipText === '' ? options.tooltip : tooltipText;
+      };
+      setAttributes();
+
+      var renderTooltipEl = function () {
+        var tooltip = $('<div class="material-tooltip"></div>');
+
+        // Create Text span
+        if (allowHtml) {
+          tooltipText = $('<span></span>').html(tooltipText);
+        } else {
+          tooltipText = $('<span></span>').text(tooltipText);
+        }
+
+        // Create tooltip
+        tooltip.append(tooltipText).appendTo($('body')).attr('id', tooltipId);
+
+        // Create backdrop
+        backdrop = $('<div class="backdrop"></div>');
+        backdrop.appendTo(tooltip);
+        return tooltip;
+      };
+      tooltipEl = renderTooltipEl();
+
+      // Destroy previously binded events
+      origin.off('mouseenter.tooltip mouseleave.tooltip');
+      // Mouse In
+      var started = false,
+          timeoutRef;
+      origin.on({ 'mouseenter.tooltip': function (e) {
+          var showTooltip = function () {
+            setAttributes();
+            started = true;
+            tooltipEl.velocity('stop');
+            backdrop.velocity('stop');
+            tooltipEl.css({ visibility: 'visible', left: '0px', top: '0px' });
+
+            // Tooltip positioning
+            var originWidth = origin.outerWidth();
+            var originHeight = origin.outerHeight();
+            var tooltipHeight = tooltipEl.outerHeight();
+            var tooltipWidth = tooltipEl.outerWidth();
+            var tooltipVerticalMovement = '0px';
+            var tooltipHorizontalMovement = '0px';
+            var backdropOffsetWidth = backdrop[0].offsetWidth;
+            var backdropOffsetHeight = backdrop[0].offsetHeight;
+            var scaleXFactor = 8;
+            var scaleYFactor = 8;
+            var scaleFactor = 0;
+            var targetTop, targetLeft, newCoordinates;
+
+            if (tooltipPosition === "top") {
+              // Top Position
+              targetTop = origin.offset().top - tooltipHeight - margin;
+              targetLeft = origin.offset().left + originWidth / 2 - tooltipWidth / 2;
+              newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
+              tooltipVerticalMovement = '-10px';
+              backdrop.css({
+                bottom: 0,
+                left: 0,
+                borderRadius: '14px 14px 0 0',
+                transformOrigin: '50% 100%',
+                marginTop: tooltipHeight,
+                marginLeft: tooltipWidth / 2 - backdropOffsetWidth / 2
+              });
+            }
+            // Left Position
+            else if (tooltipPosition === "left") {
+                targetTop = origin.offset().top + originHeight / 2 - tooltipHeight / 2;
+                targetLeft = origin.offset().left - tooltipWidth - margin;
+                newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
+
+                tooltipHorizontalMovement = '-10px';
+                backdrop.css({
+                  top: '-7px',
+                  right: 0,
+                  width: '14px',
+                  height: '14px',
+                  borderRadius: '14px 0 0 14px',
+                  transformOrigin: '95% 50%',
+                  marginTop: tooltipHeight / 2,
+                  marginLeft: tooltipWidth
+                });
+              }
+              // Right Position
+              else if (tooltipPosition === "right") {
+                  targetTop = origin.offset().top + originHeight / 2 - tooltipHeight / 2;
+                  targetLeft = origin.offset().left + originWidth + margin;
+                  newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
+
+                  tooltipHorizontalMovement = '+10px';
+                  backdrop.css({
+                    top: '-7px',
+                    left: 0,
+                    width: '14px',
+                    height: '14px',
+                    borderRadius: '0 14px 14px 0',
+                    transformOrigin: '5% 50%',
+                    marginTop: tooltipHeight / 2,
+                    marginLeft: '0px'
+                  });
+                } else {
+                  // Bottom Position
+                  targetTop = origin.offset().top + origin.outerHeight() + margin;
+                  targetLeft = origin.offset().left + originWidth / 2 - tooltipWidth / 2;
+                  newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
+                  tooltipVerticalMovement = '+10px';
+                  backdrop.css({
+                    top: 0,
+                    left: 0,
+                    marginLeft: tooltipWidth / 2 - backdropOffsetWidth / 2
+                  });
+                }
+
+            // Set tooptip css placement
+            tooltipEl.css({
+              top: newCoordinates.y,
+              left: newCoordinates.x
+            });
+
+            // Calculate Scale to fill
+            scaleXFactor = Math.SQRT2 * tooltipWidth / parseInt(backdropOffsetWidth);
+            scaleYFactor = Math.SQRT2 * tooltipHeight / parseInt(backdropOffsetHeight);
+            scaleFactor = Math.max(scaleXFactor, scaleYFactor);
+
+            tooltipEl.velocity({ translateY: tooltipVerticalMovement, translateX: tooltipHorizontalMovement }, { duration: 350, queue: false }).velocity({ opacity: 1 }, { duration: 300, delay: 50, queue: false });
+            backdrop.css({ visibility: 'visible' }).velocity({ opacity: 1 }, { duration: 55, delay: 0, queue: false }).velocity({ scaleX: scaleFactor, scaleY: scaleFactor }, { duration: 300, delay: 0, queue: false, easing: 'easeInOutQuad' });
+          };
+
+          timeoutRef = setTimeout(showTooltip, tooltipDelay); // End Interval
+
+          // Mouse Out
+        },
+        'mouseleave.tooltip': function () {
+          // Reset State
+          started = false;
+          clearTimeout(timeoutRef);
+
+          // Animate back
+          setTimeout(function () {
+            if (started !== true) {
+              tooltipEl.velocity({
+                opacity: 0, translateY: 0, translateX: 0 }, { duration: 225, queue: false });
+              backdrop.velocity({ opacity: 0, scaleX: 1, scaleY: 1 }, {
+                duration: 225,
+                queue: false,
+                complete: function () {
+                  backdrop.css({ visibility: 'hidden' });
+                  tooltipEl.css({ visibility: 'hidden' });
+                  started = false;
+                }
+              });
+            }
+          }, 225);
+        }
+      });
+    });
+  };
+
+  var repositionWithinScreen = function (x, y, width, height) {
+    var newX = x;
+    var newY = y;
+
+    if (newX < 0) {
+      newX = 4;
+    } else if (newX + width > window.innerWidth) {
+      newX -= newX + width - window.innerWidth;
+    }
+
+    if (newY < 0) {
+      newY = 4;
+    } else if (newY + height > window.innerHeight + $(window).scrollTop) {
+      newY -= newY + height - window.innerHeight;
+    }
+
+    return { x: newX, y: newY };
+  };
+
+  $(document).ready(function () {
+    $('.tooltipped').tooltip();
+  });
+})(jQuery);
+; /*!
+  * Waves v0.6.4
+  * http://fian.my.id/Waves
+  *
+  * Copyright 2014 Alfiana E. Sibuea and other contributors
+  * Released under the MIT license
+  * https://github.com/fians/Waves/blob/master/LICENSE
+  */
+
+;(function (window) {
+  'use strict';
+
+  var Waves = Waves || {};
+  var $$ = document.querySelectorAll.bind(document);
+
+  // Find exact position of element
+  function isWindow(obj) {
+    return obj !== null && obj === obj.window;
+  }
+
+  function getWindow(elem) {
+    return isWindow(elem) ? elem : elem.nodeType === 9 && elem.defaultView;
+  }
+
+  function offset(elem) {
+    var docElem,
+        win,
+        box = { top: 0, left: 0 },
+        doc = elem && elem.ownerDocument;
+
+    docElem = doc.documentElement;
+
+    if (typeof elem.getBoundingClientRect !== typeof undefined) {
+      box = elem.getBoundingClientRect();
+    }
+    win = getWindow(doc);
+    return {
+      top: box.top + win.pageYOffset - docElem.clientTop,
+      left: box.left + win.pageXOffset - docElem.clientLeft
+    };
+  }
+
+  function convertStyle(obj) {
+    var style = '';
+
+    for (var a in obj) {
+      if (obj.hasOwnProperty(a)) {
+        style += a + ':' + obj[a] + ';';
+      }
+    }
+
+    return style;
+  }
+
+  var Effect = {
+
+    // Effect delay
+    duration: 750,
+
+    show: function (e, element) {
+
+      // Disable right click
+      if (e.button === 2) {
+        return false;
+      }
+
+      var el = element || this;
+
+      // Create ripple
+      var ripple = document.createElement('div');
+      ripple.className = 'waves-ripple';
+      el.appendChild(ripple);
+
+      // Get click coordinate and element witdh
+      var pos = offset(el);
+      var relativeY = e.pageY - pos.top;
+      var relativeX = e.pageX - pos.left;
+      var scale = 'scale(' + el.clientWidth / 100 * 10 + ')';
+
+      // Support for touch devices
+      if ('touches' in e) {
+        relativeY = e.touches[0].pageY - pos.top;
+        relativeX = e.touches[0].pageX - pos.left;
+      }
+
+      // Attach data to element
+      ripple.setAttribute('data-hold', Date.now());
+      ripple.setAttribute('data-scale', scale);
+      ripple.setAttribute('data-x', relativeX);
+      ripple.setAttribute('data-y', relativeY);
+
+      // Set ripple position
+      var rippleStyle = {
+        'top': relativeY + 'px',
+        'left': relativeX + 'px'
+      };
+
+      ripple.className = ripple.className + ' waves-notransition';
+      ripple.setAttribute('style', convertStyle(rippleStyle));
+      ripple.className = ripple.className.replace('waves-notransition', '');
+
+      // Scale the ripple
+      rippleStyle['-webkit-transform'] = scale;
+      rippleStyle['-moz-transform'] = scale;
+      rippleStyle['-ms-transform'] = scale;
+      rippleStyle['-o-transform'] = scale;
+      rippleStyle.transform = scale;
+      rippleStyle.opacity = '1';
+
+      rippleStyle['-webkit-transition-duration'] = Effect.duration + 'ms';
+      rippleStyle['-moz-transition-duration'] = Effect.duration + 'ms';
+      rippleStyle['-o-transition-duration'] = Effect.duration + 'ms';
+      rippleStyle['transition-duration'] = Effect.duration + 'ms';
+
+      rippleStyle['-webkit-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
+      rippleStyle['-moz-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
+      rippleStyle['-o-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
+      rippleStyle['transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
+
+      ripple.setAttribute('style', convertStyle(rippleStyle));
+    },
+
+    hide: function (e) {
+      TouchHandler.touchup(e);
+
+      var el = this;
+      var width = el.clientWidth * 1.4;
+
+      // Get first ripple
+      var ripple = null;
+      var ripples = el.getElementsByClassName('waves-ripple');
+      if (ripples.length > 0) {
+        ripple = ripples[ripples.length - 1];
+      } else {
+        return false;
+      }
+
+      var relativeX = ripple.getAttribute('data-x');
+      var relativeY = ripple.getAttribute('data-y');
+      var scale = ripple.getAttribute('data-scale');
+
+      // Get delay beetween mousedown and mouse leave
+      var diff = Date.now() - Number(ripple.getAttribute('data-hold'));
+      var delay = 350 - diff;
+
+      if (delay < 0) {
+        delay = 0;
+      }
+
+      // Fade out ripple after delay
+      setTimeout(function () {
+        var style = {
+          'top': relativeY + 'px',
+          'left': relativeX + 'px',
+          'opacity': '0',
+
+          // Duration
+          '-webkit-transition-duration': Effect.duration + 'ms',
+          '-moz-transition-duration': Effect.duration + 'ms',
+          '-o-transition-duration': Effect.duration + 'ms',
+          'transition-duration': Effect.duration + 'ms',
+          '-webkit-transform': scale,
+          '-moz-transform': scale,
+          '-ms-transform': scale,
+          '-o-transform': scale,
+          'transform': scale
+        };
+
+        ripple.setAttribute('style', convertStyle(style));
+
+        setTimeout(function () {
+          try {
+            el.removeChild(ripple);
+          } catch (e) {
+            return false;
+          }
+        }, Effect.duration);
+      }, delay);
+    },
+
+    // Little hack to make <input> can perform waves effect
+    wrapInput: function (elements) {
+      for (var a = 0; a < elements.length; a++) {
+        var el = elements[a];
+
+        if (el.tagName.toLowerCase() === 'input') {
+          var parent = el.parentNode;
+
+          // If input already have parent just pass through
+          if (parent.tagName.toLowerCase() === 'i' && parent.className.indexOf('waves-effect') !== -1) {
+            continue;
+          }
+
+          // Put element class and style to the specified parent
+          var wrapper = document.createElement('i');
+          wrapper.className = el.className + ' waves-input-wrapper';
+
+          var elementStyle = el.getAttribute('style');
+
+          if (!elementStyle) {
+            elementStyle = '';
+          }
+
+          wrapper.setAttribute('style', elementStyle);
+
+          el.className = 'waves-button-input';
+          el.removeAttribute('style');
+
+          // Put element as child
+          parent.replaceChild(wrapper, el);
+          wrapper.appendChild(el);
+        }
+      }
+    }
+  };
+
+  /**
+   * Disable mousedown event for 500ms during and after touch
+   */
+  var TouchHandler = {
+    /* uses an integer rather than bool so there's no issues with
+     * needing to clear timeouts if another touch event occurred
+     * within the 500ms. Cannot mouseup between touchstart and
+     * touchend, nor in the 500ms after touchend. */
+    touches: 0,
+    allowEvent: function (e) {
+      var allow = true;
+
+      if (e.type === 'touchstart') {
+        TouchHandler.touches += 1; //push
+      } else if (e.type === 'touchend' || e.type === 'touchcancel') {
+        setTimeout(function () {
+          if (TouchHandler.touches > 0) {
+            TouchHandler.touches -= 1; //pop after 500ms
+          }
+        }, 500);
+      } else if (e.type === 'mousedown' && TouchHandler.touches > 0) {
+        allow = false;
+      }
+
+      return allow;
+    },
+    touchup: function (e) {
+      TouchHandler.allowEvent(e);
+    }
+  };
+
+  /**
+   * Delegated click handler for .waves-effect element.
+   * returns null when .waves-effect element not in "click tree"
+   */
+  function getWavesEffectElement(e) {
+    if (TouchHandler.allowEvent(e) === false) {
+      return null;
+    }
+
+    var element = null;
+    var target = e.target || e.srcElement;
+
+    while (target.parentNode !== null) {
+      if (!(target instanceof SVGElement) && target.className.indexOf('waves-effect') !== -1) {
+        element = target;
+        break;
+      }
+      target = target.parentNode;
+    }
+    return element;
+  }
+
+  /**
+   * Bubble the click and show effect if .waves-effect elem was found
+   */
+  function showEffect(e) {
+    var element = getWavesEffectElement(e);
+
+    if (element !== null) {
+      Effect.show(e, element);
+
+      if ('ontouchstart' in window) {
+        element.addEventListener('touchend', Effect.hide, false);
+        element.addEventListener('touchcancel', Effect.hide, false);
+      }
+
+      element.addEventListener('mouseup', Effect.hide, false);
+      element.addEventListener('mouseleave', Effect.hide, false);
+      element.addEventListener('dragend', Effect.hide, false);
+    }
+  }
+
+  Waves.displayEffect = function (options) {
+    options = options || {};
+
+    if ('duration' in options) {
+      Effect.duration = options.duration;
+    }
+
+    //Wrap input inside <i> tag
+    Effect.wrapInput($$('.waves-effect'));
+
+    if ('ontouchstart' in window) {
+      document.body.addEventListener('touchstart', showEffect, false);
+    }
+
+    document.body.addEventListener('mousedown', showEffect, false);
+  };
+
+  /**
+   * Attach Waves to an input element (or any element which doesn't
+   * bubble mouseup/mousedown events).
+   *   Intended to be used with dynamically loaded forms/inputs, or
+   * where the user doesn't want a delegated click handler.
+   */
+  Waves.attach = function (element) {
+    //FUTURE: automatically add waves classes and allow users
+    // to specify them with an options param? Eg. light/classic/button
+    if (element.tagName.toLowerCase() === 'input') {
+      Effect.wrapInput([element]);
+      element = element.parentNode;
+    }
+
+    if ('ontouchstart' in window) {
+      element.addEventListener('touchstart', showEffect, false);
+    }
+
+    element.addEventListener('mousedown', showEffect, false);
+  };
+
+  window.Waves = Waves;
+
+  document.addEventListener('DOMContentLoaded', function () {
+    Waves.displayEffect();
+  }, false);
+})(window);
+;(function ($, Vel) {
+  'use strict';
+
+  var _defaults = {
+    displayLength: Infinity,
+    inDuration: 300,
+    outDuration: 375,
+    className: undefined,
+    completeCallback: undefined,
+    activationPercent: 0.8
+  };
+
+  var Toast = function () {
+    function Toast(message, displayLength, className, completeCallback) {
+      _classCallCheck(this, Toast);
+
+      if (!message) {
+        return;
+      }
+
+      /**
+       * Options for the toast
+       * @member Toast#options
+       */
+      this.options = {
+        displayLength: displayLength,
+        className: className,
+        completeCallback: completeCallback
+      };
+
+      this.options = $.extend({}, Toast.defaults, this.options);
+      this.message = message;
+
+      /**
+       * Describes current pan state toast
+       * @type {Boolean}
+       */
+      this.panning = false;
+
+      /**
+       * Time remaining until toast is removed
+       */
+      this.timeRemaining = this.options.displayLength;
+
+      if (Toast._toasts.length === 0) {
+        Toast._createContainer();
+      }
+
+      // Create new toast
+      Toast._toasts.push(this);
+      var toastElement = this.createToast();
+      toastElement.M_Toast = this;
+      this.el = toastElement;
+      this._animateIn();
+      this.setTimer();
+    }
+
+    _createClass(Toast, [{
+      key: 'createToast',
+
+
+      /**
+       * Create toast and append it to toast container
+       */
+      value: function createToast() {
+        var toast = document.createElement('div');
+        toast.classList.add('toast');
+
+        // Add custom classes onto toast
+        if (this.options.className) {
+          var classes = this.options.className.split(' ');
+          var i = void 0,
+              count = void 0;
+          for (i = 0, count = classes.length; i < count; i++) {
+            toast.classList.add(classes[i]);
+          }
+        }
+
+        // Set content
+        if (typeof HTMLElement === 'object' ? this.message instanceof HTMLElement : this.message && typeof this.message === 'object' && this.message !== null && this.message.nodeType === 1 && typeof this.message.nodeName === 'string') {
+          toast.appendChild(this.message);
+
+          // Check if it is jQuery object
+        } else if (this.message instanceof jQuery) {
+          $(toast).append(this.message);
+
+          // Insert as text;
+        } else {
+          toast.innerHTML = this.message;
+        }
+
+        // Append toasft
+        Toast._container.appendChild(toast);
+        return toast;
+      }
+
+      /**
+       * Animate in toast
+       */
+
+    }, {
+      key: '_animateIn',
+      value: function _animateIn() {
+        // Animate toast in
+        Vel(this.el, { top: 0, opacity: 1 }, {
+          duration: 300,
+          easing: 'easeOutCubic',
+          queue: false
+        });
+      }
+
+      /**
+       * Create setInterval which automatically removes toast when timeRemaining >= 0
+       * has been reached
+       */
+
+    }, {
+      key: 'setTimer',
+      value: function setTimer() {
+        var _this3 = this;
+
+        if (this.timeRemaining !== Infinity) {
+          this.counterInterval = setInterval(function () {
+            // If toast is not being dragged, decrease its time remaining
+            if (!_this3.panning) {
+              _this3.timeRemaining -= 20;
+            }
+
+            // Animate toast out
+            if (_this3.timeRemaining <= 0) {
+              _this3.remove();
+            }
+          }, 20);
+        }
+      }
+
+      /**
+       * Dismiss toast with animation
+       */
+
+    }, {
+      key: 'remove',
+      value: function remove() {
+        var _this4 = this;
+
+        window.clearInterval(this.counterInterval);
+        var activationDistance = this.el.offsetWidth * this.options.activationPercent;
+
+        if (this.wasSwiped) {
+          this.el.style.transition = 'transform .05s, opacity .05s';
+          this.el.style.transform = 'translateX(' + activationDistance + 'px)';
+          this.el.style.opacity = 0;
+        }
+
+        Vel(this.el, { opacity: 0, marginTop: '-40px' }, {
+          duration: this.options.outDuration,
+          easing: 'easeOutExpo',
+          queue: false,
+          complete: function () {
+            // Call the optional callback
+            if (typeof _this4.options.completeCallback === 'function') {
+              _this4.options.completeCallback();
+            }
+            // Remove toast from DOM
+            _this4.el.parentNode.removeChild(_this4.el);
+            Toast._toasts.splice(Toast._toasts.indexOf(_this4), 1);
+            if (Toast._toasts.length === 0) {
+              Toast._removeContainer();
+            }
+          }
+        });
+      }
+    }], [{
+      key: '_createContainer',
+
+
+      /**
+       * Append toast container and add event handlers
+       */
+      value: function _createContainer() {
+        var container = document.createElement('div');
+        container.setAttribute('id', 'toast-container');
+
+        // Add event handler
+        container.addEventListener('touchstart', Toast._onDragStart);
+        container.addEventListener('touchmove', Toast._onDragMove);
+        container.addEventListener('touchend', Toast._onDragEnd);
+
+        container.addEventListener('mousedown', Toast._onDragStart);
+        document.addEventListener('mousemove', Toast._onDragMove);
+        document.addEventListener('mouseup', Toast._onDragEnd);
+
+        document.body.appendChild(container);
+        Toast._container = container;
+      }
+
+      /**
+       * Remove toast container and event handlers
+       */
+
+    }, {
+      key: '_removeContainer',
+      value: function _removeContainer() {
+        // Add event handler
+        document.removeEventListener('mousemove', Toast._onDragMove);
+        document.removeEventListener('mouseup', Toast._onDragEnd);
+
+        Toast._container.parentNode.removeChild(Toast._container);
+        Toast._container = null;
+      }
+
+      /**
+       * Begin drag handler
+       * @param {Event} e
+       */
+
+    }, {
+      key: '_onDragStart',
+      value: function _onDragStart(e) {
+        if (e.target && $(e.target).closest('.toast').length) {
+          var $toast = $(e.target).closest('.toast');
+          var toast = $toast[0].M_Toast;
+          toast.panning = true;
+          Toast._draggedToast = toast;
+          toast.el.classList.add('panning');
+          toast.el.style.transition = '';
+          toast.startingXPos = Toast._xPos(e);
+          toast.time = Date.now();
+          toast.xPos = Toast._xPos(e);
+        }
+      }
+
+      /**
+       * Drag move handler
+       * @param {Event} e
+       */
+
+    }, {
+      key: '_onDragMove',
+      value: function _onDragMove(e) {
+        if (!!Toast._draggedToast) {
+          e.preventDefault();
+          var toast = Toast._draggedToast;
+          toast.deltaX = Math.abs(toast.xPos - Toast._xPos(e));
+          toast.xPos = Toast._xPos(e);
+          toast.velocityX = toast.deltaX / (Date.now() - toast.time);
+          toast.time = Date.now();
+
+          var totalDeltaX = toast.xPos - toast.startingXPos;
+          var activationDistance = toast.el.offsetWidth * toast.options.activationPercent;
+          toast.el.style.transform = 'translateX(' + totalDeltaX + 'px)';
+          toast.el.style.opacity = 1 - Math.abs(totalDeltaX / activationDistance);
+        }
+      }
+
+      /**
+       * End drag handler
+       * @param {Event} e
+       */
+
+    }, {
+      key: '_onDragEnd',
+      value: function _onDragEnd(e) {
+        if (!!Toast._draggedToast) {
+          var toast = Toast._draggedToast;
+          toast.panning = false;
+          toast.el.classList.remove('panning');
+
+          var totalDeltaX = toast.xPos - toast.startingXPos;
+          var activationDistance = toast.el.offsetWidth * toast.options.activationPercent;
+          var shouldBeDismissed = Math.abs(totalDeltaX) > activationDistance || toast.velocityX > 1;
+
+          // Remove toast
+          if (shouldBeDismissed) {
+            toast.wasSwiped = true;
+            toast.remove();
+
+            // Animate toast back to original position
+          } else {
+            toast.el.style.transition = 'transform .2s, opacity .2s';
+            toast.el.style.transform = '';
+            toast.el.style.opacity = '';
+          }
+          Toast._draggedToast = null;
+        }
+      }
+
+      /**
+       * Get x position of mouse or touch event
+       * @param {Event} e
+       */
+
+    }, {
+      key: '_xPos',
+      value: function _xPos(e) {
+        if (e.targetTouches && e.targetTouches.length >= 1) {
+          return e.targetTouches[0].clientX;
+        }
+        // mouse event
+        return e.clientX;
+      }
+
+      /**
+       * Remove all toasts
+       */
+
+    }, {
+      key: 'removeAll',
+      value: function removeAll() {
+        for (var toastIndex in Toast._toasts) {
+          Toast._toasts[toastIndex].remove();
+        }
+      }
+    }, {
+      key: 'defaults',
+      get: function () {
+        return _defaults;
+      }
+    }]);
+
+    return Toast;
+  }();
+
+  /**
+   * @static
+   * @memberof Toast
+   * @type {Array.<Toast>}
+   */
+
+
+  Toast._toasts = [];
+
+  /**
+   * @static
+   * @memberof Toast
+   */
+  Toast._container = null;
+
+  /**
+   * @static
+   * @memberof Toast
+   * @type {Toast}
+   */
+  Toast._draggedToast = null;
+
+  Materialize.Toast = Toast;
+  Materialize.toast = function (message, displayLength, className, completeCallback) {
+    return new Toast(message, displayLength, className, completeCallback);
+  };
+})(jQuery, Materialize.Vel);
+;(function ($) {
+
+  var methods = {
+    init: function (options) {
+      var defaults = {
+        menuWidth: 300,
+        edge: 'left',
+        closeOnClick: false,
+        draggable: true,
+        onOpen: null,
+        onClose: null
+      };
+      options = $.extend(defaults, options);
+
+      $(this).each(function () {
+        var $this = $(this);
+        var menuId = $this.attr('data-activates');
+        var menu = $("#" + menuId);
+
+        // Set to width
+        if (options.menuWidth != 300) {
+          menu.css('width', options.menuWidth);
+        }
+
+        // Add Touch Area
+        var $dragTarget = $('.drag-target[data-sidenav="' + menuId + '"]');
+        if (options.draggable) {
+          // Regenerate dragTarget
+          if ($dragTarget.length) {
+            $dragTarget.remove();
+          }
+
+          $dragTarget = $('<div class="drag-target"></div>').attr('data-sidenav', menuId);
+          $('body').append($dragTarget);
+        } else {
+          $dragTarget = $();
+        }
+
+        if (options.edge == 'left') {
+          menu.css('transform', 'translateX(-100%)');
+          $dragTarget.css({ 'left': 0 }); // Add Touch Area
+        } else {
+          menu.addClass('right-aligned') // Change text-alignment to right
+          .css('transform', 'translateX(100%)');
+          $dragTarget.css({ 'right': 0 }); // Add Touch Area
+        }
+
+        // If fixed sidenav, bring menu out
+        if (menu.hasClass('fixed')) {
+          if (window.innerWidth > 992) {
+            menu.css('transform', 'translateX(0)');
+          }
+        }
+
+        // Window resize to reset on large screens fixed
+        if (menu.hasClass('fixed')) {
+          $(window).resize(function () {
+            if (window.innerWidth > 992) {
+              // Close menu if window is resized bigger than 992 and user has fixed sidenav
+              if ($('#sidenav-overlay').length !== 0 && menuOut) {
+                removeMenu(true);
+              } else {
+                // menu.removeAttr('style');
+                menu.css('transform', 'translateX(0%)');
+                // menu.css('width', options.menuWidth);
+              }
+            } else if (menuOut === false) {
+              if (options.edge === 'left') {
+                menu.css('transform', 'translateX(-100%)');
+              } else {
+                menu.css('transform', 'translateX(100%)');
+              }
+            }
+          });
+        }
+
+        // if closeOnClick, then add close event for all a tags in side sideNav
+        if (options.closeOnClick === true) {
+          menu.on("click.itemclick", "a:not(.collapsible-header)", function () {
+            if (!(window.innerWidth > 992 && menu.hasClass('fixed'))) {
+              removeMenu();
+            }
+          });
+        }
+
+        var removeMenu = function (restoreNav) {
+          panning = false;
+          menuOut = false;
+          // Reenable scrolling
+          $('body').css({
+            overflow: '',
+            width: ''
+          });
+
+          $('#sidenav-overlay').velocity({ opacity: 0 }, { duration: 200,
+            queue: false, easing: 'easeOutQuad',
+            complete: function () {
+              $(this).remove();
+            } });
+          if (options.edge === 'left') {
+            // Reset phantom div
+            $dragTarget.css({ width: '', right: '', left: '0' });
+            menu.velocity({ 'translateX': '-100%' }, { duration: 200,
+              queue: false,
+              easing: 'easeOutCubic',
+              complete: function () {
+                if (restoreNav === true) {
+                  // Restore Fixed sidenav
+                  menu.removeAttr('style');
+                  menu.css('width', options.menuWidth);
+                }
+              }
+
+            });
+          } else {
+            // Reset phantom div
+            $dragTarget.css({ width: '', right: '0', left: '' });
+            menu.velocity({ 'translateX': '100%' }, { duration: 200,
+              queue: false,
+              easing: 'easeOutCubic',
+              complete: function () {
+                if (restoreNav === true) {
+                  // Restore Fixed sidenav
+                  menu.removeAttr('style');
+                  menu.css('width', options.menuWidth);
+                }
+              }
+            });
+          }
+
+          // Callback
+          if (typeof options.onClose === 'function') {
+            options.onClose.call(this, menu);
+          }
+        };
+
+        // Touch Event
+        var panning = false;
+        var menuOut = false;
+
+        if (options.draggable) {
+          $dragTarget.on('click', function () {
+            if (menuOut) {
+              removeMenu();
+            }
+          });
+
+          $dragTarget.hammer({
+            prevent_default: false
+          }).on('pan', function (e) {
+
+            if (e.gesture.pointerType == "touch") {
+
+              var direction = e.gesture.direction;
+              var x = e.gesture.center.x;
+              var y = e.gesture.center.y;
+              var velocityX = e.gesture.velocityX;
+
+              // Vertical scroll bugfix
+              if (x === 0 && y === 0) {
+                return;
+              }
+
+              // Disable Scrolling
+              var $body = $('body');
+              var $overlay = $('#sidenav-overlay');
+              var oldWidth = $body.innerWidth();
+              $body.css('overflow', 'hidden');
+              $body.width(oldWidth);
+
+              // If overlay does not exist, create one and if it is clicked, close menu
+              if ($overlay.length === 0) {
+                $overlay = $('<div id="sidenav-overlay"></div>');
+                $overlay.css('opacity', 0).click(function () {
+                  removeMenu();
+                });
+
+                // Run 'onOpen' when sidenav is opened via touch/swipe if applicable
+                if (typeof options.onOpen === 'function') {
+                  options.onOpen.call(this, menu);
+                }
+
+                $('body').append($overlay);
+              }
+
+              // Keep within boundaries
+              if (options.edge === 'left') {
+                if (x > options.menuWidth) {
+                  x = options.menuWidth;
+                } else if (x < 0) {
+                  x = 0;
+                }
+              }
+
+              if (options.edge === 'left') {
+                // Left Direction
+                if (x < options.menuWidth / 2) {
+                  menuOut = false;
+                }
+                // Right Direction
+                else if (x >= options.menuWidth / 2) {
+                    menuOut = true;
+                  }
+                menu.css('transform', 'translateX(' + (x - options.menuWidth) + 'px)');
+              } else {
+                // Left Direction
+                if (x < window.innerWidth - options.menuWidth / 2) {
+                  menuOut = true;
+                }
+                // Right Direction
+                else if (x >= window.innerWidth - options.menuWidth / 2) {
+                    menuOut = false;
+                  }
+                var rightPos = x - options.menuWidth / 2;
+                if (rightPos < 0) {
+                  rightPos = 0;
+                }
+
+                menu.css('transform', 'translateX(' + rightPos + 'px)');
+              }
+
+              // Percentage overlay
+              var overlayPerc;
+              if (options.edge === 'left') {
+                overlayPerc = x / options.menuWidth;
+                $overlay.velocity({ opacity: overlayPerc }, { duration: 10, queue: false, easing: 'easeOutQuad' });
+              } else {
+                overlayPerc = Math.abs((x - window.innerWidth) / options.menuWidth);
+                $overlay.velocity({ opacity: overlayPerc }, { duration: 10, queue: false, easing: 'easeOutQuad' });
+              }
+            }
+          }).on('panend', function (e) {
+
+            if (e.gesture.pointerType == "touch") {
+              var $overlay = $('#sidenav-overlay');
+              var velocityX = e.gesture.velocityX;
+              var x = e.gesture.center.x;
+              var leftPos = x - options.menuWidth;
+              var rightPos = x - options.menuWidth / 2;
+              if (leftPos > 0) {
+                leftPos = 0;
+              }
+              if (rightPos < 0) {
+                rightPos = 0;
+              }
+              panning = false;
+
+              if (options.edge === 'left') {
+                // If velocityX <= 0.3 then the user is flinging the menu closed so ignore menuOut
+                if (menuOut && velocityX <= 0.3 || velocityX < -0.5) {
+                  // Return menu to open
+                  if (leftPos !== 0) {
+                    menu.velocity({ 'translateX': [0, leftPos] }, { duration: 300, queue: false, easing: 'easeOutQuad' });
+                  }
+
+                  $overlay.velocity({ opacity: 1 }, { duration: 50, queue: false, easing: 'easeOutQuad' });
+                  $dragTarget.css({ width: '50%', right: 0, left: '' });
+                  menuOut = true;
+                } else if (!menuOut || velocityX > 0.3) {
+                  // Enable Scrolling
+                  $('body').css({
+                    overflow: '',
+                    width: ''
+                  });
+                  // Slide menu closed
+                  menu.velocity({ 'translateX': [-1 * options.menuWidth - 10, leftPos] }, { duration: 200, queue: false, easing: 'easeOutQuad' });
+                  $overlay.velocity({ opacity: 0 }, { duration: 200, queue: false, easing: 'easeOutQuad',
+                    complete: function () {
+                      // Run 'onClose' when sidenav is closed via touch/swipe if applicable
+                      if (typeof options.onClose === 'function') {
+                        options.onClose.call(this, menu);
+                      }
+
+                      $(this).remove();
+                    } });
+                  $dragTarget.css({ width: '10px', right: '', left: 0 });
+                }
+              } else {
+                if (menuOut && velocityX >= -0.3 || velocityX > 0.5) {
+                  // Return menu to open
+                  if (rightPos !== 0) {
+                    menu.velocity({ 'translateX': [0, rightPos] }, { duration: 300, queue: false, easing: 'easeOutQuad' });
+                  }
+
+                  $overlay.velocity({ opacity: 1 }, { duration: 50, queue: false, easing: 'easeOutQuad' });
+                  $dragTarget.css({ width: '50%', right: '', left: 0 });
+                  menuOut = true;
+                } else if (!menuOut || velocityX < -0.3) {
+                  // Enable Scrolling
+                  $('body').css({
+                    overflow: '',
+                    width: ''
+                  });
+
+                  // Slide menu closed
+                  menu.velocity({ 'translateX': [options.menuWidth + 10, rightPos] }, { duration: 200, queue: false, easing: 'easeOutQuad' });
+                  $overlay.velocity({ opacity: 0 }, { duration: 200, queue: false, easing: 'easeOutQuad',
+                    complete: function () {
+                      // Run 'onClose' when sidenav is closed via touch/swipe if applicable
+                      if (typeof options.onClose === 'function') {
+                        options.onClose.call(this, menu);
+                      }
+
+                      $(this).remove();
+                    } });
+                  $dragTarget.css({ width: '10px', right: 0, left: '' });
+                }
+              }
+            }
+          });
+        }
+
+        $this.off('click.sidenav').on('click.sidenav', function () {
+          if (menuOut === true) {
+            menuOut = false;
+            panning = false;
+            removeMenu();
+          } else {
+
+            // Disable Scrolling
+            var $body = $('body');
+            var $overlay = $('<div id="sidenav-overlay"></div>');
+            var oldWidth = $body.innerWidth();
+            $body.css('overflow', 'hidden');
+            $body.width(oldWidth);
+
+            // Push current drag target on top of DOM tree
+            $('body').append($dragTarget);
+
+            if (options.edge === 'left') {
+              $dragTarget.css({ width: '50%', right: 0, left: '' });
+              menu.velocity({ 'translateX': [0, -1 * options.menuWidth] }, { duration: 300, queue: false, easing: 'easeOutQuad' });
+            } else {
+              $dragTarget.css({ width: '50%', right: '', left: 0 });
+              menu.velocity({ 'translateX': [0, options.menuWidth] }, { duration: 300, queue: false, easing: 'easeOutQuad' });
+            }
+
+            // Overlay close on click
+            $overlay.css('opacity', 0).click(function () {
+              menuOut = false;
+              panning = false;
+              removeMenu();
+              $overlay.velocity({ opacity: 0 }, { duration: 300, queue: false, easing: 'easeOutQuad',
+                complete: function () {
+                  $(this).remove();
+                }
+              });
+            });
+
+            // Append body
+            $('body').append($overlay);
+            $overlay.velocity({ opacity: 1 }, { duration: 300, queue: false, easing: 'easeOutQuad',
+              complete: function () {
+                menuOut = true;
+                panning = false;
+              }
+            });
+
+            // Callback
+            if (typeof options.onOpen === 'function') {
+              options.onOpen.call(this, menu);
+            }
+          }
+
+          return false;
+        });
+      });
+    },
+    destroy: function () {
+      var $overlay = $('#sidenav-overlay');
+      var $dragTarget = $('.drag-target[data-sidenav="' + $(this).attr('data-activates') + '"]');
+      $overlay.trigger('click');
+      $dragTarget.remove();
+      $(this).off('click');
+      $overlay.remove();
+    },
+    show: function () {
+      this.trigger('click');
+    },
+    hide: function () {
+      $('#sidenav-overlay').trigger('click');
+    }
+  };
+
+  $.fn.sideNav = function (methodOrOptions) {
+    if (methods[methodOrOptions]) {
+      return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
+    } else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
+      // Default to "init"
+      return methods.init.apply(this, arguments);
+    } else {
+      $.error('Method ' + methodOrOptions + ' does not exist on jQuery.sideNav');
+    }
+  }; // Plugin end
+})(jQuery);
+; /**
+  * Extend jquery with a scrollspy plugin.
+  * This watches the window scroll and fires events when elements are scrolled into viewport.
+  *
+  * throttle() and getTime() taken from Underscore.js
+  * https://github.com/jashkenas/underscore
+  *
+  * @author Copyright 2013 John Smart
+  * @license https://raw.github.com/thesmart/jquery-scrollspy/master/LICENSE
+  * @see https://github.com/thesmart
+  * @version 0.1.2
+  */
+(function ($) {
+
+  var jWindow = $(window);
+  var elements = [];
+  var elementsInView = [];
+  var isSpying = false;
+  var ticks = 0;
+  var unique_id = 1;
+  var offset = {
+    top: 0,
+    right: 0,
+    bottom: 0,
+    left: 0
+
+    /**
+     * Find elements that are within the boundary
+     * @param {number} top
+     * @param {number} right
+     * @param {number} bottom
+     * @param {number} left
+     * @return {jQuery}		A collection of elements
+     */
+  };function findElements(top, right, bottom, left) {
+    var hits = $();
+    $.each(elements, function (i, element) {
+      if (element.height() > 0) {
+        var elTop = element.offset().top,
+            elLeft = element.offset().left,
+            elRight = elLeft + element.width(),
+            elBottom = elTop + element.height();
+
+        var isIntersect = !(elLeft > right || elRight < left || elTop > bottom || elBottom < top);
+
+        if (isIntersect) {
+          hits.push(element);
+        }
+      }
+    });
+
+    return hits;
+  }
+
+  /**
+   * Called when the user scrolls the window
+   */
+  function onScroll(scrollOffset) {
+    // unique tick id
+    ++ticks;
+
+    // viewport rectangle
+    var top = jWindow.scrollTop(),
+        left = jWindow.scrollLeft(),
+        right = left + jWindow.width(),
+        bottom = top + jWindow.height();
+
+    // determine which elements are in view
+    var intersections = findElements(top + offset.top + scrollOffset || 200, right + offset.right, bottom + offset.bottom, left + offset.left);
+    $.each(intersections, function (i, element) {
+
+      var lastTick = element.data('scrollSpy:ticks');
+      if (typeof lastTick != 'number') {
+        // entered into view
+        element.triggerHandler('scrollSpy:enter');
+      }
+
+      // update tick id
+      element.data('scrollSpy:ticks', ticks);
+    });
+
+    // determine which elements are no longer in view
+    $.each(elementsInView, function (i, element) {
+      var lastTick = element.data('scrollSpy:ticks');
+      if (typeof lastTick == 'number' && lastTick !== ticks) {
+        // exited from view
+        element.triggerHandler('scrollSpy:exit');
+        element.data('scrollSpy:ticks', null);
+      }
+    });
+
+    // remember elements in view for next tick
+    elementsInView = intersections;
+  }
+
+  /**
+   * Called when window is resized
+  */
+  function onWinSize() {
+    jWindow.trigger('scrollSpy:winSize');
+  }
+
+  /**
+   * Enables ScrollSpy using a selector
+   * @param {jQuery|string} selector  The elements collection, or a selector
+   * @param {Object=} options	Optional.
+         throttle : number -> scrollspy throttling. Default: 100 ms
+         offsetTop : number -> offset from top. Default: 0
+         offsetRight : number -> offset from right. Default: 0
+         offsetBottom : number -> offset from bottom. Default: 0
+         offsetLeft : number -> offset from left. Default: 0
+  			activeClass : string -> Class name to be added to the active link. Default: active
+   * @returns {jQuery}
+   */
+  $.scrollSpy = function (selector, options) {
+    var defaults = {
+      throttle: 100,
+      scrollOffset: 200, // offset - 200 allows elements near bottom of page to scroll
+      activeClass: 'active',
+      getActiveElement: function (id) {
+        return 'a[href="#' + id + '"]';
+      }
+    };
+    options = $.extend(defaults, options);
+
+    var visible = [];
+    selector = $(selector);
+    selector.each(function (i, element) {
+      elements.push($(element));
+      $(element).data("scrollSpy:id", i);
+      // Smooth scroll to section
+      $('a[href="#' + $(element).attr('id') + '"]').click(function (e) {
+        e.preventDefault();
+        var offset = $(Materialize.escapeHash(this.hash)).offset().top + 1;
+        $('html, body').animate({ scrollTop: offset - options.scrollOffset }, { duration: 400, queue: false, easing: 'easeOutCubic' });
+      });
+    });
+
+    offset.top = options.offsetTop || 0;
+    offset.right = options.offsetRight || 0;
+    offset.bottom = options.offsetBottom || 0;
+    offset.left = options.offsetLeft || 0;
+
+    var throttledScroll = Materialize.throttle(function () {
+      onScroll(options.scrollOffset);
+    }, options.throttle || 100);
+    var readyScroll = function () {
+      $(document).ready(throttledScroll);
+    };
+
+    if (!isSpying) {
+      jWindow.on('scroll', readyScroll);
+      jWindow.on('resize', readyScroll);
+      isSpying = true;
+    }
+
+    // perform a scan once, after current execution context, and after dom is ready
+    setTimeout(readyScroll, 0);
+
+    selector.on('scrollSpy:enter', function () {
+      visible = $.grep(visible, function (value) {
+        return value.height() != 0;
+      });
+
+      var $this = $(this);
+
+      if (visible[0]) {
+        $(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass);
+        if ($this.data('scrollSpy:id') < visible[0].data('scrollSpy:id')) {
+          visible.unshift($(this));
+        } else {
+          visible.push($(this));
+        }
+      } else {
+        visible.push($(this));
+      }
+
+      $(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass);
+    });
+    selector.on('scrollSpy:exit', function () {
+      visible = $.grep(visible, function (value) {
+        return value.height() != 0;
+      });
+
+      if (visible[0]) {
+        $(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass);
+        var $this = $(this);
+        visible = $.grep(visible, function (value) {
+          return value.attr('id') != $this.attr('id');
+        });
+        if (visible[0]) {
+          // Check if empty
+          $(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass);
+        }
+      }
+    });
+
+    return selector;
+  };
+
+  /**
+   * Listen for window resize events
+   * @param {Object=} options						Optional. Set { throttle: number } to change throttling. Default: 100 ms
+   * @returns {jQuery}		$(window)
+   */
+  $.winSizeSpy = function (options) {
+    $.winSizeSpy = function () {
+      return jWindow;
+    }; // lock from multiple calls
+    options = options || {
+      throttle: 100
+    };
+    return jWindow.on('resize', Materialize.throttle(onWinSize, options.throttle || 100));
+  };
+
+  /**
+   * Enables ScrollSpy on a collection of elements
+   * e.g. $('.scrollSpy').scrollSpy()
+   * @param {Object=} options	Optional.
+  										throttle : number -> scrollspy throttling. Default: 100 ms
+  										offsetTop : number -> offset from top. Default: 0
+  										offsetRight : number -> offset from right. Default: 0
+  										offsetBottom : number -> offset from bottom. Default: 0
+  										offsetLeft : number -> offset from left. Default: 0
+   * @returns {jQuery}
+   */
+  $.fn.scrollSpy = function (options) {
+    return $.scrollSpy($(this), options);
+  };
+})(jQuery);
+;(function ($) {
+  $(document).ready(function () {
+
+    // Function to update labels of text fields
+    Materialize.updateTextFields = function () {
+      var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea';
+      $(input_selector).each(function (index, element) {
+        var $this = $(this);
+        if ($(element).val().length > 0 || $(element).is(':focus') || element.autofocus || $this.attr('placeholder') !== undefined) {
+          $this.siblings('label').addClass('active');
+        } else if ($(element)[0].validity) {
+          $this.siblings('label').toggleClass('active', $(element)[0].validity.badInput === true);
+        } else {
+          $this.siblings('label').removeClass('active');
+        }
+      });
+    };
+
+    // Text based inputs
+    var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea';
+
+    // Add active if form auto complete
+    $(document).on('change', input_selector, function () {
+      if ($(this).val().length !== 0 || $(this).attr('placeholder') !== undefined) {
+        $(this).siblings('label').addClass('active');
+      }
+      validate_field($(this));
+    });
+
+    // Add active if input element has been pre-populated on document ready
+    $(document).ready(function () {
+      Materialize.updateTextFields();
+    });
+
+    // HTML DOM FORM RESET handling
+    $(document).on('reset', function (e) {
+      var formReset = $(e.target);
+      if (formReset.is('form')) {
+        formReset.find(input_selector).removeClass('valid').removeClass('invalid');
+        formReset.find(input_selector).each(function () {
+          if ($(this).attr('value') === '') {
+            $(this).siblings('label').removeClass('active');
+          }
+        });
+
+        // Reset select
+        formReset.find('select.initialized').each(function () {
+          var reset_text = formReset.find('option[selected]').text();
+          formReset.siblings('input.select-dropdown').val(reset_text);
+        });
+      }
+    });
+
+    // Add active when element has focus
+    $(document).on('focus', input_selector, function () {
+      $(this).siblings('label, .prefix').addClass('active');
+    });
+
+    $(document).on('blur', input_selector, function () {
+      var $inputElement = $(this);
+      var selector = ".prefix";
+
+      if ($inputElement.val().length === 0 && $inputElement[0].validity.badInput !== true && $inputElement.attr('placeholder') === undefined) {
+        selector += ", label";
+      }
+
+      $inputElement.siblings(selector).removeClass('active');
+
+      validate_field($inputElement);
+    });
+
+    window.validate_field = function (object) {
+      var hasLength = object.attr('data-length') !== undefined;
+      var lenAttr = parseInt(object.attr('data-length'));
+      var len = object.val().length;
+
+      if (object.val().length === 0 && object[0].validity.badInput === false && !object.is(':required')) {
+        if (object.hasClass('validate')) {
+          object.removeClass('valid');
+          object.removeClass('invalid');
+        }
+      } else {
+        if (object.hasClass('validate')) {
+          // Check for character counter attributes
+          if (object.is(':valid') && hasLength && len <= lenAttr || object.is(':valid') && !hasLength) {
+            object.removeClass('invalid');
+            object.addClass('valid');
+          } else {
+            object.removeClass('valid');
+            object.addClass('invalid');
+          }
+        }
+      }
+    };
+
+    // Radio and Checkbox focus class
+    var radio_checkbox = 'input[type=radio], input[type=checkbox]';
+    $(document).on('keyup.radio', radio_checkbox, function (e) {
+      // TAB, check if tabbing to radio or checkbox.
+      if (e.which === 9) {
+        $(this).addClass('tabbed');
+        var $this = $(this);
+        $this.one('blur', function (e) {
+
+          $(this).removeClass('tabbed');
+        });
+        return;
+      }
+    });
+
+    // Textarea Auto Resize
+    var hiddenDiv = $('.hiddendiv').first();
+    if (!hiddenDiv.length) {
+      hiddenDiv = $('<div class="hiddendiv common"></div>');
+      $('body').append(hiddenDiv);
+    }
+    var text_area_selector = '.materialize-textarea';
+
+    function textareaAutoResize($textarea) {
+      // Set font properties of hiddenDiv
+
+      var fontFamily = $textarea.css('font-family');
+      var fontSize = $textarea.css('font-size');
+      var lineHeight = $textarea.css('line-height');
+      var padding = $textarea.css('padding');
+
+      if (fontSize) {
+        hiddenDiv.css('font-size', fontSize);
+      }
+      if (fontFamily) {
+        hiddenDiv.css('font-family', fontFamily);
+      }
+      if (lineHeight) {
+        hiddenDiv.css('line-height', lineHeight);
+      }
+      if (padding) {
+        hiddenDiv.css('padding', padding);
+      }
+
+      // Set original-height, if none
+      if (!$textarea.data('original-height')) {
+        $textarea.data('original-height', $textarea.height());
+      }
+
+      if ($textarea.attr('wrap') === 'off') {
+        hiddenDiv.css('overflow-wrap', 'normal').css('white-space', 'pre');
+      }
+
+      hiddenDiv.text($textarea.val() + '\n');
+      var content = hiddenDiv.html().replace(/\n/g, '<br>');
+      hiddenDiv.html(content);
+
+      // When textarea is hidden, width goes crazy.
+      // Approximate with half of window size
+
+      if ($textarea.is(':visible')) {
+        hiddenDiv.css('width', $textarea.width());
+      } else {
+        hiddenDiv.css('width', $(window).width() / 2);
+      }
+
+      /**
+       * Resize if the new height is greater than the
+       * original height of the textarea
+       */
+      if ($textarea.data('original-height') <= hiddenDiv.height()) {
+        $textarea.css('height', hiddenDiv.height());
+      } else if ($textarea.val().length < $textarea.data('previous-length')) {
+        /**
+         * In case the new height is less than original height, it
+         * means the textarea has less text than before
+         * So we set the height to the original one
+         */
+        $textarea.css('height', $textarea.data('original-height'));
+      }
+      $textarea.data('previous-length', $textarea.val().length);
+    }
+
+    $(text_area_selector).each(function () {
+      var $textarea = $(this);
+      /**
+       * Instead of resizing textarea on document load,
+       * store the original height and the original length
+       */
+      $textarea.data('original-height', $textarea.height());
+      $textarea.data('previous-length', $textarea.val().length);
+    });
+
+    $('body').on('keyup keydown autoresize', text_area_selector, function () {
+      textareaAutoResize($(this));
+    });
+
+    // File Input Path
+    $(document).on('change', '.file-field input[type="file"]', function () {
+      var file_field = $(this).closest('.file-field');
+      var path_input = file_field.find('input.file-path');
+      var files = $(this)[0].files;
+      var file_names = [];
+      for (var i = 0; i < files.length; i++) {
+        file_names.push(files[i].name);
+      }
+      path_input.val(file_names.join(", "));
+      path_input.trigger('change');
+    });
+
+    /****************
+    *  Range Input  *
+    ****************/
+
+    var range_type = 'input[type=range]';
+    var range_mousedown = false;
+    var left;
+
+    $(range_type).each(function () {
+      var thumb = $('<span class="thumb"><span class="value"></span></span>');
+      $(this).after(thumb);
+    });
+
+    var showRangeBubble = function (thumb) {
+      var paddingLeft = parseInt(thumb.parent().css('padding-left'));
+      var marginLeft = -7 + paddingLeft + 'px';
+      thumb.velocity({ height: "30px", width: "30px", top: "-30px", marginLeft: marginLeft }, { duration: 300, easing: 'easeOutExpo' });
+    };
+
+    var calcRangeOffset = function (range) {
+      var width = range.width() - 15;
+      var max = parseFloat(range.attr('max'));
+      var min = parseFloat(range.attr('min'));
+      var percent = (parseFloat(range.val()) - min) / (max - min);
+      return percent * width;
+    };
+
+    var range_wrapper = '.range-field';
+    $(document).on('change', range_type, function (e) {
+      var thumb = $(this).siblings('.thumb');
+      thumb.find('.value').html($(this).val());
+
+      if (!thumb.hasClass('active')) {
+        showRangeBubble(thumb);
+      }
+
+      var offsetLeft = calcRangeOffset($(this));
+      thumb.addClass('active').css('left', offsetLeft);
+    });
+
+    $(document).on('mousedown touchstart', range_type, function (e) {
+      var thumb = $(this).siblings('.thumb');
+
+      // If thumb indicator does not exist yet, create it
+      if (thumb.length <= 0) {
+        thumb = $('<span class="thumb"><span class="value"></span></span>');
+        $(this).after(thumb);
+      }
+
+      // Set indicator value
+      thumb.find('.value').html($(this).val());
+
+      range_mousedown = true;
+      $(this).addClass('active');
+
+      if (!thumb.hasClass('active')) {
+        showRangeBubble(thumb);
+      }
+
+      if (e.type !== 'input') {
+        var offsetLeft = calcRangeOffset($(this));
+        thumb.addClass('active').css('left', offsetLeft);
+      }
+    });
+
+    $(document).on('mouseup touchend', range_wrapper, function () {
+      range_mousedown = false;
+      $(this).removeClass('active');
+    });
+
+    $(document).on('input mousemove touchmove', range_wrapper, function (e) {
+      var thumb = $(this).children('.thumb');
+      var left;
+      var input = $(this).find(range_type);
+
+      if (range_mousedown) {
+        if (!thumb.hasClass('active')) {
+          showRangeBubble(thumb);
+        }
+
+        var offsetLeft = calcRangeOffset(input);
+        thumb.addClass('active').css('left', offsetLeft);
+        thumb.find('.value').html(thumb.siblings(range_type).val());
+      }
+    });
+
+    $(document).on('mouseout touchleave', range_wrapper, function () {
+      if (!range_mousedown) {
+
+        var thumb = $(this).children('.thumb');
+        var paddingLeft = parseInt($(this).css('padding-left'));
+        var marginLeft = 7 + paddingLeft + 'px';
+
+        if (thumb.hasClass('active')) {
+          thumb.velocity({ height: '0', width: '0', top: '10px', marginLeft: marginLeft }, { duration: 100 });
+        }
+        thumb.removeClass('active');
+      }
+    });
+
+    /**************************
+     * Auto complete plugin  *
+     *************************/
+    $.fn.autocomplete = function (options) {
+      // Defaults
+      var defaults = {
+        data: {},
+        limit: Infinity,
+        onAutocomplete: null,
+        minLength: 1
+      };
+
+      options = $.extend(defaults, options);
+
+      return this.each(function () {
+        var $input = $(this);
+        var data = options.data,
+            count = 0,
+            activeIndex = -1,
+            oldVal,
+            $inputDiv = $input.closest('.input-field'); // Div to append on
+
+        // Check if data isn't empty
+        if (!$.isEmptyObject(data)) {
+          var $autocomplete = $('<ul class="autocomplete-content dropdown-content"></ul>');
+          var $oldAutocomplete;
+
+          // Append autocomplete element.
+          // Prevent double structure init.
+          if ($inputDiv.length) {
+            $oldAutocomplete = $inputDiv.children('.autocomplete-content.dropdown-content').first();
+            if (!$oldAutocomplete.length) {
+              $inputDiv.append($autocomplete); // Set ul in body
+            }
+          } else {
+            $oldAutocomplete = $input.next('.autocomplete-content.dropdown-content');
+            if (!$oldAutocomplete.length) {
+              $input.after($autocomplete);
+            }
+          }
+          if ($oldAutocomplete.length) {
+            $autocomplete = $oldAutocomplete;
+          }
+
+          // Highlight partial match.
+          var highlight = function (string, $el) {
+            var img = $el.find('img');
+            var matchStart = $el.text().toLowerCase().indexOf("" + string.toLowerCase() + ""),
+                matchEnd = matchStart + string.length - 1,
+                beforeMatch = $el.text().slice(0, matchStart),
+                matchText = $el.text().slice(matchStart, matchEnd + 1),
+                afterMatch = $el.text().slice(matchEnd + 1);
+            $el.html("<span>" + beforeMatch + "<span class='highlight'>" + matchText + "</span>" + afterMatch + "</span>");
+            if (img.length) {
+              $el.prepend(img);
+            }
+          };
+
+          // Reset current element position
+          var resetCurrentElement = function () {
+            activeIndex = -1;
+            $autocomplete.find('.active').removeClass('active');
+          };
+
+          // Remove autocomplete elements
+          var removeAutocomplete = function () {
+            $autocomplete.empty();
+            resetCurrentElement();
+            oldVal = undefined;
+          };
+
+          $input.off('blur.autocomplete').on('blur.autocomplete', function () {
+            removeAutocomplete();
+          });
+
+          // Perform search
+          $input.off('keyup.autocomplete focus.autocomplete').on('keyup.autocomplete focus.autocomplete', function (e) {
+            // Reset count.
+            count = 0;
+            var val = $input.val().toLowerCase();
+
+            // Don't capture enter or arrow key usage.
+            if (e.which === 13 || e.which === 38 || e.which === 40) {
+              return;
+            }
+
+            // Check if the input isn't empty
+            if (oldVal !== val) {
+              removeAutocomplete();
+
+              if (val.length >= options.minLength) {
+                for (var key in data) {
+                  if (data.hasOwnProperty(key) && key.toLowerCase().indexOf(val) !== -1) {
+                    // Break if past limit
+                    if (count >= options.limit) {
+                      break;
+                    }
+
+                    var autocompleteOption = $('<li></li>');
+                    if (!!data[key]) {
+                      autocompleteOption.append('<img src="' + data[key] + '" class="right circle"><span>' + key + '</span>');
+                    } else {
+                      autocompleteOption.append('<span>' + key + '</span>');
+                    }
+
+                    $autocomplete.append(autocompleteOption);
+                    highlight(val, autocompleteOption);
+                    count++;
+                  }
+                }
+              }
+            }
+
+            // Update oldVal
+            oldVal = val;
+          });
+
+          $input.off('keydown.autocomplete').on('keydown.autocomplete', function (e) {
+            // Arrow keys and enter key usage
+            var keyCode = e.which,
+                liElement,
+                numItems = $autocomplete.children('li').length,
+                $active = $autocomplete.children('.active').first();
+
+            // select element on Enter
+            if (keyCode === 13 && activeIndex >= 0) {
+              liElement = $autocomplete.children('li').eq(activeIndex);
+              if (liElement.length) {
+                liElement.trigger('mousedown.autocomplete');
+                e.preventDefault();
+              }
+              return;
+            }
+
+            // Capture up and down key
+            if (keyCode === 38 || keyCode === 40) {
+              e.preventDefault();
+
+              if (keyCode === 38 && activeIndex > 0) {
+                activeIndex--;
+              }
+
+              if (keyCode === 40 && activeIndex < numItems - 1) {
+                activeIndex++;
+              }
+
+              $active.removeClass('active');
+              if (activeIndex >= 0) {
+                $autocomplete.children('li').eq(activeIndex).addClass('active');
+              }
+            }
+          });
+
+          // Set input value
+          $autocomplete.off('mousedown.autocomplete touchstart.autocomplete').on('mousedown.autocomplete touchstart.autocomplete', 'li', function () {
+            var text = $(this).text().trim();
+            $input.val(text);
+            $input.trigger('change');
+            removeAutocomplete();
+
+            // Handle onAutocomplete callback.
+            if (typeof options.onAutocomplete === "function") {
+              options.onAutocomplete.call(this, text);
+            }
+          });
+
+          // Empty data
+        } else {
+          $input.off('keyup.autocomplete focus.autocomplete');
+        }
+      });
+    };
+  }); // End of $(document).ready
+
+  /*******************
+   *  Select Plugin  *
+   ******************/
+  $.fn.material_select = function (callback) {
+    $(this).each(function () {
+      var $select = $(this);
+
+      if ($select.hasClass('browser-default')) {
+        return; // Continue to next (return false breaks out of entire loop)
+      }
+
+      var multiple = $select.attr('multiple') ? true : false,
+          lastID = $select.attr('data-select-id'); // Tear down structure if Select needs to be rebuilt
+
+      if (lastID) {
+        $select.parent().find('span.caret').remove();
+        $select.parent().find('input').remove();
+
+        $select.unwrap();
+        $('ul#select-options-' + lastID).remove();
+      }
+
+      // If destroying the select, remove the selelct-id and reset it to it's uninitialized state.
+      if (callback === 'destroy') {
+        $select.removeAttr('data-select-id').removeClass('initialized');
+        $(window).off('click.select');
+        return;
+      }
+
+      var uniqueID = Materialize.guid();
+      $select.attr('data-select-id', uniqueID);
+      var wrapper = $('<div class="select-wrapper"></div>');
+      wrapper.addClass($select.attr('class'));
+      if ($select.is(':disabled')) wrapper.addClass('disabled');
+      var options = $('<ul id="select-options-' + uniqueID + '" class="dropdown-content select-dropdown ' + (multiple ? 'multiple-select-dropdown' : '') + '"></ul>'),
+          selectChildren = $select.children('option, optgroup'),
+          valuesSelected = [],
+          optionsHover = false;
+
+      var label = $select.find('option:selected').html() || $select.find('option:first').html() || "";
+
+      // Function that renders and appends the option taking into
+      // account type and possible image icon.
+      var appendOptionWithIcon = function (select, option, type) {
+        // Add disabled attr if disabled
+        var disabledClass = option.is(':disabled') ? 'disabled ' : '';
+        var optgroupClass = type === 'optgroup-option' ? 'optgroup-option ' : '';
+        var multipleCheckbox = multiple ? '<input type="checkbox"' + disabledClass + '/><label></label>' : '';
+
+        // add icons
+        var icon_url = option.data('icon');
+        var classes = option.attr('class');
+        if (!!icon_url) {
+          var classString = '';
+          if (!!classes) classString = ' class="' + classes + '"';
+
+          // Check for multiple type.
+          options.append($('<li class="' + disabledClass + optgroupClass + '"><img alt="" src="' + icon_url + '"' + classString + '><span>' + multipleCheckbox + option.html() + '</span></li>'));
+          return true;
+        }
+
+        // Check for multiple type.
+        options.append($('<li class="' + disabledClass + optgroupClass + '"><span>' + multipleCheckbox + option.html() + '</span></li>'));
+      };
+
+      /* Create dropdown structure. */
+      if (selectChildren.length) {
+        selectChildren.each(function () {
+          if ($(this).is('option')) {
+            // Direct descendant option.
+            if (multiple) {
+              appendOptionWithIcon($select, $(this), 'multiple');
+            } else {
+              appendOptionWithIcon($select, $(this));
+            }
+          } else if ($(this).is('optgroup')) {
+            // Optgroup.
+            var selectOptions = $(this).children('option');
+            options.append($('<li class="optgroup"><span>' + $(this).attr('label') + '</span></li>'));
+
+            selectOptions.each(function () {
+              appendOptionWithIcon($select, $(this), 'optgroup-option');
+            });
+          }
+        });
+      }
+
+      options.find('li:not(.optgroup)').each(function (i) {
+        $(this).click(function (e) {
+          // Check if option element is disabled
+          if (!$(this).hasClass('disabled') && !$(this).hasClass('optgroup')) {
+            var selected = true;
+
+            if (multiple) {
+              $('input[type="checkbox"]', this).prop('checked', function (i, v) {
+                return !v;
+              });
+              selected = toggleEntryFromArray(valuesSelected, i, $select);
+              $newSelect.trigger('focus');
+            } else {
+              options.find('li').removeClass('active');
+              $(this).toggleClass('active');
+              $newSelect.val($(this).text());
+            }
+
+            activateOption(options, $(this));
+            $select.find('option').eq(i).prop('selected', selected);
+            // Trigger onchange() event
+            $select.trigger('change');
+            if (typeof callback !== 'undefined') callback();
+          }
+
+          e.stopPropagation();
+        });
+      });
+
+      // Wrap Elements
+      $select.wrap(wrapper);
+      // Add Select Display Element
+      var dropdownIcon = $('<span class="caret">&#9660;</span>');
+
+      // escape double quotes
+      var sanitizedLabelHtml = label.replace(/"/g, '&quot;');
+
+      var $newSelect = $('<input type="text" class="select-dropdown" readonly="true" ' + ($select.is(':disabled') ? 'disabled' : '') + ' data-activates="select-options-' + uniqueID + '" value="' + sanitizedLabelHtml + '"/>');
+      $select.before($newSelect);
+      $newSelect.before(dropdownIcon);
+
+      $newSelect.after(options);
+      // Check if section element is disabled
+      if (!$select.is(':disabled')) {
+        $newSelect.dropdown({ 'hover': false });
+      }
+
+      // Copy tabindex
+      if ($select.attr('tabindex')) {
+        $($newSelect[0]).attr('tabindex', $select.attr('tabindex'));
+      }
+
+      $select.addClass('initialized');
+
+      $newSelect.on({
+        'focus': function () {
+          if ($('ul.select-dropdown').not(options[0]).is(':visible')) {
+            $('input.select-dropdown').trigger('close');
+            $(window).off('click.select');
+          }
+          if (!options.is(':visible')) {
+            $(this).trigger('open', ['focus']);
+            var label = $(this).val();
+            if (multiple && label.indexOf(',') >= 0) {
+              label = label.split(',')[0];
+            }
+
+            var selectedOption = options.find('li').filter(function () {
+              return $(this).text().toLowerCase() === label.toLowerCase();
+            })[0];
+            activateOption(options, selectedOption, true);
+
+            $(window).off('click.select').on('click.select', function () {
+              multiple && (optionsHover || $newSelect.trigger('close'));
+              $(window).off('click.select');
+            });
+          }
+        },
+        'click': function (e) {
+          e.stopPropagation();
+        }
+      });
+
+      $newSelect.on('blur', function () {
+        if (!multiple) {
+          $(this).trigger('close');
+          $(window).off('click.select');
+        }
+        options.find('li.selected').removeClass('selected');
+      });
+
+      options.hover(function () {
+        optionsHover = true;
+      }, function () {
+        optionsHover = false;
+      });
+
+      // Add initial multiple selections.
+      if (multiple) {
+        $select.find("option:selected:not(:disabled)").each(function () {
+          var index = this.index;
+
+          toggleEntryFromArray(valuesSelected, index, $select);
+          options.find("li:not(.optgroup)").eq(index).find(":checkbox").prop("checked", true);
+        });
+      }
+
+      /**
+       * Make option as selected and scroll to selected position
+       * @param {jQuery} collection  Select options jQuery element
+       * @param {Element} newOption  element of the new option
+       * @param {Boolean} firstActivation  If on first activation of select
+       */
+      var activateOption = function (collection, newOption, firstActivation) {
+        if (newOption) {
+          collection.find('li.selected').removeClass('selected');
+          var option = $(newOption);
+          option.addClass('selected');
+          if (!multiple || !!firstActivation) {
+            options.scrollTo(option);
+          }
+        }
+      };
+
+      // Allow user to search by typing
+      // this array is cleared after 1 second
+      var filterQuery = [],
+          onKeyDown = function (e) {
+        // TAB - switch to another input
+        if (e.which == 9) {
+          $newSelect.trigger('close');
+          return;
+        }
+
+        // ARROW DOWN WHEN SELECT IS CLOSED - open select options
+        if (e.which == 40 && !options.is(':visible')) {
+          $newSelect.trigger('open');
+          return;
+        }
+
+        // ENTER WHEN SELECT IS CLOSED - submit form
+        if (e.which == 13 && !options.is(':visible')) {
+          return;
+        }
+
+        e.preventDefault();
+
+        // CASE WHEN USER TYPE LETTERS
+        var letter = String.fromCharCode(e.which).toLowerCase(),
+            nonLetters = [9, 13, 27, 38, 40];
+        if (letter && nonLetters.indexOf(e.which) === -1) {
+          filterQuery.push(letter);
+
+          var string = filterQuery.join(''),
+              newOption = options.find('li').filter(function () {
+            return $(this).text().toLowerCase().indexOf(string) === 0;
+          })[0];
+
+          if (newOption) {
+            activateOption(options, newOption);
+          }
+        }
+
+        // ENTER - select option and close when select options are opened
+        if (e.which == 13) {
+          var activeOption = options.find('li.selected:not(.disabled)')[0];
+          if (activeOption) {
+            $(activeOption).trigger('click');
+            if (!multiple) {
+              $newSelect.trigger('close');
+            }
+          }
+        }
+
+        // ARROW DOWN - move to next not disabled option
+        if (e.which == 40) {
+          if (options.find('li.selected').length) {
+            newOption = options.find('li.selected').next('li:not(.disabled)')[0];
+          } else {
+            newOption = options.find('li:not(.disabled)')[0];
+          }
+          activateOption(options, newOption);
+        }
+
+        // ESC - close options
+        if (e.which == 27) {
+          $newSelect.trigger('close');
+        }
+
+        // ARROW UP - move to previous not disabled option
+        if (e.which == 38) {
+          newOption = options.find('li.selected').prev('li:not(.disabled)')[0];
+          if (newOption) activateOption(options, newOption);
+        }
+
+        // Automaticaly clean filter query so user can search again by starting letters
+        setTimeout(function () {
+          filterQuery = [];
+        }, 1000);
+      };
+
+      $newSelect.on('keydown', onKeyDown);
+    });
+
+    function toggleEntryFromArray(entriesArray, entryIndex, select) {
+      var index = entriesArray.indexOf(entryIndex),
+          notAdded = index === -1;
+
+      if (notAdded) {
+        entriesArray.push(entryIndex);
+      } else {
+        entriesArray.splice(index, 1);
+      }
+
+      select.siblings('ul.dropdown-content').find('li:not(.optgroup)').eq(entryIndex).toggleClass('active');
+
+      // use notAdded instead of true (to detect if the option is selected or not)
+      select.find('option').eq(entryIndex).prop('selected', notAdded);
+      setValueToInput(entriesArray, select);
+
+      return notAdded;
+    }
+
+    function setValueToInput(entriesArray, select) {
+      var value = '';
+
+      for (var i = 0, count = entriesArray.length; i < count; i++) {
+        var text = select.find('option').eq(entriesArray[i]).text();
+
+        i === 0 ? value += text : value += ', ' + text;
+      }
+
+      if (value === '') {
+        value = select.find('option:disabled').eq(0).text();
+      }
+
+      select.siblings('input.select-dropdown').val(value);
+    }
+  };
+})(jQuery);
+;(function ($) {
+
+  var methods = {
+
+    init: function (options) {
+      var defaults = {
+        indicators: true,
+        height: 400,
+        transition: 500,
+        interval: 6000
+      };
+      options = $.extend(defaults, options);
+
+      return this.each(function () {
+
+        // For each slider, we want to keep track of
+        // which slide is active and its associated content
+        var $this = $(this);
+        var $slider = $this.find('ul.slides').first();
+        var $slides = $slider.find('> li');
+        var $active_index = $slider.find('.active').index();
+        var $active, $indicators, $interval;
+        if ($active_index != -1) {
+          $active = $slides.eq($active_index);
+        }
+
+        // Transitions the caption depending on alignment
+        function captionTransition(caption, duration) {
+          if (caption.hasClass("center-align")) {
+            caption.velocity({ opacity: 0, translateY: -100 }, { duration: duration, queue: false });
+          } else if (caption.hasClass("right-align")) {
+            caption.velocity({ opacity: 0, translateX: 100 }, { duration: duration, queue: false });
+          } else if (caption.hasClass("left-align")) {
+            caption.velocity({ opacity: 0, translateX: -100 }, { duration: duration, queue: false });
+          }
+        }
+
+        // This function will transition the slide to any index of the next slide
+        function moveToSlide(index) {
+          // Wrap around indices.
+          if (index >= $slides.length) index = 0;else if (index < 0) index = $slides.length - 1;
+
+          $active_index = $slider.find('.active').index();
+
+          // Only do if index changes
+          if ($active_index != index) {
+            $active = $slides.eq($active_index);
+            $caption = $active.find('.caption');
+
+            $active.removeClass('active');
+            $active.velocity({ opacity: 0 }, { duration: options.transition, queue: false, easing: 'easeOutQuad',
+              complete: function () {
+                $slides.not('.active').velocity({ opacity: 0, translateX: 0, translateY: 0 }, { duration: 0, queue: false });
+              } });
+            captionTransition($caption, options.transition);
+
+            // Update indicators
+            if (options.indicators) {
+              $indicators.eq($active_index).removeClass('active');
+            }
+
+            $slides.eq(index).velocity({ opacity: 1 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' });
+            $slides.eq(index).find('.caption').velocity({ opacity: 1, translateX: 0, translateY: 0 }, { duration: options.transition, delay: options.transition, queue: false, easing: 'easeOutQuad' });
+            $slides.eq(index).addClass('active');
+
+            // Update indicators
+            if (options.indicators) {
+              $indicators.eq(index).addClass('active');
+            }
+          }
+        }
+
+        // Set height of slider
+        // If fullscreen, do nothing
+        if (!$this.hasClass('fullscreen')) {
+          if (options.indicators) {
+            // Add height if indicators are present
+            $this.height(options.height + 40);
+          } else {
+            $this.height(options.height);
+          }
+          $slider.height(options.height);
+        }
+
+        // Set initial positions of captions
+        $slides.find('.caption').each(function () {
+          captionTransition($(this), 0);
+        });
+
+        // Move img src into background-image
+        $slides.find('img').each(function () {
+          var placeholderBase64 = 'data:image/gif;base64,R0lGODlhAQABAIABAP///wAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw==';
+          if ($(this).attr('src') !== placeholderBase64) {
+            $(this).css('background-image', 'url("' + $(this).attr('src') + '")');
+            $(this).attr('src', placeholderBase64);
+          }
+        });
+
+        // dynamically add indicators
+        if (options.indicators) {
+          $indicators = $('<ul class="indicators"></ul>');
+          $slides.each(function (index) {
+            var $indicator = $('<li class="indicator-item"></li>');
+
+            // Handle clicks on indicators
+            $indicator.click(function () {
+              var $parent = $slider.parent();
+              var curr_index = $parent.find($(this)).index();
+              moveToSlide(curr_index);
+
+              // reset interval
+              clearInterval($interval);
+              $interval = setInterval(function () {
+                $active_index = $slider.find('.active').index();
+                if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
+                else $active_index += 1;
+
+                moveToSlide($active_index);
+              }, options.transition + options.interval);
+            });
+            $indicators.append($indicator);
+          });
+          $this.append($indicators);
+          $indicators = $this.find('ul.indicators').find('li.indicator-item');
+        }
+
+        if ($active) {
+          $active.show();
+        } else {
+          $slides.first().addClass('active').velocity({ opacity: 1 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' });
+
+          $active_index = 0;
+          $active = $slides.eq($active_index);
+
+          // Update indicators
+          if (options.indicators) {
+            $indicators.eq($active_index).addClass('active');
+          }
+        }
+
+        // Adjust height to current slide
+        $active.find('img').each(function () {
+          $active.find('.caption').velocity({ opacity: 1, translateX: 0, translateY: 0 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' });
+        });
+
+        // auto scroll
+        $interval = setInterval(function () {
+          $active_index = $slider.find('.active').index();
+          moveToSlide($active_index + 1);
+        }, options.transition + options.interval);
+
+        // HammerJS, Swipe navigation
+
+        // Touch Event
+        var panning = false;
+        var swipeLeft = false;
+        var swipeRight = false;
+
+        $this.hammer({
+          prevent_default: false
+        }).on('pan', function (e) {
+          if (e.gesture.pointerType === "touch") {
+
+            // reset interval
+            clearInterval($interval);
+
+            var direction = e.gesture.direction;
+            var x = e.gesture.deltaX;
+            var velocityX = e.gesture.velocityX;
+            var velocityY = e.gesture.velocityY;
+
+            $curr_slide = $slider.find('.active');
+            if (Math.abs(velocityX) > Math.abs(velocityY)) {
+              $curr_slide.velocity({ translateX: x
+              }, { duration: 50, queue: false, easing: 'easeOutQuad' });
+            }
+
+            // Swipe Left
+            if (direction === 4 && (x > $this.innerWidth() / 2 || velocityX < -0.65)) {
+              swipeRight = true;
+            }
+            // Swipe Right
+            else if (direction === 2 && (x < -1 * $this.innerWidth() / 2 || velocityX > 0.65)) {
+                swipeLeft = true;
+              }
+
+            // Make Slide Behind active slide visible
+            var next_slide;
+            if (swipeLeft) {
+              next_slide = $curr_slide.next();
+              if (next_slide.length === 0) {
+                next_slide = $slides.first();
+              }
+              next_slide.velocity({ opacity: 1
+              }, { duration: 300, queue: false, easing: 'easeOutQuad' });
+            }
+            if (swipeRight) {
+              next_slide = $curr_slide.prev();
+              if (next_slide.length === 0) {
+                next_slide = $slides.last();
+              }
+              next_slide.velocity({ opacity: 1
+              }, { duration: 300, queue: false, easing: 'easeOutQuad' });
+            }
+          }
+        }).on('panend', function (e) {
+          if (e.gesture.pointerType === "touch") {
+
+            $curr_slide = $slider.find('.active');
+            panning = false;
+            curr_index = $slider.find('.active').index();
+
+            if (!swipeRight && !swipeLeft || $slides.length <= 1) {
+              // Return to original spot
+              $curr_slide.velocity({ translateX: 0
+              }, { duration: 300, queue: false, easing: 'easeOutQuad' });
+            } else if (swipeLeft) {
+              moveToSlide(curr_index + 1);
+              $curr_slide.velocity({ translateX: -1 * $this.innerWidth() }, { duration: 300, queue: false, easing: 'easeOutQuad',
+                complete: function () {
+                  $curr_slide.velocity({ opacity: 0, translateX: 0 }, { duration: 0, queue: false });
+                } });
+            } else if (swipeRight) {
+              moveToSlide(curr_index - 1);
+              $curr_slide.velocity({ translateX: $this.innerWidth() }, { duration: 300, queue: false, easing: 'easeOutQuad',
+                complete: function () {
+                  $curr_slide.velocity({ opacity: 0, translateX: 0 }, { duration: 0, queue: false });
+                } });
+            }
+            swipeLeft = false;
+            swipeRight = false;
+
+            // Restart interval
+            clearInterval($interval);
+            $interval = setInterval(function () {
+              $active_index = $slider.find('.active').index();
+              if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
+              else $active_index += 1;
+
+              moveToSlide($active_index);
+            }, options.transition + options.interval);
+          }
+        });
+
+        $this.on('sliderPause', function () {
+          clearInterval($interval);
+        });
+
+        $this.on('sliderStart', function () {
+          clearInterval($interval);
+          $interval = setInterval(function () {
+            $active_index = $slider.find('.active').index();
+            if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
+            else $active_index += 1;
+
+            moveToSlide($active_index);
+          }, options.transition + options.interval);
+        });
+
+        $this.on('sliderNext', function () {
+          $active_index = $slider.find('.active').index();
+          moveToSlide($active_index + 1);
+        });
+
+        $this.on('sliderPrev', function () {
+          $active_index = $slider.find('.active').index();
+          moveToSlide($active_index - 1);
+        });
+      });
+    },
+    pause: function () {
+      $(this).trigger('sliderPause');
+    },
+    start: function () {
+      $(this).trigger('sliderStart');
+    },
+    next: function () {
+      $(this).trigger('sliderNext');
+    },
+    prev: function () {
+      $(this).trigger('sliderPrev');
+    }
+  };
+
+  $.fn.slider = function (methodOrOptions) {
+    if (methods[methodOrOptions]) {
+      return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
+    } else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
+      // Default to "init"
+      return methods.init.apply(this, arguments);
+    } else {
+      $.error('Method ' + methodOrOptions + ' does not exist on jQuery.tooltip');
+    }
+  }; // Plugin end
+})(jQuery);
+;(function ($) {
+  $(document).ready(function () {
+
+    $(document).on('click.card', '.card', function (e) {
+      if ($(this).find('> .card-reveal').length) {
+        var $card = $(e.target).closest('.card');
+        if ($card.data('initialOverflow') === undefined) {
+          $card.data('initialOverflow', $card.css('overflow') === undefined ? '' : $card.css('overflow'));
+        }
+        if ($(e.target).is($('.card-reveal .card-title>i'))) {
+          // Make Reveal animate down and display none
+          $(this).find('.card-reveal').velocity({ translateY: 0 }, {
+            duration: 225,
+            queue: false,
+            easing: 'easeInOutQuad',
+            complete: function () {
+              $(this).css({ display: 'none' });
+              $card.css('overflow', $card.data('initialOverflow'));
+            }
+          });
+        } else if ($(e.target).is($('.card .activator')) || $(e.target).is($('.card .activator i'))) {
+          $card.css('overflow', 'hidden');
+          $(this).find('.card-reveal').css({ display: 'block' }).velocity("stop", false).velocity({ translateY: '-100%' }, { duration: 300, queue: false, easing: 'easeInOutQuad' });
+        }
+      }
+    });
+  });
+})(jQuery);
+;(function ($) {
+  var materialChipsDefaults = {
+    data: [],
+    placeholder: '',
+    secondaryPlaceholder: '',
+    autocompleteOptions: {}
+  };
+
+  $(document).ready(function () {
+    // Handle removal of static chips.
+    $(document).on('click', '.chip .close', function (e) {
+      var $chips = $(this).closest('.chips');
+      if ($chips.attr('data-initialized')) {
+        return;
+      }
+      $(this).closest('.chip').remove();
+    });
+  });
+
+  $.fn.material_chip = function (options) {
+    var self = this;
+    this.$el = $(this);
+    this.$document = $(document);
+    this.SELS = {
+      CHIPS: '.chips',
+      CHIP: '.chip',
+      INPUT: 'input',
+      DELETE: '.material-icons',
+      SELECTED_CHIP: '.selected'
+    };
+
+    if ('data' === options) {
+      return this.$el.data('chips');
+    }
+
+    var curr_options = $.extend({}, materialChipsDefaults, options);
+    self.hasAutocomplete = !$.isEmptyObject(curr_options.autocompleteOptions.data);
+
+    // Initialize
+    this.init = function () {
+      var i = 0;
+      var chips;
+      self.$el.each(function () {
+        var $chips = $(this);
+        var chipId = Materialize.guid();
+        self.chipId = chipId;
+
+        if (!curr_options.data || !(curr_options.data instanceof Array)) {
+          curr_options.data = [];
+        }
+        $chips.data('chips', curr_options.data);
+        $chips.attr('data-index', i);
+        $chips.attr('data-initialized', true);
+
+        if (!$chips.hasClass(self.SELS.CHIPS)) {
+          $chips.addClass('chips');
+        }
+
+        self.chips($chips, chipId);
+        i++;
+      });
+    };
+
+    this.handleEvents = function () {
+      var SELS = self.SELS;
+
+      self.$document.off('click.chips-focus', SELS.CHIPS).on('click.chips-focus', SELS.CHIPS, function (e) {
+        $(e.target).find(SELS.INPUT).focus();
+      });
+
+      self.$document.off('click.chips-select', SELS.CHIP).on('click.chips-select', SELS.CHIP, function (e) {
+        var $chip = $(e.target);
+        if ($chip.length) {
+          var wasSelected = $chip.hasClass('selected');
+          var $chips = $chip.closest(SELS.CHIPS);
+          $(SELS.CHIP).removeClass('selected');
+
+          if (!wasSelected) {
+            self.selectChip($chip.index(), $chips);
+          }
+        }
+      });
+
+      self.$document.off('keydown.chips').on('keydown.chips', function (e) {
+        if ($(e.target).is('input, textarea')) {
+          return;
+        }
+
+        // delete
+        var $chip = self.$document.find(SELS.CHIP + SELS.SELECTED_CHIP);
+        var $chips = $chip.closest(SELS.CHIPS);
+        var length = $chip.siblings(SELS.CHIP).length;
+        var index;
+
+        if (!$chip.length) {
+          return;
+        }
+
+        if (e.which === 8 || e.which === 46) {
+          e.preventDefault();
+
+          index = $chip.index();
+          self.deleteChip(index, $chips);
+
+          var selectIndex = null;
+          if (index + 1 < length) {
+            selectIndex = index;
+          } else if (index === length || index + 1 === length) {
+            selectIndex = length - 1;
+          }
+
+          if (selectIndex < 0) selectIndex = null;
+
+          if (null !== selectIndex) {
+            self.selectChip(selectIndex, $chips);
+          }
+          if (!length) $chips.find('input').focus();
+
+          // left
+        } else if (e.which === 37) {
+          index = $chip.index() - 1;
+          if (index < 0) {
+            return;
+          }
+          $(SELS.CHIP).removeClass('selected');
+          self.selectChip(index, $chips);
+
+          // right
+        } else if (e.which === 39) {
+          index = $chip.index() + 1;
+          $(SELS.CHIP).removeClass('selected');
+          if (index > length) {
+            $chips.find('input').focus();
+            return;
+          }
+          self.selectChip(index, $chips);
+        }
+      });
+
+      self.$document.off('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT, function (e) {
+        var $currChips = $(e.target).closest(SELS.CHIPS);
+        $currChips.addClass('focus');
+        $currChips.siblings('label, .prefix').addClass('active');
+        $(SELS.CHIP).removeClass('selected');
+      });
+
+      self.$document.off('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT, function (e) {
+        var $currChips = $(e.target).closest(SELS.CHIPS);
+        $currChips.removeClass('focus');
+
+        // Remove active if empty
+        if ($currChips.data('chips') === undefined || !$currChips.data('chips').length) {
+          $currChips.siblings('label').removeClass('active');
+        }
+        $currChips.siblings('.prefix').removeClass('active');
+      });
+
+      self.$document.off('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT).on('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT, function (e) {
+        var $target = $(e.target);
+        var $chips = $target.closest(SELS.CHIPS);
+        var chipsLength = $chips.children(SELS.CHIP).length;
+
+        // enter
+        if (13 === e.which) {
+          // Override enter if autocompleting.
+          if (self.hasAutocomplete && $chips.find('.autocomplete-content.dropdown-content').length && $chips.find('.autocomplete-content.dropdown-content').children().length) {
+            return;
+          }
+
+          e.preventDefault();
+          self.addChip({ tag: $target.val() }, $chips);
+          $target.val('');
+          return;
+        }
+
+        // delete or left
+        if ((8 === e.keyCode || 37 === e.keyCode) && '' === $target.val() && chipsLength) {
+          e.preventDefault();
+          self.selectChip(chipsLength - 1, $chips);
+          $target.blur();
+          return;
+        }
+      });
+
+      // Click on delete icon in chip.
+      self.$document.off('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE).on('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE, function (e) {
+        var $target = $(e.target);
+        var $chips = $target.closest(SELS.CHIPS);
+        var $chip = $target.closest(SELS.CHIP);
+        e.stopPropagation();
+        self.deleteChip($chip.index(), $chips);
+        $chips.find('input').focus();
+      });
+    };
+
+    this.chips = function ($chips, chipId) {
+      $chips.empty();
+      $chips.data('chips').forEach(function (elem) {
+        $chips.append(self.renderChip(elem));
+      });
+      $chips.append($('<input id="' + chipId + '" class="input" placeholder="">'));
+      self.setPlaceholder($chips);
+
+      // Set for attribute for label
+      var label = $chips.next('label');
+      if (label.length) {
+        label.attr('for', chipId);
+
+        if ($chips.data('chips') !== undefined && $chips.data('chips').length) {
+          label.addClass('active');
+        }
+      }
+
+      // Setup autocomplete if needed.
+      var input = $('#' + chipId);
+      if (self.hasAutocomplete) {
+        curr_options.autocompleteOptions.onAutocomplete = function (val) {
+          self.addChip({ tag: val }, $chips);
+          input.val('');
+          input.focus();
+        };
+        input.autocomplete(curr_options.autocompleteOptions);
+      }
+    };
+
+    /**
+     * Render chip jQuery element.
+     * @param {Object} elem
+     * @return {jQuery}
+     */
+    this.renderChip = function (elem) {
+      if (!elem.tag) return;
+
+      var $renderedChip = $('<div class="chip"></div>');
+      $renderedChip.text(elem.tag);
+      if (elem.image) {
+        $renderedChip.prepend($('<img />').attr('src', elem.image));
+      }
+      $renderedChip.append($('<i class="material-icons close">close</i>'));
+      return $renderedChip;
+    };
+
+    this.setPlaceholder = function ($chips) {
+      if ($chips.data('chips') !== undefined && !$chips.data('chips').length && curr_options.placeholder) {
+        $chips.find('input').prop('placeholder', curr_options.placeholder);
+      } else if (($chips.data('chips') === undefined || !!$chips.data('chips').length) && curr_options.secondaryPlaceholder) {
+        $chips.find('input').prop('placeholder', curr_options.secondaryPlaceholder);
+      }
+    };
+
+    this.isValid = function ($chips, elem) {
+      var chips = $chips.data('chips');
+      var exists = false;
+      for (var i = 0; i < chips.length; i++) {
+        if (chips[i].tag === elem.tag) {
+          exists = true;
+          return;
+        }
+      }
+      return '' !== elem.tag && !exists;
+    };
+
+    this.addChip = function (elem, $chips) {
+      if (!self.isValid($chips, elem)) {
+        return;
+      }
+      var $renderedChip = self.renderChip(elem);
+      var newData = [];
+      var oldData = $chips.data('chips');
+      for (var i = 0; i < oldData.length; i++) {
+        newData.push(oldData[i]);
+      }
+      newData.push(elem);
+
+      $chips.data('chips', newData);
+      $renderedChip.insertBefore($chips.find('input'));
+      $chips.trigger('chip.add', elem);
+      self.setPlaceholder($chips);
+    };
+
+    this.deleteChip = function (chipIndex, $chips) {
+      var chip = $chips.data('chips')[chipIndex];
+      $chips.find('.chip').eq(chipIndex).remove();
+
+      var newData = [];
+      var oldData = $chips.data('chips');
+      for (var i = 0; i < oldData.length; i++) {
+        if (i !== chipIndex) {
+          newData.push(oldData[i]);
+        }
+      }
+
+      $chips.data('chips', newData);
+      $chips.trigger('chip.delete', chip);
+      self.setPlaceholder($chips);
+    };
+
+    this.selectChip = function (chipIndex, $chips) {
+      var $chip = $chips.find('.chip').eq(chipIndex);
+      if ($chip && false === $chip.hasClass('selected')) {
+        $chip.addClass('selected');
+        $chips.trigger('chip.select', $chips.data('chips')[chipIndex]);
+      }
+    };
+
+    this.getChipsElement = function (index, $chips) {
+      return $chips.eq(index);
+    };
+
+    // init
+    this.init();
+
+    this.handleEvents();
+  };
+})(jQuery);
+;(function ($) {
+  $.fn.pushpin = function (options) {
+    // Defaults
+    var defaults = {
+      top: 0,
+      bottom: Infinity,
+      offset: 0
+    };
+
+    // Remove pushpin event and classes
+    if (options === "remove") {
+      this.each(function () {
+        if (id = $(this).data('pushpin-id')) {
+          $(window).off('scroll.' + id);
+          $(this).removeData('pushpin-id').removeClass('pin-top pinned pin-bottom').removeAttr('style');
+        }
+      });
+      return false;
+    }
+
+    options = $.extend(defaults, options);
+
+    $index = 0;
+    return this.each(function () {
+      var $uniqueId = Materialize.guid(),
+          $this = $(this),
+          $original_offset = $(this).offset().top;
+
+      function removePinClasses(object) {
+        object.removeClass('pin-top');
+        object.removeClass('pinned');
+        object.removeClass('pin-bottom');
+      }
+
+      function updateElements(objects, scrolled) {
+        objects.each(function () {
+          // Add position fixed (because its between top and bottom)
+          if (options.top <= scrolled && options.bottom >= scrolled && !$(this).hasClass('pinned')) {
+            removePinClasses($(this));
+            $(this).css('top', options.offset);
+            $(this).addClass('pinned');
+          }
+
+          // Add pin-top (when scrolled position is above top)
+          if (scrolled < options.top && !$(this).hasClass('pin-top')) {
+            removePinClasses($(this));
+            $(this).css('top', 0);
+            $(this).addClass('pin-top');
+          }
+
+          // Add pin-bottom (when scrolled position is below bottom)
+          if (scrolled > options.bottom && !$(this).hasClass('pin-bottom')) {
+            removePinClasses($(this));
+            $(this).addClass('pin-bottom');
+            $(this).css('top', options.bottom - $original_offset);
+          }
+        });
+      }
+
+      $(this).data('pushpin-id', $uniqueId);
+      updateElements($this, $(window).scrollTop());
+      $(window).on('scroll.' + $uniqueId, function () {
+        var $scrolled = $(window).scrollTop() + options.offset;
+        updateElements($this, $scrolled);
+      });
+    });
+  };
+})(jQuery);;(function ($) {
+  $(document).ready(function () {
+
+    // jQuery reverse
+    $.fn.reverse = [].reverse;
+
+    // Hover behaviour: make sure this doesn't work on .click-to-toggle FABs!
+    $(document).on('mouseenter.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function (e) {
+      var $this = $(this);
+      openFABMenu($this);
+    });
+    $(document).on('mouseleave.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function (e) {
+      var $this = $(this);
+      closeFABMenu($this);
+    });
+
+    // Toggle-on-click behaviour.
+    $(document).on('click.fabClickToggle', '.fixed-action-btn.click-to-toggle > a', function (e) {
+      var $this = $(this);
+      var $menu = $this.parent();
+      if ($menu.hasClass('active')) {
+        closeFABMenu($menu);
+      } else {
+        openFABMenu($menu);
+      }
+    });
+
+    // Toolbar transition behaviour.
+    $(document).on('click.fabToolbar', '.fixed-action-btn.toolbar > a', function (e) {
+      var $this = $(this);
+      var $menu = $this.parent();
+      FABtoToolbar($menu);
+    });
+  });
+
+  $.fn.extend({
+    openFAB: function () {
+      openFABMenu($(this));
+    },
+    closeFAB: function () {
+      closeFABMenu($(this));
+    },
+    openToolbar: function () {
+      FABtoToolbar($(this));
+    },
+    closeToolbar: function () {
+      toolbarToFAB($(this));
+    }
+  });
+
+  var openFABMenu = function (btn) {
+    var $this = btn;
+    if ($this.hasClass('active') === false) {
+
+      // Get direction option
+      var horizontal = $this.hasClass('horizontal');
+      var offsetY, offsetX;
+
+      if (horizontal === true) {
+        offsetX = 40;
+      } else {
+        offsetY = 40;
+      }
+
+      $this.addClass('active');
+      $this.find('ul .btn-floating').velocity({ scaleY: ".4", scaleX: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px' }, { duration: 0 });
+
+      var time = 0;
+      $this.find('ul .btn-floating').reverse().each(function () {
+        $(this).velocity({ opacity: "1", scaleX: "1", scaleY: "1", translateY: "0", translateX: '0' }, { duration: 80, delay: time });
+        time += 40;
+      });
+    }
+  };
+
+  var closeFABMenu = function (btn) {
+    var $this = btn;
+    // Get direction option
+    var horizontal = $this.hasClass('horizontal');
+    var offsetY, offsetX;
+
+    if (horizontal === true) {
+      offsetX = 40;
+    } else {
+      offsetY = 40;
+    }
+
+    $this.removeClass('active');
+    var time = 0;
+    $this.find('ul .btn-floating').velocity("stop", true);
+    $this.find('ul .btn-floating').velocity({ opacity: "0", scaleX: ".4", scaleY: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px' }, { duration: 80 });
+  };
+
+  /**
+   * Transform FAB into toolbar
+   * @param  {Object}  object jQuery object
+   */
+  var FABtoToolbar = function (btn) {
+    if (btn.attr('data-open') === "true") {
+      return;
+    }
+
+    var offsetX, offsetY, scaleFactor;
+    var windowWidth = window.innerWidth;
+    var windowHeight = window.innerHeight;
+    var btnRect = btn[0].getBoundingClientRect();
+    var anchor = btn.find('> a').first();
+    var menu = btn.find('> ul').first();
+    var backdrop = $('<div class="fab-backdrop"></div>');
+    var fabColor = anchor.css('background-color');
+    anchor.append(backdrop);
+
+    offsetX = btnRect.left - windowWidth / 2 + btnRect.width / 2;
+    offsetY = windowHeight - btnRect.bottom;
+    scaleFactor = windowWidth / backdrop.width();
+    btn.attr('data-origin-bottom', btnRect.bottom);
+    btn.attr('data-origin-left', btnRect.left);
+    btn.attr('data-origin-width', btnRect.width);
+
+    // Set initial state
+    btn.addClass('active');
+    btn.attr('data-open', true);
+    btn.css({
+      'text-align': 'center',
+      width: '100%',
+      bottom: 0,
+      left: 0,
+      transform: 'translateX(' + offsetX + 'px)',
+      transition: 'none'
+    });
+    anchor.css({
+      transform: 'translateY(' + -offsetY + 'px)',
+      transition: 'none'
+    });
+    backdrop.css({
+      'background-color': fabColor
+    });
+
+    setTimeout(function () {
+      btn.css({
+        transform: '',
+        transition: 'transform .2s cubic-bezier(0.550, 0.085, 0.680, 0.530), background-color 0s linear .2s'
+      });
+      anchor.css({
+        overflow: 'visible',
+        transform: '',
+        transition: 'transform .2s'
+      });
+
+      setTimeout(function () {
+        btn.css({
+          overflow: 'hidden',
+          'background-color': fabColor
+        });
+        backdrop.css({
+          transform: 'scale(' + scaleFactor + ')',
+          transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)'
+        });
+        menu.find('> li > a').css({
+          opacity: 1
+        });
+
+        // Scroll to close.
+        $(window).on('scroll.fabToolbarClose', function () {
+          toolbarToFAB(btn);
+          $(window).off('scroll.fabToolbarClose');
+          $(document).off('click.fabToolbarClose');
+        });
+
+        $(document).on('click.fabToolbarClose', function (e) {
+          if (!$(e.target).closest(menu).length) {
+            toolbarToFAB(btn);
+            $(window).off('scroll.fabToolbarClose');
+            $(document).off('click.fabToolbarClose');
+          }
+        });
+      }, 100);
+    }, 0);
+  };
+
+  /**
+   * Transform toolbar back into FAB
+   * @param  {Object}  object jQuery object
+   */
+  var toolbarToFAB = function (btn) {
+    if (btn.attr('data-open') !== "true") {
+      return;
+    }
+
+    var offsetX, offsetY, scaleFactor;
+    var windowWidth = window.innerWidth;
+    var windowHeight = window.innerHeight;
+    var btnWidth = btn.attr('data-origin-width');
+    var btnBottom = btn.attr('data-origin-bottom');
+    var btnLeft = btn.attr('data-origin-left');
+    var anchor = btn.find('> .btn-floating').first();
+    var menu = btn.find('> ul').first();
+    var backdrop = btn.find('.fab-backdrop');
+    var fabColor = anchor.css('background-color');
+
+    offsetX = btnLeft - windowWidth / 2 + btnWidth / 2;
+    offsetY = windowHeight - btnBottom;
+    scaleFactor = windowWidth / backdrop.width();
+
+    // Hide backdrop
+    btn.removeClass('active');
+    btn.attr('data-open', false);
+    btn.css({
+      'background-color': 'transparent',
+      transition: 'none'
+    });
+    anchor.css({
+      transition: 'none'
+    });
+    backdrop.css({
+      transform: 'scale(0)',
+      'background-color': fabColor
+    });
+    menu.find('> li > a').css({
+      opacity: ''
+    });
+
+    setTimeout(function () {
+      backdrop.remove();
+
+      // Set initial state.
+      btn.css({
+        'text-align': '',
+        width: '',
+        bottom: '',
+        left: '',
+        overflow: '',
+        'background-color': '',
+        transform: 'translate3d(' + -offsetX + 'px,0,0)'
+      });
+      anchor.css({
+        overflow: '',
+        transform: 'translate3d(0,' + offsetY + 'px,0)'
+      });
+
+      setTimeout(function () {
+        btn.css({
+          transform: 'translate3d(0,0,0)',
+          transition: 'transform .2s'
+        });
+        anchor.css({
+          transform: 'translate3d(0,0,0)',
+          transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)'
+        });
+      }, 20);
+    }, 200);
+  };
+})(jQuery);
+;(function ($) {
+  // Image transition function
+  Materialize.fadeInImage = function (selectorOrEl) {
+    var element;
+    if (typeof selectorOrEl === 'string') {
+      element = $(selectorOrEl);
+    } else if (typeof selectorOrEl === 'object') {
+      element = selectorOrEl;
+    } else {
+      return;
+    }
+    element.css({ opacity: 0 });
+    $(element).velocity({ opacity: 1 }, {
+      duration: 650,
+      queue: false,
+      easing: 'easeOutSine'
+    });
+    $(element).velocity({ opacity: 1 }, {
+      duration: 1300,
+      queue: false,
+      easing: 'swing',
+      step: function (now, fx) {
+        fx.start = 100;
+        var grayscale_setting = now / 100;
+        var brightness_setting = 150 - (100 - now) / 1.75;
+
+        if (brightness_setting < 100) {
+          brightness_setting = 100;
+        }
+        if (now >= 0) {
+          $(this).css({
+            "-webkit-filter": "grayscale(" + grayscale_setting + ")" + "brightness(" + brightness_setting + "%)",
+            "filter": "grayscale(" + grayscale_setting + ")" + "brightness(" + brightness_setting + "%)"
+          });
+        }
+      }
+    });
+  };
+
+  // Horizontal staggered list
+  Materialize.showStaggeredList = function (selectorOrEl) {
+    var element;
+    if (typeof selectorOrEl === 'string') {
+      element = $(selectorOrEl);
+    } else if (typeof selectorOrEl === 'object') {
+      element = selectorOrEl;
+    } else {
+      return;
+    }
+    var time = 0;
+    element.find('li').velocity({ translateX: "-100px" }, { duration: 0 });
+
+    element.find('li').each(function () {
+      $(this).velocity({ opacity: "1", translateX: "0" }, { duration: 800, delay: time, easing: [60, 10] });
+      time += 120;
+    });
+  };
+
+  $(document).ready(function () {
+    // Hardcoded .staggered-list scrollFire
+    // var staggeredListOptions = [];
+    // $('ul.staggered-list').each(function (i) {
+
+    //   var label = 'scrollFire-' + i;
+    //   $(this).addClass(label);
+    //   staggeredListOptions.push(
+    //     {selector: 'ul.staggered-list.' + label,
+    //      offset: 200,
+    //      callback: 'showStaggeredList("ul.staggered-list.' + label + '")'});
+    // });
+    // scrollFire(staggeredListOptions);
+
+    // HammerJS, Swipe navigation
+
+    // Touch Event
+    var swipeLeft = false;
+    var swipeRight = false;
+
+    // Dismissible Collections
+    $('.dismissable').each(function () {
+      $(this).hammer({
+        prevent_default: false
+      }).on('pan', function (e) {
+        if (e.gesture.pointerType === "touch") {
+          var $this = $(this);
+          var direction = e.gesture.direction;
+          var x = e.gesture.deltaX;
+          var velocityX = e.gesture.velocityX;
+
+          $this.velocity({ translateX: x
+          }, { duration: 50, queue: false, easing: 'easeOutQuad' });
+
+          // Swipe Left
+          if (direction === 4 && (x > $this.innerWidth() / 2 || velocityX < -0.75)) {
+            swipeLeft = true;
+          }
+
+          // Swipe Right
+          if (direction === 2 && (x < -1 * $this.innerWidth() / 2 || velocityX > 0.75)) {
+            swipeRight = true;
+          }
+        }
+      }).on('panend', function (e) {
+        // Reset if collection is moved back into original position
+        if (Math.abs(e.gesture.deltaX) < $(this).innerWidth() / 2) {
+          swipeRight = false;
+          swipeLeft = false;
+        }
+
+        if (e.gesture.pointerType === "touch") {
+          var $this = $(this);
+          if (swipeLeft || swipeRight) {
+            var fullWidth;
+            if (swipeLeft) {
+              fullWidth = $this.innerWidth();
+            } else {
+              fullWidth = -1 * $this.innerWidth();
+            }
+
+            $this.velocity({ translateX: fullWidth
+            }, { duration: 100, queue: false, easing: 'easeOutQuad', complete: function () {
+                $this.css('border', 'none');
+                $this.velocity({ height: 0, padding: 0
+                }, { duration: 200, queue: false, easing: 'easeOutQuad', complete: function () {
+                    $this.remove();
+                  }
+                });
+              }
+            });
+          } else {
+            $this.velocity({ translateX: 0
+            }, { duration: 100, queue: false, easing: 'easeOutQuad' });
+          }
+          swipeLeft = false;
+          swipeRight = false;
+        }
+      });
+    });
+
+    // time = 0
+    // // Vertical Staggered list
+    // $('ul.staggered-list.vertical li').velocity(
+    //     { translateY: "100px"},
+    //     { duration: 0 });
+
+    // $('ul.staggered-list.vertical li').each(function() {
+    //   $(this).velocity(
+    //     { opacity: "1", translateY: "0"},
+    //     { duration: 800, delay: time, easing: [60, 25] });
+    //   time += 120;
+    // });
+
+    // // Fade in and Scale
+    // $('.fade-in.scale').velocity(
+    //     { scaleX: .4, scaleY: .4, translateX: -600},
+    //     { duration: 0});
+    // $('.fade-in').each(function() {
+    //   $(this).velocity(
+    //     { opacity: "1", scaleX: 1, scaleY: 1, translateX: 0},
+    //     { duration: 800, easing: [60, 10] });
+    // });
+  });
+})(jQuery);
+;(function ($) {
+
+  var scrollFireEventsHandled = false;
+
+  // Input: Array of JSON objects {selector, offset, callback}
+  Materialize.scrollFire = function (options) {
+    var onScroll = function () {
+      var windowScroll = window.pageYOffset + window.innerHeight;
+
+      for (var i = 0; i < options.length; i++) {
+        // Get options from each line
+        var value = options[i];
+        var selector = value.selector,
+            offset = value.offset,
+            callback = value.callback;
+
+        var currentElement = document.querySelector(selector);
+        if (currentElement !== null) {
+          var elementOffset = currentElement.getBoundingClientRect().top + window.pageYOffset;
+
+          if (windowScroll > elementOffset + offset) {
+            if (value.done !== true) {
+              if (typeof callback === 'function') {
+                callback.call(this, currentElement);
+              } else if (typeof callback === 'string') {
+                var callbackFunc = new Function(callback);
+                callbackFunc(currentElement);
+              }
+              value.done = true;
+            }
+          }
+        }
+      }
+    };
+
+    var throttledScroll = Materialize.throttle(function () {
+      onScroll();
+    }, options.throttle || 100);
+
+    if (!scrollFireEventsHandled) {
+      window.addEventListener("scroll", throttledScroll);
+      window.addEventListener("resize", throttledScroll);
+      scrollFireEventsHandled = true;
+    }
+
+    // perform a scan once, after current execution context, and after dom is ready
+    setTimeout(throttledScroll, 0);
+  };
+})(jQuery);
+; /*!
+  * pickadate.js v3.5.0, 2014/04/13
+  * By Amsul, http://amsul.ca
+  * Hosted on http://amsul.github.io/pickadate.js
+  * Licensed under MIT
+  */
+
+(function (factory) {
+
+  Materialize.Picker = factory(jQuery);
+})(function ($) {
+
+  var $window = $(window);
+  var $document = $(document);
+  var $html = $(document.documentElement);
+
+  /**
+   * The picker constructor that creates a blank picker.
+   */
+  function PickerConstructor(ELEMENT, NAME, COMPONENT, OPTIONS) {
+
+    // If there’s no element, return the picker constructor.
+    if (!ELEMENT) return PickerConstructor;
+
+    var IS_DEFAULT_THEME = false,
+
+
+    // The state of the picker.
+    STATE = {
+      id: ELEMENT.id || 'P' + Math.abs(~~(Math.random() * new Date()))
+    },
+
+
+    // Merge the defaults and options passed.
+    SETTINGS = COMPONENT ? $.extend(true, {}, COMPONENT.defaults, OPTIONS) : OPTIONS || {},
+
+
+    // Merge the default classes with the settings classes.
+    CLASSES = $.extend({}, PickerConstructor.klasses(), SETTINGS.klass),
+
+
+    // The element node wrapper into a jQuery object.
+    $ELEMENT = $(ELEMENT),
+
+
+    // Pseudo picker constructor.
+    PickerInstance = function () {
+      return this.start();
+    },
+
+
+    // The picker prototype.
+    P = PickerInstance.prototype = {
+
+      constructor: PickerInstance,
+
+      $node: $ELEMENT,
+
+      /**
+       * Initialize everything
+       */
+      start: function () {
+
+        // If it’s already started, do nothing.
+        if (STATE && STATE.start) return P;
+
+        // Update the picker states.
+        STATE.methods = {};
+        STATE.start = true;
+        STATE.open = false;
+        STATE.type = ELEMENT.type;
+
+        // Confirm focus state, convert into text input to remove UA stylings,
+        // and set as readonly to prevent keyboard popup.
+        ELEMENT.autofocus = ELEMENT == getActiveElement();
+        ELEMENT.readOnly = !SETTINGS.editable;
+        ELEMENT.id = ELEMENT.id || STATE.id;
+        if (ELEMENT.type != 'text') {
+          ELEMENT.type = 'text';
+        }
+
+        // Create a new picker component with the settings.
+        P.component = new COMPONENT(P, SETTINGS);
+
+        // Create the picker root with a holder and then prepare it.
+        P.$root = $(PickerConstructor._.node('div', createWrappedComponent(), CLASSES.picker, 'id="' + ELEMENT.id + '_root" tabindex="0"'));
+        prepareElementRoot();
+
+        // If there’s a format for the hidden input element, create the element.
+        if (SETTINGS.formatSubmit) {
+          prepareElementHidden();
+        }
+
+        // Prepare the input element.
+        prepareElement();
+
+        // Insert the root as specified in the settings.
+        if (SETTINGS.container) $(SETTINGS.container).append(P.$root);else $ELEMENT.before(P.$root);
+
+        // Bind the default component and settings events.
+        P.on({
+          start: P.component.onStart,
+          render: P.component.onRender,
+          stop: P.component.onStop,
+          open: P.component.onOpen,
+          close: P.component.onClose,
+          set: P.component.onSet
+        }).on({
+          start: SETTINGS.onStart,
+          render: SETTINGS.onRender,
+          stop: SETTINGS.onStop,
+          open: SETTINGS.onOpen,
+          close: SETTINGS.onClose,
+          set: SETTINGS.onSet
+        });
+
+        // Once we’re all set, check the theme in use.
+        IS_DEFAULT_THEME = isUsingDefaultTheme(P.$root.children()[0]);
+
+        // If the element has autofocus, open the picker.
+        if (ELEMENT.autofocus) {
+          P.open();
+        }
+
+        // Trigger queued the “start” and “render” events.
+        return P.trigger('start').trigger('render');
+      }, //start
+
+
+      /**
+       * Render a new picker
+       */
+      render: function (entireComponent) {
+
+        // Insert a new component holder in the root or box.
+        if (entireComponent) P.$root.html(createWrappedComponent());else P.$root.find('.' + CLASSES.box).html(P.component.nodes(STATE.open));
+
+        // Trigger the queued “render” events.
+        return P.trigger('render');
+      }, //render
+
+
+      /**
+       * Destroy everything
+       */
+      stop: function () {
+
+        // If it’s already stopped, do nothing.
+        if (!STATE.start) return P;
+
+        // Then close the picker.
+        P.close();
+
+        // Remove the hidden field.
+        if (P._hidden) {
+          P._hidden.parentNode.removeChild(P._hidden);
+        }
+
+        // Remove the root.
+        P.$root.remove();
+
+        // Remove the input class, remove the stored data, and unbind
+        // the events (after a tick for IE - see `P.close`).
+        $ELEMENT.removeClass(CLASSES.input).removeData(NAME);
+        setTimeout(function () {
+          $ELEMENT.off('.' + STATE.id);
+        }, 0);
+
+        // Restore the element state
+        ELEMENT.type = STATE.type;
+        ELEMENT.readOnly = false;
+
+        // Trigger the queued “stop” events.
+        P.trigger('stop');
+
+        // Reset the picker states.
+        STATE.methods = {};
+        STATE.start = false;
+
+        return P;
+      }, //stop
+
+
+      /**
+       * Open up the picker
+       */
+      open: function (dontGiveFocus) {
+
+        // If it’s already open, do nothing.
+        if (STATE.open) return P;
+
+        // Add the “active” class.
+        $ELEMENT.addClass(CLASSES.active);
+        aria(ELEMENT, 'expanded', true);
+
+        // * A Firefox bug, when `html` has `overflow:hidden`, results in
+        //   killing transitions :(. So add the “opened” state on the next tick.
+        //   Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289
+        setTimeout(function () {
+
+          // Add the “opened” class to the picker root.
+          P.$root.addClass(CLASSES.opened);
+          aria(P.$root[0], 'hidden', false);
+        }, 0);
+
+        // If we have to give focus, bind the element and doc events.
+        if (dontGiveFocus !== false) {
+
+          // Set it as open.
+          STATE.open = true;
+
+          // Prevent the page from scrolling.
+          if (IS_DEFAULT_THEME) {
+            $html.css('overflow', 'hidden').css('padding-right', '+=' + getScrollbarWidth());
+          }
+
+          // Pass focus to the root element’s jQuery object.
+          // * Workaround for iOS8 to bring the picker’s root into view.
+          P.$root.eq(0).focus();
+
+          // Bind the document events.
+          $document.on('click.' + STATE.id + ' focusin.' + STATE.id, function (event) {
+
+            var target = event.target;
+
+            // If the target of the event is not the element, close the picker picker.
+            // * Don’t worry about clicks or focusins on the root because those don’t bubble up.
+            //   Also, for Firefox, a click on an `option` element bubbles up directly
+            //   to the doc. So make sure the target wasn't the doc.
+            // * In Firefox stopPropagation() doesn’t prevent right-click events from bubbling,
+            //   which causes the picker to unexpectedly close when right-clicking it. So make
+            //   sure the event wasn’t a right-click.
+            if (target != ELEMENT && target != document && event.which != 3) {
+
+              // If the target was the holder that covers the screen,
+              // keep the element focused to maintain tabindex.
+              P.close(target === P.$root.children()[0]);
+            }
+          }).on('keydown.' + STATE.id, function (event) {
+
+            var
+            // Get the keycode.
+            keycode = event.keyCode,
+
+
+            // Translate that to a selection change.
+            keycodeToMove = P.component.key[keycode],
+
+
+            // Grab the target.
+            target = event.target;
+
+            // On escape, close the picker and give focus.
+            if (keycode == 27) {
+              P.close(true);
+            }
+
+            // Check if there is a key movement or “enter” keypress on the element.
+            else if (target == P.$root[0] && (keycodeToMove || keycode == 13)) {
+
+                // Prevent the default action to stop page movement.
+                event.preventDefault();
+
+                // Trigger the key movement action.
+                if (keycodeToMove) {
+                  PickerConstructor._.trigger(P.component.key.go, P, [PickerConstructor._.trigger(keycodeToMove)]);
+                }
+
+                // On “enter”, if the highlighted item isn’t disabled, set the value and close.
+                else if (!P.$root.find('.' + CLASSES.highlighted).hasClass(CLASSES.disabled)) {
+                    P.set('select', P.component.item.highlight);
+                    if (SETTINGS.closeOnSelect) {
+                      P.close(true);
+                    }
+                  }
+              }
+
+              // If the target is within the root and “enter” is pressed,
+              // prevent the default action and trigger a click on the target instead.
+              else if ($.contains(P.$root[0], target) && keycode == 13) {
+                  event.preventDefault();
+                  target.click();
+                }
+          });
+        }
+
+        // Trigger the queued “open” events.
+        return P.trigger('open');
+      }, //open
+
+
+      /**
+       * Close the picker
+       */
+      close: function (giveFocus) {
+
+        // If we need to give focus, do it before changing states.
+        if (giveFocus) {
+          // ....ah yes! It would’ve been incomplete without a crazy workaround for IE :|
+          // The focus is triggered *after* the close has completed - causing it
+          // to open again. So unbind and rebind the event at the next tick.
+          P.$root.off('focus.toOpen').eq(0).focus();
+          setTimeout(function () {
+            P.$root.on('focus.toOpen', handleFocusToOpenEvent);
+          }, 0);
+        }
+
+        // Remove the “active” class.
+        $ELEMENT.removeClass(CLASSES.active);
+        aria(ELEMENT, 'expanded', false);
+
+        // * A Firefox bug, when `html` has `overflow:hidden`, results in
+        //   killing transitions :(. So remove the “opened” state on the next tick.
+        //   Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289
+        setTimeout(function () {
+
+          // Remove the “opened” and “focused” class from the picker root.
+          P.$root.removeClass(CLASSES.opened + ' ' + CLASSES.focused);
+          aria(P.$root[0], 'hidden', true);
+        }, 0);
+
+        // If it’s already closed, do nothing more.
+        if (!STATE.open) return P;
+
+        // Set it as closed.
+        STATE.open = false;
+
+        // Allow the page to scroll.
+        if (IS_DEFAULT_THEME) {
+          $html.css('overflow', '').css('padding-right', '-=' + getScrollbarWidth());
+        }
+
+        // Unbind the document events.
+        $document.off('.' + STATE.id);
+
+        // Trigger the queued “close” events.
+        return P.trigger('close');
+      }, //close
+
+
+      /**
+       * Clear the values
+       */
+      clear: function (options) {
+        return P.set('clear', null, options);
+      }, //clear
+
+
+      /**
+       * Set something
+       */
+      set: function (thing, value, options) {
+
+        var thingItem,
+            thingValue,
+            thingIsObject = $.isPlainObject(thing),
+            thingObject = thingIsObject ? thing : {};
+
+        // Make sure we have usable options.
+        options = thingIsObject && $.isPlainObject(value) ? value : options || {};
+
+        if (thing) {
+
+          // If the thing isn’t an object, make it one.
+          if (!thingIsObject) {
+            thingObject[thing] = value;
+          }
+
+          // Go through the things of items to set.
+          for (thingItem in thingObject) {
+
+            // Grab the value of the thing.
+            thingValue = thingObject[thingItem];
+
+            // First, if the item exists and there’s a value, set it.
+            if (thingItem in P.component.item) {
+              if (thingValue === undefined) thingValue = null;
+              P.component.set(thingItem, thingValue, options);
+            }
+
+            // Then, check to update the element value and broadcast a change.
+            if (thingItem == 'select' || thingItem == 'clear') {
+              $ELEMENT.val(thingItem == 'clear' ? '' : P.get(thingItem, SETTINGS.format)).trigger('change');
+            }
+          }
+
+          // Render a new picker.
+          P.render();
+        }
+
+        // When the method isn’t muted, trigger queued “set” events and pass the `thingObject`.
+        return options.muted ? P : P.trigger('set', thingObject);
+      }, //set
+
+
+      /**
+       * Get something
+       */
+      get: function (thing, format) {
+
+        // Make sure there’s something to get.
+        thing = thing || 'value';
+
+        // If a picker state exists, return that.
+        if (STATE[thing] != null) {
+          return STATE[thing];
+        }
+
+        // Return the submission value, if that.
+        if (thing == 'valueSubmit') {
+          if (P._hidden) {
+            return P._hidden.value;
+          }
+          thing = 'value';
+        }
+
+        // Return the value, if that.
+        if (thing == 'value') {
+          return ELEMENT.value;
+        }
+
+        // Check if a component item exists, return that.
+        if (thing in P.component.item) {
+          if (typeof format == 'string') {
+            var thingValue = P.component.get(thing);
+            return thingValue ? PickerConstructor._.trigger(P.component.formats.toString, P.component, [format, thingValue]) : '';
+          }
+          return P.component.get(thing);
+        }
+      }, //get
+
+
+      /**
+       * Bind events on the things.
+       */
+      on: function (thing, method, internal) {
+
+        var thingName,
+            thingMethod,
+            thingIsObject = $.isPlainObject(thing),
+            thingObject = thingIsObject ? thing : {};
+
+        if (thing) {
+
+          // If the thing isn’t an object, make it one.
+          if (!thingIsObject) {
+            thingObject[thing] = method;
+          }
+
+          // Go through the things to bind to.
+          for (thingName in thingObject) {
+
+            // Grab the method of the thing.
+            thingMethod = thingObject[thingName];
+
+            // If it was an internal binding, prefix it.
+            if (internal) {
+              thingName = '_' + thingName;
+            }
+
+            // Make sure the thing methods collection exists.
+            STATE.methods[thingName] = STATE.methods[thingName] || [];
+
+            // Add the method to the relative method collection.
+            STATE.methods[thingName].push(thingMethod);
+          }
+        }
+
+        return P;
+      }, //on
+
+
+      /**
+       * Unbind events on the things.
+       */
+      off: function () {
+        var i,
+            thingName,
+            names = arguments;
+        for (i = 0, namesCount = names.length; i < namesCount; i += 1) {
+          thingName = names[i];
+          if (thingName in STATE.methods) {
+            delete STATE.methods[thingName];
+          }
+        }
+        return P;
+      },
+
+      /**
+       * Fire off method events.
+       */
+      trigger: function (name, data) {
+        var _trigger = function (name) {
+          var methodList = STATE.methods[name];
+          if (methodList) {
+            methodList.map(function (method) {
+              PickerConstructor._.trigger(method, P, [data]);
+            });
+          }
+        };
+        _trigger('_' + name);
+        _trigger(name);
+        return P;
+      } //trigger
+      //PickerInstance.prototype
+
+
+      /**
+       * Wrap the picker holder components together.
+       */
+    };function createWrappedComponent() {
+
+      // Create a picker wrapper holder
+      return PickerConstructor._.node('div',
+
+      // Create a picker wrapper node
+      PickerConstructor._.node('div',
+
+      // Create a picker frame
+      PickerConstructor._.node('div',
+
+      // Create a picker box node
+      PickerConstructor._.node('div',
+
+      // Create the components nodes.
+      P.component.nodes(STATE.open),
+
+      // The picker box class
+      CLASSES.box),
+
+      // Picker wrap class
+      CLASSES.wrap),
+
+      // Picker frame class
+      CLASSES.frame),
+
+      // Picker holder class
+      CLASSES.holder); //endreturn
+    } //createWrappedComponent
+
+
+    /**
+     * Prepare the input element with all bindings.
+     */
+    function prepareElement() {
+
+      $ELEMENT.
+
+      // Store the picker data by component name.
+      data(NAME, P).
+
+      // Add the “input” class name.
+      addClass(CLASSES.input).
+
+      // Remove the tabindex.
+      attr('tabindex', -1).
+
+      // If there’s a `data-value`, update the value of the element.
+      val($ELEMENT.data('value') ? P.get('select', SETTINGS.format) : ELEMENT.value);
+
+      // Only bind keydown events if the element isn’t editable.
+      if (!SETTINGS.editable) {
+
+        $ELEMENT.
+
+        // On focus/click, focus onto the root to open it up.
+        on('focus.' + STATE.id + ' click.' + STATE.id, function (event) {
+          event.preventDefault();
+          P.$root.eq(0).focus();
+        }).
+
+        // Handle keyboard event based on the picker being opened or not.
+        on('keydown.' + STATE.id, handleKeydownEvent);
+      }
+
+      // Update the aria attributes.
+      aria(ELEMENT, {
+        haspopup: true,
+        expanded: false,
+        readonly: false,
+        owns: ELEMENT.id + '_root'
+      });
+    }
+
+    /**
+     * Prepare the root picker element with all bindings.
+     */
+    function prepareElementRoot() {
+
+      P.$root.on({
+
+        // For iOS8.
+        keydown: handleKeydownEvent,
+
+        // When something within the root is focused, stop from bubbling
+        // to the doc and remove the “focused” state from the root.
+        focusin: function (event) {
+          P.$root.removeClass(CLASSES.focused);
+          event.stopPropagation();
+        },
+
+        // When something within the root holder is clicked, stop it
+        // from bubbling to the doc.
+        'mousedown click': function (event) {
+
+          var target = event.target;
+
+          // Make sure the target isn’t the root holder so it can bubble up.
+          if (target != P.$root.children()[0]) {
+
+            event.stopPropagation();
+
+            // * For mousedown events, cancel the default action in order to
+            //   prevent cases where focus is shifted onto external elements
+            //   when using things like jQuery mobile or MagnificPopup (ref: #249 & #120).
+            //   Also, for Firefox, don’t prevent action on the `option` element.
+            if (event.type == 'mousedown' && !$(target).is('input, select, textarea, button, option')) {
+
+              event.preventDefault();
+
+              // Re-focus onto the root so that users can click away
+              // from elements focused within the picker.
+              P.$root.eq(0).focus();
+            }
+          }
+        }
+      }).
+
+      // Add/remove the “target” class on focus and blur.
+      on({
+        focus: function () {
+          $ELEMENT.addClass(CLASSES.target);
+        },
+        blur: function () {
+          $ELEMENT.removeClass(CLASSES.target);
+        }
+      }).
+
+      // Open the picker and adjust the root “focused” state
+      on('focus.toOpen', handleFocusToOpenEvent).
+
+      // If there’s a click on an actionable element, carry out the actions.
+      on('click', '[data-pick], [data-nav], [data-clear], [data-close]', function () {
+
+        var $target = $(this),
+            targetData = $target.data(),
+            targetDisabled = $target.hasClass(CLASSES.navDisabled) || $target.hasClass(CLASSES.disabled),
+
+
+        // * For IE, non-focusable elements can be active elements as well
+        //   (http://stackoverflow.com/a/2684561).
+        activeElement = getActiveElement();
+        activeElement = activeElement && (activeElement.type || activeElement.href) && activeElement;
+
+        // If it’s disabled or nothing inside is actively focused, re-focus the element.
+        if (targetDisabled || activeElement && !$.contains(P.$root[0], activeElement)) {
+          P.$root.eq(0).focus();
+        }
+
+        // If something is superficially changed, update the `highlight` based on the `nav`.
+        if (!targetDisabled && targetData.nav) {
+          P.set('highlight', P.component.item.highlight, { nav: targetData.nav });
+        }
+
+        // If something is picked, set `select` then close with focus.
+        else if (!targetDisabled && 'pick' in targetData) {
+            P.set('select', targetData.pick);
+            if (SETTINGS.closeOnSelect) {
+              P.close(true);
+            }
+          }
+
+          // If a “clear” button is pressed, empty the values and close with focus.
+          else if (targetData.clear) {
+              P.clear();
+              if (SETTINGS.closeOnSelect) {
+                P.close(true);
+              }
+            } else if (targetData.close) {
+              P.close(true);
+            }
+      }); //P.$root
+
+      aria(P.$root[0], 'hidden', true);
+    }
+
+    /**
+     * Prepare the hidden input element along with all bindings.
+     */
+    function prepareElementHidden() {
+
+      var name;
+
+      if (SETTINGS.hiddenName === true) {
+        name = ELEMENT.name;
+        ELEMENT.name = '';
+      } else {
+        name = [typeof SETTINGS.hiddenPrefix == 'string' ? SETTINGS.hiddenPrefix : '', typeof SETTINGS.hiddenSuffix == 'string' ? SETTINGS.hiddenSuffix : '_submit'];
+        name = name[0] + ELEMENT.name + name[1];
+      }
+
+      P._hidden = $('<input ' + 'type=hidden ' +
+
+      // Create the name using the original input’s with a prefix and suffix.
+      'name="' + name + '"' + (
+
+      // If the element has a value, set the hidden value as well.
+      $ELEMENT.data('value') || ELEMENT.value ? ' value="' + P.get('select', SETTINGS.formatSubmit) + '"' : '') + '>')[0];
+
+      $ELEMENT.
+
+      // If the value changes, update the hidden input with the correct format.
+      on('change.' + STATE.id, function () {
+        P._hidden.value = ELEMENT.value ? P.get('select', SETTINGS.formatSubmit) : '';
+      });
+
+      // Insert the hidden input as specified in the settings.
+      if (SETTINGS.container) $(SETTINGS.container).append(P._hidden);else $ELEMENT.before(P._hidden);
+    }
+
+    // For iOS8.
+    function handleKeydownEvent(event) {
+
+      var keycode = event.keyCode,
+
+
+      // Check if one of the delete keys was pressed.
+      isKeycodeDelete = /^(8|46)$/.test(keycode);
+
+      // For some reason IE clears the input value on “escape”.
+      if (keycode == 27) {
+        P.close();
+        return false;
+      }
+
+      // Check if `space` or `delete` was pressed or the picker is closed with a key movement.
+      if (keycode == 32 || isKeycodeDelete || !STATE.open && P.component.key[keycode]) {
+
+        // Prevent it from moving the page and bubbling to doc.
+        event.preventDefault();
+        event.stopPropagation();
+
+        // If `delete` was pressed, clear the values and close the picker.
+        // Otherwise open the picker.
+        if (isKeycodeDelete) {
+          P.clear().close();
+        } else {
+          P.open();
+        }
+      }
+    }
+
+    // Separated for IE
+    function handleFocusToOpenEvent(event) {
+
+      // Stop the event from propagating to the doc.
+      event.stopPropagation();
+
+      // If it’s a focus event, add the “focused” class to the root.
+      if (event.type == 'focus') {
+        P.$root.addClass(CLASSES.focused);
+      }
+
+      // And then finally open the picker.
+      P.open();
+    }
+
+    // Return a new picker instance.
+    return new PickerInstance();
+  } //PickerConstructor
+
+
+  /**
+   * The default classes and prefix to use for the HTML classes.
+   */
+  PickerConstructor.klasses = function (prefix) {
+    prefix = prefix || 'picker';
+    return {
+
+      picker: prefix,
+      opened: prefix + '--opened',
+      focused: prefix + '--focused',
+
+      input: prefix + '__input',
+      active: prefix + '__input--active',
+      target: prefix + '__input--target',
+
+      holder: prefix + '__holder',
+
+      frame: prefix + '__frame',
+      wrap: prefix + '__wrap',
+
+      box: prefix + '__box'
+    };
+  }; //PickerConstructor.klasses
+
+
+  /**
+   * Check if the default theme is being used.
+   */
+  function isUsingDefaultTheme(element) {
+
+    var theme,
+        prop = 'position';
+
+    // For IE.
+    if (element.currentStyle) {
+      theme = element.currentStyle[prop];
+    }
+
+    // For normal browsers.
+    else if (window.getComputedStyle) {
+        theme = getComputedStyle(element)[prop];
+      }
+
+    return theme == 'fixed';
+  }
+
+  /**
+   * Get the width of the browser’s scrollbar.
+   * Taken from: https://github.com/VodkaBears/Remodal/blob/master/src/jquery.remodal.js
+   */
+  function getScrollbarWidth() {
+
+    if ($html.height() <= $window.height()) {
+      return 0;
+    }
+
+    var $outer = $('<div style="visibility:hidden;width:100px" />').appendTo('body');
+
+    // Get the width without scrollbars.
+    var widthWithoutScroll = $outer[0].offsetWidth;
+
+    // Force adding scrollbars.
+    $outer.css('overflow', 'scroll');
+
+    // Add the inner div.
+    var $inner = $('<div style="width:100%" />').appendTo($outer);
+
+    // Get the width with scrollbars.
+    var widthWithScroll = $inner[0].offsetWidth;
+
+    // Remove the divs.
+    $outer.remove();
+
+    // Return the difference between the widths.
+    return widthWithoutScroll - widthWithScroll;
+  }
+
+  /**
+   * PickerConstructor helper methods.
+   */
+  PickerConstructor._ = {
+
+    /**
+     * Create a group of nodes. Expects:
+     * `
+        {
+            min:    {Integer},
+            max:    {Integer},
+            i:      {Integer},
+            node:   {String},
+            item:   {Function}
+        }
+     * `
+     */
+    group: function (groupObject) {
+
+      var
+      // Scope for the looped object
+      loopObjectScope,
+
+
+      // Create the nodes list
+      nodesList = '',
+
+
+      // The counter starts from the `min`
+      counter = PickerConstructor._.trigger(groupObject.min, groupObject);
+
+      // Loop from the `min` to `max`, incrementing by `i`
+      for (; counter <= PickerConstructor._.trigger(groupObject.max, groupObject, [counter]); counter += groupObject.i) {
+
+        // Trigger the `item` function within scope of the object
+        loopObjectScope = PickerConstructor._.trigger(groupObject.item, groupObject, [counter]);
+
+        // Splice the subgroup and create nodes out of the sub nodes
+        nodesList += PickerConstructor._.node(groupObject.node, loopObjectScope[0], // the node
+        loopObjectScope[1], // the classes
+        loopObjectScope[2] // the attributes
+        );
+      }
+
+      // Return the list of nodes
+      return nodesList;
+    }, //group
+
+
+    /**
+     * Create a dom node string
+     */
+    node: function (wrapper, item, klass, attribute) {
+
+      // If the item is false-y, just return an empty string
+      if (!item) return '';
+
+      // If the item is an array, do a join
+      item = $.isArray(item) ? item.join('') : item;
+
+      // Check for the class
+      klass = klass ? ' class="' + klass + '"' : '';
+
+      // Check for any attributes
+      attribute = attribute ? ' ' + attribute : '';
+
+      // Return the wrapped item
+      return '<' + wrapper + klass + attribute + '>' + item + '</' + wrapper + '>';
+    }, //node
+
+
+    /**
+     * Lead numbers below 10 with a zero.
+     */
+    lead: function (number) {
+      return (number < 10 ? '0' : '') + number;
+    },
+
+    /**
+     * Trigger a function otherwise return the value.
+     */
+    trigger: function (callback, scope, args) {
+      return typeof callback == 'function' ? callback.apply(scope, args || []) : callback;
+    },
+
+    /**
+     * If the second character is a digit, length is 2 otherwise 1.
+     */
+    digits: function (string) {
+      return (/\d/.test(string[1]) ? 2 : 1
+      );
+    },
+
+    /**
+     * Tell if something is a date object.
+     */
+    isDate: function (value) {
+      return {}.toString.call(value).indexOf('Date') > -1 && this.isInteger(value.getDate());
+    },
+
+    /**
+     * Tell if something is an integer.
+     */
+    isInteger: function (value) {
+      return {}.toString.call(value).indexOf('Number') > -1 && value % 1 === 0;
+    },
+
+    /**
+     * Create ARIA attribute strings.
+     */
+    ariaAttr: ariaAttr //PickerConstructor._
+
+
+    /**
+     * Extend the picker with a component and defaults.
+     */
+  };PickerConstructor.extend = function (name, Component) {
+
+    // Extend jQuery.
+    $.fn[name] = function (options, action) {
+
+      // Grab the component data.
+      var componentData = this.data(name);
+
+      // If the picker is requested, return the data object.
+      if (options == 'picker') {
+        return componentData;
+      }
+
+      // If the component data exists and `options` is a string, carry out the action.
+      if (componentData && typeof options == 'string') {
+        return PickerConstructor._.trigger(componentData[options], componentData, [action]);
+      }
+
+      // Otherwise go through each matched element and if the component
+      // doesn’t exist, create a new picker using `this` element
+      // and merging the defaults and options with a deep copy.
+      return this.each(function () {
+        var $this = $(this);
+        if (!$this.data(name)) {
+          new PickerConstructor(this, name, Component, options);
+        }
+      });
+    };
+
+    // Set the defaults.
+    $.fn[name].defaults = Component.defaults;
+  }; //PickerConstructor.extend
+
+
+  function aria(element, attribute, value) {
+    if ($.isPlainObject(attribute)) {
+      for (var key in attribute) {
+        ariaSet(element, key, attribute[key]);
+      }
+    } else {
+      ariaSet(element, attribute, value);
+    }
+  }
+  function ariaSet(element, attribute, value) {
+    element.setAttribute((attribute == 'role' ? '' : 'aria-') + attribute, value);
+  }
+  function ariaAttr(attribute, data) {
+    if (!$.isPlainObject(attribute)) {
+      attribute = { attribute: data };
+    }
+    data = '';
+    for (var key in attribute) {
+      var attr = (key == 'role' ? '' : 'aria-') + key,
+          attrVal = attribute[key];
+      data += attrVal == null ? '' : attr + '="' + attribute[key] + '"';
+    }
+    return data;
+  }
+
+  // IE8 bug throws an error for activeElements within iframes.
+  function getActiveElement() {
+    try {
+      return document.activeElement;
+    } catch (err) {}
+  }
+
+  // Expose the picker constructor.
+  return PickerConstructor;
+});
+; /*!
+  * Date picker for pickadate.js v3.5.0
+  * http://amsul.github.io/pickadate.js/date.htm
+  */
+
+(function (factory) {
+  factory(Materialize.Picker, jQuery);
+})(function (Picker, $) {
+
+  /**
+   * Globals and constants
+   */
+  var DAYS_IN_WEEK = 7,
+      WEEKS_IN_CALENDAR = 6,
+      _ = Picker._;
+
+  /**
+   * The date picker constructor
+   */
+  function DatePicker(picker, settings) {
+
+    var calendar = this,
+        element = picker.$node[0],
+        elementValue = element.value,
+        elementDataValue = picker.$node.data('value'),
+        valueString = elementDataValue || elementValue,
+        formatString = elementDataValue ? settings.formatSubmit : settings.format,
+        isRTL = function () {
+
+      return element.currentStyle ?
+
+      // For IE.
+      element.currentStyle.direction == 'rtl' :
+
+      // For normal browsers.
+      getComputedStyle(picker.$root[0]).direction == 'rtl';
+    };
+
+    calendar.settings = settings;
+    calendar.$node = picker.$node;
+
+    // The queue of methods that will be used to build item objects.
+    calendar.queue = {
+      min: 'measure create',
+      max: 'measure create',
+      now: 'now create',
+      select: 'parse create validate',
+      highlight: 'parse navigate create validate',
+      view: 'parse create validate viewset',
+      disable: 'deactivate',
+      enable: 'activate'
+
+      // The component's item object.
+    };calendar.item = {};
+
+    calendar.item.clear = null;
+    calendar.item.disable = (settings.disable || []).slice(0);
+    calendar.item.enable = -function (collectionDisabled) {
+      return collectionDisabled[0] === true ? collectionDisabled.shift() : -1;
+    }(calendar.item.disable);
+
+    calendar.set('min', settings.min).set('max', settings.max).set('now');
+
+    // When there’s a value, set the `select`, which in turn
+    // also sets the `highlight` and `view`.
+    if (valueString) {
+      calendar.set('select', valueString, { format: formatString });
+    }
+
+    // If there’s no value, default to highlighting “today”.
+    else {
+        calendar.set('select', null).set('highlight', calendar.item.now);
+      }
+
+    // The keycode to movement mapping.
+    calendar.key = {
+      40: 7, // Down
+      38: -7, // Up
+      39: function () {
+        return isRTL() ? -1 : 1;
+      }, // Right
+      37: function () {
+        return isRTL() ? 1 : -1;
+      }, // Left
+      go: function (timeChange) {
+        var highlightedObject = calendar.item.highlight,
+            targetDate = new Date(highlightedObject.year, highlightedObject.month, highlightedObject.date + timeChange);
+        calendar.set('highlight', targetDate, { interval: timeChange });
+        this.render();
+      }
+
+      // Bind some picker events.
+    };picker.on('render', function () {
+      picker.$root.find('.' + settings.klass.selectMonth).on('change', function () {
+        var value = this.value;
+        if (value) {
+          picker.set('highlight', [picker.get('view').year, value, picker.get('highlight').date]);
+          picker.$root.find('.' + settings.klass.selectMonth).trigger('focus');
+        }
+      });
+      picker.$root.find('.' + settings.klass.selectYear).on('change', function () {
+        var value = this.value;
+        if (value) {
+          picker.set('highlight', [value, picker.get('view').month, picker.get('highlight').date]);
+          picker.$root.find('.' + settings.klass.selectYear).trigger('focus');
+        }
+      });
+    }, 1).on('open', function () {
+      var includeToday = '';
+      if (calendar.disabled(calendar.get('now'))) {
+        includeToday = ':not(.' + settings.klass.buttonToday + ')';
+      }
+      picker.$root.find('button' + includeToday + ', select').attr('disabled', false);
+    }, 1).on('close', function () {
+      picker.$root.find('button, select').attr('disabled', true);
+    }, 1);
+  } //DatePicker
+
+
+  /**
+   * Set a datepicker item object.
+   */
+  DatePicker.prototype.set = function (type, value, options) {
+
+    var calendar = this,
+        calendarItem = calendar.item;
+
+    // If the value is `null` just set it immediately.
+    if (value === null) {
+      if (type == 'clear') type = 'select';
+      calendarItem[type] = value;
+      return calendar;
+    }
+
+    // Otherwise go through the queue of methods, and invoke the functions.
+    // Update this as the time unit, and set the final value as this item.
+    // * In the case of `enable`, keep the queue but set `disable` instead.
+    //   And in the case of `flip`, keep the queue but set `enable` instead.
+    calendarItem[type == 'enable' ? 'disable' : type == 'flip' ? 'enable' : type] = calendar.queue[type].split(' ').map(function (method) {
+      value = calendar[method](type, value, options);
+      return value;
+    }).pop();
+
+    // Check if we need to cascade through more updates.
+    if (type == 'select') {
+      calendar.set('highlight', calendarItem.select, options);
+    } else if (type == 'highlight') {
+      calendar.set('view', calendarItem.highlight, options);
+    } else if (type.match(/^(flip|min|max|disable|enable)$/)) {
+      if (calendarItem.select && calendar.disabled(calendarItem.select)) {
+        calendar.set('select', calendarItem.select, options);
+      }
+      if (calendarItem.highlight && calendar.disabled(calendarItem.highlight)) {
+        calendar.set('highlight', calendarItem.highlight, options);
+      }
+    }
+
+    return calendar;
+  }; //DatePicker.prototype.set
+
+
+  /**
+   * Get a datepicker item object.
+   */
+  DatePicker.prototype.get = function (type) {
+    return this.item[type];
+  }; //DatePicker.prototype.get
+
+
+  /**
+   * Create a picker date object.
+   */
+  DatePicker.prototype.create = function (type, value, options) {
+
+    var isInfiniteValue,
+        calendar = this;
+
+    // If there’s no value, use the type as the value.
+    value = value === undefined ? type : value;
+
+    // If it’s infinity, update the value.
+    if (value == -Infinity || value == Infinity) {
+      isInfiniteValue = value;
+    }
+
+    // If it’s an object, use the native date object.
+    else if ($.isPlainObject(value) && _.isInteger(value.pick)) {
+        value = value.obj;
+      }
+
+      // If it’s an array, convert it into a date and make sure
+      // that it’s a valid date – otherwise default to today.
+      else if ($.isArray(value)) {
+          value = new Date(value[0], value[1], value[2]);
+          value = _.isDate(value) ? value : calendar.create().obj;
+        }
+
+        // If it’s a number or date object, make a normalized date.
+        else if (_.isInteger(value) || _.isDate(value)) {
+            value = calendar.normalize(new Date(value), options);
+          }
+
+          // If it’s a literal true or any other case, set it to now.
+          else /*if ( value === true )*/{
+              value = calendar.now(type, value, options);
+            }
+
+    // Return the compiled object.
+    return {
+      year: isInfiniteValue || value.getFullYear(),
+      month: isInfiniteValue || value.getMonth(),
+      date: isInfiniteValue || value.getDate(),
+      day: isInfiniteValue || value.getDay(),
+      obj: isInfiniteValue || value,
+      pick: isInfiniteValue || value.getTime()
+    };
+  }; //DatePicker.prototype.create
+
+
+  /**
+   * Create a range limit object using an array, date object,
+   * literal “true”, or integer relative to another time.
+   */
+  DatePicker.prototype.createRange = function (from, to) {
+
+    var calendar = this,
+        createDate = function (date) {
+      if (date === true || $.isArray(date) || _.isDate(date)) {
+        return calendar.create(date);
+      }
+      return date;
+    };
+
+    // Create objects if possible.
+    if (!_.isInteger(from)) {
+      from = createDate(from);
+    }
+    if (!_.isInteger(to)) {
+      to = createDate(to);
+    }
+
+    // Create relative dates.
+    if (_.isInteger(from) && $.isPlainObject(to)) {
+      from = [to.year, to.month, to.date + from];
+    } else if (_.isInteger(to) && $.isPlainObject(from)) {
+      to = [from.year, from.month, from.date + to];
+    }
+
+    return {
+      from: createDate(from),
+      to: createDate(to)
+    };
+  }; //DatePicker.prototype.createRange
+
+
+  /**
+   * Check if a date unit falls within a date range object.
+   */
+  DatePicker.prototype.withinRange = function (range, dateUnit) {
+    range = this.createRange(range.from, range.to);
+    return dateUnit.pick >= range.from.pick && dateUnit.pick <= range.to.pick;
+  };
+
+  /**
+   * Check if two date range objects overlap.
+   */
+  DatePicker.prototype.overlapRanges = function (one, two) {
+
+    var calendar = this;
+
+    // Convert the ranges into comparable dates.
+    one = calendar.createRange(one.from, one.to);
+    two = calendar.createRange(two.from, two.to);
+
+    return calendar.withinRange(one, two.from) || calendar.withinRange(one, two.to) || calendar.withinRange(two, one.from) || calendar.withinRange(two, one.to);
+  };
+
+  /**
+   * Get the date today.
+   */
+  DatePicker.prototype.now = function (type, value, options) {
+    value = new Date();
+    if (options && options.rel) {
+      value.setDate(value.getDate() + options.rel);
+    }
+    return this.normalize(value, options);
+  };
+
+  /**
+   * Navigate to next/prev month.
+   */
+  DatePicker.prototype.navigate = function (type, value, options) {
+
+    var targetDateObject,
+        targetYear,
+        targetMonth,
+        targetDate,
+        isTargetArray = $.isArray(value),
+        isTargetObject = $.isPlainObject(value),
+        viewsetObject = this.item.view; /*,
+                                        safety = 100*/
+
+    if (isTargetArray || isTargetObject) {
+
+      if (isTargetObject) {
+        targetYear = value.year;
+        targetMonth = value.month;
+        targetDate = value.date;
+      } else {
+        targetYear = +value[0];
+        targetMonth = +value[1];
+        targetDate = +value[2];
+      }
+
+      // If we’re navigating months but the view is in a different
+      // month, navigate to the view’s year and month.
+      if (options && options.nav && viewsetObject && viewsetObject.month !== targetMonth) {
+        targetYear = viewsetObject.year;
+        targetMonth = viewsetObject.month;
+      }
+
+      // Figure out the expected target year and month.
+      targetDateObject = new Date(targetYear, targetMonth + (options && options.nav ? options.nav : 0), 1);
+      targetYear = targetDateObject.getFullYear();
+      targetMonth = targetDateObject.getMonth();
+
+      // If the month we’re going to doesn’t have enough days,
+      // keep decreasing the date until we reach the month’s last date.
+      while ( /*safety &&*/new Date(targetYear, targetMonth, targetDate).getMonth() !== targetMonth) {
+        targetDate -= 1;
+        /*safety -= 1
+        if ( !safety ) {
+            throw 'Fell into an infinite loop while navigating to ' + new Date( targetYear, targetMonth, targetDate ) + '.'
+        }*/
+      }
+
+      value = [targetYear, targetMonth, targetDate];
+    }
+
+    return value;
+  }; //DatePicker.prototype.navigate
+
+
+  /**
+   * Normalize a date by setting the hours to midnight.
+   */
+  DatePicker.prototype.normalize = function (value /*, options*/) {
+    value.setHours(0, 0, 0, 0);
+    return value;
+  };
+
+  /**
+   * Measure the range of dates.
+   */
+  DatePicker.prototype.measure = function (type, value /*, options*/) {
+
+    var calendar = this;
+
+    // If it’s anything false-y, remove the limits.
+    if (!value) {
+      value = type == 'min' ? -Infinity : Infinity;
+    }
+
+    // If it’s a string, parse it.
+    else if (typeof value == 'string') {
+        value = calendar.parse(type, value);
+      }
+
+      // If it's an integer, get a date relative to today.
+      else if (_.isInteger(value)) {
+          value = calendar.now(type, value, { rel: value });
+        }
+
+    return value;
+  }; ///DatePicker.prototype.measure
+
+
+  /**
+   * Create a viewset object based on navigation.
+   */
+  DatePicker.prototype.viewset = function (type, dateObject /*, options*/) {
+    return this.create([dateObject.year, dateObject.month, 1]);
+  };
+
+  /**
+   * Validate a date as enabled and shift if needed.
+   */
+  DatePicker.prototype.validate = function (type, dateObject, options) {
+
+    var calendar = this,
+
+
+    // Keep a reference to the original date.
+    originalDateObject = dateObject,
+
+
+    // Make sure we have an interval.
+    interval = options && options.interval ? options.interval : 1,
+
+
+    // Check if the calendar enabled dates are inverted.
+    isFlippedBase = calendar.item.enable === -1,
+
+
+    // Check if we have any enabled dates after/before now.
+    hasEnabledBeforeTarget,
+        hasEnabledAfterTarget,
+
+
+    // The min & max limits.
+    minLimitObject = calendar.item.min,
+        maxLimitObject = calendar.item.max,
+
+
+    // Check if we’ve reached the limit during shifting.
+    reachedMin,
+        reachedMax,
+
+
+    // Check if the calendar is inverted and at least one weekday is enabled.
+    hasEnabledWeekdays = isFlippedBase && calendar.item.disable.filter(function (value) {
+
+      // If there’s a date, check where it is relative to the target.
+      if ($.isArray(value)) {
+        var dateTime = calendar.create(value).pick;
+        if (dateTime < dateObject.pick) hasEnabledBeforeTarget = true;else if (dateTime > dateObject.pick) hasEnabledAfterTarget = true;
+      }
+
+      // Return only integers for enabled weekdays.
+      return _.isInteger(value);
+    }).length; /*,
+               safety = 100*/
+
+    // Cases to validate for:
+    // [1] Not inverted and date disabled.
+    // [2] Inverted and some dates enabled.
+    // [3] Not inverted and out of range.
+    //
+    // Cases to **not** validate for:
+    // • Navigating months.
+    // • Not inverted and date enabled.
+    // • Inverted and all dates disabled.
+    // • ..and anything else.
+    if (!options || !options.nav) if (
+    /* 1 */!isFlippedBase && calendar.disabled(dateObject) ||
+    /* 2 */isFlippedBase && calendar.disabled(dateObject) && (hasEnabledWeekdays || hasEnabledBeforeTarget || hasEnabledAfterTarget) ||
+    /* 3 */!isFlippedBase && (dateObject.pick <= minLimitObject.pick || dateObject.pick >= maxLimitObject.pick)) {
+
+      // When inverted, flip the direction if there aren’t any enabled weekdays
+      // and there are no enabled dates in the direction of the interval.
+      if (isFlippedBase && !hasEnabledWeekdays && (!hasEnabledAfterTarget && interval > 0 || !hasEnabledBeforeTarget && interval < 0)) {
+        interval *= -1;
+      }
+
+      // Keep looping until we reach an enabled date.
+      while ( /*safety &&*/calendar.disabled(dateObject)) {
+
+        /*safety -= 1
+        if ( !safety ) {
+            throw 'Fell into an infinite loop while validating ' + dateObject.obj + '.'
+        }*/
+
+        // If we’ve looped into the next/prev month with a large interval, return to the original date and flatten the interval.
+        if (Math.abs(interval) > 1 && (dateObject.month < originalDateObject.month || dateObject.month > originalDateObject.month)) {
+          dateObject = originalDateObject;
+          interval = interval > 0 ? 1 : -1;
+        }
+
+        // If we’ve reached the min/max limit, reverse the direction, flatten the interval and set it to the limit.
+        if (dateObject.pick <= minLimitObject.pick) {
+          reachedMin = true;
+          interval = 1;
+          dateObject = calendar.create([minLimitObject.year, minLimitObject.month, minLimitObject.date + (dateObject.pick === minLimitObject.pick ? 0 : -1)]);
+        } else if (dateObject.pick >= maxLimitObject.pick) {
+          reachedMax = true;
+          interval = -1;
+          dateObject = calendar.create([maxLimitObject.year, maxLimitObject.month, maxLimitObject.date + (dateObject.pick === maxLimitObject.pick ? 0 : 1)]);
+        }
+
+        // If we’ve reached both limits, just break out of the loop.
+        if (reachedMin && reachedMax) {
+          break;
+        }
+
+        // Finally, create the shifted date using the interval and keep looping.
+        dateObject = calendar.create([dateObject.year, dateObject.month, dateObject.date + interval]);
+      }
+    } //endif
+
+
+    // Return the date object settled on.
+    return dateObject;
+  }; //DatePicker.prototype.validate
+
+
+  /**
+   * Check if a date is disabled.
+   */
+  DatePicker.prototype.disabled = function (dateToVerify) {
+
+    var calendar = this,
+
+
+    // Filter through the disabled dates to check if this is one.
+    isDisabledMatch = calendar.item.disable.filter(function (dateToDisable) {
+
+      // If the date is a number, match the weekday with 0index and `firstDay` check.
+      if (_.isInteger(dateToDisable)) {
+        return dateToVerify.day === (calendar.settings.firstDay ? dateToDisable : dateToDisable - 1) % 7;
+      }
+
+      // If it’s an array or a native JS date, create and match the exact date.
+      if ($.isArray(dateToDisable) || _.isDate(dateToDisable)) {
+        return dateToVerify.pick === calendar.create(dateToDisable).pick;
+      }
+
+      // If it’s an object, match a date within the “from” and “to” range.
+      if ($.isPlainObject(dateToDisable)) {
+        return calendar.withinRange(dateToDisable, dateToVerify);
+      }
+    });
+
+    // If this date matches a disabled date, confirm it’s not inverted.
+    isDisabledMatch = isDisabledMatch.length && !isDisabledMatch.filter(function (dateToDisable) {
+      return $.isArray(dateToDisable) && dateToDisable[3] == 'inverted' || $.isPlainObject(dateToDisable) && dateToDisable.inverted;
+    }).length;
+
+    // Check the calendar “enabled” flag and respectively flip the
+    // disabled state. Then also check if it’s beyond the min/max limits.
+    return calendar.item.enable === -1 ? !isDisabledMatch : isDisabledMatch || dateToVerify.pick < calendar.item.min.pick || dateToVerify.pick > calendar.item.max.pick;
+  }; //DatePicker.prototype.disabled
+
+
+  /**
+   * Parse a string into a usable type.
+   */
+  DatePicker.prototype.parse = function (type, value, options) {
+
+    var calendar = this,
+        parsingObject = {};
+
+    // If it’s already parsed, we’re good.
+    if (!value || typeof value != 'string') {
+      return value;
+    }
+
+    // We need a `.format` to parse the value with.
+    if (!(options && options.format)) {
+      options = options || {};
+      options.format = calendar.settings.format;
+    }
+
+    // Convert the format into an array and then map through it.
+    calendar.formats.toArray(options.format).map(function (label) {
+
+      var
+      // Grab the formatting label.
+      formattingLabel = calendar.formats[label],
+
+
+      // The format length is from the formatting label function or the
+      // label length without the escaping exclamation (!) mark.
+      formatLength = formattingLabel ? _.trigger(formattingLabel, calendar, [value, parsingObject]) : label.replace(/^!/, '').length;
+
+      // If there's a format label, split the value up to the format length.
+      // Then add it to the parsing object with appropriate label.
+      if (formattingLabel) {
+        parsingObject[label] = value.substr(0, formatLength);
+      }
+
+      // Update the value as the substring from format length to end.
+      value = value.substr(formatLength);
+    });
+
+    // Compensate for month 0index.
+    return [parsingObject.yyyy || parsingObject.yy, +(parsingObject.mm || parsingObject.m) - 1, parsingObject.dd || parsingObject.d];
+  }; //DatePicker.prototype.parse
+
+
+  /**
+   * Various formats to display the object in.
+   */
+  DatePicker.prototype.formats = function () {
+
+    // Return the length of the first word in a collection.
+    function getWordLengthFromCollection(string, collection, dateObject) {
+
+      // Grab the first word from the string.
+      var word = string.match(/\w+/)[0];
+
+      // If there's no month index, add it to the date object
+      if (!dateObject.mm && !dateObject.m) {
+        dateObject.m = collection.indexOf(word) + 1;
+      }
+
+      // Return the length of the word.
+      return word.length;
+    }
+
+    // Get the length of the first word in a string.
+    function getFirstWordLength(string) {
+      return string.match(/\w+/)[0].length;
+    }
+
+    return {
+
+      d: function (string, dateObject) {
+
+        // If there's string, then get the digits length.
+        // Otherwise return the selected date.
+        return string ? _.digits(string) : dateObject.date;
+      },
+      dd: function (string, dateObject) {
+
+        // If there's a string, then the length is always 2.
+        // Otherwise return the selected date with a leading zero.
+        return string ? 2 : _.lead(dateObject.date);
+      },
+      ddd: function (string, dateObject) {
+
+        // If there's a string, then get the length of the first word.
+        // Otherwise return the short selected weekday.
+        return string ? getFirstWordLength(string) : this.settings.weekdaysShort[dateObject.day];
+      },
+      dddd: function (string, dateObject) {
+
+        // If there's a string, then get the length of the first word.
+        // Otherwise return the full selected weekday.
+        return string ? getFirstWordLength(string) : this.settings.weekdaysFull[dateObject.day];
+      },
+      m: function (string, dateObject) {
+
+        // If there's a string, then get the length of the digits
+        // Otherwise return the selected month with 0index compensation.
+        return string ? _.digits(string) : dateObject.month + 1;
+      },
+      mm: function (string, dateObject) {
+
+        // If there's a string, then the length is always 2.
+        // Otherwise return the selected month with 0index and leading zero.
+        return string ? 2 : _.lead(dateObject.month + 1);
+      },
+      mmm: function (string, dateObject) {
+
+        var collection = this.settings.monthsShort;
+
+        // If there's a string, get length of the relevant month from the short
+        // months collection. Otherwise return the selected month from that collection.
+        return string ? getWordLengthFromCollection(string, collection, dateObject) : collection[dateObject.month];
+      },
+      mmmm: function (string, dateObject) {
+
+        var collection = this.settings.monthsFull;
+
+        // If there's a string, get length of the relevant month from the full
+        // months collection. Otherwise return the selected month from that collection.
+        return string ? getWordLengthFromCollection(string, collection, dateObject) : collection[dateObject.month];
+      },
+      yy: function (string, dateObject) {
+
+        // If there's a string, then the length is always 2.
+        // Otherwise return the selected year by slicing out the first 2 digits.
+        return string ? 2 : ('' + dateObject.year).slice(2);
+      },
+      yyyy: function (string, dateObject) {
+
+        // If there's a string, then the length is always 4.
+        // Otherwise return the selected year.
+        return string ? 4 : dateObject.year;
+      },
+
+      // Create an array by splitting the formatting string passed.
+      toArray: function (formatString) {
+        return formatString.split(/(d{1,4}|m{1,4}|y{4}|yy|!.)/g);
+      },
+
+      // Format an object into a string using the formatting options.
+      toString: function (formatString, itemObject) {
+        var calendar = this;
+        return calendar.formats.toArray(formatString).map(function (label) {
+          return _.trigger(calendar.formats[label], calendar, [0, itemObject]) || label.replace(/^!/, '');
+        }).join('');
+      }
+    };
+  }(); //DatePicker.prototype.formats
+
+
+  /**
+   * Check if two date units are the exact.
+   */
+  DatePicker.prototype.isDateExact = function (one, two) {
+
+    var calendar = this;
+
+    // When we’re working with weekdays, do a direct comparison.
+    if (_.isInteger(one) && _.isInteger(two) || typeof one == 'boolean' && typeof two == 'boolean') {
+      return one === two;
+    }
+
+    // When we’re working with date representations, compare the “pick” value.
+    if ((_.isDate(one) || $.isArray(one)) && (_.isDate(two) || $.isArray(two))) {
+      return calendar.create(one).pick === calendar.create(two).pick;
+    }
+
+    // When we’re working with range objects, compare the “from” and “to”.
+    if ($.isPlainObject(one) && $.isPlainObject(two)) {
+      return calendar.isDateExact(one.from, two.from) && calendar.isDateExact(one.to, two.to);
+    }
+
+    return false;
+  };
+
+  /**
+   * Check if two date units overlap.
+   */
+  DatePicker.prototype.isDateOverlap = function (one, two) {
+
+    var calendar = this,
+        firstDay = calendar.settings.firstDay ? 1 : 0;
+
+    // When we’re working with a weekday index, compare the days.
+    if (_.isInteger(one) && (_.isDate(two) || $.isArray(two))) {
+      one = one % 7 + firstDay;
+      return one === calendar.create(two).day + 1;
+    }
+    if (_.isInteger(two) && (_.isDate(one) || $.isArray(one))) {
+      two = two % 7 + firstDay;
+      return two === calendar.create(one).day + 1;
+    }
+
+    // When we’re working with range objects, check if the ranges overlap.
+    if ($.isPlainObject(one) && $.isPlainObject(two)) {
+      return calendar.overlapRanges(one, two);
+    }
+
+    return false;
+  };
+
+  /**
+   * Flip the “enabled” state.
+   */
+  DatePicker.prototype.flipEnable = function (val) {
+    var itemObject = this.item;
+    itemObject.enable = val || (itemObject.enable == -1 ? 1 : -1);
+  };
+
+  /**
+   * Mark a collection of dates as “disabled”.
+   */
+  DatePicker.prototype.deactivate = function (type, datesToDisable) {
+
+    var calendar = this,
+        disabledItems = calendar.item.disable.slice(0);
+
+    // If we’re flipping, that’s all we need to do.
+    if (datesToDisable == 'flip') {
+      calendar.flipEnable();
+    } else if (datesToDisable === false) {
+      calendar.flipEnable(1);
+      disabledItems = [];
+    } else if (datesToDisable === true) {
+      calendar.flipEnable(-1);
+      disabledItems = [];
+    }
+
+    // Otherwise go through the dates to disable.
+    else {
+
+        datesToDisable.map(function (unitToDisable) {
+
+          var matchFound;
+
+          // When we have disabled items, check for matches.
+          // If something is matched, immediately break out.
+          for (var index = 0; index < disabledItems.length; index += 1) {
+            if (calendar.isDateExact(unitToDisable, disabledItems[index])) {
+              matchFound = true;
+              break;
+            }
+          }
+
+          // If nothing was found, add the validated unit to the collection.
+          if (!matchFound) {
+            if (_.isInteger(unitToDisable) || _.isDate(unitToDisable) || $.isArray(unitToDisable) || $.isPlainObject(unitToDisable) && unitToDisable.from && unitToDisable.to) {
+              disabledItems.push(unitToDisable);
+            }
+          }
+        });
+      }
+
+    // Return the updated collection.
+    return disabledItems;
+  }; //DatePicker.prototype.deactivate
+
+
+  /**
+   * Mark a collection of dates as “enabled”.
+   */
+  DatePicker.prototype.activate = function (type, datesToEnable) {
+
+    var calendar = this,
+        disabledItems = calendar.item.disable,
+        disabledItemsCount = disabledItems.length;
+
+    // If we’re flipping, that’s all we need to do.
+    if (datesToEnable == 'flip') {
+      calendar.flipEnable();
+    } else if (datesToEnable === true) {
+      calendar.flipEnable(1);
+      disabledItems = [];
+    } else if (datesToEnable === false) {
+      calendar.flipEnable(-1);
+      disabledItems = [];
+    }
+
+    // Otherwise go through the disabled dates.
+    else {
+
+        datesToEnable.map(function (unitToEnable) {
+
+          var matchFound, disabledUnit, index, isExactRange;
+
+          // Go through the disabled items and try to find a match.
+          for (index = 0; index < disabledItemsCount; index += 1) {
+
+            disabledUnit = disabledItems[index];
+
+            // When an exact match is found, remove it from the collection.
+            if (calendar.isDateExact(disabledUnit, unitToEnable)) {
+              matchFound = disabledItems[index] = null;
+              isExactRange = true;
+              break;
+            }
+
+            // When an overlapped match is found, add the “inverted” state to it.
+            else if (calendar.isDateOverlap(disabledUnit, unitToEnable)) {
+                if ($.isPlainObject(unitToEnable)) {
+                  unitToEnable.inverted = true;
+                  matchFound = unitToEnable;
+                } else if ($.isArray(unitToEnable)) {
+                  matchFound = unitToEnable;
+                  if (!matchFound[3]) matchFound.push('inverted');
+                } else if (_.isDate(unitToEnable)) {
+                  matchFound = [unitToEnable.getFullYear(), unitToEnable.getMonth(), unitToEnable.getDate(), 'inverted'];
+                }
+                break;
+              }
+          }
+
+          // If a match was found, remove a previous duplicate entry.
+          if (matchFound) for (index = 0; index < disabledItemsCount; index += 1) {
+            if (calendar.isDateExact(disabledItems[index], unitToEnable)) {
+              disabledItems[index] = null;
+              break;
+            }
+          }
+
+          // In the event that we’re dealing with an exact range of dates,
+          // make sure there are no “inverted” dates because of it.
+          if (isExactRange) for (index = 0; index < disabledItemsCount; index += 1) {
+            if (calendar.isDateOverlap(disabledItems[index], unitToEnable)) {
+              disabledItems[index] = null;
+              break;
+            }
+          }
+
+          // If something is still matched, add it into the collection.
+          if (matchFound) {
+            disabledItems.push(matchFound);
+          }
+        });
+      }
+
+    // Return the updated collection.
+    return disabledItems.filter(function (val) {
+      return val != null;
+    });
+  }; //DatePicker.prototype.activate
+
+
+  /**
+   * Create a string for the nodes in the picker.
+   */
+  DatePicker.prototype.nodes = function (isOpen) {
+
+    var calendar = this,
+        settings = calendar.settings,
+        calendarItem = calendar.item,
+        nowObject = calendarItem.now,
+        selectedObject = calendarItem.select,
+        highlightedObject = calendarItem.highlight,
+        viewsetObject = calendarItem.view,
+        disabledCollection = calendarItem.disable,
+        minLimitObject = calendarItem.min,
+        maxLimitObject = calendarItem.max,
+
+
+    // Create the calendar table head using a copy of weekday labels collection.
+    // * We do a copy so we don't mutate the original array.
+    tableHead = function (collection, fullCollection) {
+
+      // If the first day should be Monday, move Sunday to the end.
+      if (settings.firstDay) {
+        collection.push(collection.shift());
+        fullCollection.push(fullCollection.shift());
+      }
+
+      // Create and return the table head group.
+      return _.node('thead', _.node('tr', _.group({
+        min: 0,
+        max: DAYS_IN_WEEK - 1,
+        i: 1,
+        node: 'th',
+        item: function (counter) {
+          return [collection[counter], settings.klass.weekdays, 'scope=col title="' + fullCollection[counter] + '"'];
+        }
+      }))); //endreturn
+
+      // Materialize modified
+    }((settings.showWeekdaysFull ? settings.weekdaysFull : settings.weekdaysLetter).slice(0), settings.weekdaysFull.slice(0)),
+        //tableHead
+
+
+    // Create the nav for next/prev month.
+    createMonthNav = function (next) {
+
+      // Otherwise, return the created month tag.
+      return _.node('div', ' ', settings.klass['nav' + (next ? 'Next' : 'Prev')] + (
+
+      // If the focused month is outside the range, disabled the button.
+      next && viewsetObject.year >= maxLimitObject.year && viewsetObject.month >= maxLimitObject.month || !next && viewsetObject.year <= minLimitObject.year && viewsetObject.month <= minLimitObject.month ? ' ' + settings.klass.navDisabled : ''), 'data-nav=' + (next || -1) + ' ' + _.ariaAttr({
+        role: 'button',
+        controls: calendar.$node[0].id + '_table'
+      }) + ' ' + 'title="' + (next ? settings.labelMonthNext : settings.labelMonthPrev) + '"'); //endreturn
+    },
+        //createMonthNav
+
+
+    // Create the month label.
+    //Materialize modified
+    createMonthLabel = function (override) {
+
+      var monthsCollection = settings.showMonthsShort ? settings.monthsShort : settings.monthsFull;
+
+      // Materialize modified
+      if (override == "short_months") {
+        monthsCollection = settings.monthsShort;
+      }
+
+      // If there are months to select, add a dropdown menu.
+      if (settings.selectMonths && override == undefined) {
+
+        return _.node('select', _.group({
+          min: 0,
+          max: 11,
+          i: 1,
+          node: 'option',
+          item: function (loopedMonth) {
+
+            return [
+
+            // The looped month and no classes.
+            monthsCollection[loopedMonth], 0,
+
+            // Set the value and selected index.
+            'value=' + loopedMonth + (viewsetObject.month == loopedMonth ? ' selected' : '') + (viewsetObject.year == minLimitObject.year && loopedMonth < minLimitObject.month || viewsetObject.year == maxLimitObject.year && loopedMonth > maxLimitObject.month ? ' disabled' : '')];
+          }
+        }), settings.klass.selectMonth + ' browser-default', (isOpen ? '' : 'disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' + 'title="' + settings.labelMonthSelect + '"');
+      }
+
+      // Materialize modified
+      if (override == "short_months") if (selectedObject != null) return monthsCollection[selectedObject.month];else return monthsCollection[viewsetObject.month];
+
+      // If there's a need for a month selector
+      return _.node('div', monthsCollection[viewsetObject.month], settings.klass.month);
+    },
+        //createMonthLabel
+
+
+    // Create the year label.
+    // Materialize modified
+    createYearLabel = function (override) {
+
+      var focusedYear = viewsetObject.year,
+
+
+      // If years selector is set to a literal "true", set it to 5. Otherwise
+      // divide in half to get half before and half after focused year.
+      numberYears = settings.selectYears === true ? 5 : ~~(settings.selectYears / 2);
+
+      // If there are years to select, add a dropdown menu.
+      if (numberYears) {
+
+        var minYear = minLimitObject.year,
+            maxYear = maxLimitObject.year,
+            lowestYear = focusedYear - numberYears,
+            highestYear = focusedYear + numberYears;
+
+        // If the min year is greater than the lowest year, increase the highest year
+        // by the difference and set the lowest year to the min year.
+        if (minYear > lowestYear) {
+          highestYear += minYear - lowestYear;
+          lowestYear = minYear;
+        }
+
+        // If the max year is less than the highest year, decrease the lowest year
+        // by the lower of the two: available and needed years. Then set the
+        // highest year to the max year.
+        if (maxYear < highestYear) {
+
+          var availableYears = lowestYear - minYear,
+              neededYears = highestYear - maxYear;
+
+          lowestYear -= availableYears > neededYears ? neededYears : availableYears;
+          highestYear = maxYear;
+        }
+
+        if (settings.selectYears && override == undefined) {
+          return _.node('select', _.group({
+            min: lowestYear,
+            max: highestYear,
+            i: 1,
+            node: 'option',
+            item: function (loopedYear) {
+              return [
+
+              // The looped year and no classes.
+              loopedYear, 0,
+
+              // Set the value and selected index.
+              'value=' + loopedYear + (focusedYear == loopedYear ? ' selected' : '')];
+            }
+          }), settings.klass.selectYear + ' browser-default', (isOpen ? '' : 'disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' + 'title="' + settings.labelYearSelect + '"');
+        }
+      }
+
+      // Materialize modified
+      if (override === 'raw' && selectedObject != null) {
+        return _.node('div', selectedObject.year);
+      }
+
+      // Otherwise just return the year focused
+      return _.node('div', focusedYear, settings.klass.year);
+    }; //createYearLabel
+
+
+    // Materialize modified
+    createDayLabel = function () {
+      if (selectedObject != null) return selectedObject.date;else return nowObject.date;
+    };
+    createWeekdayLabel = function () {
+      var display_day;
+
+      if (selectedObject != null) display_day = selectedObject.day;else display_day = nowObject.day;
+      var weekday = settings.weekdaysShort[display_day];
+      return weekday;
+    };
+
+    // Create and return the entire calendar.
+
+    return _.node(
+    // Date presentation View
+    'div', _.node(
+    // Div for Year
+    'div', createYearLabel("raw"), settings.klass.year_display) + _.node('span', createWeekdayLabel() + ', ', "picker__weekday-display") + _.node(
+    // Div for short Month
+    'span', createMonthLabel("short_months") + ' ', settings.klass.month_display) + _.node(
+    // Div for Day
+    'span', createDayLabel(), settings.klass.day_display), settings.klass.date_display) +
+    // Calendar container
+    _.node('div', _.node('div', _.node('div', (settings.selectYears ? createMonthLabel() + createYearLabel() : createMonthLabel() + createYearLabel()) + createMonthNav() + createMonthNav(1), settings.klass.header) + _.node('table', tableHead + _.node('tbody', _.group({
+      min: 0,
+      max: WEEKS_IN_CALENDAR - 1,
+      i: 1,
+      node: 'tr',
+      item: function (rowCounter) {
+
+        // If Monday is the first day and the month starts on Sunday, shift the date back a week.
+        var shiftDateBy = settings.firstDay && calendar.create([viewsetObject.year, viewsetObject.month, 1]).day === 0 ? -7 : 0;
+
+        return [_.group({
+          min: DAYS_IN_WEEK * rowCounter - viewsetObject.day + shiftDateBy + 1, // Add 1 for weekday 0index
+          max: function () {
+            return this.min + DAYS_IN_WEEK - 1;
+          },
+          i: 1,
+          node: 'td',
+          item: function (targetDate) {
+
+            // Convert the time date from a relative date to a target date.
+            targetDate = calendar.create([viewsetObject.year, viewsetObject.month, targetDate + (settings.firstDay ? 1 : 0)]);
+
+            var isSelected = selectedObject && selectedObject.pick == targetDate.pick,
+                isHighlighted = highlightedObject && highlightedObject.pick == targetDate.pick,
+                isDisabled = disabledCollection && calendar.disabled(targetDate) || targetDate.pick < minLimitObject.pick || targetDate.pick > maxLimitObject.pick,
+                formattedDate = _.trigger(calendar.formats.toString, calendar, [settings.format, targetDate]);
+
+            return [_.node('div', targetDate.date, function (klasses) {
+
+              // Add the `infocus` or `outfocus` classes based on month in view.
+              klasses.push(viewsetObject.month == targetDate.month ? settings.klass.infocus : settings.klass.outfocus);
+
+              // Add the `today` class if needed.
+              if (nowObject.pick == targetDate.pick) {
+                klasses.push(settings.klass.now);
+              }
+
+              // Add the `selected` class if something's selected and the time matches.
+              if (isSelected) {
+                klasses.push(settings.klass.selected);
+              }
+
+              // Add the `highlighted` class if something's highlighted and the time matches.
+              if (isHighlighted) {
+                klasses.push(settings.klass.highlighted);
+              }
+
+              // Add the `disabled` class if something's disabled and the object matches.
+              if (isDisabled) {
+                klasses.push(settings.klass.disabled);
+              }
+
+              return klasses.join(' ');
+            }([settings.klass.day]), 'data-pick=' + targetDate.pick + ' ' + _.ariaAttr({
+              role: 'gridcell',
+              label: formattedDate,
+              selected: isSelected && calendar.$node.val() === formattedDate ? true : null,
+              activedescendant: isHighlighted ? true : null,
+              disabled: isDisabled ? true : null
+            }) + ' ' + (isDisabled ? '' : 'tabindex="0"')), '', _.ariaAttr({ role: 'presentation' })]; //endreturn
+          }
+        })]; //endreturn
+      }
+    })), settings.klass.table, 'id="' + calendar.$node[0].id + '_table' + '" ' + _.ariaAttr({
+      role: 'grid',
+      controls: calendar.$node[0].id,
+      readonly: true
+    })), settings.klass.calendar_container) // end calendar
+
+    +
+
+    // * For Firefox forms to submit, make sure to set the buttons’ `type` attributes as “button”.
+    _.node('div', _.node('button', settings.today, "btn-flat picker__today waves-effect", 'type=button data-pick=' + nowObject.pick + (isOpen && !calendar.disabled(nowObject) ? '' : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })) + _.node('button', settings.clear, "btn-flat picker__clear waves-effect", 'type=button data-clear=1' + (isOpen ? '' : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })) + _.node('button', settings.close, "btn-flat picker__close waves-effect", 'type=button data-close=true ' + (isOpen ? '' : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })), settings.klass.footer), 'picker__container__wrapper'); //endreturn
+  }; //DatePicker.prototype.nodes
+
+
+  /**
+   * The date picker defaults.
+   */
+  DatePicker.defaults = function (prefix) {
+
+    return {
+
+      // The title label to use for the month nav buttons
+      labelMonthNext: 'Next month',
+      labelMonthPrev: 'Previous month',
+
+      // The title label to use for the dropdown selectors
+      labelMonthSelect: 'Select a month',
+      labelYearSelect: 'Select a year',
+
+      // Months and weekdays
+      monthsFull: ['January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December'],
+      monthsShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'],
+      weekdaysFull: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'],
+      weekdaysShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'],
+
+      // Materialize modified
+      weekdaysLetter: ['S', 'M', 'T', 'W', 'T', 'F', 'S'],
+
+      // Today and clear
+      today: 'Today',
+      clear: 'Clear',
+      close: 'Ok',
+
+      // Picker close behavior (Prevent a change in behaviour for backwards compatibility)
+      closeOnSelect: false,
+
+      // The format to show on the `input` element
+      format: 'd mmmm, yyyy',
+
+      // Classes
+      klass: {
+
+        table: prefix + 'table',
+
+        header: prefix + 'header',
+
+        // Materialize Added klasses
+        date_display: prefix + 'date-display',
+        day_display: prefix + 'day-display',
+        month_display: prefix + 'month-display',
+        year_display: prefix + 'year-display',
+        calendar_container: prefix + 'calendar-container',
+        // end
+
+
+        navPrev: prefix + 'nav--prev',
+        navNext: prefix + 'nav--next',
+        navDisabled: prefix + 'nav--disabled',
+
+        month: prefix + 'month',
+        year: prefix + 'year',
+
+        selectMonth: prefix + 'select--month',
+        selectYear: prefix + 'select--year',
+
+        weekdays: prefix + 'weekday',
+
+        day: prefix + 'day',
+        disabled: prefix + 'day--disabled',
+        selected: prefix + 'day--selected',
+        highlighted: prefix + 'day--highlighted',
+        now: prefix + 'day--today',
+        infocus: prefix + 'day--infocus',
+        outfocus: prefix + 'day--outfocus',
+
+        footer: prefix + 'footer',
+
+        buttonClear: prefix + 'button--clear',
+        buttonToday: prefix + 'button--today',
+        buttonClose: prefix + 'button--close'
+      }
+    };
+  }(Picker.klasses().picker + '__');
+
+  /**
+   * Extend the picker to add the date picker.
+   */
+  Picker.extend('pickadate', DatePicker);
+});
+; /*!
+  * ClockPicker v0.0.7 (http://weareoutman.github.io/clockpicker/)
+  * Copyright 2014 Wang Shenwei.
+  * Licensed under MIT (https://github.com/weareoutman/clockpicker/blob/gh-pages/LICENSE)
+  *
+  * Further modified
+  * Copyright 2015 Ching Yaw Hao.
+  */
+
+(function ($) {
+  var $win = $(window),
+      $doc = $(document);
+
+  // Can I use inline svg ?
+  var svgNS = 'http://www.w3.org/2000/svg',
+      svgSupported = 'SVGAngle' in window && function () {
+    var supported,
+        el = document.createElement('div');
+    el.innerHTML = '<svg/>';
+    supported = (el.firstChild && el.firstChild.namespaceURI) == svgNS;
+    el.innerHTML = '';
+    return supported;
+  }();
+
+  // Can I use transition ?
+  var transitionSupported = function () {
+    var style = document.createElement('div').style;
+    return 'transition' in style || 'WebkitTransition' in style || 'MozTransition' in style || 'msTransition' in style || 'OTransition' in style;
+  }();
+
+  // Listen touch events in touch screen device, instead of mouse events in desktop.
+  var touchSupported = 'ontouchstart' in window,
+      mousedownEvent = 'mousedown' + (touchSupported ? ' touchstart' : ''),
+      mousemoveEvent = 'mousemove.clockpicker' + (touchSupported ? ' touchmove.clockpicker' : ''),
+      mouseupEvent = 'mouseup.clockpicker' + (touchSupported ? ' touchend.clockpicker' : '');
+
+  // Vibrate the device if supported
+  var vibrate = navigator.vibrate ? 'vibrate' : navigator.webkitVibrate ? 'webkitVibrate' : null;
+
+  function createSvgElement(name) {
+    return document.createElementNS(svgNS, name);
+  }
+
+  function leadingZero(num) {
+    return (num < 10 ? '0' : '') + num;
+  }
+
+  // Get a unique id
+  var idCounter = 0;
+  function uniqueId(prefix) {
+    var id = ++idCounter + '';
+    return prefix ? prefix + id : id;
+  }
+
+  // Clock size
+  var dialRadius = 135,
+      outerRadius = 105,
+
+  // innerRadius = 80 on 12 hour clock
+  innerRadius = 70,
+      tickRadius = 20,
+      diameter = dialRadius * 2,
+      duration = transitionSupported ? 350 : 1;
+
+  // Popover template
+  var tpl = ['<div class="clockpicker picker">', '<div class="picker__holder">', '<div class="picker__frame">', '<div class="picker__wrap">', '<div class="picker__box">', '<div class="picker__date-display">', '<div class="clockpicker-display">', '<div class="clockpicker-display-column">', '<span class="clockpicker-span-hours text-primary"></span>', ':', '<span class="clockpicker-span-minutes"></span>', '</div>', '<div class="clockpicker-display-column clockpicker-display-am-pm">', '<div class="clockpicker-span-am-pm"></div>', '</div>', '</div>', '</div>', '<div class="picker__container__wrapper">', '<div class="picker__calendar-container">', '<div class="clockpicker-plate">', '<div class="clockpicker-canvas"></div>', '<div class="clockpicker-dial clockpicker-hours"></div>', '<div class="clockpicker-dial clockpicker-minutes clockpicker-dial-out"></div>', '</div>', '<div class="clockpicker-am-pm-block">', '</div>', '</div>', '<div class="picker__footer">', '</div>', '</div>', '</div>', '</div>', '</div>', '</div>', '</div>'].join('');
+
+  // ClockPicker
+  function ClockPicker(element, options) {
+    var popover = $(tpl),
+        plate = popover.find('.clockpicker-plate'),
+        holder = popover.find('.picker__holder'),
+        hoursView = popover.find('.clockpicker-hours'),
+        minutesView = popover.find('.clockpicker-minutes'),
+        amPmBlock = popover.find('.clockpicker-am-pm-block'),
+        isInput = element.prop('tagName') === 'INPUT',
+        input = isInput ? element : element.find('input'),
+        label = $("label[for=" + input.attr("id") + "]"),
+        self = this;
+
+    this.id = uniqueId('cp');
+    this.element = element;
+    this.holder = holder;
+    this.options = options;
+    this.isAppended = false;
+    this.isShown = false;
+    this.currentView = 'hours';
+    this.isInput = isInput;
+    this.input = input;
+    this.label = label;
+    this.popover = popover;
+    this.plate = plate;
+    this.hoursView = hoursView;
+    this.minutesView = minutesView;
+    this.amPmBlock = amPmBlock;
+    this.spanHours = popover.find('.clockpicker-span-hours');
+    this.spanMinutes = popover.find('.clockpicker-span-minutes');
+    this.spanAmPm = popover.find('.clockpicker-span-am-pm');
+    this.footer = popover.find('.picker__footer');
+    this.amOrPm = "PM";
+
+    // Setup for for 12 hour clock if option is selected
+    if (options.twelvehour) {
+      if (!options.ampmclickable) {
+        this.spanAmPm.empty();
+        $('<div id="click-am">AM</div>').appendTo(this.spanAmPm);
+        $('<div id="click-pm">PM</div>').appendTo(this.spanAmPm);
+      } else {
+        this.spanAmPm.empty();
+        $('<div id="click-am">AM</div>').on("click", function () {
+          self.spanAmPm.children('#click-am').addClass("text-primary");
+          self.spanAmPm.children('#click-pm').removeClass("text-primary");
+          self.amOrPm = "AM";
+        }).appendTo(this.spanAmPm);
+        $('<div id="click-pm">PM</div>').on("click", function () {
+          self.spanAmPm.children('#click-pm').addClass("text-primary");
+          self.spanAmPm.children('#click-am').removeClass("text-primary");
+          self.amOrPm = 'PM';
+        }).appendTo(this.spanAmPm);
+      }
+    }
+
+    // Add buttons to footer
+    $('<button type="button" class="btn-flat picker__clear" tabindex="' + (options.twelvehour ? '3' : '1') + '">' + options.cleartext + '</button>').click($.proxy(this.clear, this)).appendTo(this.footer);
+    $('<button type="button" class="btn-flat picker__close" tabindex="' + (options.twelvehour ? '3' : '1') + '">' + options.canceltext + '</button>').click($.proxy(this.hide, this)).appendTo(this.footer);
+    $('<button type="button" class="btn-flat picker__close" tabindex="' + (options.twelvehour ? '3' : '1') + '">' + options.donetext + '</button>').click($.proxy(this.done, this)).appendTo(this.footer);
+
+    this.spanHours.click($.proxy(this.toggleView, this, 'hours'));
+    this.spanMinutes.click($.proxy(this.toggleView, this, 'minutes'));
+
+    // Show or toggle
+    input.on('focus.clockpicker click.clockpicker', $.proxy(this.show, this));
+
+    // Build ticks
+    var tickTpl = $('<div class="clockpicker-tick"></div>'),
+        i,
+        tick,
+        radian,
+        radius;
+
+    // Hours view
+    if (options.twelvehour) {
+      for (i = 1; i < 13; i += 1) {
+        tick = tickTpl.clone();
+        radian = i / 6 * Math.PI;
+        radius = outerRadius;
+        tick.css({
+          left: dialRadius + Math.sin(radian) * radius - tickRadius,
+          top: dialRadius - Math.cos(radian) * radius - tickRadius
+        });
+        tick.html(i === 0 ? '00' : i);
+        hoursView.append(tick);
+        tick.on(mousedownEvent, mousedown);
+      }
+    } else {
+      for (i = 0; i < 24; i += 1) {
+        tick = tickTpl.clone();
+        radian = i / 6 * Math.PI;
+        var inner = i > 0 && i < 13;
+        radius = inner ? innerRadius : outerRadius;
+        tick.css({
+          left: dialRadius + Math.sin(radian) * radius - tickRadius,
+          top: dialRadius - Math.cos(radian) * radius - tickRadius
+        });
+        tick.html(i === 0 ? '00' : i);
+        hoursView.append(tick);
+        tick.on(mousedownEvent, mousedown);
+      }
+    }
+
+    // Minutes view
+    for (i = 0; i < 60; i += 5) {
+      tick = tickTpl.clone();
+      radian = i / 30 * Math.PI;
+      tick.css({
+        left: dialRadius + Math.sin(radian) * outerRadius - tickRadius,
+        top: dialRadius - Math.cos(radian) * outerRadius - tickRadius
+      });
+      tick.html(leadingZero(i));
+      minutesView.append(tick);
+      tick.on(mousedownEvent, mousedown);
+    }
+
+    // Clicking on minutes view space
+    plate.on(mousedownEvent, function (e) {
+      if ($(e.target).closest('.clockpicker-tick').length === 0) {
+        mousedown(e, true);
+      }
+    });
+
+    // Mousedown or touchstart
+    function mousedown(e, space) {
+      var offset = plate.offset(),
+          isTouch = /^touch/.test(e.type),
+          x0 = offset.left + dialRadius,
+          y0 = offset.top + dialRadius,
+          dx = (isTouch ? e.originalEvent.touches[0] : e).pageX - x0,
+          dy = (isTouch ? e.originalEvent.touches[0] : e).pageY - y0,
+          z = Math.sqrt(dx * dx + dy * dy),
+          moved = false;
+
+      // When clicking on minutes view space, check the mouse position
+      if (space && (z < outerRadius - tickRadius || z > outerRadius + tickRadius)) {
+        return;
+      }
+      e.preventDefault();
+
+      // Set cursor style of body after 200ms
+      var movingTimer = setTimeout(function () {
+        self.popover.addClass('clockpicker-moving');
+      }, 200);
+
+      // Clock
+      self.setHand(dx, dy, !space, true);
+
+      // Mousemove on document
+      $doc.off(mousemoveEvent).on(mousemoveEvent, function (e) {
+        e.preventDefault();
+        var isTouch = /^touch/.test(e.type),
+            x = (isTouch ? e.originalEvent.touches[0] : e).pageX - x0,
+            y = (isTouch ? e.originalEvent.touches[0] : e).pageY - y0;
+        if (!moved && x === dx && y === dy) {
+          // Clicking in chrome on windows will trigger a mousemove event
+          return;
+        }
+        moved = true;
+        self.setHand(x, y, false, true);
+      });
+
+      // Mouseup on document
+      $doc.off(mouseupEvent).on(mouseupEvent, function (e) {
+        $doc.off(mouseupEvent);
+        e.preventDefault();
+        var isTouch = /^touch/.test(e.type),
+            x = (isTouch ? e.originalEvent.changedTouches[0] : e).pageX - x0,
+            y = (isTouch ? e.originalEvent.changedTouches[0] : e).pageY - y0;
+        if ((space || moved) && x === dx && y === dy) {
+          self.setHand(x, y);
+        }
+
+        if (self.currentView === 'hours') {
+          self.toggleView('minutes', duration / 2);
+        } else if (options.autoclose) {
+          self.minutesView.addClass('clockpicker-dial-out');
+          setTimeout(function () {
+            self.done();
+          }, duration / 2);
+        }
+        plate.prepend(canvas);
+
+        // Reset cursor style of body
+        clearTimeout(movingTimer);
+        self.popover.removeClass('clockpicker-moving');
+
+        // Unbind mousemove event
+        $doc.off(mousemoveEvent);
+      });
+    }
+
+    if (svgSupported) {
+      // Draw clock hands and others
+      var canvas = popover.find('.clockpicker-canvas'),
+          svg = createSvgElement('svg');
+      svg.setAttribute('class', 'clockpicker-svg');
+      svg.setAttribute('width', diameter);
+      svg.setAttribute('height', diameter);
+      var g = createSvgElement('g');
+      g.setAttribute('transform', 'translate(' + dialRadius + ',' + dialRadius + ')');
+      var bearing = createSvgElement('circle');
+      bearing.setAttribute('class', 'clockpicker-canvas-bearing');
+      bearing.setAttribute('cx', 0);
+      bearing.setAttribute('cy', 0);
+      bearing.setAttribute('r', 4);
+      var hand = createSvgElement('line');
+      hand.setAttribute('x1', 0);
+      hand.setAttribute('y1', 0);
+      var bg = createSvgElement('circle');
+      bg.setAttribute('class', 'clockpicker-canvas-bg');
+      bg.setAttribute('r', tickRadius);
+      g.appendChild(hand);
+      g.appendChild(bg);
+      g.appendChild(bearing);
+      svg.appendChild(g);
+      canvas.append(svg);
+
+      this.hand = hand;
+      this.bg = bg;
+      this.bearing = bearing;
+      this.g = g;
+      this.canvas = canvas;
+    }
+
+    raiseCallback(this.options.init);
+  }
+
+  function raiseCallback(callbackFunction) {
+    if (callbackFunction && typeof callbackFunction === "function") callbackFunction();
+  }
+
+  // Default options
+  ClockPicker.DEFAULTS = {
+    'default': '', // default time, 'now' or '13:14' e.g.
+    fromnow: 0, // set default time to * milliseconds from now (using with default = 'now')
+    donetext: 'Ok', // done button text
+    cleartext: 'Clear',
+    canceltext: 'Cancel',
+    autoclose: false, // auto close when minute is selected
+    ampmclickable: true, // set am/pm button on itself
+    darktheme: false, // set to dark theme
+    twelvehour: true, // change to 12 hour AM/PM clock from 24 hour
+    vibrate: true // vibrate the device when dragging clock hand
+  };
+
+  // Show or hide popover
+  ClockPicker.prototype.toggle = function () {
+    this[this.isShown ? 'hide' : 'show']();
+  };
+
+  // Set popover position
+  ClockPicker.prototype.locate = function () {
+    var element = this.element,
+        popover = this.popover,
+        offset = element.offset(),
+        width = element.outerWidth(),
+        height = element.outerHeight(),
+        align = this.options.align,
+        self = this;
+
+    popover.show();
+  };
+
+  // Show popover
+  ClockPicker.prototype.show = function (e) {
+    // Not show again
+    if (this.isShown) {
+      return;
+    }
+    raiseCallback(this.options.beforeShow);
+    $(':input').each(function () {
+      $(this).attr('tabindex', -1);
+    });
+    var self = this;
+    // Initialize
+    this.input.blur();
+    this.popover.addClass('picker--opened');
+    this.input.addClass('picker__input picker__input--active');
+    $(document.body).css('overflow', 'hidden');
+    // Get the time
+    var value = ((this.input.prop('value') || this.options['default'] || '') + '').split(':');
+    if (this.options.twelvehour && !(typeof value[1] === 'undefined')) {
+      if (value[1].indexOf("AM") > 0) {
+        this.amOrPm = 'AM';
+      } else {
+        this.amOrPm = 'PM';
+      }
+      value[1] = value[1].replace("AM", "").replace("PM", "");
+    }
+    if (value[0] === 'now') {
+      var now = new Date(+new Date() + this.options.fromnow);
+      value = [now.getHours(), now.getMinutes()];
+      if (this.options.twelvehour) {
+        this.amOrPm = value[0] >= 12 && value[0] < 24 ? 'PM' : 'AM';
+      }
+    }
+    this.hours = +value[0] || 0;
+    this.minutes = +value[1] || 0;
+    this.spanHours.html(this.hours);
+    this.spanMinutes.html(leadingZero(this.minutes));
+    if (!this.isAppended) {
+
+      // Append popover to input by default
+      var containerEl = document.querySelector(this.options.container);
+      if (this.options.container && containerEl) {
+        containerEl.appendChild(this.popover[0]);
+      } else {
+        this.popover.insertAfter(this.input);
+      }
+
+      if (this.options.twelvehour) {
+        if (this.amOrPm === 'PM') {
+          this.spanAmPm.children('#click-pm').addClass("text-primary");
+          this.spanAmPm.children('#click-am').removeClass("text-primary");
+        } else {
+          this.spanAmPm.children('#click-am').addClass("text-primary");
+          this.spanAmPm.children('#click-pm').removeClass("text-primary");
+        }
+      }
+      // Reset position when resize
+      $win.on('resize.clockpicker' + this.id, function () {
+        if (self.isShown) {
+          self.locate();
+        }
+      });
+      this.isAppended = true;
+    }
+    // Toggle to hours view
+    this.toggleView('hours');
+    // Set position
+    this.locate();
+    this.isShown = true;
+    // Hide when clicking or tabbing on any element except the clock and input
+    $doc.on('click.clockpicker.' + this.id + ' focusin.clockpicker.' + this.id, function (e) {
+      var target = $(e.target);
+      if (target.closest(self.popover.find('.picker__wrap')).length === 0 && target.closest(self.input).length === 0) {
+        self.hide();
+      }
+    });
+    // Hide when ESC is pressed
+    $doc.on('keyup.clockpicker.' + this.id, function (e) {
+      if (e.keyCode === 27) {
+        self.hide();
+      }
+    });
+    raiseCallback(this.options.afterShow);
+  };
+  // Hide popover
+  ClockPicker.prototype.hide = function () {
+    raiseCallback(this.options.beforeHide);
+    this.input.removeClass('picker__input picker__input--active');
+    this.popover.removeClass('picker--opened');
+    $(document.body).css('overflow', 'visible');
+    this.isShown = false;
+    $(':input').each(function (index) {
+      $(this).attr('tabindex', index + 1);
+    });
+    // Unbinding events on document
+    $doc.off('click.clockpicker.' + this.id + ' focusin.clockpicker.' + this.id);
+    $doc.off('keyup.clockpicker.' + this.id);
+    this.popover.hide();
+    raiseCallback(this.options.afterHide);
+  };
+  // Toggle to hours or minutes view
+  ClockPicker.prototype.toggleView = function (view, delay) {
+    var raiseAfterHourSelect = false;
+    if (view === 'minutes' && $(this.hoursView).css("visibility") === "visible") {
+      raiseCallback(this.options.beforeHourSelect);
+      raiseAfterHourSelect = true;
+    }
+    var isHours = view === 'hours',
+        nextView = isHours ? this.hoursView : this.minutesView,
+        hideView = isHours ? this.minutesView : this.hoursView;
+    this.currentView = view;
+
+    this.spanHours.toggleClass('text-primary', isHours);
+    this.spanMinutes.toggleClass('text-primary', !isHours);
+
+    // Let's make transitions
+    hideView.addClass('clockpicker-dial-out');
+    nextView.css('visibility', 'visible').removeClass('clockpicker-dial-out');
+
+    // Reset clock hand
+    this.resetClock(delay);
+
+    // After transitions ended
+    clearTimeout(this.toggleViewTimer);
+    this.toggleViewTimer = setTimeout(function () {
+      hideView.css('visibility', 'hidden');
+    }, duration);
+
+    if (raiseAfterHourSelect) {
+      raiseCallback(this.options.afterHourSelect);
+    }
+  };
+
+  // Reset clock hand
+  ClockPicker.prototype.resetClock = function (delay) {
+    var view = this.currentView,
+        value = this[view],
+        isHours = view === 'hours',
+        unit = Math.PI / (isHours ? 6 : 30),
+        radian = value * unit,
+        radius = isHours && value > 0 && value < 13 ? innerRadius : outerRadius,
+        x = Math.sin(radian) * radius,
+        y = -Math.cos(radian) * radius,
+        self = this;
+
+    if (svgSupported && delay) {
+      self.canvas.addClass('clockpicker-canvas-out');
+      setTimeout(function () {
+        self.canvas.removeClass('clockpicker-canvas-out');
+        self.setHand(x, y);
+      }, delay);
+    } else this.setHand(x, y);
+  };
+
+  // Set clock hand to (x, y)
+  ClockPicker.prototype.setHand = function (x, y, roundBy5, dragging) {
+    var radian = Math.atan2(x, -y),
+        isHours = this.currentView === 'hours',
+        unit = Math.PI / (isHours || roundBy5 ? 6 : 30),
+        z = Math.sqrt(x * x + y * y),
+        options = this.options,
+        inner = isHours && z < (outerRadius + innerRadius) / 2,
+        radius = inner ? innerRadius : outerRadius,
+        value;
+
+    if (options.twelvehour) {
+      radius = outerRadius;
+    }
+
+    // Radian should in range [0, 2PI]
+    if (radian < 0) {
+      radian = Math.PI * 2 + radian;
+    }
+
+    // Get the round value
+    value = Math.round(radian / unit);
+
+    // Get the round radian
+    radian = value * unit;
+
+    // Correct the hours or minutes
+    if (options.twelvehour) {
+      if (isHours) {
+        if (value === 0) value = 12;
+      } else {
+        if (roundBy5) value *= 5;
+        if (value === 60) value = 0;
+      }
+    } else {
+      if (isHours) {
+        if (value === 12) value = 0;
+        value = inner ? value === 0 ? 12 : value : value === 0 ? 0 : value + 12;
+      } else {
+        if (roundBy5) value *= 5;
+        if (value === 60) value = 0;
+      }
+    }
+
+    // Once hours or minutes changed, vibrate the device
+    if (this[this.currentView] !== value) {
+      if (vibrate && this.options.vibrate) {
+        // Do not vibrate too frequently
+        if (!this.vibrateTimer) {
+          navigator[vibrate](10);
+          this.vibrateTimer = setTimeout($.proxy(function () {
+            this.vibrateTimer = null;
+          }, this), 100);
+        }
+      }
+    }
+
+    this[this.currentView] = value;
+    if (isHours) {
+      this['spanHours'].html(value);
+    } else {
+      this['spanMinutes'].html(leadingZero(value));
+    }
+
+    // If svg is not supported, just add an active class to the tick
+    if (!svgSupported) {
+      this[isHours ? 'hoursView' : 'minutesView'].find('.clockpicker-tick').each(function () {
+        var tick = $(this);
+        tick.toggleClass('active', value === +tick.html());
+      });
+      return;
+    }
+
+    // Set clock hand and others' position
+    var cx1 = Math.sin(radian) * (radius - tickRadius),
+        cy1 = -Math.cos(radian) * (radius - tickRadius),
+        cx2 = Math.sin(radian) * radius,
+        cy2 = -Math.cos(radian) * radius;
+    this.hand.setAttribute('x2', cx1);
+    this.hand.setAttribute('y2', cy1);
+    this.bg.setAttribute('cx', cx2);
+    this.bg.setAttribute('cy', cy2);
+  };
+
+  // Hours and minutes are selected
+  ClockPicker.prototype.done = function () {
+    raiseCallback(this.options.beforeDone);
+    this.hide();
+    this.label.addClass('active');
+
+    var last = this.input.prop('value'),
+        value = leadingZero(this.hours) + ':' + leadingZero(this.minutes);
+    if (this.options.twelvehour) {
+      value = value + this.amOrPm;
+    }
+
+    this.input.prop('value', value);
+    if (value !== last) {
+      this.input.triggerHandler('change');
+      if (!this.isInput) {
+        this.element.trigger('change');
+      }
+    }
+
+    if (this.options.autoclose) this.input.trigger('blur');
+
+    raiseCallback(this.options.afterDone);
+  };
+
+  // Clear input field
+  ClockPicker.prototype.clear = function () {
+    this.hide();
+    this.label.removeClass('active');
+
+    var last = this.input.prop('value'),
+        value = '';
+
+    this.input.prop('value', value);
+    if (value !== last) {
+      this.input.triggerHandler('change');
+      if (!this.isInput) {
+        this.element.trigger('change');
+      }
+    }
+
+    if (this.options.autoclose) {
+      this.input.trigger('blur');
+    }
+  };
+
+  // Remove clockpicker from input
+  ClockPicker.prototype.remove = function () {
+    this.element.removeData('clockpicker');
+    this.input.off('focus.clockpicker click.clockpicker');
+    if (this.isShown) {
+      this.hide();
+    }
+    if (this.isAppended) {
+      $win.off('resize.clockpicker' + this.id);
+      this.popover.remove();
+    }
+  };
+
+  // Extends $.fn.clockpicker
+  $.fn.pickatime = function (option) {
+    var args = Array.prototype.slice.call(arguments, 1);
+    return this.each(function () {
+      var $this = $(this),
+          data = $this.data('clockpicker');
+      if (!data) {
+        var options = $.extend({}, ClockPicker.DEFAULTS, $this.data(), typeof option == 'object' && option);
+        $this.data('clockpicker', new ClockPicker($this, options));
+      } else {
+        // Manual operatsions. show, hide, remove, e.g.
+        if (typeof data[option] === 'function') {
+          data[option].apply(data, args);
+        }
+      }
+    });
+  };
+})(jQuery);
+;(function ($) {
+
+  $.fn.characterCounter = function () {
+    return this.each(function () {
+      var $input = $(this);
+      var $counterElement = $input.parent().find('span[class="character-counter"]');
+
+      // character counter has already been added appended to the parent container
+      if ($counterElement.length) {
+        return;
+      }
+
+      var itHasLengthAttribute = $input.attr('data-length') !== undefined;
+
+      if (itHasLengthAttribute) {
+        $input.on('input', updateCounter);
+        $input.on('focus', updateCounter);
+        $input.on('blur', removeCounterElement);
+
+        addCounterElement($input);
+      }
+    });
+  };
+
+  function updateCounter() {
+    var maxLength = +$(this).attr('data-length'),
+        actualLength = +$(this).val().length,
+        isValidLength = actualLength <= maxLength;
+
+    $(this).parent().find('span[class="character-counter"]').html(actualLength + '/' + maxLength);
+
+    addInputStyle(isValidLength, $(this));
+  }
+
+  function addCounterElement($input) {
+    var $counterElement = $input.parent().find('span[class="character-counter"]');
+
+    if ($counterElement.length) {
+      return;
+    }
+
+    $counterElement = $('<span/>').addClass('character-counter').css('float', 'right').css('font-size', '12px').css('height', 1);
+
+    $input.parent().append($counterElement);
+  }
+
+  function removeCounterElement() {
+    $(this).parent().find('span[class="character-counter"]').html('');
+  }
+
+  function addInputStyle(isValidLength, $input) {
+    var inputHasInvalidClass = $input.hasClass('invalid');
+    if (isValidLength && inputHasInvalidClass) {
+      $input.removeClass('invalid');
+    } else if (!isValidLength && !inputHasInvalidClass) {
+      $input.removeClass('valid');
+      $input.addClass('invalid');
+    }
+  }
+
+  $(document).ready(function () {
+    $('input, textarea').characterCounter();
+  });
+})(jQuery);
+;(function ($) {
+
+  var methods = {
+
+    init: function (options) {
+      var defaults = {
+        duration: 200, // ms
+        dist: -100, // zoom scale TODO: make this more intuitive as an option
+        shift: 0, // spacing for center image
+        padding: 0, // Padding between non center items
+        fullWidth: false, // Change to full width styles
+        indicators: false, // Toggle indicators
+        noWrap: false, // Don't wrap around and cycle through items.
+        onCycleTo: null // Callback for when a new slide is cycled to.
+      };
+      options = $.extend(defaults, options);
+      var namespace = Materialize.objectSelectorString($(this));
+
+      return this.each(function (i) {
+
+        var images, item_width, item_height, offset, center, pressed, dim, count, reference, referenceY, amplitude, target, velocity, scrolling, xform, frame, timestamp, ticker, dragged, vertical_dragged;
+        var $indicators = $('<ul class="indicators"></ul>');
+        var scrollingTimeout = null;
+        var oneTimeCallback = null;
+
+        // Initialize
+        var view = $(this);
+        var hasMultipleSlides = view.find('.carousel-item').length > 1;
+        var showIndicators = (view.attr('data-indicators') || options.indicators) && hasMultipleSlides;
+        var noWrap = view.attr('data-no-wrap') || options.noWrap || !hasMultipleSlides;
+        var uniqueNamespace = view.attr('data-namespace') || namespace + i;
+        view.attr('data-namespace', uniqueNamespace);
+
+        // Options
+        var setCarouselHeight = function (imageOnly) {
+          var firstSlide = view.find('.carousel-item.active').length ? view.find('.carousel-item.active').first() : view.find('.carousel-item').first();
+          var firstImage = firstSlide.find('img').first();
+          if (firstImage.length) {
+            if (firstImage[0].complete) {
+              // If image won't trigger the load event
+              var imageHeight = firstImage.height();
+              if (imageHeight > 0) {
+                view.css('height', firstImage.height());
+              } else {
+                // If image still has no height, use the natural dimensions to calculate
+                var naturalWidth = firstImage[0].naturalWidth;
+                var naturalHeight = firstImage[0].naturalHeight;
+                var adjustedHeight = view.width() / naturalWidth * naturalHeight;
+                view.css('height', adjustedHeight);
+              }
+            } else {
+              // Get height when image is loaded normally
+              firstImage.on('load', function () {
+                view.css('height', $(this).height());
+              });
+            }
+          } else if (!imageOnly) {
+            var slideHeight = firstSlide.height();
+            view.css('height', slideHeight);
+          }
+        };
+
+        if (options.fullWidth) {
+          options.dist = 0;
+          setCarouselHeight();
+
+          // Offset fixed items when indicators.
+          if (showIndicators) {
+            view.find('.carousel-fixed-item').addClass('with-indicators');
+          }
+        }
+
+        // Don't double initialize.
+        if (view.hasClass('initialized')) {
+          // Recalculate variables
+          $(window).trigger('resize');
+
+          // Redraw carousel.
+          view.trigger('carouselNext', [0.000001]);
+          return true;
+        }
+
+        view.addClass('initialized');
+        pressed = false;
+        offset = target = 0;
+        images = [];
+        item_width = view.find('.carousel-item').first().innerWidth();
+        item_height = view.find('.carousel-item').first().innerHeight();
+        dim = item_width * 2 + options.padding;
+
+        view.find('.carousel-item').each(function (i) {
+          images.push($(this)[0]);
+          if (showIndicators) {
+            var $indicator = $('<li class="indicator-item"></li>');
+
+            // Add active to first by default.
+            if (i === 0) {
+              $indicator.addClass('active');
+            }
+
+            // Handle clicks on indicators.
+            $indicator.click(function (e) {
+              e.stopPropagation();
+
+              var index = $(this).index();
+              cycleTo(index);
+            });
+            $indicators.append($indicator);
+          }
+        });
+
+        if (showIndicators) {
+          view.append($indicators);
+        }
+        count = images.length;
+
+        function setupEvents() {
+          if (typeof window.ontouchstart !== 'undefined') {
+            view.on('touchstart.carousel', tap);
+            view.on('touchmove.carousel', drag);
+            view.on('touchend.carousel', release);
+          }
+          view.on('mousedown.carousel', tap);
+          view.on('mousemove.carousel', drag);
+          view.on('mouseup.carousel', release);
+          view.on('mouseleave.carousel', release);
+          view.on('click.carousel', click);
+        }
+
+        function xpos(e) {
+          // touch event
+          if (e.targetTouches && e.targetTouches.length >= 1) {
+            return e.targetTouches[0].clientX;
+          }
+
+          // mouse event
+          return e.clientX;
+        }
+
+        function ypos(e) {
+          // touch event
+          if (e.targetTouches && e.targetTouches.length >= 1) {
+            return e.targetTouches[0].clientY;
+          }
+
+          // mouse event
+          return e.clientY;
+        }
+
+        function wrap(x) {
+          return x >= count ? x % count : x < 0 ? wrap(count + x % count) : x;
+        }
+
+        function scroll(x) {
+          // Track scrolling state
+          scrolling = true;
+          if (!view.hasClass('scrolling')) {
+            view.addClass('scrolling');
+          }
+          if (scrollingTimeout != null) {
+            window.clearTimeout(scrollingTimeout);
+          }
+          scrollingTimeout = window.setTimeout(function () {
+            scrolling = false;
+            view.removeClass('scrolling');
+          }, options.duration);
+
+          // Start actual scroll
+          var i, half, delta, dir, tween, el, alignment, xTranslation;
+          var lastCenter = center;
+
+          offset = typeof x === 'number' ? x : offset;
+          center = Math.floor((offset + dim / 2) / dim);
+          delta = offset - center * dim;
+          dir = delta < 0 ? 1 : -1;
+          tween = -dir * delta * 2 / dim;
+          half = count >> 1;
+
+          if (!options.fullWidth) {
+            alignment = 'translateX(' + (view[0].clientWidth - item_width) / 2 + 'px) ';
+            alignment += 'translateY(' + (view[0].clientHeight - item_height) / 2 + 'px)';
+          } else {
+            alignment = 'translateX(0)';
+          }
+
+          // Set indicator active
+          if (showIndicators) {
+            var diff = center % count;
+            var activeIndicator = $indicators.find('.indicator-item.active');
+            if (activeIndicator.index() !== diff) {
+              activeIndicator.removeClass('active');
+              $indicators.find('.indicator-item').eq(diff).addClass('active');
+            }
+          }
+
+          // center
+          // Don't show wrapped items.
+          if (!noWrap || center >= 0 && center < count) {
+            el = images[wrap(center)];
+
+            // Add active class to center item.
+            if (!$(el).hasClass('active')) {
+              view.find('.carousel-item').removeClass('active');
+              $(el).addClass('active');
+            }
+            el.style[xform] = alignment + ' translateX(' + -delta / 2 + 'px)' + ' translateX(' + dir * options.shift * tween * i + 'px)' + ' translateZ(' + options.dist * tween + 'px)';
+            el.style.zIndex = 0;
+            if (options.fullWidth) {
+              tweenedOpacity = 1;
+            } else {
+              tweenedOpacity = 1 - 0.2 * tween;
+            }
+            el.style.opacity = tweenedOpacity;
+            el.style.display = 'block';
+          }
+
+          for (i = 1; i <= half; ++i) {
+            // right side
+            if (options.fullWidth) {
+              zTranslation = options.dist;
+              tweenedOpacity = i === half && delta < 0 ? 1 - tween : 1;
+            } else {
+              zTranslation = options.dist * (i * 2 + tween * dir);
+              tweenedOpacity = 1 - 0.2 * (i * 2 + tween * dir);
+            }
+            // Don't show wrapped items.
+            if (!noWrap || center + i < count) {
+              el = images[wrap(center + i)];
+              el.style[xform] = alignment + ' translateX(' + (options.shift + (dim * i - delta) / 2) + 'px)' + ' translateZ(' + zTranslation + 'px)';
+              el.style.zIndex = -i;
+              el.style.opacity = tweenedOpacity;
+              el.style.display = 'block';
+            }
+
+            // left side
+            if (options.fullWidth) {
+              zTranslation = options.dist;
+              tweenedOpacity = i === half && delta > 0 ? 1 - tween : 1;
+            } else {
+              zTranslation = options.dist * (i * 2 - tween * dir);
+              tweenedOpacity = 1 - 0.2 * (i * 2 - tween * dir);
+            }
+            // Don't show wrapped items.
+            if (!noWrap || center - i >= 0) {
+              el = images[wrap(center - i)];
+              el.style[xform] = alignment + ' translateX(' + (-options.shift + (-dim * i - delta) / 2) + 'px)' + ' translateZ(' + zTranslation + 'px)';
+              el.style.zIndex = -i;
+              el.style.opacity = tweenedOpacity;
+              el.style.display = 'block';
+            }
+          }
+
+          // center
+          // Don't show wrapped items.
+          if (!noWrap || center >= 0 && center < count) {
+            el = images[wrap(center)];
+            el.style[xform] = alignment + ' translateX(' + -delta / 2 + 'px)' + ' translateX(' + dir * options.shift * tween + 'px)' + ' translateZ(' + options.dist * tween + 'px)';
+            el.style.zIndex = 0;
+            if (options.fullWidth) {
+              tweenedOpacity = 1;
+            } else {
+              tweenedOpacity = 1 - 0.2 * tween;
+            }
+            el.style.opacity = tweenedOpacity;
+            el.style.display = 'block';
+          }
+
+          // onCycleTo callback
+          if (lastCenter !== center && typeof options.onCycleTo === "function") {
+            var $curr_item = view.find('.carousel-item').eq(wrap(center));
+            options.onCycleTo.call(this, $curr_item, dragged);
+          }
+
+          // One time callback
+          if (typeof oneTimeCallback === "function") {
+            oneTimeCallback.call(this, $curr_item, dragged);
+            oneTimeCallback = null;
+          }
+        }
+
+        function track() {
+          var now, elapsed, delta, v;
+
+          now = Date.now();
+          elapsed = now - timestamp;
+          timestamp = now;
+          delta = offset - frame;
+          frame = offset;
+
+          v = 1000 * delta / (1 + elapsed);
+          velocity = 0.8 * v + 0.2 * velocity;
+        }
+
+        function autoScroll() {
+          var elapsed, delta;
+
+          if (amplitude) {
+            elapsed = Date.now() - timestamp;
+            delta = amplitude * Math.exp(-elapsed / options.duration);
+            if (delta > 2 || delta < -2) {
+              scroll(target - delta);
+              requestAnimationFrame(autoScroll);
+            } else {
+              scroll(target);
+            }
+          }
+        }
+
+        function click(e) {
+          // Disable clicks if carousel was dragged.
+          if (dragged) {
+            e.preventDefault();
+            e.stopPropagation();
+            return false;
+          } else if (!options.fullWidth) {
+            var clickedIndex = $(e.target).closest('.carousel-item').index();
+            var diff = wrap(center) - clickedIndex;
+
+            // Disable clicks if carousel was shifted by click
+            if (diff !== 0) {
+              e.preventDefault();
+              e.stopPropagation();
+            }
+            cycleTo(clickedIndex);
+          }
+        }
+
+        function cycleTo(n) {
+          var diff = center % count - n;
+
+          // Account for wraparound.
+          if (!noWrap) {
+            if (diff < 0) {
+              if (Math.abs(diff + count) < Math.abs(diff)) {
+                diff += count;
+              }
+            } else if (diff > 0) {
+              if (Math.abs(diff - count) < diff) {
+                diff -= count;
+              }
+            }
+          }
+
+          // Call prev or next accordingly.
+          if (diff < 0) {
+            view.trigger('carouselNext', [Math.abs(diff)]);
+          } else if (diff > 0) {
+            view.trigger('carouselPrev', [diff]);
+          }
+        }
+
+        function tap(e) {
+          // Fixes firefox draggable image bug
+          if (e.type === 'mousedown' && $(e.target).is('img')) {
+            e.preventDefault();
+          }
+          pressed = true;
+          dragged = false;
+          vertical_dragged = false;
+          reference = xpos(e);
+          referenceY = ypos(e);
+
+          velocity = amplitude = 0;
+          frame = offset;
+          timestamp = Date.now();
+          clearInterval(ticker);
+          ticker = setInterval(track, 100);
+        }
+
+        function drag(e) {
+          var x, delta, deltaY;
+          if (pressed) {
+            x = xpos(e);
+            y = ypos(e);
+            delta = reference - x;
+            deltaY = Math.abs(referenceY - y);
+            if (deltaY < 30 && !vertical_dragged) {
+              // If vertical scrolling don't allow dragging.
+              if (delta > 2 || delta < -2) {
+                dragged = true;
+                reference = x;
+                scroll(offset + delta);
+              }
+            } else if (dragged) {
+              // If dragging don't allow vertical scroll.
+              e.preventDefault();
+              e.stopPropagation();
+              return false;
+            } else {
+              // Vertical scrolling.
+              vertical_dragged = true;
+            }
+          }
+
+          if (dragged) {
+            // If dragging don't allow vertical scroll.
+            e.preventDefault();
+            e.stopPropagation();
+            return false;
+          }
+        }
+
+        function release(e) {
+          if (pressed) {
+            pressed = false;
+          } else {
+            return;
+          }
+
+          clearInterval(ticker);
+          target = offset;
+          if (velocity > 10 || velocity < -10) {
+            amplitude = 0.9 * velocity;
+            target = offset + amplitude;
+          }
+          target = Math.round(target / dim) * dim;
+
+          // No wrap of items.
+          if (noWrap) {
+            if (target >= dim * (count - 1)) {
+              target = dim * (count - 1);
+            } else if (target < 0) {
+              target = 0;
+            }
+          }
+          amplitude = target - offset;
+          timestamp = Date.now();
+          requestAnimationFrame(autoScroll);
+
+          if (dragged) {
+            e.preventDefault();
+            e.stopPropagation();
+          }
+          return false;
+        }
+
+        xform = 'transform';
+        ['webkit', 'Moz', 'O', 'ms'].every(function (prefix) {
+          var e = prefix + 'Transform';
+          if (typeof document.body.style[e] !== 'undefined') {
+            xform = e;
+            return false;
+          }
+          return true;
+        });
+
+        var throttledResize = Materialize.throttle(function () {
+          if (options.fullWidth) {
+            item_width = view.find('.carousel-item').first().innerWidth();
+            var imageHeight = view.find('.carousel-item.active').height();
+            dim = item_width * 2 + options.padding;
+            offset = center * 2 * item_width;
+            target = offset;
+            setCarouselHeight(true);
+          } else {
+            scroll();
+          }
+        }, 200);
+        $(window).off('resize.carousel-' + uniqueNamespace).on('resize.carousel-' + uniqueNamespace, throttledResize);
+
+        setupEvents();
+        scroll(offset);
+
+        $(this).on('carouselNext', function (e, n, callback) {
+          if (n === undefined) {
+            n = 1;
+          }
+          if (typeof callback === "function") {
+            oneTimeCallback = callback;
+          }
+
+          target = dim * Math.round(offset / dim) + dim * n;
+          if (offset !== target) {
+            amplitude = target - offset;
+            timestamp = Date.now();
+            requestAnimationFrame(autoScroll);
+          }
+        });
+
+        $(this).on('carouselPrev', function (e, n, callback) {
+          if (n === undefined) {
+            n = 1;
+          }
+          if (typeof callback === "function") {
+            oneTimeCallback = callback;
+          }
+
+          target = dim * Math.round(offset / dim) - dim * n;
+          if (offset !== target) {
+            amplitude = target - offset;
+            timestamp = Date.now();
+            requestAnimationFrame(autoScroll);
+          }
+        });
+
+        $(this).on('carouselSet', function (e, n, callback) {
+          if (n === undefined) {
+            n = 0;
+          }
+          if (typeof callback === "function") {
+            oneTimeCallback = callback;
+          }
+
+          cycleTo(n);
+        });
+      });
+    },
+    next: function (n, callback) {
+      $(this).trigger('carouselNext', [n, callback]);
+    },
+    prev: function (n, callback) {
+      $(this).trigger('carouselPrev', [n, callback]);
+    },
+    set: function (n, callback) {
+      $(this).trigger('carouselSet', [n, callback]);
+    },
+    destroy: function () {
+      var uniqueNamespace = $(this).attr('data-namespace');
+      $(this).removeAttr('data-namespace');
+      $(this).removeClass('initialized');
+      $(this).find('.indicators').remove();
+
+      // Remove event handlers
+      $(this).off('carouselNext carouselPrev carouselSet');
+      $(window).off('resize.carousel-' + uniqueNamespace);
+      if (typeof window.ontouchstart !== 'undefined') {
+        $(this).off('touchstart.carousel touchmove.carousel touchend.carousel');
+      }
+      $(this).off('mousedown.carousel mousemove.carousel mouseup.carousel mouseleave.carousel click.carousel');
+    }
+  };
+
+  $.fn.carousel = function (methodOrOptions) {
+    if (methods[methodOrOptions]) {
+      return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
+    } else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
+      // Default to "init"
+      return methods.init.apply(this, arguments);
+    } else {
+      $.error('Method ' + methodOrOptions + ' does not exist on jQuery.carousel');
+    }
+  }; // Plugin end
+})(jQuery);
+;(function ($) {
+
+  var methods = {
+    init: function (options) {
+      return this.each(function () {
+        var origin = $('#' + $(this).attr('data-activates'));
+        var screen = $('body');
+
+        // Creating tap target
+        var tapTargetEl = $(this);
+        var tapTargetWrapper = tapTargetEl.parent('.tap-target-wrapper');
+        var tapTargetWave = tapTargetWrapper.find('.tap-target-wave');
+        var tapTargetOriginEl = tapTargetWrapper.find('.tap-target-origin');
+        var tapTargetContentEl = tapTargetEl.find('.tap-target-content');
+
+        // Creating wrapper
+        if (!tapTargetWrapper.length) {
+          tapTargetWrapper = tapTargetEl.wrap($('<div class="tap-target-wrapper"></div>')).parent();
+        }
+
+        // Creating content
+        if (!tapTargetContentEl.length) {
+          tapTargetContentEl = $('<div class="tap-target-content"></div>');
+          tapTargetEl.append(tapTargetContentEl);
+        }
+
+        // Creating foreground wave
+        if (!tapTargetWave.length) {
+          tapTargetWave = $('<div class="tap-target-wave"></div>');
+
+          // Creating origin
+          if (!tapTargetOriginEl.length) {
+            tapTargetOriginEl = origin.clone(true, true);
+            tapTargetOriginEl.addClass('tap-target-origin');
+            tapTargetOriginEl.removeAttr('id');
+            tapTargetOriginEl.removeAttr('style');
+            tapTargetWave.append(tapTargetOriginEl);
+          }
+
+          tapTargetWrapper.append(tapTargetWave);
+        }
+
+        // Open
+        var openTapTarget = function () {
+          if (tapTargetWrapper.is('.open')) {
+            return;
+          }
+
+          // Adding open class
+          tapTargetWrapper.addClass('open');
+
+          setTimeout(function () {
+            tapTargetOriginEl.off('click.tapTarget').on('click.tapTarget', function (e) {
+              closeTapTarget();
+              tapTargetOriginEl.off('click.tapTarget');
+            });
+
+            $(document).off('click.tapTarget').on('click.tapTarget', function (e) {
+              closeTapTarget();
+              $(document).off('click.tapTarget');
+            });
+
+            var throttledCalc = Materialize.throttle(function () {
+              calculateTapTarget();
+            }, 200);
+            $(window).off('resize.tapTarget').on('resize.tapTarget', throttledCalc);
+          }, 0);
+        };
+
+        // Close
+        var closeTapTarget = function () {
+          if (!tapTargetWrapper.is('.open')) {
+            return;
+          }
+
+          tapTargetWrapper.removeClass('open');
+          tapTargetOriginEl.off('click.tapTarget');
+          $(document).off('click.tapTarget');
+          $(window).off('resize.tapTarget');
+        };
+
+        // Pre calculate
+        var calculateTapTarget = function () {
+          // Element or parent is fixed position?
+          var isFixed = origin.css('position') === 'fixed';
+          if (!isFixed) {
+            var parents = origin.parents();
+            for (var i = 0; i < parents.length; i++) {
+              isFixed = $(parents[i]).css('position') == 'fixed';
+              if (isFixed) {
+                break;
+              }
+            }
+          }
+
+          // Calculating origin
+          var originWidth = origin.outerWidth();
+          var originHeight = origin.outerHeight();
+          var originTop = isFixed ? origin.offset().top - $(document).scrollTop() : origin.offset().top;
+          var originLeft = isFixed ? origin.offset().left - $(document).scrollLeft() : origin.offset().left;
+
+          // Calculating screen
+          var windowWidth = $(window).width();
+          var windowHeight = $(window).height();
+          var centerX = windowWidth / 2;
+          var centerY = windowHeight / 2;
+          var isLeft = originLeft <= centerX;
+          var isRight = originLeft > centerX;
+          var isTop = originTop <= centerY;
+          var isBottom = originTop > centerY;
+          var isCenterX = originLeft >= windowWidth * 0.25 && originLeft <= windowWidth * 0.75;
+          var isCenterY = originTop >= windowHeight * 0.25 && originTop <= windowHeight * 0.75;
+
+          // Calculating tap target
+          var tapTargetWidth = tapTargetEl.outerWidth();
+          var tapTargetHeight = tapTargetEl.outerHeight();
+          var tapTargetTop = originTop + originHeight / 2 - tapTargetHeight / 2;
+          var tapTargetLeft = originLeft + originWidth / 2 - tapTargetWidth / 2;
+          var tapTargetPosition = isFixed ? 'fixed' : 'absolute';
+
+          // Calculating content
+          var tapTargetTextWidth = isCenterX ? tapTargetWidth : tapTargetWidth / 2 + originWidth;
+          var tapTargetTextHeight = tapTargetHeight / 2;
+          var tapTargetTextTop = isTop ? tapTargetHeight / 2 : 0;
+          var tapTargetTextBottom = 0;
+          var tapTargetTextLeft = isLeft && !isCenterX ? tapTargetWidth / 2 - originWidth : 0;
+          var tapTargetTextRight = 0;
+          var tapTargetTextPadding = originWidth;
+          var tapTargetTextAlign = isBottom ? 'bottom' : 'top';
+
+          // Calculating wave
+          var tapTargetWaveWidth = originWidth > originHeight ? originWidth * 2 : originWidth * 2;
+          var tapTargetWaveHeight = tapTargetWaveWidth;
+          var tapTargetWaveTop = tapTargetHeight / 2 - tapTargetWaveHeight / 2;
+          var tapTargetWaveLeft = tapTargetWidth / 2 - tapTargetWaveWidth / 2;
+
+          // Setting tap target
+          var tapTargetWrapperCssObj = {};
+          tapTargetWrapperCssObj.top = isTop ? tapTargetTop : '';
+          tapTargetWrapperCssObj.right = isRight ? windowWidth - tapTargetLeft - tapTargetWidth : '';
+          tapTargetWrapperCssObj.bottom = isBottom ? windowHeight - tapTargetTop - tapTargetHeight : '';
+          tapTargetWrapperCssObj.left = isLeft ? tapTargetLeft : '';
+          tapTargetWrapperCssObj.position = tapTargetPosition;
+          tapTargetWrapper.css(tapTargetWrapperCssObj);
+
+          // Setting content
+          tapTargetContentEl.css({
+            width: tapTargetTextWidth,
+            height: tapTargetTextHeight,
+            top: tapTargetTextTop,
+            right: tapTargetTextRight,
+            bottom: tapTargetTextBottom,
+            left: tapTargetTextLeft,
+            padding: tapTargetTextPadding,
+            verticalAlign: tapTargetTextAlign
+          });
+
+          // Setting wave
+          tapTargetWave.css({
+            top: tapTargetWaveTop,
+            left: tapTargetWaveLeft,
+            width: tapTargetWaveWidth,
+            height: tapTargetWaveHeight
+          });
+        };
+
+        if (options == 'open') {
+          calculateTapTarget();
+          openTapTarget();
+        }
+
+        if (options == 'close') closeTapTarget();
+      });
+    },
+    open: function () {},
+    close: function () {}
+  };
+
+  $.fn.tapTarget = function (methodOrOptions) {
+    if (methods[methodOrOptions] || typeof methodOrOptions === 'object') return methods.init.apply(this, arguments);
+
+    $.error('Method ' + methodOrOptions + ' does not exist on jQuery.tap-target');
+  };
+})(jQuery);

La diferencia del archivo ha sido suprimido porque es demasiado grande
+ 5 - 0
dist/static/materialize/js/materialize.min.js


La diferencia del archivo ha sido suprimido porque es demasiado grande
+ 7 - 0
dist/static/tracking-min.js


+ 3111 - 0
dist/static/tracking.js

@@ -0,0 +1,3111 @@
+/**
+ * tracking - A modern approach for Computer Vision on the web.
+ * @author Eduardo Lundgren <edu@rdo.io>
+ * @version v1.1.3
+ * @link http://trackingjs.com
+ * @license BSD
+ */
+(function(window, undefined) {
+  window.tracking = window.tracking || {};
+
+  /**
+   * Inherit the prototype methods from one constructor into another.
+   *
+   * Usage:
+   * <pre>
+   * function ParentClass(a, b) { }
+   * ParentClass.prototype.foo = function(a) { }
+   *
+   * function ChildClass(a, b, c) {
+   *   tracking.base(this, a, b);
+   * }
+   * tracking.inherits(ChildClass, ParentClass);
+   *
+   * var child = new ChildClass('a', 'b', 'c');
+   * child.foo();
+   * </pre>
+   *
+   * @param {Function} childCtor Child class.
+   * @param {Function} parentCtor Parent class.
+   */
+  tracking.inherits = function(childCtor, parentCtor) {
+    function TempCtor() {
+    }
+    TempCtor.prototype = parentCtor.prototype;
+    childCtor.superClass_ = parentCtor.prototype;
+    childCtor.prototype = new TempCtor();
+    childCtor.prototype.constructor = childCtor;
+
+    /**
+     * Calls superclass constructor/method.
+     *
+     * This function is only available if you use tracking.inherits to express
+     * inheritance relationships between classes.
+     *
+     * @param {!object} me Should always be "this".
+     * @param {string} methodName The method name to call. Calling superclass
+     *     constructor can be done with the special string 'constructor'.
+     * @param {...*} var_args The arguments to pass to superclass
+     *     method/constructor.
+     * @return {*} The return value of the superclass method/constructor.
+     */
+    childCtor.base = function(me, methodName) {
+      var args = Array.prototype.slice.call(arguments, 2);
+      return parentCtor.prototype[methodName].apply(me, args);
+    };
+  };
+
+  /**
+   * Captures the user camera when tracking a video element and set its source
+   * to the camera stream.
+   * @param {HTMLVideoElement} element Canvas element to track.
+   * @param {object} opt_options Optional configuration to the tracker.
+   */
+  tracking.initUserMedia_ = function(element, opt_options) {
+    window.navigator.mediaDevices.getUserMedia({
+      video: true,
+      audio: (opt_options && opt_options.audio) ? true : false,
+    }).then(function(stream) {
+      element.srcObject = stream;
+    }).catch(function(err) {
+      throw Error('Cannot capture user camera.');
+    });
+  };
+
+  /**
+   * Tests whether the object is a dom node.
+   * @param {object} o Object to be tested.
+   * @return {boolean} True if the object is a dom node.
+   */
+  tracking.isNode = function(o) {
+    return o.nodeType || this.isWindow(o);
+  };
+
+  /**
+   * Tests whether the object is the `window` object.
+   * @param {object} o Object to be tested.
+   * @return {boolean} True if the object is the `window` object.
+   */
+  tracking.isWindow = function(o) {
+    return !!(o && o.alert && o.document);
+  };
+
+  /**
+   * Selects a dom node from a CSS3 selector using `document.querySelector`.
+   * @param {string} selector
+   * @param {object} opt_element The root element for the query. When not
+   *     specified `document` is used as root element.
+   * @return {HTMLElement} The first dom element that matches to the selector.
+   *     If not found, returns `null`.
+   */
+  tracking.one = function(selector, opt_element) {
+    if (this.isNode(selector)) {
+      return selector;
+    }
+    return (opt_element || document).querySelector(selector);
+  };
+
+  /**
+   * Tracks a canvas, image or video element based on the specified `tracker`
+   * instance. This method extract the pixel information of the input element
+   * to pass to the `tracker` instance. When tracking a video, the
+   * `tracker.track(pixels, width, height)` will be in a
+   * `requestAnimationFrame` loop in order to track all video frames.
+   *
+   * Example:
+   * var tracker = new tracking.ColorTracker();
+   *
+   * tracking.track('#video', tracker);
+   * or
+   * tracking.track('#video', tracker, { camera: true });
+   *
+   * tracker.on('track', function(event) {
+   *   // console.log(event.data[0].x, event.data[0].y)
+   * });
+   *
+   * @param {HTMLElement} element The element to track, canvas, image or
+   *     video.
+   * @param {tracking.Tracker} tracker The tracker instance used to track the
+   *     element.
+   * @param {object} opt_options Optional configuration to the tracker.
+   */
+  tracking.track = function(element, tracker, opt_options) {
+    element = tracking.one(element);
+    if (!element) {
+      throw new Error('Element not found, try a different element or selector.');
+    }
+    if (!tracker) {
+      throw new Error('Tracker not specified, try `tracking.track(element, new tracking.FaceTracker())`.');
+    }
+
+    switch (element.nodeName.toLowerCase()) {
+      case 'canvas':
+        return this.trackCanvas_(element, tracker, opt_options);
+      case 'img':
+        return this.trackImg_(element, tracker, opt_options);
+      case 'video':
+        if (opt_options) {
+          if (opt_options.camera) {
+            this.initUserMedia_(element, opt_options);
+          }
+        }
+        return this.trackVideo_(element, tracker, opt_options);
+      default:
+        throw new Error('Element not supported, try in a canvas, img, or video.');
+    }
+  };
+
+  /**
+   * Tracks a canvas element based on the specified `tracker` instance and
+   * returns a `TrackerTask` for this track.
+   * @param {HTMLCanvasElement} element Canvas element to track.
+   * @param {tracking.Tracker} tracker The tracker instance used to track the
+   *     element.
+   * @param {object} opt_options Optional configuration to the tracker.
+   * @return {tracking.TrackerTask}
+   * @private
+   */
+  tracking.trackCanvas_ = function(element, tracker) {
+    var self = this;
+    var task = new tracking.TrackerTask(tracker);
+    task.on('run', function() {
+      self.trackCanvasInternal_(element, tracker);
+    });
+    return task.run();
+  };
+
+  /**
+   * Tracks a canvas element based on the specified `tracker` instance. This
+   * method extract the pixel information of the input element to pass to the
+   * `tracker` instance.
+   * @param {HTMLCanvasElement} element Canvas element to track.
+   * @param {tracking.Tracker} tracker The tracker instance used to track the
+   *     element.
+   * @param {object} opt_options Optional configuration to the tracker.
+   * @private
+   */
+  tracking.trackCanvasInternal_ = function(element, tracker) {
+    var width = element.width;
+    var height = element.height;
+    var context = element.getContext('2d');
+    var imageData = context.getImageData(0, 0, width, height);
+    tracker.track(imageData.data, width, height);
+  };
+
+  /**
+   * Tracks a image element based on the specified `tracker` instance. This
+   * method extract the pixel information of the input element to pass to the
+   * `tracker` instance.
+   * @param {HTMLImageElement} element Canvas element to track.
+   * @param {tracking.Tracker} tracker The tracker instance used to track the
+   *     element.
+   * @param {object} opt_options Optional configuration to the tracker.
+   * @private
+   */
+  tracking.trackImg_ = function(element, tracker) {
+    var width = element.width;
+    var height = element.height;
+    var canvas = document.createElement('canvas');
+
+    canvas.width = width;
+    canvas.height = height;
+
+    var task = new tracking.TrackerTask(tracker);
+    task.on('run', function() {
+      tracking.Canvas.loadImage(canvas, element.src, 0, 0, width, height, function() {
+        tracking.trackCanvasInternal_(canvas, tracker);
+      });
+    });
+    return task.run();
+  };
+
+  /**
+   * Tracks a video element based on the specified `tracker` instance. This
+   * method extract the pixel information of the input element to pass to the
+   * `tracker` instance. The `tracker.track(pixels, width, height)` will be in
+   * a `requestAnimationFrame` loop in order to track all video frames.
+   * @param {HTMLVideoElement} element Canvas element to track.
+   * @param {tracking.Tracker} tracker The tracker instance used to track the
+   *     element.
+   * @param {object} opt_options Optional configuration to the tracker.
+   * @private
+   */
+  tracking.trackVideo_ = function(element, tracker) {
+    var canvas = document.createElement('canvas');
+    var context = canvas.getContext('2d');
+    var width;
+    var height;
+
+    var resizeCanvas_ = function() {
+      width = element.offsetWidth;
+      height = element.offsetHeight;
+      canvas.width = width;
+      canvas.height = height;
+    };
+    resizeCanvas_();
+    element.addEventListener('resize', resizeCanvas_);
+
+    var requestId;
+    var requestAnimationFrame_ = function() {
+      requestId = window.requestAnimationFrame(function() {
+        if (element.readyState === element.HAVE_ENOUGH_DATA) {
+          try {
+            // Firefox v~30.0 gets confused with the video readyState firing an
+            // erroneous HAVE_ENOUGH_DATA just before HAVE_CURRENT_DATA state,
+            // hence keep trying to read it until resolved.
+            context.drawImage(element, 0, 0, width, height);
+          } catch (err) {}
+          tracking.trackCanvasInternal_(canvas, tracker);
+        }
+        requestAnimationFrame_();
+      });
+    };
+
+    var task = new tracking.TrackerTask(tracker);
+    task.on('stop', function() {
+      window.cancelAnimationFrame(requestId);
+    });
+    task.on('run', function() {
+      requestAnimationFrame_();
+    });
+    return task.run();
+  };
+
+  // Browser polyfills
+  //===================
+
+  if (!window.URL) {
+    window.URL = window.URL || window.webkitURL || window.msURL || window.oURL;
+  }
+
+  if (!navigator.getUserMedia) {
+    navigator.getUserMedia = navigator.getUserMedia || navigator.webkitGetUserMedia ||
+    navigator.mozGetUserMedia || navigator.msGetUserMedia;
+  }
+}(window));
+
+(function() {
+  /**
+   * EventEmitter utility.
+   * @constructor
+   */
+  tracking.EventEmitter = function() {};
+
+  /**
+   * Holds event listeners scoped by event type.
+   * @type {object}
+   * @private
+   */
+  tracking.EventEmitter.prototype.events_ = null;
+
+  /**
+   * Adds a listener to the end of the listeners array for the specified event.
+   * @param {string} event
+   * @param {function} listener
+   * @return {object} Returns emitter, so calls can be chained.
+   */
+  tracking.EventEmitter.prototype.addListener = function(event, listener) {
+    if (typeof listener !== 'function') {
+      throw new TypeError('Listener must be a function');
+    }
+    if (!this.events_) {
+      this.events_ = {};
+    }
+
+    this.emit('newListener', event, listener);
+
+    if (!this.events_[event]) {
+      this.events_[event] = [];
+    }
+
+    this.events_[event].push(listener);
+
+    return this;
+  };
+
+  /**
+   * Returns an array of listeners for the specified event.
+   * @param {string} event
+   * @return {array} Array of listeners.
+   */
+  tracking.EventEmitter.prototype.listeners = function(event) {
+    return this.events_ && this.events_[event];
+  };
+
+  /**
+   * Execute each of the listeners in order with the supplied arguments.
+   * @param {string} event
+   * @param {*} opt_args [arg1], [arg2], [...]
+   * @return {boolean} Returns true if event had listeners, false otherwise.
+   */
+  tracking.EventEmitter.prototype.emit = function(event) {
+    var listeners = this.listeners(event);
+    if (listeners) {
+      var args = Array.prototype.slice.call(arguments, 1);
+      for (var i = 0; i < listeners.length; i++) {
+        if (listeners[i]) {
+          listeners[i].apply(this, args);
+        }
+      }
+      return true;
+    }
+    return false;
+  };
+
+  /**
+   * Adds a listener to the end of the listeners array for the specified event.
+   * @param {string} event
+   * @param {function} listener
+   * @return {object} Returns emitter, so calls can be chained.
+   */
+  tracking.EventEmitter.prototype.on = tracking.EventEmitter.prototype.addListener;
+
+  /**
+   * Adds a one time listener for the event. This listener is invoked only the
+   * next time the event is fired, after which it is removed.
+   * @param {string} event
+   * @param {function} listener
+   * @return {object} Returns emitter, so calls can be chained.
+   */
+  tracking.EventEmitter.prototype.once = function(event, listener) {
+    var self = this;
+    self.on(event, function handlerInternal() {
+      self.removeListener(event, handlerInternal);
+      listener.apply(this, arguments);
+    });
+  };
+
+  /**
+   * Removes all listeners, or those of the specified event. It's not a good
+   * idea to remove listeners that were added elsewhere in the code,
+   * especially when it's on an emitter that you didn't create.
+   * @param {string} event
+   * @return {object} Returns emitter, so calls can be chained.
+   */
+  tracking.EventEmitter.prototype.removeAllListeners = function(opt_event) {
+    if (!this.events_) {
+      return this;
+    }
+    if (opt_event) {
+      delete this.events_[opt_event];
+    } else {
+      delete this.events_;
+    }
+    return this;
+  };
+
+  /**
+   * Remove a listener from the listener array for the specified event.
+   * Caution: changes array indices in the listener array behind the listener.
+   * @param {string} event
+   * @param {function} listener
+   * @return {object} Returns emitter, so calls can be chained.
+   */
+  tracking.EventEmitter.prototype.removeListener = function(event, listener) {
+    if (typeof listener !== 'function') {
+      throw new TypeError('Listener must be a function');
+    }
+    if (!this.events_) {
+      return this;
+    }
+
+    var listeners = this.listeners(event);
+    if (Array.isArray(listeners)) {
+      var i = listeners.indexOf(listener);
+      if (i < 0) {
+        return this;
+      }
+      listeners.splice(i, 1);
+    }
+
+    return this;
+  };
+
+  /**
+   * By default EventEmitters will print a warning if more than 10 listeners
+   * are added for a particular event. This is a useful default which helps
+   * finding memory leaks. Obviously not all Emitters should be limited to 10.
+   * This function allows that to be increased. Set to zero for unlimited.
+   * @param {number} n The maximum number of listeners.
+   */
+  tracking.EventEmitter.prototype.setMaxListeners = function() {
+    throw new Error('Not implemented');
+  };
+
+}());
+
+(function() {
+  /**
+   * Canvas utility.
+   * @static
+   * @constructor
+   */
+  tracking.Canvas = {};
+
+  /**
+   * Loads an image source into the canvas.
+   * @param {HTMLCanvasElement} canvas The canvas dom element.
+   * @param {string} src The image source.
+   * @param {number} x The canvas horizontal coordinate to load the image.
+   * @param {number} y The canvas vertical coordinate to load the image.
+   * @param {number} width The image width.
+   * @param {number} height The image height.
+   * @param {function} opt_callback Callback that fires when the image is loaded
+   *     into the canvas.
+   * @static
+   */
+  tracking.Canvas.loadImage = function(canvas, src, x, y, width, height, opt_callback) {
+    var instance = this;
+    var img = new window.Image();
+    img.crossOrigin = '*';
+    img.onload = function() {
+      var context = canvas.getContext('2d');
+      canvas.width = width;
+      canvas.height = height;
+      context.drawImage(img, x, y, width, height);
+      if (opt_callback) {
+        opt_callback.call(instance);
+      }
+      img = null;
+    };
+    img.src = src;
+  };
+}());
+
+(function() {
+  /**
+   * DisjointSet utility with path compression. Some applications involve
+   * grouping n distinct objects into a collection of disjoint sets. Two
+   * important operations are then finding which set a given object belongs to
+   * and uniting the two sets. A disjoint set data structure maintains a
+   * collection S={ S1 , S2 ,..., Sk } of disjoint dynamic sets. Each set is
+   * identified by a representative, which usually is a member in the set.
+   * @static
+   * @constructor
+   */
+  tracking.DisjointSet = function(length) {
+    if (length === undefined) {
+      throw new Error('DisjointSet length not specified.');
+    }
+    this.length = length;
+    this.parent = new Uint32Array(length);
+    for (var i = 0; i < length; i++) {
+      this.parent[i] = i;
+    }
+  };
+
+  /**
+   * Holds the length of the internal set.
+   * @type {number}
+   */
+  tracking.DisjointSet.prototype.length = null;
+
+  /**
+   * Holds the set containing the representative values.
+   * @type {Array.<number>}
+   */
+  tracking.DisjointSet.prototype.parent = null;
+
+  /**
+   * Finds a pointer to the representative of the set containing i.
+   * @param {number} i
+   * @return {number} The representative set of i.
+   */
+  tracking.DisjointSet.prototype.find = function(i) {
+    if (this.parent[i] === i) {
+      return i;
+    } else {
+      return (this.parent[i] = this.find(this.parent[i]));
+    }
+  };
+
+  /**
+   * Unites two dynamic sets containing objects i and j, say Si and Sj, into
+   * a new set that Si ∪ Sj, assuming that Si ∩ Sj = ∅;
+   * @param {number} i
+   * @param {number} j
+   */
+  tracking.DisjointSet.prototype.union = function(i, j) {
+    var iRepresentative = this.find(i);
+    var jRepresentative = this.find(j);
+    this.parent[iRepresentative] = jRepresentative;
+  };
+
+}());
+
+(function() {
+  /**
+   * Image utility.
+   * @static
+   * @constructor
+   */
+  tracking.Image = {};
+
+  /**
+   * Computes gaussian blur. Adapted from
+   * https://github.com/kig/canvasfilters.
+   * @param {pixels} pixels The pixels in a linear [r,g,b,a,...] array.
+   * @param {number} width The image width.
+   * @param {number} height The image height.
+   * @param {number} diameter Gaussian blur diameter, must be greater than 1.
+   * @return {array} The edge pixels in a linear [r,g,b,a,...] array.
+   */
+  tracking.Image.blur = function(pixels, width, height, diameter) {
+    diameter = Math.abs(diameter);
+    if (diameter <= 1) {
+      throw new Error('Diameter should be greater than 1.');
+    }
+    var radius = diameter / 2;
+    var len = Math.ceil(diameter) + (1 - (Math.ceil(diameter) % 2));
+    var weights = new Float32Array(len);
+    var rho = (radius + 0.5) / 3;
+    var rhoSq = rho * rho;
+    var gaussianFactor = 1 / Math.sqrt(2 * Math.PI * rhoSq);
+    var rhoFactor = -1 / (2 * rho * rho);
+    var wsum = 0;
+    var middle = Math.floor(len / 2);
+    for (var i = 0; i < len; i++) {
+      var x = i - middle;
+      var gx = gaussianFactor * Math.exp(x * x * rhoFactor);
+      weights[i] = gx;
+      wsum += gx;
+    }
+    for (var j = 0; j < weights.length; j++) {
+      weights[j] /= wsum;
+    }
+    return this.separableConvolve(pixels, width, height, weights, weights, false);
+  };
+
+  /**
+   * Computes the integral image for summed, squared, rotated and sobel pixels.
+   * @param {array} pixels The pixels in a linear [r,g,b,a,...] array to loop
+   *     through.
+   * @param {number} width The image width.
+   * @param {number} height The image height.
+   * @param {array} opt_integralImage Empty array of size `width * height` to
+   *     be filled with the integral image values. If not specified compute sum
+   *     values will be skipped.
+   * @param {array} opt_integralImageSquare Empty array of size `width *
+   *     height` to be filled with the integral image squared values. If not
+   *     specified compute squared values will be skipped.
+   * @param {array} opt_tiltedIntegralImage Empty array of size `width *
+   *     height` to be filled with the rotated integral image values. If not
+   *     specified compute sum values will be skipped.
+   * @param {array} opt_integralImageSobel Empty array of size `width *
+   *     height` to be filled with the integral image of sobel values. If not
+   *     specified compute sobel filtering will be skipped.
+   * @static
+   */
+  tracking.Image.computeIntegralImage = function(pixels, width, height, opt_integralImage, opt_integralImageSquare, opt_tiltedIntegralImage, opt_integralImageSobel) {
+    if (arguments.length < 4) {
+      throw new Error('You should specify at least one output array in the order: sum, square, tilted, sobel.');
+    }
+    var pixelsSobel;
+    if (opt_integralImageSobel) {
+      pixelsSobel = tracking.Image.sobel(pixels, width, height);
+    }
+    for (var i = 0; i < height; i++) {
+      for (var j = 0; j < width; j++) {
+        var w = i * width * 4 + j * 4;
+        var pixel = ~~(pixels[w] * 0.299 + pixels[w + 1] * 0.587 + pixels[w + 2] * 0.114);
+        if (opt_integralImage) {
+          this.computePixelValueSAT_(opt_integralImage, width, i, j, pixel);
+        }
+        if (opt_integralImageSquare) {
+          this.computePixelValueSAT_(opt_integralImageSquare, width, i, j, pixel * pixel);
+        }
+        if (opt_tiltedIntegralImage) {
+          var w1 = w - width * 4;
+          var pixelAbove = ~~(pixels[w1] * 0.299 + pixels[w1 + 1] * 0.587 + pixels[w1 + 2] * 0.114);
+          this.computePixelValueRSAT_(opt_tiltedIntegralImage, width, i, j, pixel, pixelAbove || 0);
+        }
+        if (opt_integralImageSobel) {
+          this.computePixelValueSAT_(opt_integralImageSobel, width, i, j, pixelsSobel[w]);
+        }
+      }
+    }
+  };
+
+  /**
+   * Helper method to compute the rotated summed area table (RSAT) by the
+   * formula:
+   *
+   * RSAT(x, y) = RSAT(x-1, y-1) + RSAT(x+1, y-1) - RSAT(x, y-2) + I(x, y) + I(x, y-1)
+   *
+   * @param {number} width The image width.
+   * @param {array} RSAT Empty array of size `width * height` to be filled with
+   *     the integral image values. If not specified compute sum values will be
+   *     skipped.
+   * @param {number} i Vertical position of the pixel to be evaluated.
+   * @param {number} j Horizontal position of the pixel to be evaluated.
+   * @param {number} pixel Pixel value to be added to the integral image.
+   * @static
+   * @private
+   */
+  tracking.Image.computePixelValueRSAT_ = function(RSAT, width, i, j, pixel, pixelAbove) {
+    var w = i * width + j;
+    RSAT[w] = (RSAT[w - width - 1] || 0) + (RSAT[w - width + 1] || 0) - (RSAT[w - width - width] || 0) + pixel + pixelAbove;
+  };
+
+  /**
+   * Helper method to compute the summed area table (SAT) by the formula:
+   *
+   * SAT(x, y) = SAT(x, y-1) + SAT(x-1, y) + I(x, y) - SAT(x-1, y-1)
+   *
+   * @param {number} width The image width.
+   * @param {array} SAT Empty array of size `width * height` to be filled with
+   *     the integral image values. If not specified compute sum values will be
+   *     skipped.
+   * @param {number} i Vertical position of the pixel to be evaluated.
+   * @param {number} j Horizontal position of the pixel to be evaluated.
+   * @param {number} pixel Pixel value to be added to the integral image.
+   * @static
+   * @private
+   */
+  tracking.Image.computePixelValueSAT_ = function(SAT, width, i, j, pixel) {
+    var w = i * width + j;
+    SAT[w] = (SAT[w - width] || 0) + (SAT[w - 1] || 0) + pixel - (SAT[w - width - 1] || 0);
+  };
+
+  /**
+   * Converts a color from a colorspace based on an RGB color model to a
+   * grayscale representation of its luminance. The coefficients represent the
+   * measured intensity perception of typical trichromat humans, in
+   * particular, human vision is most sensitive to green and least sensitive
+   * to blue.
+   * @param {pixels} pixels The pixels in a linear [r,g,b,a,...] array.
+   * @param {number} width The image width.
+   * @param {number} height The image height.
+   * @param {boolean} fillRGBA If the result should fill all RGBA values with the gray scale
+   *  values, instead of returning a single value per pixel.
+   * @param {Uint8ClampedArray} The grayscale pixels in a linear array ([p,p,p,a,...] if fillRGBA
+   *  is true and [p1, p2, p3, ...] if fillRGBA is false).
+   * @static
+   */
+  tracking.Image.grayscale = function(pixels, width, height, fillRGBA) {
+    var gray = new Uint8ClampedArray(fillRGBA ? pixels.length : pixels.length >> 2);
+    var p = 0;
+    var w = 0;
+    for (var i = 0; i < height; i++) {
+      for (var j = 0; j < width; j++) {
+        var value = pixels[w] * 0.299 + pixels[w + 1] * 0.587 + pixels[w + 2] * 0.114;
+        gray[p++] = value;
+
+        if (fillRGBA) {
+          gray[p++] = value;
+          gray[p++] = value;
+          gray[p++] = pixels[w + 3];
+        }
+
+        w += 4;
+      }
+    }
+    return gray;
+  };
+
+  /**
+   * Fast horizontal separable convolution. A point spread function (PSF) is
+   * said to be separable if it can be broken into two one-dimensional
+   * signals: a vertical and a horizontal projection. The convolution is
+   * performed by sliding the kernel over the image, generally starting at the
+   * top left corner, so as to move the kernel through all the positions where
+   * the kernel fits entirely within the boundaries of the image. Adapted from
+   * https://github.com/kig/canvasfilters.
+   * @param {pixels} pixels The pixels in a linear [r,g,b,a,...] array.
+   * @param {number} width The image width.
+   * @param {number} height The image height.
+   * @param {array} weightsVector The weighting vector, e.g [-1,0,1].
+   * @param {number} opaque
+   * @return {array} The convoluted pixels in a linear [r,g,b,a,...] array.
+   */
+  tracking.Image.horizontalConvolve = function(pixels, width, height, weightsVector, opaque) {
+    var side = weightsVector.length;
+    var halfSide = Math.floor(side / 2);
+    var output = new Float32Array(width * height * 4);
+    var alphaFac = opaque ? 1 : 0;
+
+    for (var y = 0; y < height; y++) {
+      for (var x = 0; x < width; x++) {
+        var sy = y;
+        var sx = x;
+        var offset = (y * width + x) * 4;
+        var r = 0;
+        var g = 0;
+        var b = 0;
+        var a = 0;
+        for (var cx = 0; cx < side; cx++) {
+          var scy = sy;
+          var scx = Math.min(width - 1, Math.max(0, sx + cx - halfSide));
+          var poffset = (scy * width + scx) * 4;
+          var wt = weightsVector[cx];
+          r += pixels[poffset] * wt;
+          g += pixels[poffset + 1] * wt;
+          b += pixels[poffset + 2] * wt;
+          a += pixels[poffset + 3] * wt;
+        }
+        output[offset] = r;
+        output[offset + 1] = g;
+        output[offset + 2] = b;
+        output[offset + 3] = a + alphaFac * (255 - a);
+      }
+    }
+    return output;
+  };
+
+  /**
+   * Fast vertical separable convolution. A point spread function (PSF) is
+   * said to be separable if it can be broken into two one-dimensional
+   * signals: a vertical and a horizontal projection. The convolution is
+   * performed by sliding the kernel over the image, generally starting at the
+   * top left corner, so as to move the kernel through all the positions where
+   * the kernel fits entirely within the boundaries of the image. Adapted from
+   * https://github.com/kig/canvasfilters.
+   * @param {pixels} pixels The pixels in a linear [r,g,b,a,...] array.
+   * @param {number} width The image width.
+   * @param {number} height The image height.
+   * @param {array} weightsVector The weighting vector, e.g [-1,0,1].
+   * @param {number} opaque
+   * @return {array} The convoluted pixels in a linear [r,g,b,a,...] array.
+   */
+  tracking.Image.verticalConvolve = function(pixels, width, height, weightsVector, opaque) {
+    var side = weightsVector.length;
+    var halfSide = Math.floor(side / 2);
+    var output = new Float32Array(width * height * 4);
+    var alphaFac = opaque ? 1 : 0;
+
+    for (var y = 0; y < height; y++) {
+      for (var x = 0; x < width; x++) {
+        var sy = y;
+        var sx = x;
+        var offset = (y * width + x) * 4;
+        var r = 0;
+        var g = 0;
+        var b = 0;
+        var a = 0;
+        for (var cy = 0; cy < side; cy++) {
+          var scy = Math.min(height - 1, Math.max(0, sy + cy - halfSide));
+          var scx = sx;
+          var poffset = (scy * width + scx) * 4;
+          var wt = weightsVector[cy];
+          r += pixels[poffset] * wt;
+          g += pixels[poffset + 1] * wt;
+          b += pixels[poffset + 2] * wt;
+          a += pixels[poffset + 3] * wt;
+        }
+        output[offset] = r;
+        output[offset + 1] = g;
+        output[offset + 2] = b;
+        output[offset + 3] = a + alphaFac * (255 - a);
+      }
+    }
+    return output;
+  };
+
+  /**
+   * Fast separable convolution. A point spread function (PSF) is said to be
+   * separable if it can be broken into two one-dimensional signals: a
+   * vertical and a horizontal projection. The convolution is performed by
+   * sliding the kernel over the image, generally starting at the top left
+   * corner, so as to move the kernel through all the positions where the
+   * kernel fits entirely within the boundaries of the image. Adapted from
+   * https://github.com/kig/canvasfilters.
+   * @param {pixels} pixels The pixels in a linear [r,g,b,a,...] array.
+   * @param {number} width The image width.
+   * @param {number} height The image height.
+   * @param {array} horizWeights The horizontal weighting vector, e.g [-1,0,1].
+   * @param {array} vertWeights The vertical vector, e.g [-1,0,1].
+   * @param {number} opaque
+   * @return {array} The convoluted pixels in a linear [r,g,b,a,...] array.
+   */
+  tracking.Image.separableConvolve = function(pixels, width, height, horizWeights, vertWeights, opaque) {
+    var vertical = this.verticalConvolve(pixels, width, height, vertWeights, opaque);
+    return this.horizontalConvolve(vertical, width, height, horizWeights, opaque);
+  };
+
+  /**
+   * Compute image edges using Sobel operator. Computes the vertical and
+   * horizontal gradients of the image and combines the computed images to
+   * find edges in the image. The way we implement the Sobel filter here is by
+   * first grayscaling the image, then taking the horizontal and vertical
+   * gradients and finally combining the gradient images to make up the final
+   * image. Adapted from https://github.com/kig/canvasfilters.
+   * @param {pixels} pixels The pixels in a linear [r,g,b,a,...] array.
+   * @param {number} width The image width.
+   * @param {number} height The image height.
+   * @return {array} The edge pixels in a linear [r,g,b,a,...] array.
+   */
+  tracking.Image.sobel = function(pixels, width, height) {
+    pixels = this.grayscale(pixels, width, height, true);
+    var output = new Float32Array(width * height * 4);
+    var sobelSignVector = new Float32Array([-1, 0, 1]);
+    var sobelScaleVector = new Float32Array([1, 2, 1]);
+    var vertical = this.separableConvolve(pixels, width, height, sobelSignVector, sobelScaleVector);
+    var horizontal = this.separableConvolve(pixels, width, height, sobelScaleVector, sobelSignVector);
+
+    for (var i = 0; i < output.length; i += 4) {
+      var v = vertical[i];
+      var h = horizontal[i];
+      var p = Math.sqrt(h * h + v * v);
+      output[i] = p;
+      output[i + 1] = p;
+      output[i + 2] = p;
+      output[i + 3] = 255;
+    }
+
+    return output;
+  };
+
+  /**
+   * Equalizes the histogram of a grayscale image, normalizing the
+   * brightness and increasing the contrast of the image.
+   * @param {pixels} pixels The grayscale pixels in a linear array.
+   * @param {number} width The image width.
+   * @param {number} height The image height.
+   * @return {array} The equalized grayscale pixels in a linear array.
+   */
+  tracking.Image.equalizeHist = function(pixels, width, height){
+    var equalized = new Uint8ClampedArray(pixels.length);
+
+    var histogram = new Array(256);
+    for(var i=0; i < 256; i++) histogram[i] = 0;
+
+    for(var i=0; i < pixels.length; i++){
+      equalized[i] = pixels[i];
+      histogram[pixels[i]]++;
+    }
+
+    var prev = histogram[0];
+    for(var i=0; i < 256; i++){
+      histogram[i] += prev;
+      prev = histogram[i];
+    }
+
+    var norm = 255 / pixels.length;
+    for(var i=0; i < pixels.length; i++)
+      equalized[i] = (histogram[pixels[i]] * norm + 0.5) | 0;
+
+    return equalized;
+  }
+
+}());
+
+(function() {
+  /**
+   * ViolaJones utility.
+   * @static
+   * @constructor
+   */
+  tracking.ViolaJones = {};
+
+  /**
+   * Holds the minimum area of intersection that defines when a rectangle is
+   * from the same group. Often when a face is matched multiple rectangles are
+   * classified as possible rectangles to represent the face, when they
+   * intersects they are grouped as one face.
+   * @type {number}
+   * @default 0.5
+   * @static
+   */
+  tracking.ViolaJones.REGIONS_OVERLAP = 0.5;
+
+  /**
+   * Holds the HAAR cascade classifiers converted from OpenCV training.
+   * @type {array}
+   * @static
+   */
+  tracking.ViolaJones.classifiers = {};
+
+  /**
+   * Detects through the HAAR cascade data rectangles matches.
+   * @param {pixels} pixels The pixels in a linear [r,g,b,a,...] array.
+   * @param {number} width The image width.
+   * @param {number} height The image height.
+   * @param {number} initialScale The initial scale to start the block
+   *     scaling.
+   * @param {number} scaleFactor The scale factor to scale the feature block.
+   * @param {number} stepSize The block step size.
+   * @param {number} edgesDensity Percentage density edges inside the
+   *     classifier block. Value from [0.0, 1.0], defaults to 0.2. If specified
+   *     edge detection will be applied to the image to prune dead areas of the
+   *     image, this can improve significantly performance.
+   * @param {number} data The HAAR cascade data.
+   * @return {array} Found rectangles.
+   * @static
+   */
+  tracking.ViolaJones.detect = function(pixels, width, height, initialScale, scaleFactor, stepSize, edgesDensity, data) {
+    var total = 0;
+    var rects = [];
+    var integralImage = new Int32Array(width * height);
+    var integralImageSquare = new Int32Array(width * height);
+    var tiltedIntegralImage = new Int32Array(width * height);
+
+    var integralImageSobel;
+    if (edgesDensity > 0) {
+      integralImageSobel = new Int32Array(width * height);
+    }
+
+    tracking.Image.computeIntegralImage(pixels, width, height, integralImage, integralImageSquare, tiltedIntegralImage, integralImageSobel);
+
+    var minWidth = data[0];
+    var minHeight = data[1];
+    var scale = initialScale * scaleFactor;
+    var blockWidth = (scale * minWidth) | 0;
+    var blockHeight = (scale * minHeight) | 0;
+
+    while (blockWidth < width && blockHeight < height) {
+      var step = (scale * stepSize + 0.5) | 0;
+      for (var i = 0; i < (height - blockHeight); i += step) {
+        for (var j = 0; j < (width - blockWidth); j += step) {
+
+          if (edgesDensity > 0) {
+            if (this.isTriviallyExcluded(edgesDensity, integralImageSobel, i, j, width, blockWidth, blockHeight)) {
+              continue;
+            }
+          }
+
+          if (this.evalStages_(data, integralImage, integralImageSquare, tiltedIntegralImage, i, j, width, blockWidth, blockHeight, scale)) {
+            rects[total++] = {
+              width: blockWidth,
+              height: blockHeight,
+              x: j,
+              y: i
+            };
+          }
+        }
+      }
+
+      scale *= scaleFactor;
+      blockWidth = (scale * minWidth) | 0;
+      blockHeight = (scale * minHeight) | 0;
+    }
+    return this.mergeRectangles_(rects);
+  };
+
+  /**
+   * Fast check to test whether the edges density inside the block is greater
+   * than a threshold, if true it tests the stages. This can improve
+   * significantly performance.
+   * @param {number} edgesDensity Percentage density edges inside the
+   *     classifier block.
+   * @param {array} integralImageSobel The integral image of a sobel image.
+   * @param {number} i Vertical position of the pixel to be evaluated.
+   * @param {number} j Horizontal position of the pixel to be evaluated.
+   * @param {number} width The image width.
+   * @return {boolean} True whether the block at position i,j can be skipped,
+   *     false otherwise.
+   * @static
+   * @protected
+   */
+  tracking.ViolaJones.isTriviallyExcluded = function(edgesDensity, integralImageSobel, i, j, width, blockWidth, blockHeight) {
+    var wbA = i * width + j;
+    var wbB = wbA + blockWidth;
+    var wbD = wbA + blockHeight * width;
+    var wbC = wbD + blockWidth;
+    var blockEdgesDensity = (integralImageSobel[wbA] - integralImageSobel[wbB] - integralImageSobel[wbD] + integralImageSobel[wbC]) / (blockWidth * blockHeight * 255);
+    if (blockEdgesDensity < edgesDensity) {
+      return true;
+    }
+    return false;
+  };
+
+  /**
+   * Evaluates if the block size on i,j position is a valid HAAR cascade
+   * stage.
+   * @param {number} data The HAAR cascade data.
+   * @param {number} i Vertical position of the pixel to be evaluated.
+   * @param {number} j Horizontal position of the pixel to be evaluated.
+   * @param {number} width The image width.
+   * @param {number} blockSize The block size.
+   * @param {number} scale The scale factor of the block size and its original
+   *     size.
+   * @param {number} inverseArea The inverse area of the block size.
+   * @return {boolean} Whether the region passes all the stage tests.
+   * @private
+   * @static
+   */
+  tracking.ViolaJones.evalStages_ = function(data, integralImage, integralImageSquare, tiltedIntegralImage, i, j, width, blockWidth, blockHeight, scale) {
+    var inverseArea = 1.0 / (blockWidth * blockHeight);
+    var wbA = i * width + j;
+    var wbB = wbA + blockWidth;
+    var wbD = wbA + blockHeight * width;
+    var wbC = wbD + blockWidth;
+    var mean = (integralImage[wbA] - integralImage[wbB] - integralImage[wbD] + integralImage[wbC]) * inverseArea;
+    var variance = (integralImageSquare[wbA] - integralImageSquare[wbB] - integralImageSquare[wbD] + integralImageSquare[wbC]) * inverseArea - mean * mean;
+
+    var standardDeviation = 1;
+    if (variance > 0) {
+      standardDeviation = Math.sqrt(variance);
+    }
+
+    var length = data.length;
+
+    for (var w = 2; w < length; ) {
+      var stageSum = 0;
+      var stageThreshold = data[w++];
+      var nodeLength = data[w++];
+
+      while (nodeLength--) {
+        var rectsSum = 0;
+        var tilted = data[w++];
+        var rectsLength = data[w++];
+
+        for (var r = 0; r < rectsLength; r++) {
+          var rectLeft = (j + data[w++] * scale + 0.5) | 0;
+          var rectTop = (i + data[w++] * scale + 0.5) | 0;
+          var rectWidth = (data[w++] * scale + 0.5) | 0;
+          var rectHeight = (data[w++] * scale + 0.5) | 0;
+          var rectWeight = data[w++];
+
+          var w1;
+          var w2;
+          var w3;
+          var w4;
+          if (tilted) {
+            // RectSum(r) = RSAT(x-h+w, y+w+h-1) + RSAT(x, y-1) - RSAT(x-h, y+h-1) - RSAT(x+w, y+w-1)
+            w1 = (rectLeft - rectHeight + rectWidth) + (rectTop + rectWidth + rectHeight - 1) * width;
+            w2 = rectLeft + (rectTop - 1) * width;
+            w3 = (rectLeft - rectHeight) + (rectTop + rectHeight - 1) * width;
+            w4 = (rectLeft + rectWidth) + (rectTop + rectWidth - 1) * width;
+            rectsSum += (tiltedIntegralImage[w1] + tiltedIntegralImage[w2] - tiltedIntegralImage[w3] - tiltedIntegralImage[w4]) * rectWeight;
+          } else {
+            // RectSum(r) = SAT(x-1, y-1) + SAT(x+w-1, y+h-1) - SAT(x-1, y+h-1) - SAT(x+w-1, y-1)
+            w1 = rectTop * width + rectLeft;
+            w2 = w1 + rectWidth;
+            w3 = w1 + rectHeight * width;
+            w4 = w3 + rectWidth;
+            rectsSum += (integralImage[w1] - integralImage[w2] - integralImage[w3] + integralImage[w4]) * rectWeight;
+            // TODO: Review the code below to analyze performance when using it instead.
+            // w1 = (rectLeft - 1) + (rectTop - 1) * width;
+            // w2 = (rectLeft + rectWidth - 1) + (rectTop + rectHeight - 1) * width;
+            // w3 = (rectLeft - 1) + (rectTop + rectHeight - 1) * width;
+            // w4 = (rectLeft + rectWidth - 1) + (rectTop - 1) * width;
+            // rectsSum += (integralImage[w1] + integralImage[w2] - integralImage[w3] - integralImage[w4]) * rectWeight;
+          }
+        }
+
+        var nodeThreshold = data[w++];
+        var nodeLeft = data[w++];
+        var nodeRight = data[w++];
+
+        if (rectsSum * inverseArea < nodeThreshold * standardDeviation) {
+          stageSum += nodeLeft;
+        } else {
+          stageSum += nodeRight;
+        }
+      }
+
+      if (stageSum < stageThreshold) {
+        return false;
+      }
+    }
+    return true;
+  };
+
+  /**
+   * Postprocess the detected sub-windows in order to combine overlapping
+   * detections into a single detection.
+   * @param {array} rects
+   * @return {array}
+   * @private
+   * @static
+   */
+  tracking.ViolaJones.mergeRectangles_ = function(rects) {
+    var disjointSet = new tracking.DisjointSet(rects.length);
+
+    for (var i = 0; i < rects.length; i++) {
+      var r1 = rects[i];
+      for (var j = 0; j < rects.length; j++) {
+        var r2 = rects[j];
+        if (tracking.Math.intersectRect(r1.x, r1.y, r1.x + r1.width, r1.y + r1.height, r2.x, r2.y, r2.x + r2.width, r2.y + r2.height)) {
+          var x1 = Math.max(r1.x, r2.x);
+          var y1 = Math.max(r1.y, r2.y);
+          var x2 = Math.min(r1.x + r1.width, r2.x + r2.width);
+          var y2 = Math.min(r1.y + r1.height, r2.y + r2.height);
+          var overlap = (x1 - x2) * (y1 - y2);
+          var area1 = (r1.width * r1.height);
+          var area2 = (r2.width * r2.height);
+
+          if ((overlap / (area1 * (area1 / area2)) >= this.REGIONS_OVERLAP) &&
+            (overlap / (area2 * (area1 / area2)) >= this.REGIONS_OVERLAP)) {
+            disjointSet.union(i, j);
+          }
+        }
+      }
+    }
+
+    var map = {};
+    for (var k = 0; k < disjointSet.length; k++) {
+      var rep = disjointSet.find(k);
+      if (!map[rep]) {
+        map[rep] = {
+          total: 1,
+          width: rects[k].width,
+          height: rects[k].height,
+          x: rects[k].x,
+          y: rects[k].y
+        };
+        continue;
+      }
+      map[rep].total++;
+      map[rep].width += rects[k].width;
+      map[rep].height += rects[k].height;
+      map[rep].x += rects[k].x;
+      map[rep].y += rects[k].y;
+    }
+
+    var result = [];
+    Object.keys(map).forEach(function(key) {
+      var rect = map[key];
+      result.push({
+        total: rect.total,
+        width: (rect.width / rect.total + 0.5) | 0,
+        height: (rect.height / rect.total + 0.5) | 0,
+        x: (rect.x / rect.total + 0.5) | 0,
+        y: (rect.y / rect.total + 0.5) | 0
+      });
+    });
+
+    return result;
+  };
+
+}());
+
+(function() {
+  /**
+   * Brief intends for "Binary Robust Independent Elementary Features".This
+   * method generates a binary string for each keypoint found by an extractor
+   * method.
+   * @static
+   * @constructor
+   */
+  tracking.Brief = {};
+
+  /**
+   * The set of binary tests is defined by the nd (x,y)-location pairs
+   * uniquely chosen during the initialization. Values could vary between N =
+   * 128,256,512. N=128 yield good compromises between speed, storage
+   * efficiency, and recognition rate.
+   * @type {number}
+   */
+  tracking.Brief.N = 512;
+
+  /**
+   * Caches coordinates values of (x,y)-location pairs uniquely chosen during
+   * the initialization.
+   * @type {Object.<number, Int32Array>}
+   * @private
+   * @static
+   */
+  tracking.Brief.randomImageOffsets_ = {};
+
+  /**
+   * Caches delta values of (x,y)-location pairs uniquely chosen during
+   * the initialization.
+   * @type {Int32Array}
+   * @private
+   * @static
+   */
+  tracking.Brief.randomWindowOffsets_ = null;
+
+  /**
+   * Generates a binary string for each found keypoints extracted using an
+   * extractor method.
+   * @param {array} The grayscale pixels in a linear [p1,p2,...] array.
+   * @param {number} width The image width.
+   * @param {array} keypoints
+   * @return {Int32Array} Returns an array where for each four sequence int
+   *     values represent the descriptor binary string (128 bits) necessary
+   *     to describe the corner, e.g. [0,0,0,0, 0,0,0,0, ...].
+   * @static
+   */
+  tracking.Brief.getDescriptors = function(pixels, width, keypoints) {
+    // Optimizing divide by 32 operation using binary shift
+    // (this.N >> 5) === this.N/32.
+    var descriptors = new Int32Array((keypoints.length >> 1) * (this.N >> 5));
+    var descriptorWord = 0;
+    var offsets = this.getRandomOffsets_(width);
+    var position = 0;
+
+    for (var i = 0; i < keypoints.length; i += 2) {
+      var w = width * keypoints[i + 1] + keypoints[i];
+
+      var offsetsPosition = 0;
+      for (var j = 0, n = this.N; j < n; j++) {
+        if (pixels[offsets[offsetsPosition++] + w] < pixels[offsets[offsetsPosition++] + w]) {
+          // The bit in the position `j % 32` of descriptorWord should be set to 1. We do
+          // this by making an OR operation with a binary number that only has the bit
+          // in that position set to 1. That binary number is obtained by shifting 1 left by
+          // `j % 32` (which is the same as `j & 31` left) positions.
+          descriptorWord |= 1 << (j & 31);
+        }
+
+        // If the next j is a multiple of 32, we will need to use a new descriptor word to hold
+        // the next results.
+        if (!((j + 1) & 31)) {
+          descriptors[position++] = descriptorWord;
+          descriptorWord = 0;
+        }
+      }
+    }
+
+    return descriptors;
+  };
+
+  /**
+   * Matches sets of features {mi} and {m′j} extracted from two images taken
+   * from similar, and often successive, viewpoints. A classical procedure
+   * runs as follows. For each point {mi} in the first image, search in a
+   * region of the second image around location {mi} for point {m′j}. The
+   * search is based on the similarity of the local image windows, also known
+   * as kernel windows, centered on the points, which strongly characterizes
+   * the points when the images are sufficiently close. Once each keypoint is
+   * described with its binary string, they need to be compared with the
+   * closest matching point. Distance metric is critical to the performance of
+   * in- trusion detection systems. Thus using binary strings reduces the size
+   * of the descriptor and provides an interesting data structure that is fast
+   * to operate whose similarity can be measured by the Hamming distance.
+   * @param {array} keypoints1
+   * @param {array} descriptors1
+   * @param {array} keypoints2
+   * @param {array} descriptors2
+   * @return {Int32Array} Returns an array where the index is the corner1
+   *     index coordinate, and the value is the corresponding match index of
+   *     corner2, e.g. keypoints1=[x0,y0,x1,y1,...] and
+   *     keypoints2=[x'0,y'0,x'1,y'1,...], if x0 matches x'1 and x1 matches x'0,
+   *     the return array would be [3,0].
+   * @static
+   */
+  tracking.Brief.match = function(keypoints1, descriptors1, keypoints2, descriptors2) {
+    var len1 = keypoints1.length >> 1;
+    var len2 = keypoints2.length >> 1;
+    var matches = new Array(len1);
+
+    for (var i = 0; i < len1; i++) {
+      var min = Infinity;
+      var minj = 0;
+      for (var j = 0; j < len2; j++) {
+        var dist = 0;
+        // Optimizing divide by 32 operation using binary shift
+        // (this.N >> 5) === this.N/32.
+        for (var k = 0, n = this.N >> 5; k < n; k++) {
+          dist += tracking.Math.hammingWeight(descriptors1[i * n + k] ^ descriptors2[j * n + k]);
+        }
+        if (dist < min) {
+          min = dist;
+          minj = j;
+        }
+      }
+      matches[i] = {
+        index1: i,
+        index2: minj,
+        keypoint1: [keypoints1[2 * i], keypoints1[2 * i + 1]],
+        keypoint2: [keypoints2[2 * minj], keypoints2[2 * minj + 1]],
+        confidence: 1 - min / this.N
+      };
+    }
+
+    return matches;
+  };
+
+  /**
+   * Removes matches outliers by testing matches on both directions.
+   * @param {array} keypoints1
+   * @param {array} descriptors1
+   * @param {array} keypoints2
+   * @param {array} descriptors2
+   * @return {Int32Array} Returns an array where the index is the corner1
+   *     index coordinate, and the value is the corresponding match index of
+   *     corner2, e.g. keypoints1=[x0,y0,x1,y1,...] and
+   *     keypoints2=[x'0,y'0,x'1,y'1,...], if x0 matches x'1 and x1 matches x'0,
+   *     the return array would be [3,0].
+   * @static
+   */
+  tracking.Brief.reciprocalMatch = function(keypoints1, descriptors1, keypoints2, descriptors2) {
+    var matches = [];
+    if (keypoints1.length === 0 || keypoints2.length === 0) {
+      return matches;
+    }
+
+    var matches1 = tracking.Brief.match(keypoints1, descriptors1, keypoints2, descriptors2);
+    var matches2 = tracking.Brief.match(keypoints2, descriptors2, keypoints1, descriptors1);
+    for (var i = 0; i < matches1.length; i++) {
+      if (matches2[matches1[i].index2].index2 === i) {
+        matches.push(matches1[i]);
+      }
+    }
+    return matches;
+  };
+
+  /**
+   * Gets the coordinates values of (x,y)-location pairs uniquely chosen
+   * during the initialization.
+   * @return {array} Array with the random offset values.
+   * @private
+   */
+  tracking.Brief.getRandomOffsets_ = function(width) {
+    if (!this.randomWindowOffsets_) {
+      var windowPosition = 0;
+      var windowOffsets = new Int32Array(4 * this.N);
+      for (var i = 0; i < this.N; i++) {
+        windowOffsets[windowPosition++] = Math.round(tracking.Math.uniformRandom(-15, 16));
+        windowOffsets[windowPosition++] = Math.round(tracking.Math.uniformRandom(-15, 16));
+        windowOffsets[windowPosition++] = Math.round(tracking.Math.uniformRandom(-15, 16));
+        windowOffsets[windowPosition++] = Math.round(tracking.Math.uniformRandom(-15, 16));
+      }
+      this.randomWindowOffsets_ = windowOffsets;
+    }
+
+    if (!this.randomImageOffsets_[width]) {
+      var imagePosition = 0;
+      var imageOffsets = new Int32Array(2 * this.N);
+      for (var j = 0; j < this.N; j++) {
+        imageOffsets[imagePosition++] = this.randomWindowOffsets_[4 * j] * width + this.randomWindowOffsets_[4 * j + 1];
+        imageOffsets[imagePosition++] = this.randomWindowOffsets_[4 * j + 2] * width + this.randomWindowOffsets_[4 * j + 3];
+      }
+      this.randomImageOffsets_[width] = imageOffsets;
+    }
+
+    return this.randomImageOffsets_[width];
+  };
+}());
+
+(function() {
+  /**
+   * FAST intends for "Features from Accelerated Segment Test". This method
+   * performs a point segment test corner detection. The segment test
+   * criterion operates by considering a circle of sixteen pixels around the
+   * corner candidate p. The detector classifies p as a corner if there exists
+   * a set of n contiguous pixelsin the circle which are all brighter than the
+   * intensity of the candidate pixel Ip plus a threshold t, or all darker
+   * than Ip − t.
+   *
+   *       15 00 01
+   *    14          02
+   * 13                03
+   * 12       []       04
+   * 11                05
+   *    10          06
+   *       09 08 07
+   *
+   * For more reference:
+   * http://citeseerx.ist.psu.edu/viewdoc/download?doi=10.1.1.60.3991&rep=rep1&type=pdf
+   * @static
+   * @constructor
+   */
+  tracking.Fast = {};
+
+  /**
+   * Holds the threshold to determine whether the tested pixel is brighter or
+   * darker than the corner candidate p.
+   * @type {number}
+   * @default 40
+   * @static
+   */
+  tracking.Fast.THRESHOLD = 40;
+
+  /**
+   * Caches coordinates values of the circle surrounding the pixel candidate p.
+   * @type {Object.<number, Int32Array>}
+   * @private
+   * @static
+   */
+  tracking.Fast.circles_ = {};
+
+  /**
+   * Finds corners coordinates on the graysacaled image.
+   * @param {array} The grayscale pixels in a linear [p1,p2,...] array.
+   * @param {number} width The image width.
+   * @param {number} height The image height.
+   * @param {number} threshold to determine whether the tested pixel is brighter or
+   *     darker than the corner candidate p. Default value is 40.
+   * @return {array} Array containing the coordinates of all found corners,
+   *     e.g. [x0,y0,x1,y1,...], where P(x0,y0) represents a corner coordinate.
+   * @static
+   */
+  tracking.Fast.findCorners = function(pixels, width, height, opt_threshold) {
+    var circleOffsets = this.getCircleOffsets_(width);
+    var circlePixels = new Int32Array(16);
+    var corners = [];
+
+    if (opt_threshold === undefined) {
+      opt_threshold = this.THRESHOLD;
+    }
+
+    // When looping through the image pixels, skips the first three lines from
+    // the image boundaries to constrain the surrounding circle inside the image
+    // area.
+    for (var i = 3; i < height - 3; i++) {
+      for (var j = 3; j < width - 3; j++) {
+        var w = i * width + j;
+        var p = pixels[w];
+
+        // Loops the circle offsets to read the pixel value for the sixteen
+        // surrounding pixels.
+        for (var k = 0; k < 16; k++) {
+          circlePixels[k] = pixels[w + circleOffsets[k]];
+        }
+
+        if (this.isCorner(p, circlePixels, opt_threshold)) {
+          // The pixel p is classified as a corner, as optimization increment j
+          // by the circle radius 3 to skip the neighbor pixels inside the
+          // surrounding circle. This can be removed without compromising the
+          // result.
+          corners.push(j, i);
+          j += 3;
+        }
+      }
+    }
+
+    return corners;
+  };
+
+  /**
+   * Checks if the circle pixel is brighter than the candidate pixel p by
+   * a threshold.
+   * @param {number} circlePixel The circle pixel value.
+   * @param {number} p The value of the candidate pixel p.
+   * @param {number} threshold
+   * @return {Boolean}
+   * @static
+   */
+  tracking.Fast.isBrighter = function(circlePixel, p, threshold) {
+    return circlePixel - p > threshold;
+  };
+
+  /**
+   * Checks if the circle pixel is within the corner of the candidate pixel p
+   * by a threshold.
+   * @param {number} p The value of the candidate pixel p.
+   * @param {number} circlePixel The circle pixel value.
+   * @param {number} threshold
+   * @return {Boolean}
+   * @static
+   */
+  tracking.Fast.isCorner = function(p, circlePixels, threshold) {
+    if (this.isTriviallyExcluded(circlePixels, p, threshold)) {
+      return false;
+    }
+
+    for (var x = 0; x < 16; x++) {
+      var darker = true;
+      var brighter = true;
+
+      for (var y = 0; y < 9; y++) {
+        var circlePixel = circlePixels[(x + y) & 15];
+
+        if (!this.isBrighter(p, circlePixel, threshold)) {
+          brighter = false;
+          if (darker === false) {
+            break;
+          }
+        }
+
+        if (!this.isDarker(p, circlePixel, threshold)) {
+          darker = false;
+          if (brighter === false) {
+            break;
+          }
+        }
+      }
+
+      if (brighter || darker) {
+        return true;
+      }
+    }
+
+    return false;
+  };
+
+  /**
+   * Checks if the circle pixel is darker than the candidate pixel p by
+   * a threshold.
+   * @param {number} circlePixel The circle pixel value.
+   * @param {number} p The value of the candidate pixel p.
+   * @param {number} threshold
+   * @return {Boolean}
+   * @static
+   */
+  tracking.Fast.isDarker = function(circlePixel, p, threshold) {
+    return p - circlePixel > threshold;
+  };
+
+  /**
+   * Fast check to test if the candidate pixel is a trivially excluded value.
+   * In order to be a corner, the candidate pixel value should be darker or
+   * brighter than 9-12 surrounding pixels, when at least three of the top,
+   * bottom, left and right pixels are brighter or darker it can be
+   * automatically excluded improving the performance.
+   * @param {number} circlePixel The circle pixel value.
+   * @param {number} p The value of the candidate pixel p.
+   * @param {number} threshold
+   * @return {Boolean}
+   * @static
+   * @protected
+   */
+  tracking.Fast.isTriviallyExcluded = function(circlePixels, p, threshold) {
+    var count = 0;
+    var circleBottom = circlePixels[8];
+    var circleLeft = circlePixels[12];
+    var circleRight = circlePixels[4];
+    var circleTop = circlePixels[0];
+
+    if (this.isBrighter(circleTop, p, threshold)) {
+      count++;
+    }
+    if (this.isBrighter(circleRight, p, threshold)) {
+      count++;
+    }
+    if (this.isBrighter(circleBottom, p, threshold)) {
+      count++;
+    }
+    if (this.isBrighter(circleLeft, p, threshold)) {
+      count++;
+    }
+
+    if (count < 3) {
+      count = 0;
+      if (this.isDarker(circleTop, p, threshold)) {
+        count++;
+      }
+      if (this.isDarker(circleRight, p, threshold)) {
+        count++;
+      }
+      if (this.isDarker(circleBottom, p, threshold)) {
+        count++;
+      }
+      if (this.isDarker(circleLeft, p, threshold)) {
+        count++;
+      }
+      if (count < 3) {
+        return true;
+      }
+    }
+
+    return false;
+  };
+
+  /**
+   * Gets the sixteen offset values of the circle surrounding pixel.
+   * @param {number} width The image width.
+   * @return {array} Array with the sixteen offset values of the circle
+   *     surrounding pixel.
+   * @private
+   */
+  tracking.Fast.getCircleOffsets_ = function(width) {
+    if (this.circles_[width]) {
+      return this.circles_[width];
+    }
+
+    var circle = new Int32Array(16);
+
+    circle[0] = -width - width - width;
+    circle[1] = circle[0] + 1;
+    circle[2] = circle[1] + width + 1;
+    circle[3] = circle[2] + width + 1;
+    circle[4] = circle[3] + width;
+    circle[5] = circle[4] + width;
+    circle[6] = circle[5] + width - 1;
+    circle[7] = circle[6] + width - 1;
+    circle[8] = circle[7] - 1;
+    circle[9] = circle[8] - 1;
+    circle[10] = circle[9] - width - 1;
+    circle[11] = circle[10] - width - 1;
+    circle[12] = circle[11] - width;
+    circle[13] = circle[12] - width;
+    circle[14] = circle[13] - width + 1;
+    circle[15] = circle[14] - width + 1;
+
+    this.circles_[width] = circle;
+    return circle;
+  };
+}());
+
+(function() {
+  /**
+   * Math utility.
+   * @static
+   * @constructor
+   */
+  tracking.Math = {};
+
+  /**
+   * Euclidean distance between two points P(x0, y0) and P(x1, y1).
+   * @param {number} x0 Horizontal coordinate of P0.
+   * @param {number} y0 Vertical coordinate of P0.
+   * @param {number} x1 Horizontal coordinate of P1.
+   * @param {number} y1 Vertical coordinate of P1.
+   * @return {number} The euclidean distance.
+   */
+  tracking.Math.distance = function(x0, y0, x1, y1) {
+    var dx = x1 - x0;
+    var dy = y1 - y0;
+
+    return Math.sqrt(dx * dx + dy * dy);
+  };
+
+  /**
+   * Calculates the Hamming weight of a string, which is the number of symbols that are
+   * different from the zero-symbol of the alphabet used. It is thus
+   * equivalent to the Hamming distance from the all-zero string of the same
+   * length. For the most typical case, a string of bits, this is the number
+   * of 1's in the string.
+   *
+   * Example:
+   *
+   * <pre>
+   *  Binary string     Hamming weight
+   *   11101                 4
+   *   11101010              5
+   * </pre>
+   *
+   * @param {number} i Number that holds the binary string to extract the hamming weight.
+   * @return {number} The hamming weight.
+   */
+  tracking.Math.hammingWeight = function(i) {
+    i = i - ((i >> 1) & 0x55555555);
+    i = (i & 0x33333333) + ((i >> 2) & 0x33333333);
+
+    return ((i + (i >> 4) & 0xF0F0F0F) * 0x1010101) >> 24;
+  };
+
+  /**
+   * Generates a random number between [a, b] interval.
+   * @param {number} a
+   * @param {number} b
+   * @return {number}
+   */
+  tracking.Math.uniformRandom = function(a, b) {
+    return a + Math.random() * (b - a);
+  };
+
+  /**
+   * Tests if a rectangle intersects with another.
+   *
+   *  <pre>
+   *  x0y0 --------       x2y2 --------
+   *      |       |           |       |
+   *      -------- x1y1       -------- x3y3
+   * </pre>
+   *
+   * @param {number} x0 Horizontal coordinate of P0.
+   * @param {number} y0 Vertical coordinate of P0.
+   * @param {number} x1 Horizontal coordinate of P1.
+   * @param {number} y1 Vertical coordinate of P1.
+   * @param {number} x2 Horizontal coordinate of P2.
+   * @param {number} y2 Vertical coordinate of P2.
+   * @param {number} x3 Horizontal coordinate of P3.
+   * @param {number} y3 Vertical coordinate of P3.
+   * @return {boolean}
+   */
+  tracking.Math.intersectRect = function(x0, y0, x1, y1, x2, y2, x3, y3) {
+    return !(x2 > x1 || x3 < x0 || y2 > y1 || y3 < y0);
+  };
+
+}());
+
+(function() {
+  /**
+   * Matrix utility.
+   * @static
+   * @constructor
+   */
+  tracking.Matrix = {};
+
+  /**
+   * Loops the array organized as major-row order and executes `fn` callback
+   * for each iteration. The `fn` callback receives the following parameters:
+   * `(r,g,b,a,index,i,j)`, where `r,g,b,a` represents the pixel color with
+   * alpha channel, `index` represents the position in the major-row order
+   * array and `i,j` the respective indexes positions in two dimensions.
+   * @param {array} pixels The pixels in a linear [r,g,b,a,...] array to loop
+   *     through.
+   * @param {number} width The image width.
+   * @param {number} height The image height.
+   * @param {function} fn The callback function for each pixel.
+   * @param {number} opt_jump Optional jump for the iteration, by default it
+   *     is 1, hence loops all the pixels of the array.
+   * @static
+   */
+  tracking.Matrix.forEach = function(pixels, width, height, fn, opt_jump) {
+    opt_jump = opt_jump || 1;
+    for (var i = 0; i < height; i += opt_jump) {
+      for (var j = 0; j < width; j += opt_jump) {
+        var w = i * width * 4 + j * 4;
+        fn.call(this, pixels[w], pixels[w + 1], pixels[w + 2], pixels[w + 3], w, i, j);
+      }
+    }
+  };
+
+  /**
+   * Calculates the per-element subtraction of two NxM matrices and returns a 
+   * new NxM matrix as the result.
+   * @param {matrix} a The first matrix.
+   * @param {matrix} a The second matrix.
+   * @static
+   */
+  tracking.Matrix.sub = function(a, b){
+    var res = tracking.Matrix.clone(a);
+    for(var i=0; i < res.length; i++){
+      for(var j=0; j < res[i].length; j++){
+        res[i][j] -= b[i][j]; 
+      }
+    }
+    return res;
+  }
+
+  /**
+   * Calculates the per-element sum of two NxM matrices and returns a new NxM
+   * NxM matrix as the result.
+   * @param {matrix} a The first matrix.
+   * @param {matrix} a The second matrix.
+   * @static
+   */
+  tracking.Matrix.add = function(a, b){
+    var res = tracking.Matrix.clone(a);
+    for(var i=0; i < res.length; i++){
+      for(var j=0; j < res[i].length; j++){
+        res[i][j] += b[i][j]; 
+      }
+    }
+    return res;
+  }
+
+  /**
+   * Clones a matrix (or part of it) and returns a new matrix as the result.
+   * @param {matrix} src The matrix to be cloned.
+   * @param {number} width The second matrix.
+   * @static
+   */
+  tracking.Matrix.clone = function(src, width, height){
+    width = width || src[0].length;
+    height = height || src.length;
+    var temp = new Array(height);
+    var i = height;
+    while(i--){
+      temp[i] = new Array(width);
+      var j = width;
+      while(j--) temp[i][j] = src[i][j];
+    } 
+    return temp;
+  }
+
+  /**
+   * Multiply a matrix by a scalar and returns a new matrix as the result.
+   * @param {number} scalar The scalar to multiply the matrix by.
+   * @param {matrix} src The matrix to be multiplied.
+   * @static
+   */
+  tracking.Matrix.mulScalar = function(scalar, src){
+    var res = tracking.Matrix.clone(src);
+    for(var i=0; i < src.length; i++){
+      for(var j=0; j < src[i].length; j++){
+        res[i][j] *= scalar;
+      }
+    }
+    return res;
+  }
+
+  /**
+   * Transpose a matrix and returns a new matrix as the result.
+   * @param {matrix} src The matrix to be transposed.
+   * @static
+   */
+  tracking.Matrix.transpose = function(src){
+    var transpose = new Array(src[0].length);
+    for(var i=0; i < src[0].length; i++){
+      transpose[i] = new Array(src.length);
+      for(var j=0; j < src.length; j++){
+        transpose[i][j] = src[j][i];
+      }
+    }
+    return transpose;
+  }
+
+  /**
+   * Multiply an MxN matrix with an NxP matrix and returns a new MxP matrix
+   * as the result.
+   * @param {matrix} a The first matrix.
+   * @param {matrix} b The second matrix.
+   * @static
+   */
+  tracking.Matrix.mul = function(a, b) {
+    var res = new Array(a.length);
+    for (var i = 0; i < a.length; i++) {
+      res[i] = new Array(b[0].length);
+      for (var j = 0; j < b[0].length; j++) {
+        res[i][j] = 0;            
+        for (var k = 0; k < a[0].length; k++) {
+          res[i][j] += a[i][k] * b[k][j];
+        }
+      }
+    }
+    return res;
+  }
+
+  /**
+   * Calculates the absolute norm of a matrix.
+   * @param {matrix} src The matrix which norm will be calculated.
+   * @static
+   */
+  tracking.Matrix.norm = function(src){
+    var res = 0;
+    for(var i=0; i < src.length; i++){
+      for(var j=0; j < src[i].length; j++){
+        res += src[i][j]*src[i][j];
+      }
+    }
+    return Math.sqrt(res);
+  }
+
+  /**
+   * Calculates and returns the covariance matrix of a set of vectors as well
+   * as the mean of the matrix.
+   * @param {matrix} src The matrix which covariance matrix will be calculated.
+   * @static
+   */
+  tracking.Matrix.calcCovarMatrix = function(src){
+
+    var mean = new Array(src.length);
+    for(var i=0; i < src.length; i++){
+      mean[i] = [0.0];
+      for(var j=0; j < src[i].length; j++){
+        mean[i][0] += src[i][j]/src[i].length;
+      }
+    }
+
+    var deltaFull = tracking.Matrix.clone(mean);
+    for(var i=0; i < deltaFull.length; i++){
+      for(var j=0; j < src[0].length - 1; j++){
+        deltaFull[i].push(deltaFull[i][0]);
+      }
+    }
+
+    var a = tracking.Matrix.sub(src, deltaFull);
+    var b = tracking.Matrix.transpose(a);
+    var covar = tracking.Matrix.mul(b,a); 
+    return [covar, mean];
+
+  }
+
+}());
+(function() {
+  /**
+   * EPnp utility.
+   * @static
+   * @constructor
+   */
+  tracking.EPnP = {};
+
+  tracking.EPnP.solve = function(objectPoints, imagePoints, cameraMatrix) {};
+}());
+
+(function() {
+  /**
+   * Tracker utility.
+   * @constructor
+   * @extends {tracking.EventEmitter}
+   */
+  tracking.Tracker = function() {
+    tracking.Tracker.base(this, 'constructor');
+  };
+
+  tracking.inherits(tracking.Tracker, tracking.EventEmitter);
+
+  /**
+   * Tracks the pixels on the array. This method is called for each video
+   * frame in order to emit `track` event.
+   * @param {Uint8ClampedArray} pixels The pixels data to track.
+   * @param {number} width The pixels canvas width.
+   * @param {number} height The pixels canvas height.
+   */
+  tracking.Tracker.prototype.track = function() {};
+}());
+
+(function() {
+  /**
+   * TrackerTask utility.
+   * @constructor
+   * @extends {tracking.EventEmitter}
+   */
+  tracking.TrackerTask = function(tracker) {
+    tracking.TrackerTask.base(this, 'constructor');
+
+    if (!tracker) {
+      throw new Error('Tracker instance not specified.');
+    }
+
+    this.setTracker(tracker);
+  };
+
+  tracking.inherits(tracking.TrackerTask, tracking.EventEmitter);
+
+  /**
+   * Holds the tracker instance managed by this task.
+   * @type {tracking.Tracker}
+   * @private
+   */
+  tracking.TrackerTask.prototype.tracker_ = null;
+
+  /**
+   * Holds if the tracker task is in running.
+   * @type {boolean}
+   * @private
+   */
+  tracking.TrackerTask.prototype.running_ = false;
+
+  /**
+   * Gets the tracker instance managed by this task.
+   * @return {tracking.Tracker}
+   */
+  tracking.TrackerTask.prototype.getTracker = function() {
+    return this.tracker_;
+  };
+
+  /**
+   * Returns true if the tracker task is in running, false otherwise.
+   * @return {boolean}
+   * @private
+   */
+  tracking.TrackerTask.prototype.inRunning = function() {
+    return this.running_;
+  };
+
+  /**
+   * Sets if the tracker task is in running.
+   * @param {boolean} running
+   * @private
+   */
+  tracking.TrackerTask.prototype.setRunning = function(running) {
+    this.running_ = running;
+  };
+
+  /**
+   * Sets the tracker instance managed by this task.
+   * @return {tracking.Tracker}
+   */
+  tracking.TrackerTask.prototype.setTracker = function(tracker) {
+    this.tracker_ = tracker;
+  };
+
+  /**
+   * Emits a `run` event on the tracker task for the implementers to run any
+   * child action, e.g. `requestAnimationFrame`.
+   * @return {object} Returns itself, so calls can be chained.
+   */
+  tracking.TrackerTask.prototype.run = function() {
+    var self = this;
+
+    if (this.inRunning()) {
+      return;
+    }
+
+    this.setRunning(true);
+    this.reemitTrackEvent_ = function(event) {
+      self.emit('track', event);
+    };
+    this.tracker_.on('track', this.reemitTrackEvent_);
+    this.emit('run');
+    return this;
+  };
+
+  /**
+   * Emits a `stop` event on the tracker task for the implementers to stop any
+   * child action being done, e.g. `requestAnimationFrame`.
+   * @return {object} Returns itself, so calls can be chained.
+   */
+  tracking.TrackerTask.prototype.stop = function() {
+    if (!this.inRunning()) {
+      return;
+    }
+
+    this.setRunning(false);
+    this.emit('stop');
+    this.tracker_.removeListener('track', this.reemitTrackEvent_);
+    return this;
+  };
+}());
+
+(function() {
+  /**
+   * ColorTracker utility to track colored blobs in a frame using color
+   * difference evaluation.
+   * @constructor
+   * @param {string|Array.<string>} opt_colors Optional colors to track.
+   * @extends {tracking.Tracker}
+   */
+  tracking.ColorTracker = function(opt_colors) {
+    tracking.ColorTracker.base(this, 'constructor');
+
+    if (typeof opt_colors === 'string') {
+      opt_colors = [opt_colors];
+    }
+
+    if (opt_colors) {
+      opt_colors.forEach(function(color) {
+        if (!tracking.ColorTracker.getColor(color)) {
+          throw new Error('Color not valid, try `new tracking.ColorTracker("magenta")`.');
+        }
+      });
+      this.setColors(opt_colors);
+    }
+  };
+
+  tracking.inherits(tracking.ColorTracker, tracking.Tracker);
+
+  /**
+   * Holds the known colors.
+   * @type {Object.<string, function>}
+   * @private
+   * @static
+   */
+  tracking.ColorTracker.knownColors_ = {};
+
+  /**
+   * Caches coordinates values of the neighbours surrounding a pixel.
+   * @type {Object.<number, Int32Array>}
+   * @private
+   * @static
+   */
+  tracking.ColorTracker.neighbours_ = {};
+
+  /**
+   * Registers a color as known color.
+   * @param {string} name The color name.
+   * @param {function} fn The color function to test if the passed (r,g,b) is
+   *     the desired color.
+   * @static
+   */
+  tracking.ColorTracker.registerColor = function(name, fn) {
+    tracking.ColorTracker.knownColors_[name] = fn;
+  };
+
+  /**
+   * Gets the known color function that is able to test whether an (r,g,b) is
+   * the desired color.
+   * @param {string} name The color name.
+   * @return {function} The known color test function.
+   * @static
+   */
+  tracking.ColorTracker.getColor = function(name) {
+    return tracking.ColorTracker.knownColors_[name];
+  };
+
+  /**
+   * Holds the colors to be tracked by the `ColorTracker` instance.
+   * @default ['magenta']
+   * @type {Array.<string>}
+   */
+  tracking.ColorTracker.prototype.colors = ['magenta'];
+
+  /**
+   * Holds the minimum dimension to classify a rectangle.
+   * @default 20
+   * @type {number}
+   */
+  tracking.ColorTracker.prototype.minDimension = 20;
+
+  /**
+   * Holds the maximum dimension to classify a rectangle.
+   * @default Infinity
+   * @type {number}
+   */
+  tracking.ColorTracker.prototype.maxDimension = Infinity;
+
+
+  /**
+   * Holds the minimum group size to be classified as a rectangle.
+   * @default 30
+   * @type {number}
+   */
+  tracking.ColorTracker.prototype.minGroupSize = 30;
+
+  /**
+   * Calculates the central coordinate from the cloud points. The cloud points
+   * are all points that matches the desired color.
+   * @param {Array.<number>} cloud Major row order array containing all the
+   *     points from the desired color, e.g. [x1, y1, c2, y2, ...].
+   * @param {number} total Total numbers of pixels of the desired color.
+   * @return {object} Object containing the x, y and estimated z coordinate of
+   *     the blog extracted from the cloud points.
+   * @private
+   */
+  tracking.ColorTracker.prototype.calculateDimensions_ = function(cloud, total) {
+    var maxx = -1;
+    var maxy = -1;
+    var minx = Infinity;
+    var miny = Infinity;
+
+    for (var c = 0; c < total; c += 2) {
+      var x = cloud[c];
+      var y = cloud[c + 1];
+
+      if (x < minx) {
+        minx = x;
+      }
+      if (x > maxx) {
+        maxx = x;
+      }
+      if (y < miny) {
+        miny = y;
+      }
+      if (y > maxy) {
+        maxy = y;
+      }
+    }
+
+    return {
+      width: maxx - minx,
+      height: maxy - miny,
+      x: minx,
+      y: miny
+    };
+  };
+
+  /**
+   * Gets the colors being tracked by the `ColorTracker` instance.
+   * @return {Array.<string>}
+   */
+  tracking.ColorTracker.prototype.getColors = function() {
+    return this.colors;
+  };
+
+  /**
+   * Gets the minimum dimension to classify a rectangle.
+   * @return {number}
+   */
+  tracking.ColorTracker.prototype.getMinDimension = function() {
+    return this.minDimension;
+  };
+
+  /**
+   * Gets the maximum dimension to classify a rectangle.
+   * @return {number}
+   */
+  tracking.ColorTracker.prototype.getMaxDimension = function() {
+    return this.maxDimension;
+  };
+
+  /**
+   * Gets the minimum group size to be classified as a rectangle.
+   * @return {number}
+   */
+  tracking.ColorTracker.prototype.getMinGroupSize = function() {
+    return this.minGroupSize;
+  };
+
+  /**
+   * Gets the eight offset values of the neighbours surrounding a pixel.
+   * @param {number} width The image width.
+   * @return {array} Array with the eight offset values of the neighbours
+   *     surrounding a pixel.
+   * @private
+   */
+  tracking.ColorTracker.prototype.getNeighboursForWidth_ = function(width) {
+    if (tracking.ColorTracker.neighbours_[width]) {
+      return tracking.ColorTracker.neighbours_[width];
+    }
+
+    var neighbours = new Int32Array(8);
+
+    neighbours[0] = -width * 4;
+    neighbours[1] = -width * 4 + 4;
+    neighbours[2] = 4;
+    neighbours[3] = width * 4 + 4;
+    neighbours[4] = width * 4;
+    neighbours[5] = width * 4 - 4;
+    neighbours[6] = -4;
+    neighbours[7] = -width * 4 - 4;
+
+    tracking.ColorTracker.neighbours_[width] = neighbours;
+
+    return neighbours;
+  };
+
+  /**
+   * Unites groups whose bounding box intersect with each other.
+   * @param {Array.<Object>} rects
+   * @private
+   */
+  tracking.ColorTracker.prototype.mergeRectangles_ = function(rects) {
+    var intersects;
+    var results = [];
+    var minDimension = this.getMinDimension();
+    var maxDimension = this.getMaxDimension();
+
+    for (var r = 0; r < rects.length; r++) {
+      var r1 = rects[r];
+      intersects = true;
+      for (var s = r + 1; s < rects.length; s++) {
+        var r2 = rects[s];
+        if (tracking.Math.intersectRect(r1.x, r1.y, r1.x + r1.width, r1.y + r1.height, r2.x, r2.y, r2.x + r2.width, r2.y + r2.height)) {
+          intersects = false;
+          var x1 = Math.min(r1.x, r2.x);
+          var y1 = Math.min(r1.y, r2.y);
+          var x2 = Math.max(r1.x + r1.width, r2.x + r2.width);
+          var y2 = Math.max(r1.y + r1.height, r2.y + r2.height);
+          r2.height = y2 - y1;
+          r2.width = x2 - x1;
+          r2.x = x1;
+          r2.y = y1;
+          break;
+        }
+      }
+
+      if (intersects) {
+        if (r1.width >= minDimension && r1.height >= minDimension) {
+          if (r1.width <= maxDimension && r1.height <= maxDimension) {
+            results.push(r1);
+          }
+        }
+      }
+    }
+
+    return results;
+  };
+
+  /**
+   * Sets the colors to be tracked by the `ColorTracker` instance.
+   * @param {Array.<string>} colors
+   */
+  tracking.ColorTracker.prototype.setColors = function(colors) {
+    this.colors = colors;
+  };
+
+  /**
+   * Sets the minimum dimension to classify a rectangle.
+   * @param {number} minDimension
+   */
+  tracking.ColorTracker.prototype.setMinDimension = function(minDimension) {
+    this.minDimension = minDimension;
+  };
+
+  /**
+   * Sets the maximum dimension to classify a rectangle.
+   * @param {number} maxDimension
+   */
+  tracking.ColorTracker.prototype.setMaxDimension = function(maxDimension) {
+    this.maxDimension = maxDimension;
+  };
+
+  /**
+   * Sets the minimum group size to be classified as a rectangle.
+   * @param {number} minGroupSize
+   */
+  tracking.ColorTracker.prototype.setMinGroupSize = function(minGroupSize) {
+    this.minGroupSize = minGroupSize;
+  };
+
+  /**
+   * Tracks the `Video` frames. This method is called for each video frame in
+   * order to emit `track` event.
+   * @param {Uint8ClampedArray} pixels The pixels data to track.
+   * @param {number} width The pixels canvas width.
+   * @param {number} height The pixels canvas height.
+   */
+  tracking.ColorTracker.prototype.track = function(pixels, width, height) {
+    var self = this;
+    var colors = this.getColors();
+
+    if (!colors) {
+      throw new Error('Colors not specified, try `new tracking.ColorTracker("magenta")`.');
+    }
+
+    var results = [];
+
+    colors.forEach(function(color) {
+      results = results.concat(self.trackColor_(pixels, width, height, color));
+    });
+
+    this.emit('track', {
+      data: results
+    });
+  };
+
+  /**
+   * Find the given color in the given matrix of pixels using Flood fill
+   * algorithm to determines the area connected to a given node in a
+   * multi-dimensional array.
+   * @param {Uint8ClampedArray} pixels The pixels data to track.
+   * @param {number} width The pixels canvas width.
+   * @param {number} height The pixels canvas height.
+   * @param {string} color The color to be found
+   * @private
+   */
+  tracking.ColorTracker.prototype.trackColor_ = function(pixels, width, height, color) {
+    var colorFn = tracking.ColorTracker.knownColors_[color];
+    var currGroup = new Int32Array(pixels.length >> 2);
+    var currGroupSize;
+    var currI;
+    var currJ;
+    var currW;
+    var marked = new Int8Array(pixels.length);
+    var minGroupSize = this.getMinGroupSize();
+    var neighboursW = this.getNeighboursForWidth_(width);
+    var queue = new Int32Array(pixels.length);
+    var queuePosition;
+    var results = [];
+    var w = -4;
+
+    if (!colorFn) {
+      return results;
+    }
+
+    for (var i = 0; i < height; i++) {
+      for (var j = 0; j < width; j++) {
+        w += 4;
+
+        if (marked[w]) {
+          continue;
+        }
+
+        currGroupSize = 0;
+
+        queuePosition = -1;
+        queue[++queuePosition] = w;
+        queue[++queuePosition] = i;
+        queue[++queuePosition] = j;
+
+        marked[w] = 1;
+
+        while (queuePosition >= 0) {
+          currJ = queue[queuePosition--];
+          currI = queue[queuePosition--];
+          currW = queue[queuePosition--];
+
+          if (colorFn(pixels[currW], pixels[currW + 1], pixels[currW + 2], pixels[currW + 3], currW, currI, currJ)) {
+            currGroup[currGroupSize++] = currJ;
+            currGroup[currGroupSize++] = currI;
+
+            for (var k = 0; k < neighboursW.length; k++) {
+              var otherW = currW + neighboursW[k];
+              var otherI = currI + neighboursI[k];
+              var otherJ = currJ + neighboursJ[k];
+              if (!marked[otherW] && otherI >= 0 && otherI < height && otherJ >= 0 && otherJ < width) {
+                queue[++queuePosition] = otherW;
+                queue[++queuePosition] = otherI;
+                queue[++queuePosition] = otherJ;
+
+                marked[otherW] = 1;
+              }
+            }
+          }
+        }
+
+        if (currGroupSize >= minGroupSize) {
+          var data = this.calculateDimensions_(currGroup, currGroupSize);
+          if (data) {
+            data.color = color;
+            results.push(data);
+          }
+        }
+      }
+    }
+
+    return this.mergeRectangles_(results);
+  };
+
+  // Default colors
+  //===================
+
+  tracking.ColorTracker.registerColor('cyan', function(r, g, b) {
+    var thresholdGreen = 50,
+      thresholdBlue = 70,
+      dx = r - 0,
+      dy = g - 255,
+      dz = b - 255;
+
+    if ((g - r) >= thresholdGreen && (b - r) >= thresholdBlue) {
+      return true;
+    }
+    return dx * dx + dy * dy + dz * dz < 6400;
+  });
+
+  tracking.ColorTracker.registerColor('magenta', function(r, g, b) {
+    var threshold = 50,
+      dx = r - 255,
+      dy = g - 0,
+      dz = b - 255;
+
+    if ((r - g) >= threshold && (b - g) >= threshold) {
+      return true;
+    }
+    return dx * dx + dy * dy + dz * dz < 19600;
+  });
+
+  tracking.ColorTracker.registerColor('yellow', function(r, g, b) {
+    var threshold = 50,
+      dx = r - 255,
+      dy = g - 255,
+      dz = b - 0;
+
+    if ((r - b) >= threshold && (g - b) >= threshold) {
+      return true;
+    }
+    return dx * dx + dy * dy + dz * dz < 10000;
+  });
+
+
+  // Caching neighbour i/j offset values.
+  //=====================================
+  var neighboursI = new Int32Array([-1, -1, 0, 1, 1, 1, 0, -1]);
+  var neighboursJ = new Int32Array([0, 1, 1, 1, 0, -1, -1, -1]);
+}());
+
+(function() {
+  /**
+   * ObjectTracker utility.
+   * @constructor
+   * @param {string|Array.<string|Array.<number>>} opt_classifiers Optional
+   *     object classifiers to track.
+   * @extends {tracking.Tracker}
+   */
+  tracking.ObjectTracker = function(opt_classifiers) {
+    tracking.ObjectTracker.base(this, 'constructor');
+
+    if (opt_classifiers) {
+      if (!Array.isArray(opt_classifiers)) {
+        opt_classifiers = [opt_classifiers];
+      }
+
+      if (Array.isArray(opt_classifiers)) {
+        opt_classifiers.forEach(function(classifier, i) {
+          if (typeof classifier === 'string') {
+            opt_classifiers[i] = tracking.ViolaJones.classifiers[classifier];
+          }
+          if (!opt_classifiers[i]) {
+            throw new Error('Object classifier not valid, try `new tracking.ObjectTracker("face")`.');
+          }
+        });
+      }
+    }
+
+    this.setClassifiers(opt_classifiers);
+  };
+
+  tracking.inherits(tracking.ObjectTracker, tracking.Tracker);
+
+  /**
+   * Specifies the edges density of a block in order to decide whether to skip
+   * it or not.
+   * @default 0.2
+   * @type {number}
+   */
+  tracking.ObjectTracker.prototype.edgesDensity = 0.2;
+
+  /**
+   * Specifies the initial scale to start the feature block scaling.
+   * @default 1.0
+   * @type {number}
+   */
+  tracking.ObjectTracker.prototype.initialScale = 1.0;
+
+  /**
+   * Specifies the scale factor to scale the feature block.
+   * @default 1.25
+   * @type {number}
+   */
+  tracking.ObjectTracker.prototype.scaleFactor = 1.25;
+
+  /**
+   * Specifies the block step size.
+   * @default 1.5
+   * @type {number}
+   */
+  tracking.ObjectTracker.prototype.stepSize = 1.5;
+
+  /**
+   * Gets the tracker HAAR classifiers.
+   * @return {TypedArray.<number>}
+   */
+  tracking.ObjectTracker.prototype.getClassifiers = function() {
+    return this.classifiers;
+  };
+
+  /**
+   * Gets the edges density value.
+   * @return {number}
+   */
+  tracking.ObjectTracker.prototype.getEdgesDensity = function() {
+    return this.edgesDensity;
+  };
+
+  /**
+   * Gets the initial scale to start the feature block scaling.
+   * @return {number}
+   */
+  tracking.ObjectTracker.prototype.getInitialScale = function() {
+    return this.initialScale;
+  };
+
+  /**
+   * Gets the scale factor to scale the feature block.
+   * @return {number}
+   */
+  tracking.ObjectTracker.prototype.getScaleFactor = function() {
+    return this.scaleFactor;
+  };
+
+  /**
+   * Gets the block step size.
+   * @return {number}
+   */
+  tracking.ObjectTracker.prototype.getStepSize = function() {
+    return this.stepSize;
+  };
+
+  /**
+   * Tracks the `Video` frames. This method is called for each video frame in
+   * order to emit `track` event.
+   * @param {Uint8ClampedArray} pixels The pixels data to track.
+   * @param {number} width The pixels canvas width.
+   * @param {number} height The pixels canvas height.
+   */
+  tracking.ObjectTracker.prototype.track = function(pixels, width, height) {
+    var self = this;
+    var classifiers = this.getClassifiers();
+
+    if (!classifiers) {
+      throw new Error('Object classifier not specified, try `new tracking.ObjectTracker("face")`.');
+    }
+
+    var results = [];
+
+    classifiers.forEach(function(classifier) {
+      results = results.concat(tracking.ViolaJones.detect(pixels, width, height, self.getInitialScale(), self.getScaleFactor(), self.getStepSize(), self.getEdgesDensity(), classifier));
+    });
+
+    this.emit('track', {
+      data: results
+    });
+  };
+
+  /**
+   * Sets the tracker HAAR classifiers.
+   * @param {TypedArray.<number>} classifiers
+   */
+  tracking.ObjectTracker.prototype.setClassifiers = function(classifiers) {
+    this.classifiers = classifiers;
+  };
+
+  /**
+   * Sets the edges density.
+   * @param {number} edgesDensity
+   */
+  tracking.ObjectTracker.prototype.setEdgesDensity = function(edgesDensity) {
+    this.edgesDensity = edgesDensity;
+  };
+
+  /**
+   * Sets the initial scale to start the block scaling.
+   * @param {number} initialScale
+   */
+  tracking.ObjectTracker.prototype.setInitialScale = function(initialScale) {
+    this.initialScale = initialScale;
+  };
+
+  /**
+   * Sets the scale factor to scale the feature block.
+   * @param {number} scaleFactor
+   */
+  tracking.ObjectTracker.prototype.setScaleFactor = function(scaleFactor) {
+    this.scaleFactor = scaleFactor;
+  };
+
+  /**
+   * Sets the block step size.
+   * @param {number} stepSize
+   */
+  tracking.ObjectTracker.prototype.setStepSize = function(stepSize) {
+    this.stepSize = stepSize;
+  };
+
+}());
+
+(function() {
+
+
+  tracking.LandmarksTracker = function() {
+    tracking.LandmarksTracker.base(this, 'constructor');
+  }
+
+  tracking.inherits(tracking.LandmarksTracker, tracking.ObjectTracker);
+
+  tracking.LandmarksTracker.prototype.track = function(pixels, width, height) {
+	 
+    var image = {
+      'data': pixels,
+      'width': width,
+      'height': height
+    };
+
+    var classifier = tracking.ViolaJones.classifiers['face'];
+
+    var faces = tracking.ViolaJones.detect(pixels, width, height, 
+      this.getInitialScale(), this.getScaleFactor(), this.getStepSize(), 
+      this.getEdgesDensity(), classifier);
+
+    var landmarks = tracking.LBF.align(pixels, width, height, faces);
+
+    this.emit('track', {
+      'data': {
+        'faces' : faces,
+        'landmarks' : landmarks
+      }
+    });
+
+  }
+
+}());
+
+(function() {
+
+  tracking.LBF = {};
+
+  /**
+   * LBF Regressor utility.
+   * @constructor
+   */
+  tracking.LBF.Regressor = function(maxNumStages){
+    this.maxNumStages = maxNumStages;
+
+    this.rfs = new Array(maxNumStages);
+    this.models = new Array(maxNumStages);
+    for(var i=0; i < maxNumStages; i++){
+      this.rfs[i] = new tracking.LBF.RandomForest(i);
+      this.models[i] = tracking.LBF.RegressorData[i].models;
+    }
+
+    this.meanShape = tracking.LBF.LandmarksData;
+  }
+
+  /**
+   * Predicts the position of the landmarks based on the bounding box of the face.
+   * @param {pixels} pixels The grayscale pixels in a linear array.
+   * @param {number} width Width of the image.
+   * @param {number} height Height of the image.
+   * @param {object} boudingBox Bounding box of the face to be aligned.
+   * @return {matrix} A matrix with each landmark position in a row [x,y].
+   */
+  tracking.LBF.Regressor.prototype.predict = function(pixels, width, height, boundingBox) {
+
+    var images = [];
+    var currentShapes = [];
+    var boundingBoxes = [];
+
+    var meanShapeClone = tracking.Matrix.clone(this.meanShape);
+
+    images.push({
+      'data': pixels,
+      'width': width,
+      'height': height
+    });
+    boundingBoxes.push(boundingBox);
+
+    currentShapes.push(tracking.LBF.projectShapeToBoundingBox_(meanShapeClone, boundingBox));
+
+    for(var stage = 0; stage < this.maxNumStages; stage++){
+      var binaryFeatures = tracking.LBF.Regressor.deriveBinaryFeat(this.rfs[stage], images, currentShapes, boundingBoxes, meanShapeClone);
+      this.applyGlobalPrediction(binaryFeatures, this.models[stage], currentShapes, boundingBoxes);
+    }
+
+    return currentShapes[0];
+  };
+
+  /**
+   * Multiplies the binary features of the landmarks with the regression matrix
+   * to obtain the displacement for each landmark. Then applies this displacement
+   * into the landmarks shape.
+   * @param {object} binaryFeatures The binary features for the landmarks.
+   * @param {object} models The regressor models.
+   * @param {matrix} currentShapes The landmarks shapes.
+   * @param {array} boudingBoxes The bounding boxes of the faces.
+   */
+  tracking.LBF.Regressor.prototype.applyGlobalPrediction = function(binaryFeatures, models, currentShapes, 
+    boundingBoxes){
+
+    var residual = currentShapes[0].length * 2;
+
+    var rotation = [];
+    var deltashape = new Array(residual/2);
+    for(var i=0; i < residual/2; i++){
+      deltashape[i] = [0.0, 0.0];
+    }
+
+    for(var i=0; i < currentShapes.length; i++){
+      for(var j=0; j < residual; j++){
+        var tmp = 0;
+        for(var lx=0, idx=0; (idx = binaryFeatures[i][lx].index) != -1; lx++){
+          if(idx <= models[j].nr_feature){
+            tmp += models[j].data[(idx - 1)] * binaryFeatures[i][lx].value;
+          }
+        }
+        if(j < residual/2){
+          deltashape[j][0] = tmp;
+        }else{
+          deltashape[j - residual/2][1] = tmp;
+        }
+      }
+
+      var res = tracking.LBF.similarityTransform_(tracking.LBF.unprojectShapeToBoundingBox_(currentShapes[i], boundingBoxes[i]), this.meanShape);
+      var rotation = tracking.Matrix.transpose(res[0]);
+
+      var s = tracking.LBF.unprojectShapeToBoundingBox_(currentShapes[i], boundingBoxes[i]);
+      s = tracking.Matrix.add(s, deltashape);
+
+      currentShapes[i] = tracking.LBF.projectShapeToBoundingBox_(s, boundingBoxes[i]);
+
+    }
+  };
+
+  /**
+   * Derives the binary features from the image for each landmark. 
+   * @param {object} forest The random forest to search for the best binary feature match.
+   * @param {array} images The images with pixels in a grayscale linear array.
+   * @param {array} currentShapes The current landmarks shape.
+   * @param {array} boudingBoxes The bounding boxes of the faces.
+   * @param {matrix} meanShape The mean shape of the current landmarks set.
+   * @return {array} The binary features extracted from the image and matched with the
+   *     training data.
+   * @static
+   */
+  tracking.LBF.Regressor.deriveBinaryFeat = function(forest, images, currentShapes, boundingBoxes, meanShape){
+
+    var binaryFeatures = new Array(images.length);
+    for(var i=0; i < images.length; i++){
+      var t = forest.maxNumTrees * forest.landmarkNum + 1;
+      binaryFeatures[i] = new Array(t);
+      for(var j=0; j < t; j++){
+        binaryFeatures[i][j] = {};
+      }
+    }
+
+    var leafnodesPerTree = 1 << (forest.maxDepth - 1);
+
+    for(var i=0; i < images.length; i++){
+
+      var projectedShape = tracking.LBF.unprojectShapeToBoundingBox_(currentShapes[i], boundingBoxes[i]);
+      var transform = tracking.LBF.similarityTransform_(projectedShape, meanShape);
+      
+      for(var j=0; j < forest.landmarkNum; j++){
+        for(var k=0; k < forest.maxNumTrees; k++){
+
+          var binaryCode = tracking.LBF.Regressor.getCodeFromTree(forest.rfs[j][k], images[i], 
+                              currentShapes[i], boundingBoxes[i], transform[0], transform[1]);
+
+          var index = j*forest.maxNumTrees + k;
+          binaryFeatures[i][index].index = leafnodesPerTree * index + binaryCode;
+          binaryFeatures[i][index].value = 1;
+
+        }
+      }
+      binaryFeatures[i][forest.landmarkNum * forest.maxNumTrees].index = -1;
+      binaryFeatures[i][forest.landmarkNum * forest.maxNumTrees].value = -1;
+    }
+    return binaryFeatures;
+
+  }
+
+  /**
+   * Gets the binary code for a specific tree in a random forest. For each landmark,
+   * the position from two pre-defined points are recovered from the training data
+   * and then the intensity of the pixels corresponding to these points is extracted 
+   * from the image and used to traverse the trees in the random forest. At the end,
+   * the ending nodes will be represented by 1, and the remaining nodes by 0.
+   * 
+   * +--------------------------- Random Forest -----------------------------+ 
+   * | Ø = Ending leaf                                                       |
+   * |                                                                       |
+   * |       O             O             O             O             O       |
+   * |     /   \         /   \         /   \         /   \         /   \     |
+   * |    O     O       O     O       O     O       O     O       O     O    |
+   * |   / \   / \     / \   / \     / \   / \     / \   / \     / \   / \   |
+   * |  Ø   O O   O   O   O Ø   O   O   Ø O   O   O   O Ø   O   O   O O   Ø  |
+   * |  1   0 0   0   0   0 1   0   0   1 0   0   0   0 1   0   0   0 0   1  |
+   * +-----------------------------------------------------------------------+
+   * Final binary code for this landmark: 10000010010000100001
+   *
+   * @param {object} forest The tree to be analyzed.
+   * @param {array} image The image with pixels in a grayscale linear array.
+   * @param {matrix} shape The current landmarks shape.
+   * @param {object} boudingBoxes The bounding box of the face.
+   * @param {matrix} rotation The rotation matrix used to transform the projected landmarks
+   *     into the mean shape.
+   * @param {number} scale The scale factor used to transform the projected landmarks
+   *     into the mean shape.
+   * @return {number} The binary code extracted from the tree.
+   * @static
+   */
+  tracking.LBF.Regressor.getCodeFromTree = function(tree, image, shape, boundingBox, rotation, scale){
+    var current = 0;
+    var bincode = 0;
+
+    while(true){
+      
+      var x1 = Math.cos(tree.nodes[current].feats[0]) * tree.nodes[current].feats[2] * tree.maxRadioRadius * boundingBox.width;
+      var y1 = Math.sin(tree.nodes[current].feats[0]) * tree.nodes[current].feats[2] * tree.maxRadioRadius * boundingBox.height;
+      var x2 = Math.cos(tree.nodes[current].feats[1]) * tree.nodes[current].feats[3] * tree.maxRadioRadius * boundingBox.width;
+      var y2 = Math.sin(tree.nodes[current].feats[1]) * tree.nodes[current].feats[3] * tree.maxRadioRadius * boundingBox.height;
+
+      var project_x1 = rotation[0][0] * x1 + rotation[0][1] * y1;
+      var project_y1 = rotation[1][0] * x1 + rotation[1][1] * y1;
+
+      var real_x1 = Math.floor(project_x1 + shape[tree.landmarkID][0]);
+      var real_y1 = Math.floor(project_y1 + shape[tree.landmarkID][1]);
+      real_x1 = Math.max(0.0, Math.min(real_x1, image.height - 1.0));
+      real_y1 = Math.max(0.0, Math.min(real_y1, image.width - 1.0));
+
+      var project_x2 = rotation[0][0] * x2 + rotation[0][1] * y2;
+      var project_y2 = rotation[1][0] * x2 + rotation[1][1] * y2;
+
+      var real_x2 = Math.floor(project_x2 + shape[tree.landmarkID][0]);
+      var real_y2 = Math.floor(project_y2 + shape[tree.landmarkID][1]);
+      real_x2 = Math.max(0.0, Math.min(real_x2, image.height - 1.0));
+      real_y2 = Math.max(0.0, Math.min(real_y2, image.width - 1.0));
+      var pdf = Math.floor(image.data[real_y1*image.width + real_x1]) - 
+          Math.floor(image.data[real_y2 * image.width +real_x2]);
+
+      if(pdf < tree.nodes[current].thresh){
+        current = tree.nodes[current].cnodes[0];
+      }else{
+        current = tree.nodes[current].cnodes[1];
+      }
+
+      if (tree.nodes[current].is_leafnode == 1) {
+        bincode = 1;
+        for (var i=0; i < tree.leafnodes.length; i++) {
+          if (tree.leafnodes[i] == current) {
+            return bincode;
+          }
+          bincode++;
+        }
+        return bincode;
+      }
+
+    }
+
+    return bincode;
+  }
+
+}());
+(function() {
+  /**
+   * Face Alignment via Regressing Local Binary Features (LBF)
+   * This approach has two components: a set of local binary features and
+   * a locality principle for learning those features.
+   * The locality principle is used to guide the learning of a set of highly
+   * discriminative local binary features for each landmark independently.
+   * The obtained local binary features are used to learn a linear regression
+   * that later will be used to guide the landmarks in the alignment phase.
+   * 
+   * @authors: VoxarLabs Team (http://cin.ufpe.br/~voxarlabs)
+   *           Lucas Figueiredo <lsf@cin.ufpe.br>, Thiago Menezes <tmc2@cin.ufpe.br>,
+   *           Thiago Domingues <tald@cin.ufpe.br>, Rafael Roberto <rar3@cin.ufpe.br>,
+   *           Thulio Araujo <tlsa@cin.ufpe.br>, Joao Victor <jvfl@cin.ufpe.br>,
+   *           Tomer Simis <tls@cin.ufpe.br>)
+   */
+  
+  /**
+   * Holds the maximum number of stages that will be used in the alignment algorithm.
+   * Each stage contains a different set of random forests and retrieves the binary
+   * code from a more "specialized" (i.e. smaller) region around the landmarks.
+   * @type {number}
+   * @static
+   */
+  tracking.LBF.maxNumStages = 4;
+
+  /**
+   * Holds the regressor that will be responsible for extracting the local features from 
+   * the image and guide the landmarks using the training data.
+   * @type {object}
+   * @protected
+   * @static
+   */
+  tracking.LBF.regressor_ = null; 
+  
+  /**
+   * Generates a set of landmarks for a set of faces
+   * @param {pixels} pixels The pixels in a linear [r,g,b,a,...] array.
+   * @param {number} width The image width.
+   * @param {number} height The image height.
+   * @param {array} faces The list of faces detected in the image
+   * @return {array} The aligned landmarks, each set of landmarks corresponding
+   *     to a specific face.
+   * @static
+   */
+  tracking.LBF.align = function(pixels, width, height, faces){
+
+    if(tracking.LBF.regressor_ == null){
+      tracking.LBF.regressor_ = new tracking.LBF.Regressor(
+        tracking.LBF.maxNumStages
+      );
+    }
+
+    pixels = tracking.Image.grayscale(pixels, width, height, false);
+
+    pixels = tracking.Image.equalizeHist(pixels, width, height);
+
+    var shapes = new Array(faces.length);
+
+    for(var i in faces){
+
+      faces[i].height = faces[i].width;
+
+      var boundingBox = {};
+      boundingBox.startX = faces[i].x;
+      boundingBox.startY = faces[i].y;
+      boundingBox.width = faces[i].width;
+      boundingBox.height = faces[i].height;
+
+      shapes[i] = tracking.LBF.regressor_.predict(pixels, width, height, boundingBox);
+    }
+
+    return shapes;
+  }
+
+  /**
+   * Unprojects the landmarks shape from the bounding box.
+   * @param {matrix} shape The landmarks shape.
+   * @param {matrix} boudingBox The bounding box.
+   * @return {matrix} The landmarks shape projected into the bounding box.
+   * @static
+   * @protected
+   */
+  tracking.LBF.unprojectShapeToBoundingBox_ = function(shape, boundingBox){
+    var temp = new Array(shape.length);
+    for(var i=0; i < shape.length; i++){
+      temp[i] = [
+        (shape[i][0] - boundingBox.startX) / boundingBox.width,
+        (shape[i][1] - boundingBox.startY) / boundingBox.height
+      ];
+    }
+    return temp;
+  }
+
+  /**
+   * Projects the landmarks shape into the bounding box. The landmarks shape has
+   * normalized coordinates, so it is necessary to map these coordinates into
+   * the bounding box coordinates.
+   * @param {matrix} shape The landmarks shape.
+   * @param {matrix} boudingBox The bounding box.
+   * @return {matrix} The landmarks shape.
+   * @static
+   * @protected
+   */
+  tracking.LBF.projectShapeToBoundingBox_ = function(shape, boundingBox){
+    var temp = new Array(shape.length);
+    for(var i=0; i < shape.length; i++){
+      temp[i] = [
+        shape[i][0] * boundingBox.width + boundingBox.startX,
+        shape[i][1] * boundingBox.height + boundingBox.startY
+      ];
+    }
+    return temp;
+  }
+
+  /**
+   * Calculates the rotation and scale necessary to transform shape1 into shape2.
+   * @param {matrix} shape1 The shape to be transformed.
+   * @param {matrix} shape2 The shape to be transformed in.
+   * @return {[matrix, scalar]} The rotation matrix and scale that applied to shape1
+   *     results in shape2.
+   * @static
+   * @protected
+   */
+  tracking.LBF.similarityTransform_ = function(shape1, shape2){
+
+    var center1 = [0,0];
+    var center2 = [0,0];
+    for (var i = 0; i < shape1.length; i++) {
+      center1[0] += shape1[i][0];
+      center1[1] += shape1[i][1];
+      center2[0] += shape2[i][0];
+      center2[1] += shape2[i][1];
+    }
+    center1[0] /= shape1.length;
+    center1[1] /= shape1.length;
+    center2[0] /= shape2.length;
+    center2[1] /= shape2.length;
+
+    var temp1 = tracking.Matrix.clone(shape1);
+    var temp2 = tracking.Matrix.clone(shape2);
+    for(var i=0; i < shape1.length; i++){
+      temp1[i][0] -= center1[0];
+      temp1[i][1] -= center1[1];
+      temp2[i][0] -= center2[0];
+      temp2[i][1] -= center2[1];
+    }
+
+    var covariance1, covariance2;
+    var mean1, mean2;
+
+    var t = tracking.Matrix.calcCovarMatrix(temp1);
+    covariance1 = t[0];
+    mean1 = t[1];
+
+    t = tracking.Matrix.calcCovarMatrix(temp2);
+    covariance2 = t[0];
+    mean2 = t[1];
+
+    var s1 = Math.sqrt(tracking.Matrix.norm(covariance1));
+    var s2 = Math.sqrt(tracking.Matrix.norm(covariance2));
+
+    var scale = s1/s2;
+    temp1 = tracking.Matrix.mulScalar(1.0/s1, temp1);
+    temp2 = tracking.Matrix.mulScalar(1.0/s2, temp2);
+
+    var num = 0, den = 0;
+    for (var i = 0; i < shape1.length; i++) {
+      num = num + temp1[i][1] * temp2[i][0] - temp1[i][0] * temp2[i][1];
+      den = den + temp1[i][0] * temp2[i][0] + temp1[i][1] * temp2[i][1];
+    }
+
+    var norm = Math.sqrt(num*num + den*den);
+    var sin_theta = num/norm;
+    var cos_theta = den/norm;
+    var rotation = [
+      [cos_theta, -sin_theta],
+      [sin_theta, cos_theta]
+    ];
+
+    return [rotation, scale];
+  }
+
+  /**
+   * LBF Random Forest data structure.
+   * @static
+   * @constructor
+   */
+  tracking.LBF.RandomForest = function(forestIndex){
+    this.maxNumTrees = tracking.LBF.RegressorData[forestIndex].max_numtrees;
+    this.landmarkNum = tracking.LBF.RegressorData[forestIndex].num_landmark;
+    this.maxDepth = tracking.LBF.RegressorData[forestIndex].max_depth;
+    this.stages = tracking.LBF.RegressorData[forestIndex].stages; 
+
+    this.rfs = new Array(this.landmarkNum);
+    for(var i=0; i < this.landmarkNum; i++){
+      this.rfs[i] = new Array(this.maxNumTrees);
+      for(var j=0; j < this.maxNumTrees; j++){
+        this.rfs[i][j] = new tracking.LBF.Tree(forestIndex, i, j);
+      }
+    }
+  }
+
+  /**
+   * LBF Tree data structure.
+   * @static
+   * @constructor
+   */
+  tracking.LBF.Tree = function(forestIndex, landmarkIndex, treeIndex){
+    var data = tracking.LBF.RegressorData[forestIndex].landmarks[landmarkIndex][treeIndex];
+    this.maxDepth = data.max_depth;
+    this.maxNumNodes = data.max_numnodes;
+    this.nodes = data.nodes;
+    this.landmarkID = data.landmark_id;
+    this.numLeafnodes = data.num_leafnodes;
+    this.numNodes = data.num_nodes;
+    this.maxNumFeats = data.max_numfeats;
+    this.maxRadioRadius = data.max_radio_radius;
+    this.leafnodes = data.id_leafnodes;
+  }
+
+}());

+ 18 - 32
src/components/test.vue

@@ -4,22 +4,8 @@
     <!-- <p>{{FaceisDetected}}</p> -->
     <div class="content-cam">
       <div class="camera-wrp sec">
-        <video
-          width="320"
-          height="320"
-          ref="videoDom"
-          id="video_cam"
-          preload
-          autoplay
-          loop
-          muted
-        ></video>
-        <canvas
-          width="320"
-          height="320"
-          ref="canvasDOM"
-          id="face_detect"
-        ></canvas>
+        <video width="320" height="320" ref="videoDom" id="video_cam" preload autoplay loop muted></video>
+        <canvas width="320" height="320" ref="canvasDOM" id="face_detect"></canvas>
         <div class="control-btn"></div>
       </div>
       <div class="images-wrp sec">
@@ -57,32 +43,32 @@ export default {
           width: {
             min: 320,
             ideal: 1280,
-            max: 1920,
+            max: 1920
           },
           height: {
             min: 240,
             ideal: 720,
-            max: 1080,
+            max: 1080
           },
           // frameRate受限带宽传输时,低帧率可能更适宜
           frameRate: {
             min: 15,
             ideal: 30,
-            max: 60,
+            max: 60
           },
           // 摄像头翻转
-          facingMode: "user",
-        },
-      },
+          facingMode: "user"
+        }
+      }
     };
   },
   created() {
-    // this.changeView();
+    this.changeView();
   },
   computed: {
     FaceisDetected() {
       return this.isdetected;
-    },
+    }
   },
   mounted() {
     // The getUserMedia interface is used for handling camera input.
@@ -131,10 +117,10 @@ export default {
       tracker.setStepSize(2);
       tracker.setEdgesDensity(0.1);
       window.tracking.track("#video_cam", tracker, { camera: true });
-      tracker.on("track", function (event) {
+      tracker.on("track", function(event) {
         const { autoCaptureTrackTraking } = context;
         canvasContext.clearRect(0, 0, canvas.width, canvas.height);
-        event.data.forEach(function ({ x, y, width, height }) {
+        event.data.forEach(function({ x, y, width, height }) {
           canvasContext.strokeStyle = "#a64ceb";
           canvasContext.strokeRect(x, y, width, height);
           canvasContext.font = "11px Helvetica";
@@ -207,13 +193,13 @@ export default {
       tracker.setStepSize(1.7);
       tracking.track(image, tracker);
 
-      tracker.on("track", function (event) {
-        event.data.forEach(function (rect) {
+      tracker.on("track", function(event) {
+        event.data.forEach(function(rect) {
           window.plot(rect.x, rect.y, rect.width, rect.height);
         });
       });
 
-      window.plot = function (x, y, w, h) {
+      window.plot = function(x, y, w, h) {
         const rect = document.createElement("div");
         document.querySelector(`.img-item-${index}`).appendChild(rect);
         rect.classList.add("rect");
@@ -242,9 +228,9 @@ export default {
       if (typeof window.stream === "object") {
         this.videoEl.srcObject = null;
         //this.$store.commit('setVideoCanvasObject', '')
-        window.stream.getTracks().forEach((track) => track.stop());
+        window.stream.getTracks().forEach(track => track.stop());
       }
-    },
-  },
+    }
+  }
 };
 </script>

La diferencia del archivo ha sido suprimido porque es demasiado grande
+ 7 - 0
static/face-min.js


La diferencia del archivo ha sido suprimido porque es demasiado grande
+ 7 - 0
static/tracking-min.js


+ 3111 - 0
static/tracking.js

@@ -0,0 +1,3111 @@
+/**
+ * tracking - A modern approach for Computer Vision on the web.
+ * @author Eduardo Lundgren <edu@rdo.io>
+ * @version v1.1.3
+ * @link http://trackingjs.com
+ * @license BSD
+ */
+(function(window, undefined) {
+  window.tracking = window.tracking || {};
+
+  /**
+   * Inherit the prototype methods from one constructor into another.
+   *
+   * Usage:
+   * <pre>
+   * function ParentClass(a, b) { }
+   * ParentClass.prototype.foo = function(a) { }
+   *
+   * function ChildClass(a, b, c) {
+   *   tracking.base(this, a, b);
+   * }
+   * tracking.inherits(ChildClass, ParentClass);
+   *
+   * var child = new ChildClass('a', 'b', 'c');
+   * child.foo();
+   * </pre>
+   *
+   * @param {Function} childCtor Child class.
+   * @param {Function} parentCtor Parent class.
+   */
+  tracking.inherits = function(childCtor, parentCtor) {
+    function TempCtor() {
+    }
+    TempCtor.prototype = parentCtor.prototype;
+    childCtor.superClass_ = parentCtor.prototype;
+    childCtor.prototype = new TempCtor();
+    childCtor.prototype.constructor = childCtor;
+
+    /**
+     * Calls superclass constructor/method.
+     *
+     * This function is only available if you use tracking.inherits to express
+     * inheritance relationships between classes.
+     *
+     * @param {!object} me Should always be "this".
+     * @param {string} methodName The method name to call. Calling superclass
+     *     constructor can be done with the special string 'constructor'.
+     * @param {...*} var_args The arguments to pass to superclass
+     *     method/constructor.
+     * @return {*} The return value of the superclass method/constructor.
+     */
+    childCtor.base = function(me, methodName) {
+      var args = Array.prototype.slice.call(arguments, 2);
+      return parentCtor.prototype[methodName].apply(me, args);
+    };
+  };
+
+  /**
+   * Captures the user camera when tracking a video element and set its source
+   * to the camera stream.
+   * @param {HTMLVideoElement} element Canvas element to track.
+   * @param {object} opt_options Optional configuration to the tracker.
+   */
+  tracking.initUserMedia_ = function(element, opt_options) {
+    window.navigator.mediaDevices.getUserMedia({
+      video: true,
+      audio: (opt_options && opt_options.audio) ? true : false,
+    }).then(function(stream) {
+      element.srcObject = stream;
+    }).catch(function(err) {
+      throw Error('Cannot capture user camera.');
+    });
+  };
+
+  /**
+   * Tests whether the object is a dom node.
+   * @param {object} o Object to be tested.
+   * @return {boolean} True if the object is a dom node.
+   */
+  tracking.isNode = function(o) {
+    return o.nodeType || this.isWindow(o);
+  };
+
+  /**
+   * Tests whether the object is the `window` object.
+   * @param {object} o Object to be tested.
+   * @return {boolean} True if the object is the `window` object.
+   */
+  tracking.isWindow = function(o) {
+    return !!(o && o.alert && o.document);
+  };
+
+  /**
+   * Selects a dom node from a CSS3 selector using `document.querySelector`.
+   * @param {string} selector
+   * @param {object} opt_element The root element for the query. When not
+   *     specified `document` is used as root element.
+   * @return {HTMLElement} The first dom element that matches to the selector.
+   *     If not found, returns `null`.
+   */
+  tracking.one = function(selector, opt_element) {
+    if (this.isNode(selector)) {
+      return selector;
+    }
+    return (opt_element || document).querySelector(selector);
+  };
+
+  /**
+   * Tracks a canvas, image or video element based on the specified `tracker`
+   * instance. This method extract the pixel information of the input element
+   * to pass to the `tracker` instance. When tracking a video, the
+   * `tracker.track(pixels, width, height)` will be in a
+   * `requestAnimationFrame` loop in order to track all video frames.
+   *
+   * Example:
+   * var tracker = new tracking.ColorTracker();
+   *
+   * tracking.track('#video', tracker);
+   * or
+   * tracking.track('#video', tracker, { camera: true });
+   *
+   * tracker.on('track', function(event) {
+   *   // console.log(event.data[0].x, event.data[0].y)
+   * });
+   *
+   * @param {HTMLElement} element The element to track, canvas, image or
+   *     video.
+   * @param {tracking.Tracker} tracker The tracker instance used to track the
+   *     element.
+   * @param {object} opt_options Optional configuration to the tracker.
+   */
+  tracking.track = function(element, tracker, opt_options) {
+    element = tracking.one(element);
+    if (!element) {
+      throw new Error('Element not found, try a different element or selector.');
+    }
+    if (!tracker) {
+      throw new Error('Tracker not specified, try `tracking.track(element, new tracking.FaceTracker())`.');
+    }
+
+    switch (element.nodeName.toLowerCase()) {
+      case 'canvas':
+        return this.trackCanvas_(element, tracker, opt_options);
+      case 'img':
+        return this.trackImg_(element, tracker, opt_options);
+      case 'video':
+        if (opt_options) {
+          if (opt_options.camera) {
+            this.initUserMedia_(element, opt_options);
+          }
+        }
+        return this.trackVideo_(element, tracker, opt_options);
+      default:
+        throw new Error('Element not supported, try in a canvas, img, or video.');
+    }
+  };
+
+  /**
+   * Tracks a canvas element based on the specified `tracker` instance and
+   * returns a `TrackerTask` for this track.
+   * @param {HTMLCanvasElement} element Canvas element to track.
+   * @param {tracking.Tracker} tracker The tracker instance used to track the
+   *     element.
+   * @param {object} opt_options Optional configuration to the tracker.
+   * @return {tracking.TrackerTask}
+   * @private
+   */
+  tracking.trackCanvas_ = function(element, tracker) {
+    var self = this;
+    var task = new tracking.TrackerTask(tracker);
+    task.on('run', function() {
+      self.trackCanvasInternal_(element, tracker);
+    });
+    return task.run();
+  };
+
+  /**
+   * Tracks a canvas element based on the specified `tracker` instance. This
+   * method extract the pixel information of the input element to pass to the
+   * `tracker` instance.
+   * @param {HTMLCanvasElement} element Canvas element to track.
+   * @param {tracking.Tracker} tracker The tracker instance used to track the
+   *     element.
+   * @param {object} opt_options Optional configuration to the tracker.
+   * @private
+   */
+  tracking.trackCanvasInternal_ = function(element, tracker) {
+    var width = element.width;
+    var height = element.height;
+    var context = element.getContext('2d');
+    var imageData = context.getImageData(0, 0, width, height);
+    tracker.track(imageData.data, width, height);
+  };
+
+  /**
+   * Tracks a image element based on the specified `tracker` instance. This
+   * method extract the pixel information of the input element to pass to the
+   * `tracker` instance.
+   * @param {HTMLImageElement} element Canvas element to track.
+   * @param {tracking.Tracker} tracker The tracker instance used to track the
+   *     element.
+   * @param {object} opt_options Optional configuration to the tracker.
+   * @private
+   */
+  tracking.trackImg_ = function(element, tracker) {
+    var width = element.width;
+    var height = element.height;
+    var canvas = document.createElement('canvas');
+
+    canvas.width = width;
+    canvas.height = height;
+
+    var task = new tracking.TrackerTask(tracker);
+    task.on('run', function() {
+      tracking.Canvas.loadImage(canvas, element.src, 0, 0, width, height, function() {
+        tracking.trackCanvasInternal_(canvas, tracker);
+      });
+    });
+    return task.run();
+  };
+
+  /**
+   * Tracks a video element based on the specified `tracker` instance. This
+   * method extract the pixel information of the input element to pass to the
+   * `tracker` instance. The `tracker.track(pixels, width, height)` will be in
+   * a `requestAnimationFrame` loop in order to track all video frames.
+   * @param {HTMLVideoElement} element Canvas element to track.
+   * @param {tracking.Tracker} tracker The tracker instance used to track the
+   *     element.
+   * @param {object} opt_options Optional configuration to the tracker.
+   * @private
+   */
+  tracking.trackVideo_ = function(element, tracker) {
+    var canvas = document.createElement('canvas');
+    var context = canvas.getContext('2d');
+    var width;
+    var height;
+
+    var resizeCanvas_ = function() {
+      width = element.offsetWidth;
+      height = element.offsetHeight;
+      canvas.width = width;
+      canvas.height = height;
+    };
+    resizeCanvas_();
+    element.addEventListener('resize', resizeCanvas_);
+
+    var requestId;
+    var requestAnimationFrame_ = function() {
+      requestId = window.requestAnimationFrame(function() {
+        if (element.readyState === element.HAVE_ENOUGH_DATA) {
+          try {
+            // Firefox v~30.0 gets confused with the video readyState firing an
+            // erroneous HAVE_ENOUGH_DATA just before HAVE_CURRENT_DATA state,
+            // hence keep trying to read it until resolved.
+            context.drawImage(element, 0, 0, width, height);
+          } catch (err) {}
+          tracking.trackCanvasInternal_(canvas, tracker);
+        }
+        requestAnimationFrame_();
+      });
+    };
+
+    var task = new tracking.TrackerTask(tracker);
+    task.on('stop', function() {
+      window.cancelAnimationFrame(requestId);
+    });
+    task.on('run', function() {
+      requestAnimationFrame_();
+    });
+    return task.run();
+  };
+
+  // Browser polyfills
+  //===================
+
+  if (!window.URL) {
+    window.URL = window.URL || window.webkitURL || window.msURL || window.oURL;
+  }
+
+  if (!navigator.getUserMedia) {
+    navigator.getUserMedia = navigator.getUserMedia || navigator.webkitGetUserMedia ||
+    navigator.mozGetUserMedia || navigator.msGetUserMedia;
+  }
+}(window));
+
+(function() {
+  /**
+   * EventEmitter utility.
+   * @constructor
+   */
+  tracking.EventEmitter = function() {};
+
+  /**
+   * Holds event listeners scoped by event type.
+   * @type {object}
+   * @private
+   */
+  tracking.EventEmitter.prototype.events_ = null;
+
+  /**
+   * Adds a listener to the end of the listeners array for the specified event.
+   * @param {string} event
+   * @param {function} listener
+   * @return {object} Returns emitter, so calls can be chained.
+   */
+  tracking.EventEmitter.prototype.addListener = function(event, listener) {
+    if (typeof listener !== 'function') {
+      throw new TypeError('Listener must be a function');
+    }
+    if (!this.events_) {
+      this.events_ = {};
+    }
+
+    this.emit('newListener', event, listener);
+
+    if (!this.events_[event]) {
+      this.events_[event] = [];
+    }
+
+    this.events_[event].push(listener);
+
+    return this;
+  };
+
+  /**
+   * Returns an array of listeners for the specified event.
+   * @param {string} event
+   * @return {array} Array of listeners.
+   */
+  tracking.EventEmitter.prototype.listeners = function(event) {
+    return this.events_ && this.events_[event];
+  };
+
+  /**
+   * Execute each of the listeners in order with the supplied arguments.
+   * @param {string} event
+   * @param {*} opt_args [arg1], [arg2], [...]
+   * @return {boolean} Returns true if event had listeners, false otherwise.
+   */
+  tracking.EventEmitter.prototype.emit = function(event) {
+    var listeners = this.listeners(event);
+    if (listeners) {
+      var args = Array.prototype.slice.call(arguments, 1);
+      for (var i = 0; i < listeners.length; i++) {
+        if (listeners[i]) {
+          listeners[i].apply(this, args);
+        }
+      }
+      return true;
+    }
+    return false;
+  };
+
+  /**
+   * Adds a listener to the end of the listeners array for the specified event.
+   * @param {string} event
+   * @param {function} listener
+   * @return {object} Returns emitter, so calls can be chained.
+   */
+  tracking.EventEmitter.prototype.on = tracking.EventEmitter.prototype.addListener;
+
+  /**
+   * Adds a one time listener for the event. This listener is invoked only the
+   * next time the event is fired, after which it is removed.
+   * @param {string} event
+   * @param {function} listener
+   * @return {object} Returns emitter, so calls can be chained.
+   */
+  tracking.EventEmitter.prototype.once = function(event, listener) {
+    var self = this;
+    self.on(event, function handlerInternal() {
+      self.removeListener(event, handlerInternal);
+      listener.apply(this, arguments);
+    });
+  };
+
+  /**
+   * Removes all listeners, or those of the specified event. It's not a good
+   * idea to remove listeners that were added elsewhere in the code,
+   * especially when it's on an emitter that you didn't create.
+   * @param {string} event
+   * @return {object} Returns emitter, so calls can be chained.
+   */
+  tracking.EventEmitter.prototype.removeAllListeners = function(opt_event) {
+    if (!this.events_) {
+      return this;
+    }
+    if (opt_event) {
+      delete this.events_[opt_event];
+    } else {
+      delete this.events_;
+    }
+    return this;
+  };
+
+  /**
+   * Remove a listener from the listener array for the specified event.
+   * Caution: changes array indices in the listener array behind the listener.
+   * @param {string} event
+   * @param {function} listener
+   * @return {object} Returns emitter, so calls can be chained.
+   */
+  tracking.EventEmitter.prototype.removeListener = function(event, listener) {
+    if (typeof listener !== 'function') {
+      throw new TypeError('Listener must be a function');
+    }
+    if (!this.events_) {
+      return this;
+    }
+
+    var listeners = this.listeners(event);
+    if (Array.isArray(listeners)) {
+      var i = listeners.indexOf(listener);
+      if (i < 0) {
+        return this;
+      }
+      listeners.splice(i, 1);
+    }
+
+    return this;
+  };
+
+  /**
+   * By default EventEmitters will print a warning if more than 10 listeners
+   * are added for a particular event. This is a useful default which helps
+   * finding memory leaks. Obviously not all Emitters should be limited to 10.
+   * This function allows that to be increased. Set to zero for unlimited.
+   * @param {number} n The maximum number of listeners.
+   */
+  tracking.EventEmitter.prototype.setMaxListeners = function() {
+    throw new Error('Not implemented');
+  };
+
+}());
+
+(function() {
+  /**
+   * Canvas utility.
+   * @static
+   * @constructor
+   */
+  tracking.Canvas = {};
+
+  /**
+   * Loads an image source into the canvas.
+   * @param {HTMLCanvasElement} canvas The canvas dom element.
+   * @param {string} src The image source.
+   * @param {number} x The canvas horizontal coordinate to load the image.
+   * @param {number} y The canvas vertical coordinate to load the image.
+   * @param {number} width The image width.
+   * @param {number} height The image height.
+   * @param {function} opt_callback Callback that fires when the image is loaded
+   *     into the canvas.
+   * @static
+   */
+  tracking.Canvas.loadImage = function(canvas, src, x, y, width, height, opt_callback) {
+    var instance = this;
+    var img = new window.Image();
+    img.crossOrigin = '*';
+    img.onload = function() {
+      var context = canvas.getContext('2d');
+      canvas.width = width;
+      canvas.height = height;
+      context.drawImage(img, x, y, width, height);
+      if (opt_callback) {
+        opt_callback.call(instance);
+      }
+      img = null;
+    };
+    img.src = src;
+  };
+}());
+
+(function() {
+  /**
+   * DisjointSet utility with path compression. Some applications involve
+   * grouping n distinct objects into a collection of disjoint sets. Two
+   * important operations are then finding which set a given object belongs to
+   * and uniting the two sets. A disjoint set data structure maintains a
+   * collection S={ S1 , S2 ,..., Sk } of disjoint dynamic sets. Each set is
+   * identified by a representative, which usually is a member in the set.
+   * @static
+   * @constructor
+   */
+  tracking.DisjointSet = function(length) {
+    if (length === undefined) {
+      throw new Error('DisjointSet length not specified.');
+    }
+    this.length = length;
+    this.parent = new Uint32Array(length);
+    for (var i = 0; i < length; i++) {
+      this.parent[i] = i;
+    }
+  };
+
+  /**
+   * Holds the length of the internal set.
+   * @type {number}
+   */
+  tracking.DisjointSet.prototype.length = null;
+
+  /**
+   * Holds the set containing the representative values.
+   * @type {Array.<number>}
+   */
+  tracking.DisjointSet.prototype.parent = null;
+
+  /**
+   * Finds a pointer to the representative of the set containing i.
+   * @param {number} i
+   * @return {number} The representative set of i.
+   */
+  tracking.DisjointSet.prototype.find = function(i) {
+    if (this.parent[i] === i) {
+      return i;
+    } else {
+      return (this.parent[i] = this.find(this.parent[i]));
+    }
+  };
+
+  /**
+   * Unites two dynamic sets containing objects i and j, say Si and Sj, into
+   * a new set that Si ∪ Sj, assuming that Si ∩ Sj = ∅;
+   * @param {number} i
+   * @param {number} j
+   */
+  tracking.DisjointSet.prototype.union = function(i, j) {
+    var iRepresentative = this.find(i);
+    var jRepresentative = this.find(j);
+    this.parent[iRepresentative] = jRepresentative;
+  };
+
+}());
+
+(function() {
+  /**
+   * Image utility.
+   * @static
+   * @constructor
+   */
+  tracking.Image = {};
+
+  /**
+   * Computes gaussian blur. Adapted from
+   * https://github.com/kig/canvasfilters.
+   * @param {pixels} pixels The pixels in a linear [r,g,b,a,...] array.
+   * @param {number} width The image width.
+   * @param {number} height The image height.
+   * @param {number} diameter Gaussian blur diameter, must be greater than 1.
+   * @return {array} The edge pixels in a linear [r,g,b,a,...] array.
+   */
+  tracking.Image.blur = function(pixels, width, height, diameter) {
+    diameter = Math.abs(diameter);
+    if (diameter <= 1) {
+      throw new Error('Diameter should be greater than 1.');
+    }
+    var radius = diameter / 2;
+    var len = Math.ceil(diameter) + (1 - (Math.ceil(diameter) % 2));
+    var weights = new Float32Array(len);
+    var rho = (radius + 0.5) / 3;
+    var rhoSq = rho * rho;
+    var gaussianFactor = 1 / Math.sqrt(2 * Math.PI * rhoSq);
+    var rhoFactor = -1 / (2 * rho * rho);
+    var wsum = 0;
+    var middle = Math.floor(len / 2);
+    for (var i = 0; i < len; i++) {
+      var x = i - middle;
+      var gx = gaussianFactor * Math.exp(x * x * rhoFactor);
+      weights[i] = gx;
+      wsum += gx;
+    }
+    for (var j = 0; j < weights.length; j++) {
+      weights[j] /= wsum;
+    }
+    return this.separableConvolve(pixels, width, height, weights, weights, false);
+  };
+
+  /**
+   * Computes the integral image for summed, squared, rotated and sobel pixels.
+   * @param {array} pixels The pixels in a linear [r,g,b,a,...] array to loop
+   *     through.
+   * @param {number} width The image width.
+   * @param {number} height The image height.
+   * @param {array} opt_integralImage Empty array of size `width * height` to
+   *     be filled with the integral image values. If not specified compute sum
+   *     values will be skipped.
+   * @param {array} opt_integralImageSquare Empty array of size `width *
+   *     height` to be filled with the integral image squared values. If not
+   *     specified compute squared values will be skipped.
+   * @param {array} opt_tiltedIntegralImage Empty array of size `width *
+   *     height` to be filled with the rotated integral image values. If not
+   *     specified compute sum values will be skipped.
+   * @param {array} opt_integralImageSobel Empty array of size `width *
+   *     height` to be filled with the integral image of sobel values. If not
+   *     specified compute sobel filtering will be skipped.
+   * @static
+   */
+  tracking.Image.computeIntegralImage = function(pixels, width, height, opt_integralImage, opt_integralImageSquare, opt_tiltedIntegralImage, opt_integralImageSobel) {
+    if (arguments.length < 4) {
+      throw new Error('You should specify at least one output array in the order: sum, square, tilted, sobel.');
+    }
+    var pixelsSobel;
+    if (opt_integralImageSobel) {
+      pixelsSobel = tracking.Image.sobel(pixels, width, height);
+    }
+    for (var i = 0; i < height; i++) {
+      for (var j = 0; j < width; j++) {
+        var w = i * width * 4 + j * 4;
+        var pixel = ~~(pixels[w] * 0.299 + pixels[w + 1] * 0.587 + pixels[w + 2] * 0.114);
+        if (opt_integralImage) {
+          this.computePixelValueSAT_(opt_integralImage, width, i, j, pixel);
+        }
+        if (opt_integralImageSquare) {
+          this.computePixelValueSAT_(opt_integralImageSquare, width, i, j, pixel * pixel);
+        }
+        if (opt_tiltedIntegralImage) {
+          var w1 = w - width * 4;
+          var pixelAbove = ~~(pixels[w1] * 0.299 + pixels[w1 + 1] * 0.587 + pixels[w1 + 2] * 0.114);
+          this.computePixelValueRSAT_(opt_tiltedIntegralImage, width, i, j, pixel, pixelAbove || 0);
+        }
+        if (opt_integralImageSobel) {
+          this.computePixelValueSAT_(opt_integralImageSobel, width, i, j, pixelsSobel[w]);
+        }
+      }
+    }
+  };
+
+  /**
+   * Helper method to compute the rotated summed area table (RSAT) by the
+   * formula:
+   *
+   * RSAT(x, y) = RSAT(x-1, y-1) + RSAT(x+1, y-1) - RSAT(x, y-2) + I(x, y) + I(x, y-1)
+   *
+   * @param {number} width The image width.
+   * @param {array} RSAT Empty array of size `width * height` to be filled with
+   *     the integral image values. If not specified compute sum values will be
+   *     skipped.
+   * @param {number} i Vertical position of the pixel to be evaluated.
+   * @param {number} j Horizontal position of the pixel to be evaluated.
+   * @param {number} pixel Pixel value to be added to the integral image.
+   * @static
+   * @private
+   */
+  tracking.Image.computePixelValueRSAT_ = function(RSAT, width, i, j, pixel, pixelAbove) {
+    var w = i * width + j;
+    RSAT[w] = (RSAT[w - width - 1] || 0) + (RSAT[w - width + 1] || 0) - (RSAT[w - width - width] || 0) + pixel + pixelAbove;
+  };
+
+  /**
+   * Helper method to compute the summed area table (SAT) by the formula:
+   *
+   * SAT(x, y) = SAT(x, y-1) + SAT(x-1, y) + I(x, y) - SAT(x-1, y-1)
+   *
+   * @param {number} width The image width.
+   * @param {array} SAT Empty array of size `width * height` to be filled with
+   *     the integral image values. If not specified compute sum values will be
+   *     skipped.
+   * @param {number} i Vertical position of the pixel to be evaluated.
+   * @param {number} j Horizontal position of the pixel to be evaluated.
+   * @param {number} pixel Pixel value to be added to the integral image.
+   * @static
+   * @private
+   */
+  tracking.Image.computePixelValueSAT_ = function(SAT, width, i, j, pixel) {
+    var w = i * width + j;
+    SAT[w] = (SAT[w - width] || 0) + (SAT[w - 1] || 0) + pixel - (SAT[w - width - 1] || 0);
+  };
+
+  /**
+   * Converts a color from a colorspace based on an RGB color model to a
+   * grayscale representation of its luminance. The coefficients represent the
+   * measured intensity perception of typical trichromat humans, in
+   * particular, human vision is most sensitive to green and least sensitive
+   * to blue.
+   * @param {pixels} pixels The pixels in a linear [r,g,b,a,...] array.
+   * @param {number} width The image width.
+   * @param {number} height The image height.
+   * @param {boolean} fillRGBA If the result should fill all RGBA values with the gray scale
+   *  values, instead of returning a single value per pixel.
+   * @param {Uint8ClampedArray} The grayscale pixels in a linear array ([p,p,p,a,...] if fillRGBA
+   *  is true and [p1, p2, p3, ...] if fillRGBA is false).
+   * @static
+   */
+  tracking.Image.grayscale = function(pixels, width, height, fillRGBA) {
+    var gray = new Uint8ClampedArray(fillRGBA ? pixels.length : pixels.length >> 2);
+    var p = 0;
+    var w = 0;
+    for (var i = 0; i < height; i++) {
+      for (var j = 0; j < width; j++) {
+        var value = pixels[w] * 0.299 + pixels[w + 1] * 0.587 + pixels[w + 2] * 0.114;
+        gray[p++] = value;
+
+        if (fillRGBA) {
+          gray[p++] = value;
+          gray[p++] = value;
+          gray[p++] = pixels[w + 3];
+        }
+
+        w += 4;
+      }
+    }
+    return gray;
+  };
+
+  /**
+   * Fast horizontal separable convolution. A point spread function (PSF) is
+   * said to be separable if it can be broken into two one-dimensional
+   * signals: a vertical and a horizontal projection. The convolution is
+   * performed by sliding the kernel over the image, generally starting at the
+   * top left corner, so as to move the kernel through all the positions where
+   * the kernel fits entirely within the boundaries of the image. Adapted from
+   * https://github.com/kig/canvasfilters.
+   * @param {pixels} pixels The pixels in a linear [r,g,b,a,...] array.
+   * @param {number} width The image width.
+   * @param {number} height The image height.
+   * @param {array} weightsVector The weighting vector, e.g [-1,0,1].
+   * @param {number} opaque
+   * @return {array} The convoluted pixels in a linear [r,g,b,a,...] array.
+   */
+  tracking.Image.horizontalConvolve = function(pixels, width, height, weightsVector, opaque) {
+    var side = weightsVector.length;
+    var halfSide = Math.floor(side / 2);
+    var output = new Float32Array(width * height * 4);
+    var alphaFac = opaque ? 1 : 0;
+
+    for (var y = 0; y < height; y++) {
+      for (var x = 0; x < width; x++) {
+        var sy = y;
+        var sx = x;
+        var offset = (y * width + x) * 4;
+        var r = 0;
+        var g = 0;
+        var b = 0;
+        var a = 0;
+        for (var cx = 0; cx < side; cx++) {
+          var scy = sy;
+          var scx = Math.min(width - 1, Math.max(0, sx + cx - halfSide));
+          var poffset = (scy * width + scx) * 4;
+          var wt = weightsVector[cx];
+          r += pixels[poffset] * wt;
+          g += pixels[poffset + 1] * wt;
+          b += pixels[poffset + 2] * wt;
+          a += pixels[poffset + 3] * wt;
+        }
+        output[offset] = r;
+        output[offset + 1] = g;
+        output[offset + 2] = b;
+        output[offset + 3] = a + alphaFac * (255 - a);
+      }
+    }
+    return output;
+  };
+
+  /**
+   * Fast vertical separable convolution. A point spread function (PSF) is
+   * said to be separable if it can be broken into two one-dimensional
+   * signals: a vertical and a horizontal projection. The convolution is
+   * performed by sliding the kernel over the image, generally starting at the
+   * top left corner, so as to move the kernel through all the positions where
+   * the kernel fits entirely within the boundaries of the image. Adapted from
+   * https://github.com/kig/canvasfilters.
+   * @param {pixels} pixels The pixels in a linear [r,g,b,a,...] array.
+   * @param {number} width The image width.
+   * @param {number} height The image height.
+   * @param {array} weightsVector The weighting vector, e.g [-1,0,1].
+   * @param {number} opaque
+   * @return {array} The convoluted pixels in a linear [r,g,b,a,...] array.
+   */
+  tracking.Image.verticalConvolve = function(pixels, width, height, weightsVector, opaque) {
+    var side = weightsVector.length;
+    var halfSide = Math.floor(side / 2);
+    var output = new Float32Array(width * height * 4);
+    var alphaFac = opaque ? 1 : 0;
+
+    for (var y = 0; y < height; y++) {
+      for (var x = 0; x < width; x++) {
+        var sy = y;
+        var sx = x;
+        var offset = (y * width + x) * 4;
+        var r = 0;
+        var g = 0;
+        var b = 0;
+        var a = 0;
+        for (var cy = 0; cy < side; cy++) {
+          var scy = Math.min(height - 1, Math.max(0, sy + cy - halfSide));
+          var scx = sx;
+          var poffset = (scy * width + scx) * 4;
+          var wt = weightsVector[cy];
+          r += pixels[poffset] * wt;
+          g += pixels[poffset + 1] * wt;
+          b += pixels[poffset + 2] * wt;
+          a += pixels[poffset + 3] * wt;
+        }
+        output[offset] = r;
+        output[offset + 1] = g;
+        output[offset + 2] = b;
+        output[offset + 3] = a + alphaFac * (255 - a);
+      }
+    }
+    return output;
+  };
+
+  /**
+   * Fast separable convolution. A point spread function (PSF) is said to be
+   * separable if it can be broken into two one-dimensional signals: a
+   * vertical and a horizontal projection. The convolution is performed by
+   * sliding the kernel over the image, generally starting at the top left
+   * corner, so as to move the kernel through all the positions where the
+   * kernel fits entirely within the boundaries of the image. Adapted from
+   * https://github.com/kig/canvasfilters.
+   * @param {pixels} pixels The pixels in a linear [r,g,b,a,...] array.
+   * @param {number} width The image width.
+   * @param {number} height The image height.
+   * @param {array} horizWeights The horizontal weighting vector, e.g [-1,0,1].
+   * @param {array} vertWeights The vertical vector, e.g [-1,0,1].
+   * @param {number} opaque
+   * @return {array} The convoluted pixels in a linear [r,g,b,a,...] array.
+   */
+  tracking.Image.separableConvolve = function(pixels, width, height, horizWeights, vertWeights, opaque) {
+    var vertical = this.verticalConvolve(pixels, width, height, vertWeights, opaque);
+    return this.horizontalConvolve(vertical, width, height, horizWeights, opaque);
+  };
+
+  /**
+   * Compute image edges using Sobel operator. Computes the vertical and
+   * horizontal gradients of the image and combines the computed images to
+   * find edges in the image. The way we implement the Sobel filter here is by
+   * first grayscaling the image, then taking the horizontal and vertical
+   * gradients and finally combining the gradient images to make up the final
+   * image. Adapted from https://github.com/kig/canvasfilters.
+   * @param {pixels} pixels The pixels in a linear [r,g,b,a,...] array.
+   * @param {number} width The image width.
+   * @param {number} height The image height.
+   * @return {array} The edge pixels in a linear [r,g,b,a,...] array.
+   */
+  tracking.Image.sobel = function(pixels, width, height) {
+    pixels = this.grayscale(pixels, width, height, true);
+    var output = new Float32Array(width * height * 4);
+    var sobelSignVector = new Float32Array([-1, 0, 1]);
+    var sobelScaleVector = new Float32Array([1, 2, 1]);
+    var vertical = this.separableConvolve(pixels, width, height, sobelSignVector, sobelScaleVector);
+    var horizontal = this.separableConvolve(pixels, width, height, sobelScaleVector, sobelSignVector);
+
+    for (var i = 0; i < output.length; i += 4) {
+      var v = vertical[i];
+      var h = horizontal[i];
+      var p = Math.sqrt(h * h + v * v);
+      output[i] = p;
+      output[i + 1] = p;
+      output[i + 2] = p;
+      output[i + 3] = 255;
+    }
+
+    return output;
+  };
+
+  /**
+   * Equalizes the histogram of a grayscale image, normalizing the
+   * brightness and increasing the contrast of the image.
+   * @param {pixels} pixels The grayscale pixels in a linear array.
+   * @param {number} width The image width.
+   * @param {number} height The image height.
+   * @return {array} The equalized grayscale pixels in a linear array.
+   */
+  tracking.Image.equalizeHist = function(pixels, width, height){
+    var equalized = new Uint8ClampedArray(pixels.length);
+
+    var histogram = new Array(256);
+    for(var i=0; i < 256; i++) histogram[i] = 0;
+
+    for(var i=0; i < pixels.length; i++){
+      equalized[i] = pixels[i];
+      histogram[pixels[i]]++;
+    }
+
+    var prev = histogram[0];
+    for(var i=0; i < 256; i++){
+      histogram[i] += prev;
+      prev = histogram[i];
+    }
+
+    var norm = 255 / pixels.length;
+    for(var i=0; i < pixels.length; i++)
+      equalized[i] = (histogram[pixels[i]] * norm + 0.5) | 0;
+
+    return equalized;
+  }
+
+}());
+
+(function() {
+  /**
+   * ViolaJones utility.
+   * @static
+   * @constructor
+   */
+  tracking.ViolaJones = {};
+
+  /**
+   * Holds the minimum area of intersection that defines when a rectangle is
+   * from the same group. Often when a face is matched multiple rectangles are
+   * classified as possible rectangles to represent the face, when they
+   * intersects they are grouped as one face.
+   * @type {number}
+   * @default 0.5
+   * @static
+   */
+  tracking.ViolaJones.REGIONS_OVERLAP = 0.5;
+
+  /**
+   * Holds the HAAR cascade classifiers converted from OpenCV training.
+   * @type {array}
+   * @static
+   */
+  tracking.ViolaJones.classifiers = {};
+
+  /**
+   * Detects through the HAAR cascade data rectangles matches.
+   * @param {pixels} pixels The pixels in a linear [r,g,b,a,...] array.
+   * @param {number} width The image width.
+   * @param {number} height The image height.
+   * @param {number} initialScale The initial scale to start the block
+   *     scaling.
+   * @param {number} scaleFactor The scale factor to scale the feature block.
+   * @param {number} stepSize The block step size.
+   * @param {number} edgesDensity Percentage density edges inside the
+   *     classifier block. Value from [0.0, 1.0], defaults to 0.2. If specified
+   *     edge detection will be applied to the image to prune dead areas of the
+   *     image, this can improve significantly performance.
+   * @param {number} data The HAAR cascade data.
+   * @return {array} Found rectangles.
+   * @static
+   */
+  tracking.ViolaJones.detect = function(pixels, width, height, initialScale, scaleFactor, stepSize, edgesDensity, data) {
+    var total = 0;
+    var rects = [];
+    var integralImage = new Int32Array(width * height);
+    var integralImageSquare = new Int32Array(width * height);
+    var tiltedIntegralImage = new Int32Array(width * height);
+
+    var integralImageSobel;
+    if (edgesDensity > 0) {
+      integralImageSobel = new Int32Array(width * height);
+    }
+
+    tracking.Image.computeIntegralImage(pixels, width, height, integralImage, integralImageSquare, tiltedIntegralImage, integralImageSobel);
+
+    var minWidth = data[0];
+    var minHeight = data[1];
+    var scale = initialScale * scaleFactor;
+    var blockWidth = (scale * minWidth) | 0;
+    var blockHeight = (scale * minHeight) | 0;
+
+    while (blockWidth < width && blockHeight < height) {
+      var step = (scale * stepSize + 0.5) | 0;
+      for (var i = 0; i < (height - blockHeight); i += step) {
+        for (var j = 0; j < (width - blockWidth); j += step) {
+
+          if (edgesDensity > 0) {
+            if (this.isTriviallyExcluded(edgesDensity, integralImageSobel, i, j, width, blockWidth, blockHeight)) {
+              continue;
+            }
+          }
+
+          if (this.evalStages_(data, integralImage, integralImageSquare, tiltedIntegralImage, i, j, width, blockWidth, blockHeight, scale)) {
+            rects[total++] = {
+              width: blockWidth,
+              height: blockHeight,
+              x: j,
+              y: i
+            };
+          }
+        }
+      }
+
+      scale *= scaleFactor;
+      blockWidth = (scale * minWidth) | 0;
+      blockHeight = (scale * minHeight) | 0;
+    }
+    return this.mergeRectangles_(rects);
+  };
+
+  /**
+   * Fast check to test whether the edges density inside the block is greater
+   * than a threshold, if true it tests the stages. This can improve
+   * significantly performance.
+   * @param {number} edgesDensity Percentage density edges inside the
+   *     classifier block.
+   * @param {array} integralImageSobel The integral image of a sobel image.
+   * @param {number} i Vertical position of the pixel to be evaluated.
+   * @param {number} j Horizontal position of the pixel to be evaluated.
+   * @param {number} width The image width.
+   * @return {boolean} True whether the block at position i,j can be skipped,
+   *     false otherwise.
+   * @static
+   * @protected
+   */
+  tracking.ViolaJones.isTriviallyExcluded = function(edgesDensity, integralImageSobel, i, j, width, blockWidth, blockHeight) {
+    var wbA = i * width + j;
+    var wbB = wbA + blockWidth;
+    var wbD = wbA + blockHeight * width;
+    var wbC = wbD + blockWidth;
+    var blockEdgesDensity = (integralImageSobel[wbA] - integralImageSobel[wbB] - integralImageSobel[wbD] + integralImageSobel[wbC]) / (blockWidth * blockHeight * 255);
+    if (blockEdgesDensity < edgesDensity) {
+      return true;
+    }
+    return false;
+  };
+
+  /**
+   * Evaluates if the block size on i,j position is a valid HAAR cascade
+   * stage.
+   * @param {number} data The HAAR cascade data.
+   * @param {number} i Vertical position of the pixel to be evaluated.
+   * @param {number} j Horizontal position of the pixel to be evaluated.
+   * @param {number} width The image width.
+   * @param {number} blockSize The block size.
+   * @param {number} scale The scale factor of the block size and its original
+   *     size.
+   * @param {number} inverseArea The inverse area of the block size.
+   * @return {boolean} Whether the region passes all the stage tests.
+   * @private
+   * @static
+   */
+  tracking.ViolaJones.evalStages_ = function(data, integralImage, integralImageSquare, tiltedIntegralImage, i, j, width, blockWidth, blockHeight, scale) {
+    var inverseArea = 1.0 / (blockWidth * blockHeight);
+    var wbA = i * width + j;
+    var wbB = wbA + blockWidth;
+    var wbD = wbA + blockHeight * width;
+    var wbC = wbD + blockWidth;
+    var mean = (integralImage[wbA] - integralImage[wbB] - integralImage[wbD] + integralImage[wbC]) * inverseArea;
+    var variance = (integralImageSquare[wbA] - integralImageSquare[wbB] - integralImageSquare[wbD] + integralImageSquare[wbC]) * inverseArea - mean * mean;
+
+    var standardDeviation = 1;
+    if (variance > 0) {
+      standardDeviation = Math.sqrt(variance);
+    }
+
+    var length = data.length;
+
+    for (var w = 2; w < length; ) {
+      var stageSum = 0;
+      var stageThreshold = data[w++];
+      var nodeLength = data[w++];
+
+      while (nodeLength--) {
+        var rectsSum = 0;
+        var tilted = data[w++];
+        var rectsLength = data[w++];
+
+        for (var r = 0; r < rectsLength; r++) {
+          var rectLeft = (j + data[w++] * scale + 0.5) | 0;
+          var rectTop = (i + data[w++] * scale + 0.5) | 0;
+          var rectWidth = (data[w++] * scale + 0.5) | 0;
+          var rectHeight = (data[w++] * scale + 0.5) | 0;
+          var rectWeight = data[w++];
+
+          var w1;
+          var w2;
+          var w3;
+          var w4;
+          if (tilted) {
+            // RectSum(r) = RSAT(x-h+w, y+w+h-1) + RSAT(x, y-1) - RSAT(x-h, y+h-1) - RSAT(x+w, y+w-1)
+            w1 = (rectLeft - rectHeight + rectWidth) + (rectTop + rectWidth + rectHeight - 1) * width;
+            w2 = rectLeft + (rectTop - 1) * width;
+            w3 = (rectLeft - rectHeight) + (rectTop + rectHeight - 1) * width;
+            w4 = (rectLeft + rectWidth) + (rectTop + rectWidth - 1) * width;
+            rectsSum += (tiltedIntegralImage[w1] + tiltedIntegralImage[w2] - tiltedIntegralImage[w3] - tiltedIntegralImage[w4]) * rectWeight;
+          } else {
+            // RectSum(r) = SAT(x-1, y-1) + SAT(x+w-1, y+h-1) - SAT(x-1, y+h-1) - SAT(x+w-1, y-1)
+            w1 = rectTop * width + rectLeft;
+            w2 = w1 + rectWidth;
+            w3 = w1 + rectHeight * width;
+            w4 = w3 + rectWidth;
+            rectsSum += (integralImage[w1] - integralImage[w2] - integralImage[w3] + integralImage[w4]) * rectWeight;
+            // TODO: Review the code below to analyze performance when using it instead.
+            // w1 = (rectLeft - 1) + (rectTop - 1) * width;
+            // w2 = (rectLeft + rectWidth - 1) + (rectTop + rectHeight - 1) * width;
+            // w3 = (rectLeft - 1) + (rectTop + rectHeight - 1) * width;
+            // w4 = (rectLeft + rectWidth - 1) + (rectTop - 1) * width;
+            // rectsSum += (integralImage[w1] + integralImage[w2] - integralImage[w3] - integralImage[w4]) * rectWeight;
+          }
+        }
+
+        var nodeThreshold = data[w++];
+        var nodeLeft = data[w++];
+        var nodeRight = data[w++];
+
+        if (rectsSum * inverseArea < nodeThreshold * standardDeviation) {
+          stageSum += nodeLeft;
+        } else {
+          stageSum += nodeRight;
+        }
+      }
+
+      if (stageSum < stageThreshold) {
+        return false;
+      }
+    }
+    return true;
+  };
+
+  /**
+   * Postprocess the detected sub-windows in order to combine overlapping
+   * detections into a single detection.
+   * @param {array} rects
+   * @return {array}
+   * @private
+   * @static
+   */
+  tracking.ViolaJones.mergeRectangles_ = function(rects) {
+    var disjointSet = new tracking.DisjointSet(rects.length);
+
+    for (var i = 0; i < rects.length; i++) {
+      var r1 = rects[i];
+      for (var j = 0; j < rects.length; j++) {
+        var r2 = rects[j];
+        if (tracking.Math.intersectRect(r1.x, r1.y, r1.x + r1.width, r1.y + r1.height, r2.x, r2.y, r2.x + r2.width, r2.y + r2.height)) {
+          var x1 = Math.max(r1.x, r2.x);
+          var y1 = Math.max(r1.y, r2.y);
+          var x2 = Math.min(r1.x + r1.width, r2.x + r2.width);
+          var y2 = Math.min(r1.y + r1.height, r2.y + r2.height);
+          var overlap = (x1 - x2) * (y1 - y2);
+          var area1 = (r1.width * r1.height);
+          var area2 = (r2.width * r2.height);
+
+          if ((overlap / (area1 * (area1 / area2)) >= this.REGIONS_OVERLAP) &&
+            (overlap / (area2 * (area1 / area2)) >= this.REGIONS_OVERLAP)) {
+            disjointSet.union(i, j);
+          }
+        }
+      }
+    }
+
+    var map = {};
+    for (var k = 0; k < disjointSet.length; k++) {
+      var rep = disjointSet.find(k);
+      if (!map[rep]) {
+        map[rep] = {
+          total: 1,
+          width: rects[k].width,
+          height: rects[k].height,
+          x: rects[k].x,
+          y: rects[k].y
+        };
+        continue;
+      }
+      map[rep].total++;
+      map[rep].width += rects[k].width;
+      map[rep].height += rects[k].height;
+      map[rep].x += rects[k].x;
+      map[rep].y += rects[k].y;
+    }
+
+    var result = [];
+    Object.keys(map).forEach(function(key) {
+      var rect = map[key];
+      result.push({
+        total: rect.total,
+        width: (rect.width / rect.total + 0.5) | 0,
+        height: (rect.height / rect.total + 0.5) | 0,
+        x: (rect.x / rect.total + 0.5) | 0,
+        y: (rect.y / rect.total + 0.5) | 0
+      });
+    });
+
+    return result;
+  };
+
+}());
+
+(function() {
+  /**
+   * Brief intends for "Binary Robust Independent Elementary Features".This
+   * method generates a binary string for each keypoint found by an extractor
+   * method.
+   * @static
+   * @constructor
+   */
+  tracking.Brief = {};
+
+  /**
+   * The set of binary tests is defined by the nd (x,y)-location pairs
+   * uniquely chosen during the initialization. Values could vary between N =
+   * 128,256,512. N=128 yield good compromises between speed, storage
+   * efficiency, and recognition rate.
+   * @type {number}
+   */
+  tracking.Brief.N = 512;
+
+  /**
+   * Caches coordinates values of (x,y)-location pairs uniquely chosen during
+   * the initialization.
+   * @type {Object.<number, Int32Array>}
+   * @private
+   * @static
+   */
+  tracking.Brief.randomImageOffsets_ = {};
+
+  /**
+   * Caches delta values of (x,y)-location pairs uniquely chosen during
+   * the initialization.
+   * @type {Int32Array}
+   * @private
+   * @static
+   */
+  tracking.Brief.randomWindowOffsets_ = null;
+
+  /**
+   * Generates a binary string for each found keypoints extracted using an
+   * extractor method.
+   * @param {array} The grayscale pixels in a linear [p1,p2,...] array.
+   * @param {number} width The image width.
+   * @param {array} keypoints
+   * @return {Int32Array} Returns an array where for each four sequence int
+   *     values represent the descriptor binary string (128 bits) necessary
+   *     to describe the corner, e.g. [0,0,0,0, 0,0,0,0, ...].
+   * @static
+   */
+  tracking.Brief.getDescriptors = function(pixels, width, keypoints) {
+    // Optimizing divide by 32 operation using binary shift
+    // (this.N >> 5) === this.N/32.
+    var descriptors = new Int32Array((keypoints.length >> 1) * (this.N >> 5));
+    var descriptorWord = 0;
+    var offsets = this.getRandomOffsets_(width);
+    var position = 0;
+
+    for (var i = 0; i < keypoints.length; i += 2) {
+      var w = width * keypoints[i + 1] + keypoints[i];
+
+      var offsetsPosition = 0;
+      for (var j = 0, n = this.N; j < n; j++) {
+        if (pixels[offsets[offsetsPosition++] + w] < pixels[offsets[offsetsPosition++] + w]) {
+          // The bit in the position `j % 32` of descriptorWord should be set to 1. We do
+          // this by making an OR operation with a binary number that only has the bit
+          // in that position set to 1. That binary number is obtained by shifting 1 left by
+          // `j % 32` (which is the same as `j & 31` left) positions.
+          descriptorWord |= 1 << (j & 31);
+        }
+
+        // If the next j is a multiple of 32, we will need to use a new descriptor word to hold
+        // the next results.
+        if (!((j + 1) & 31)) {
+          descriptors[position++] = descriptorWord;
+          descriptorWord = 0;
+        }
+      }
+    }
+
+    return descriptors;
+  };
+
+  /**
+   * Matches sets of features {mi} and {m′j} extracted from two images taken
+   * from similar, and often successive, viewpoints. A classical procedure
+   * runs as follows. For each point {mi} in the first image, search in a
+   * region of the second image around location {mi} for point {m′j}. The
+   * search is based on the similarity of the local image windows, also known
+   * as kernel windows, centered on the points, which strongly characterizes
+   * the points when the images are sufficiently close. Once each keypoint is
+   * described with its binary string, they need to be compared with the
+   * closest matching point. Distance metric is critical to the performance of
+   * in- trusion detection systems. Thus using binary strings reduces the size
+   * of the descriptor and provides an interesting data structure that is fast
+   * to operate whose similarity can be measured by the Hamming distance.
+   * @param {array} keypoints1
+   * @param {array} descriptors1
+   * @param {array} keypoints2
+   * @param {array} descriptors2
+   * @return {Int32Array} Returns an array where the index is the corner1
+   *     index coordinate, and the value is the corresponding match index of
+   *     corner2, e.g. keypoints1=[x0,y0,x1,y1,...] and
+   *     keypoints2=[x'0,y'0,x'1,y'1,...], if x0 matches x'1 and x1 matches x'0,
+   *     the return array would be [3,0].
+   * @static
+   */
+  tracking.Brief.match = function(keypoints1, descriptors1, keypoints2, descriptors2) {
+    var len1 = keypoints1.length >> 1;
+    var len2 = keypoints2.length >> 1;
+    var matches = new Array(len1);
+
+    for (var i = 0; i < len1; i++) {
+      var min = Infinity;
+      var minj = 0;
+      for (var j = 0; j < len2; j++) {
+        var dist = 0;
+        // Optimizing divide by 32 operation using binary shift
+        // (this.N >> 5) === this.N/32.
+        for (var k = 0, n = this.N >> 5; k < n; k++) {
+          dist += tracking.Math.hammingWeight(descriptors1[i * n + k] ^ descriptors2[j * n + k]);
+        }
+        if (dist < min) {
+          min = dist;
+          minj = j;
+        }
+      }
+      matches[i] = {
+        index1: i,
+        index2: minj,
+        keypoint1: [keypoints1[2 * i], keypoints1[2 * i + 1]],
+        keypoint2: [keypoints2[2 * minj], keypoints2[2 * minj + 1]],
+        confidence: 1 - min / this.N
+      };
+    }
+
+    return matches;
+  };
+
+  /**
+   * Removes matches outliers by testing matches on both directions.
+   * @param {array} keypoints1
+   * @param {array} descriptors1
+   * @param {array} keypoints2
+   * @param {array} descriptors2
+   * @return {Int32Array} Returns an array where the index is the corner1
+   *     index coordinate, and the value is the corresponding match index of
+   *     corner2, e.g. keypoints1=[x0,y0,x1,y1,...] and
+   *     keypoints2=[x'0,y'0,x'1,y'1,...], if x0 matches x'1 and x1 matches x'0,
+   *     the return array would be [3,0].
+   * @static
+   */
+  tracking.Brief.reciprocalMatch = function(keypoints1, descriptors1, keypoints2, descriptors2) {
+    var matches = [];
+    if (keypoints1.length === 0 || keypoints2.length === 0) {
+      return matches;
+    }
+
+    var matches1 = tracking.Brief.match(keypoints1, descriptors1, keypoints2, descriptors2);
+    var matches2 = tracking.Brief.match(keypoints2, descriptors2, keypoints1, descriptors1);
+    for (var i = 0; i < matches1.length; i++) {
+      if (matches2[matches1[i].index2].index2 === i) {
+        matches.push(matches1[i]);
+      }
+    }
+    return matches;
+  };
+
+  /**
+   * Gets the coordinates values of (x,y)-location pairs uniquely chosen
+   * during the initialization.
+   * @return {array} Array with the random offset values.
+   * @private
+   */
+  tracking.Brief.getRandomOffsets_ = function(width) {
+    if (!this.randomWindowOffsets_) {
+      var windowPosition = 0;
+      var windowOffsets = new Int32Array(4 * this.N);
+      for (var i = 0; i < this.N; i++) {
+        windowOffsets[windowPosition++] = Math.round(tracking.Math.uniformRandom(-15, 16));
+        windowOffsets[windowPosition++] = Math.round(tracking.Math.uniformRandom(-15, 16));
+        windowOffsets[windowPosition++] = Math.round(tracking.Math.uniformRandom(-15, 16));
+        windowOffsets[windowPosition++] = Math.round(tracking.Math.uniformRandom(-15, 16));
+      }
+      this.randomWindowOffsets_ = windowOffsets;
+    }
+
+    if (!this.randomImageOffsets_[width]) {
+      var imagePosition = 0;
+      var imageOffsets = new Int32Array(2 * this.N);
+      for (var j = 0; j < this.N; j++) {
+        imageOffsets[imagePosition++] = this.randomWindowOffsets_[4 * j] * width + this.randomWindowOffsets_[4 * j + 1];
+        imageOffsets[imagePosition++] = this.randomWindowOffsets_[4 * j + 2] * width + this.randomWindowOffsets_[4 * j + 3];
+      }
+      this.randomImageOffsets_[width] = imageOffsets;
+    }
+
+    return this.randomImageOffsets_[width];
+  };
+}());
+
+(function() {
+  /**
+   * FAST intends for "Features from Accelerated Segment Test". This method
+   * performs a point segment test corner detection. The segment test
+   * criterion operates by considering a circle of sixteen pixels around the
+   * corner candidate p. The detector classifies p as a corner if there exists
+   * a set of n contiguous pixelsin the circle which are all brighter than the
+   * intensity of the candidate pixel Ip plus a threshold t, or all darker
+   * than Ip − t.
+   *
+   *       15 00 01
+   *    14          02
+   * 13                03
+   * 12       []       04
+   * 11                05
+   *    10          06
+   *       09 08 07
+   *
+   * For more reference:
+   * http://citeseerx.ist.psu.edu/viewdoc/download?doi=10.1.1.60.3991&rep=rep1&type=pdf
+   * @static
+   * @constructor
+   */
+  tracking.Fast = {};
+
+  /**
+   * Holds the threshold to determine whether the tested pixel is brighter or
+   * darker than the corner candidate p.
+   * @type {number}
+   * @default 40
+   * @static
+   */
+  tracking.Fast.THRESHOLD = 40;
+
+  /**
+   * Caches coordinates values of the circle surrounding the pixel candidate p.
+   * @type {Object.<number, Int32Array>}
+   * @private
+   * @static
+   */
+  tracking.Fast.circles_ = {};
+
+  /**
+   * Finds corners coordinates on the graysacaled image.
+   * @param {array} The grayscale pixels in a linear [p1,p2,...] array.
+   * @param {number} width The image width.
+   * @param {number} height The image height.
+   * @param {number} threshold to determine whether the tested pixel is brighter or
+   *     darker than the corner candidate p. Default value is 40.
+   * @return {array} Array containing the coordinates of all found corners,
+   *     e.g. [x0,y0,x1,y1,...], where P(x0,y0) represents a corner coordinate.
+   * @static
+   */
+  tracking.Fast.findCorners = function(pixels, width, height, opt_threshold) {
+    var circleOffsets = this.getCircleOffsets_(width);
+    var circlePixels = new Int32Array(16);
+    var corners = [];
+
+    if (opt_threshold === undefined) {
+      opt_threshold = this.THRESHOLD;
+    }
+
+    // When looping through the image pixels, skips the first three lines from
+    // the image boundaries to constrain the surrounding circle inside the image
+    // area.
+    for (var i = 3; i < height - 3; i++) {
+      for (var j = 3; j < width - 3; j++) {
+        var w = i * width + j;
+        var p = pixels[w];
+
+        // Loops the circle offsets to read the pixel value for the sixteen
+        // surrounding pixels.
+        for (var k = 0; k < 16; k++) {
+          circlePixels[k] = pixels[w + circleOffsets[k]];
+        }
+
+        if (this.isCorner(p, circlePixels, opt_threshold)) {
+          // The pixel p is classified as a corner, as optimization increment j
+          // by the circle radius 3 to skip the neighbor pixels inside the
+          // surrounding circle. This can be removed without compromising the
+          // result.
+          corners.push(j, i);
+          j += 3;
+        }
+      }
+    }
+
+    return corners;
+  };
+
+  /**
+   * Checks if the circle pixel is brighter than the candidate pixel p by
+   * a threshold.
+   * @param {number} circlePixel The circle pixel value.
+   * @param {number} p The value of the candidate pixel p.
+   * @param {number} threshold
+   * @return {Boolean}
+   * @static
+   */
+  tracking.Fast.isBrighter = function(circlePixel, p, threshold) {
+    return circlePixel - p > threshold;
+  };
+
+  /**
+   * Checks if the circle pixel is within the corner of the candidate pixel p
+   * by a threshold.
+   * @param {number} p The value of the candidate pixel p.
+   * @param {number} circlePixel The circle pixel value.
+   * @param {number} threshold
+   * @return {Boolean}
+   * @static
+   */
+  tracking.Fast.isCorner = function(p, circlePixels, threshold) {
+    if (this.isTriviallyExcluded(circlePixels, p, threshold)) {
+      return false;
+    }
+
+    for (var x = 0; x < 16; x++) {
+      var darker = true;
+      var brighter = true;
+
+      for (var y = 0; y < 9; y++) {
+        var circlePixel = circlePixels[(x + y) & 15];
+
+        if (!this.isBrighter(p, circlePixel, threshold)) {
+          brighter = false;
+          if (darker === false) {
+            break;
+          }
+        }
+
+        if (!this.isDarker(p, circlePixel, threshold)) {
+          darker = false;
+          if (brighter === false) {
+            break;
+          }
+        }
+      }
+
+      if (brighter || darker) {
+        return true;
+      }
+    }
+
+    return false;
+  };
+
+  /**
+   * Checks if the circle pixel is darker than the candidate pixel p by
+   * a threshold.
+   * @param {number} circlePixel The circle pixel value.
+   * @param {number} p The value of the candidate pixel p.
+   * @param {number} threshold
+   * @return {Boolean}
+   * @static
+   */
+  tracking.Fast.isDarker = function(circlePixel, p, threshold) {
+    return p - circlePixel > threshold;
+  };
+
+  /**
+   * Fast check to test if the candidate pixel is a trivially excluded value.
+   * In order to be a corner, the candidate pixel value should be darker or
+   * brighter than 9-12 surrounding pixels, when at least three of the top,
+   * bottom, left and right pixels are brighter or darker it can be
+   * automatically excluded improving the performance.
+   * @param {number} circlePixel The circle pixel value.
+   * @param {number} p The value of the candidate pixel p.
+   * @param {number} threshold
+   * @return {Boolean}
+   * @static
+   * @protected
+   */
+  tracking.Fast.isTriviallyExcluded = function(circlePixels, p, threshold) {
+    var count = 0;
+    var circleBottom = circlePixels[8];
+    var circleLeft = circlePixels[12];
+    var circleRight = circlePixels[4];
+    var circleTop = circlePixels[0];
+
+    if (this.isBrighter(circleTop, p, threshold)) {
+      count++;
+    }
+    if (this.isBrighter(circleRight, p, threshold)) {
+      count++;
+    }
+    if (this.isBrighter(circleBottom, p, threshold)) {
+      count++;
+    }
+    if (this.isBrighter(circleLeft, p, threshold)) {
+      count++;
+    }
+
+    if (count < 3) {
+      count = 0;
+      if (this.isDarker(circleTop, p, threshold)) {
+        count++;
+      }
+      if (this.isDarker(circleRight, p, threshold)) {
+        count++;
+      }
+      if (this.isDarker(circleBottom, p, threshold)) {
+        count++;
+      }
+      if (this.isDarker(circleLeft, p, threshold)) {
+        count++;
+      }
+      if (count < 3) {
+        return true;
+      }
+    }
+
+    return false;
+  };
+
+  /**
+   * Gets the sixteen offset values of the circle surrounding pixel.
+   * @param {number} width The image width.
+   * @return {array} Array with the sixteen offset values of the circle
+   *     surrounding pixel.
+   * @private
+   */
+  tracking.Fast.getCircleOffsets_ = function(width) {
+    if (this.circles_[width]) {
+      return this.circles_[width];
+    }
+
+    var circle = new Int32Array(16);
+
+    circle[0] = -width - width - width;
+    circle[1] = circle[0] + 1;
+    circle[2] = circle[1] + width + 1;
+    circle[3] = circle[2] + width + 1;
+    circle[4] = circle[3] + width;
+    circle[5] = circle[4] + width;
+    circle[6] = circle[5] + width - 1;
+    circle[7] = circle[6] + width - 1;
+    circle[8] = circle[7] - 1;
+    circle[9] = circle[8] - 1;
+    circle[10] = circle[9] - width - 1;
+    circle[11] = circle[10] - width - 1;
+    circle[12] = circle[11] - width;
+    circle[13] = circle[12] - width;
+    circle[14] = circle[13] - width + 1;
+    circle[15] = circle[14] - width + 1;
+
+    this.circles_[width] = circle;
+    return circle;
+  };
+}());
+
+(function() {
+  /**
+   * Math utility.
+   * @static
+   * @constructor
+   */
+  tracking.Math = {};
+
+  /**
+   * Euclidean distance between two points P(x0, y0) and P(x1, y1).
+   * @param {number} x0 Horizontal coordinate of P0.
+   * @param {number} y0 Vertical coordinate of P0.
+   * @param {number} x1 Horizontal coordinate of P1.
+   * @param {number} y1 Vertical coordinate of P1.
+   * @return {number} The euclidean distance.
+   */
+  tracking.Math.distance = function(x0, y0, x1, y1) {
+    var dx = x1 - x0;
+    var dy = y1 - y0;
+
+    return Math.sqrt(dx * dx + dy * dy);
+  };
+
+  /**
+   * Calculates the Hamming weight of a string, which is the number of symbols that are
+   * different from the zero-symbol of the alphabet used. It is thus
+   * equivalent to the Hamming distance from the all-zero string of the same
+   * length. For the most typical case, a string of bits, this is the number
+   * of 1's in the string.
+   *
+   * Example:
+   *
+   * <pre>
+   *  Binary string     Hamming weight
+   *   11101                 4
+   *   11101010              5
+   * </pre>
+   *
+   * @param {number} i Number that holds the binary string to extract the hamming weight.
+   * @return {number} The hamming weight.
+   */
+  tracking.Math.hammingWeight = function(i) {
+    i = i - ((i >> 1) & 0x55555555);
+    i = (i & 0x33333333) + ((i >> 2) & 0x33333333);
+
+    return ((i + (i >> 4) & 0xF0F0F0F) * 0x1010101) >> 24;
+  };
+
+  /**
+   * Generates a random number between [a, b] interval.
+   * @param {number} a
+   * @param {number} b
+   * @return {number}
+   */
+  tracking.Math.uniformRandom = function(a, b) {
+    return a + Math.random() * (b - a);
+  };
+
+  /**
+   * Tests if a rectangle intersects with another.
+   *
+   *  <pre>
+   *  x0y0 --------       x2y2 --------
+   *      |       |           |       |
+   *      -------- x1y1       -------- x3y3
+   * </pre>
+   *
+   * @param {number} x0 Horizontal coordinate of P0.
+   * @param {number} y0 Vertical coordinate of P0.
+   * @param {number} x1 Horizontal coordinate of P1.
+   * @param {number} y1 Vertical coordinate of P1.
+   * @param {number} x2 Horizontal coordinate of P2.
+   * @param {number} y2 Vertical coordinate of P2.
+   * @param {number} x3 Horizontal coordinate of P3.
+   * @param {number} y3 Vertical coordinate of P3.
+   * @return {boolean}
+   */
+  tracking.Math.intersectRect = function(x0, y0, x1, y1, x2, y2, x3, y3) {
+    return !(x2 > x1 || x3 < x0 || y2 > y1 || y3 < y0);
+  };
+
+}());
+
+(function() {
+  /**
+   * Matrix utility.
+   * @static
+   * @constructor
+   */
+  tracking.Matrix = {};
+
+  /**
+   * Loops the array organized as major-row order and executes `fn` callback
+   * for each iteration. The `fn` callback receives the following parameters:
+   * `(r,g,b,a,index,i,j)`, where `r,g,b,a` represents the pixel color with
+   * alpha channel, `index` represents the position in the major-row order
+   * array and `i,j` the respective indexes positions in two dimensions.
+   * @param {array} pixels The pixels in a linear [r,g,b,a,...] array to loop
+   *     through.
+   * @param {number} width The image width.
+   * @param {number} height The image height.
+   * @param {function} fn The callback function for each pixel.
+   * @param {number} opt_jump Optional jump for the iteration, by default it
+   *     is 1, hence loops all the pixels of the array.
+   * @static
+   */
+  tracking.Matrix.forEach = function(pixels, width, height, fn, opt_jump) {
+    opt_jump = opt_jump || 1;
+    for (var i = 0; i < height; i += opt_jump) {
+      for (var j = 0; j < width; j += opt_jump) {
+        var w = i * width * 4 + j * 4;
+        fn.call(this, pixels[w], pixels[w + 1], pixels[w + 2], pixels[w + 3], w, i, j);
+      }
+    }
+  };
+
+  /**
+   * Calculates the per-element subtraction of two NxM matrices and returns a 
+   * new NxM matrix as the result.
+   * @param {matrix} a The first matrix.
+   * @param {matrix} a The second matrix.
+   * @static
+   */
+  tracking.Matrix.sub = function(a, b){
+    var res = tracking.Matrix.clone(a);
+    for(var i=0; i < res.length; i++){
+      for(var j=0; j < res[i].length; j++){
+        res[i][j] -= b[i][j]; 
+      }
+    }
+    return res;
+  }
+
+  /**
+   * Calculates the per-element sum of two NxM matrices and returns a new NxM
+   * NxM matrix as the result.
+   * @param {matrix} a The first matrix.
+   * @param {matrix} a The second matrix.
+   * @static
+   */
+  tracking.Matrix.add = function(a, b){
+    var res = tracking.Matrix.clone(a);
+    for(var i=0; i < res.length; i++){
+      for(var j=0; j < res[i].length; j++){
+        res[i][j] += b[i][j]; 
+      }
+    }
+    return res;
+  }
+
+  /**
+   * Clones a matrix (or part of it) and returns a new matrix as the result.
+   * @param {matrix} src The matrix to be cloned.
+   * @param {number} width The second matrix.
+   * @static
+   */
+  tracking.Matrix.clone = function(src, width, height){
+    width = width || src[0].length;
+    height = height || src.length;
+    var temp = new Array(height);
+    var i = height;
+    while(i--){
+      temp[i] = new Array(width);
+      var j = width;
+      while(j--) temp[i][j] = src[i][j];
+    } 
+    return temp;
+  }
+
+  /**
+   * Multiply a matrix by a scalar and returns a new matrix as the result.
+   * @param {number} scalar The scalar to multiply the matrix by.
+   * @param {matrix} src The matrix to be multiplied.
+   * @static
+   */
+  tracking.Matrix.mulScalar = function(scalar, src){
+    var res = tracking.Matrix.clone(src);
+    for(var i=0; i < src.length; i++){
+      for(var j=0; j < src[i].length; j++){
+        res[i][j] *= scalar;
+      }
+    }
+    return res;
+  }
+
+  /**
+   * Transpose a matrix and returns a new matrix as the result.
+   * @param {matrix} src The matrix to be transposed.
+   * @static
+   */
+  tracking.Matrix.transpose = function(src){
+    var transpose = new Array(src[0].length);
+    for(var i=0; i < src[0].length; i++){
+      transpose[i] = new Array(src.length);
+      for(var j=0; j < src.length; j++){
+        transpose[i][j] = src[j][i];
+      }
+    }
+    return transpose;
+  }
+
+  /**
+   * Multiply an MxN matrix with an NxP matrix and returns a new MxP matrix
+   * as the result.
+   * @param {matrix} a The first matrix.
+   * @param {matrix} b The second matrix.
+   * @static
+   */
+  tracking.Matrix.mul = function(a, b) {
+    var res = new Array(a.length);
+    for (var i = 0; i < a.length; i++) {
+      res[i] = new Array(b[0].length);
+      for (var j = 0; j < b[0].length; j++) {
+        res[i][j] = 0;            
+        for (var k = 0; k < a[0].length; k++) {
+          res[i][j] += a[i][k] * b[k][j];
+        }
+      }
+    }
+    return res;
+  }
+
+  /**
+   * Calculates the absolute norm of a matrix.
+   * @param {matrix} src The matrix which norm will be calculated.
+   * @static
+   */
+  tracking.Matrix.norm = function(src){
+    var res = 0;
+    for(var i=0; i < src.length; i++){
+      for(var j=0; j < src[i].length; j++){
+        res += src[i][j]*src[i][j];
+      }
+    }
+    return Math.sqrt(res);
+  }
+
+  /**
+   * Calculates and returns the covariance matrix of a set of vectors as well
+   * as the mean of the matrix.
+   * @param {matrix} src The matrix which covariance matrix will be calculated.
+   * @static
+   */
+  tracking.Matrix.calcCovarMatrix = function(src){
+
+    var mean = new Array(src.length);
+    for(var i=0; i < src.length; i++){
+      mean[i] = [0.0];
+      for(var j=0; j < src[i].length; j++){
+        mean[i][0] += src[i][j]/src[i].length;
+      }
+    }
+
+    var deltaFull = tracking.Matrix.clone(mean);
+    for(var i=0; i < deltaFull.length; i++){
+      for(var j=0; j < src[0].length - 1; j++){
+        deltaFull[i].push(deltaFull[i][0]);
+      }
+    }
+
+    var a = tracking.Matrix.sub(src, deltaFull);
+    var b = tracking.Matrix.transpose(a);
+    var covar = tracking.Matrix.mul(b,a); 
+    return [covar, mean];
+
+  }
+
+}());
+(function() {
+  /**
+   * EPnp utility.
+   * @static
+   * @constructor
+   */
+  tracking.EPnP = {};
+
+  tracking.EPnP.solve = function(objectPoints, imagePoints, cameraMatrix) {};
+}());
+
+(function() {
+  /**
+   * Tracker utility.
+   * @constructor
+   * @extends {tracking.EventEmitter}
+   */
+  tracking.Tracker = function() {
+    tracking.Tracker.base(this, 'constructor');
+  };
+
+  tracking.inherits(tracking.Tracker, tracking.EventEmitter);
+
+  /**
+   * Tracks the pixels on the array. This method is called for each video
+   * frame in order to emit `track` event.
+   * @param {Uint8ClampedArray} pixels The pixels data to track.
+   * @param {number} width The pixels canvas width.
+   * @param {number} height The pixels canvas height.
+   */
+  tracking.Tracker.prototype.track = function() {};
+}());
+
+(function() {
+  /**
+   * TrackerTask utility.
+   * @constructor
+   * @extends {tracking.EventEmitter}
+   */
+  tracking.TrackerTask = function(tracker) {
+    tracking.TrackerTask.base(this, 'constructor');
+
+    if (!tracker) {
+      throw new Error('Tracker instance not specified.');
+    }
+
+    this.setTracker(tracker);
+  };
+
+  tracking.inherits(tracking.TrackerTask, tracking.EventEmitter);
+
+  /**
+   * Holds the tracker instance managed by this task.
+   * @type {tracking.Tracker}
+   * @private
+   */
+  tracking.TrackerTask.prototype.tracker_ = null;
+
+  /**
+   * Holds if the tracker task is in running.
+   * @type {boolean}
+   * @private
+   */
+  tracking.TrackerTask.prototype.running_ = false;
+
+  /**
+   * Gets the tracker instance managed by this task.
+   * @return {tracking.Tracker}
+   */
+  tracking.TrackerTask.prototype.getTracker = function() {
+    return this.tracker_;
+  };
+
+  /**
+   * Returns true if the tracker task is in running, false otherwise.
+   * @return {boolean}
+   * @private
+   */
+  tracking.TrackerTask.prototype.inRunning = function() {
+    return this.running_;
+  };
+
+  /**
+   * Sets if the tracker task is in running.
+   * @param {boolean} running
+   * @private
+   */
+  tracking.TrackerTask.prototype.setRunning = function(running) {
+    this.running_ = running;
+  };
+
+  /**
+   * Sets the tracker instance managed by this task.
+   * @return {tracking.Tracker}
+   */
+  tracking.TrackerTask.prototype.setTracker = function(tracker) {
+    this.tracker_ = tracker;
+  };
+
+  /**
+   * Emits a `run` event on the tracker task for the implementers to run any
+   * child action, e.g. `requestAnimationFrame`.
+   * @return {object} Returns itself, so calls can be chained.
+   */
+  tracking.TrackerTask.prototype.run = function() {
+    var self = this;
+
+    if (this.inRunning()) {
+      return;
+    }
+
+    this.setRunning(true);
+    this.reemitTrackEvent_ = function(event) {
+      self.emit('track', event);
+    };
+    this.tracker_.on('track', this.reemitTrackEvent_);
+    this.emit('run');
+    return this;
+  };
+
+  /**
+   * Emits a `stop` event on the tracker task for the implementers to stop any
+   * child action being done, e.g. `requestAnimationFrame`.
+   * @return {object} Returns itself, so calls can be chained.
+   */
+  tracking.TrackerTask.prototype.stop = function() {
+    if (!this.inRunning()) {
+      return;
+    }
+
+    this.setRunning(false);
+    this.emit('stop');
+    this.tracker_.removeListener('track', this.reemitTrackEvent_);
+    return this;
+  };
+}());
+
+(function() {
+  /**
+   * ColorTracker utility to track colored blobs in a frame using color
+   * difference evaluation.
+   * @constructor
+   * @param {string|Array.<string>} opt_colors Optional colors to track.
+   * @extends {tracking.Tracker}
+   */
+  tracking.ColorTracker = function(opt_colors) {
+    tracking.ColorTracker.base(this, 'constructor');
+
+    if (typeof opt_colors === 'string') {
+      opt_colors = [opt_colors];
+    }
+
+    if (opt_colors) {
+      opt_colors.forEach(function(color) {
+        if (!tracking.ColorTracker.getColor(color)) {
+          throw new Error('Color not valid, try `new tracking.ColorTracker("magenta")`.');
+        }
+      });
+      this.setColors(opt_colors);
+    }
+  };
+
+  tracking.inherits(tracking.ColorTracker, tracking.Tracker);
+
+  /**
+   * Holds the known colors.
+   * @type {Object.<string, function>}
+   * @private
+   * @static
+   */
+  tracking.ColorTracker.knownColors_ = {};
+
+  /**
+   * Caches coordinates values of the neighbours surrounding a pixel.
+   * @type {Object.<number, Int32Array>}
+   * @private
+   * @static
+   */
+  tracking.ColorTracker.neighbours_ = {};
+
+  /**
+   * Registers a color as known color.
+   * @param {string} name The color name.
+   * @param {function} fn The color function to test if the passed (r,g,b) is
+   *     the desired color.
+   * @static
+   */
+  tracking.ColorTracker.registerColor = function(name, fn) {
+    tracking.ColorTracker.knownColors_[name] = fn;
+  };
+
+  /**
+   * Gets the known color function that is able to test whether an (r,g,b) is
+   * the desired color.
+   * @param {string} name The color name.
+   * @return {function} The known color test function.
+   * @static
+   */
+  tracking.ColorTracker.getColor = function(name) {
+    return tracking.ColorTracker.knownColors_[name];
+  };
+
+  /**
+   * Holds the colors to be tracked by the `ColorTracker` instance.
+   * @default ['magenta']
+   * @type {Array.<string>}
+   */
+  tracking.ColorTracker.prototype.colors = ['magenta'];
+
+  /**
+   * Holds the minimum dimension to classify a rectangle.
+   * @default 20
+   * @type {number}
+   */
+  tracking.ColorTracker.prototype.minDimension = 20;
+
+  /**
+   * Holds the maximum dimension to classify a rectangle.
+   * @default Infinity
+   * @type {number}
+   */
+  tracking.ColorTracker.prototype.maxDimension = Infinity;
+
+
+  /**
+   * Holds the minimum group size to be classified as a rectangle.
+   * @default 30
+   * @type {number}
+   */
+  tracking.ColorTracker.prototype.minGroupSize = 30;
+
+  /**
+   * Calculates the central coordinate from the cloud points. The cloud points
+   * are all points that matches the desired color.
+   * @param {Array.<number>} cloud Major row order array containing all the
+   *     points from the desired color, e.g. [x1, y1, c2, y2, ...].
+   * @param {number} total Total numbers of pixels of the desired color.
+   * @return {object} Object containing the x, y and estimated z coordinate of
+   *     the blog extracted from the cloud points.
+   * @private
+   */
+  tracking.ColorTracker.prototype.calculateDimensions_ = function(cloud, total) {
+    var maxx = -1;
+    var maxy = -1;
+    var minx = Infinity;
+    var miny = Infinity;
+
+    for (var c = 0; c < total; c += 2) {
+      var x = cloud[c];
+      var y = cloud[c + 1];
+
+      if (x < minx) {
+        minx = x;
+      }
+      if (x > maxx) {
+        maxx = x;
+      }
+      if (y < miny) {
+        miny = y;
+      }
+      if (y > maxy) {
+        maxy = y;
+      }
+    }
+
+    return {
+      width: maxx - minx,
+      height: maxy - miny,
+      x: minx,
+      y: miny
+    };
+  };
+
+  /**
+   * Gets the colors being tracked by the `ColorTracker` instance.
+   * @return {Array.<string>}
+   */
+  tracking.ColorTracker.prototype.getColors = function() {
+    return this.colors;
+  };
+
+  /**
+   * Gets the minimum dimension to classify a rectangle.
+   * @return {number}
+   */
+  tracking.ColorTracker.prototype.getMinDimension = function() {
+    return this.minDimension;
+  };
+
+  /**
+   * Gets the maximum dimension to classify a rectangle.
+   * @return {number}
+   */
+  tracking.ColorTracker.prototype.getMaxDimension = function() {
+    return this.maxDimension;
+  };
+
+  /**
+   * Gets the minimum group size to be classified as a rectangle.
+   * @return {number}
+   */
+  tracking.ColorTracker.prototype.getMinGroupSize = function() {
+    return this.minGroupSize;
+  };
+
+  /**
+   * Gets the eight offset values of the neighbours surrounding a pixel.
+   * @param {number} width The image width.
+   * @return {array} Array with the eight offset values of the neighbours
+   *     surrounding a pixel.
+   * @private
+   */
+  tracking.ColorTracker.prototype.getNeighboursForWidth_ = function(width) {
+    if (tracking.ColorTracker.neighbours_[width]) {
+      return tracking.ColorTracker.neighbours_[width];
+    }
+
+    var neighbours = new Int32Array(8);
+
+    neighbours[0] = -width * 4;
+    neighbours[1] = -width * 4 + 4;
+    neighbours[2] = 4;
+    neighbours[3] = width * 4 + 4;
+    neighbours[4] = width * 4;
+    neighbours[5] = width * 4 - 4;
+    neighbours[6] = -4;
+    neighbours[7] = -width * 4 - 4;
+
+    tracking.ColorTracker.neighbours_[width] = neighbours;
+
+    return neighbours;
+  };
+
+  /**
+   * Unites groups whose bounding box intersect with each other.
+   * @param {Array.<Object>} rects
+   * @private
+   */
+  tracking.ColorTracker.prototype.mergeRectangles_ = function(rects) {
+    var intersects;
+    var results = [];
+    var minDimension = this.getMinDimension();
+    var maxDimension = this.getMaxDimension();
+
+    for (var r = 0; r < rects.length; r++) {
+      var r1 = rects[r];
+      intersects = true;
+      for (var s = r + 1; s < rects.length; s++) {
+        var r2 = rects[s];
+        if (tracking.Math.intersectRect(r1.x, r1.y, r1.x + r1.width, r1.y + r1.height, r2.x, r2.y, r2.x + r2.width, r2.y + r2.height)) {
+          intersects = false;
+          var x1 = Math.min(r1.x, r2.x);
+          var y1 = Math.min(r1.y, r2.y);
+          var x2 = Math.max(r1.x + r1.width, r2.x + r2.width);
+          var y2 = Math.max(r1.y + r1.height, r2.y + r2.height);
+          r2.height = y2 - y1;
+          r2.width = x2 - x1;
+          r2.x = x1;
+          r2.y = y1;
+          break;
+        }
+      }
+
+      if (intersects) {
+        if (r1.width >= minDimension && r1.height >= minDimension) {
+          if (r1.width <= maxDimension && r1.height <= maxDimension) {
+            results.push(r1);
+          }
+        }
+      }
+    }
+
+    return results;
+  };
+
+  /**
+   * Sets the colors to be tracked by the `ColorTracker` instance.
+   * @param {Array.<string>} colors
+   */
+  tracking.ColorTracker.prototype.setColors = function(colors) {
+    this.colors = colors;
+  };
+
+  /**
+   * Sets the minimum dimension to classify a rectangle.
+   * @param {number} minDimension
+   */
+  tracking.ColorTracker.prototype.setMinDimension = function(minDimension) {
+    this.minDimension = minDimension;
+  };
+
+  /**
+   * Sets the maximum dimension to classify a rectangle.
+   * @param {number} maxDimension
+   */
+  tracking.ColorTracker.prototype.setMaxDimension = function(maxDimension) {
+    this.maxDimension = maxDimension;
+  };
+
+  /**
+   * Sets the minimum group size to be classified as a rectangle.
+   * @param {number} minGroupSize
+   */
+  tracking.ColorTracker.prototype.setMinGroupSize = function(minGroupSize) {
+    this.minGroupSize = minGroupSize;
+  };
+
+  /**
+   * Tracks the `Video` frames. This method is called for each video frame in
+   * order to emit `track` event.
+   * @param {Uint8ClampedArray} pixels The pixels data to track.
+   * @param {number} width The pixels canvas width.
+   * @param {number} height The pixels canvas height.
+   */
+  tracking.ColorTracker.prototype.track = function(pixels, width, height) {
+    var self = this;
+    var colors = this.getColors();
+
+    if (!colors) {
+      throw new Error('Colors not specified, try `new tracking.ColorTracker("magenta")`.');
+    }
+
+    var results = [];
+
+    colors.forEach(function(color) {
+      results = results.concat(self.trackColor_(pixels, width, height, color));
+    });
+
+    this.emit('track', {
+      data: results
+    });
+  };
+
+  /**
+   * Find the given color in the given matrix of pixels using Flood fill
+   * algorithm to determines the area connected to a given node in a
+   * multi-dimensional array.
+   * @param {Uint8ClampedArray} pixels The pixels data to track.
+   * @param {number} width The pixels canvas width.
+   * @param {number} height The pixels canvas height.
+   * @param {string} color The color to be found
+   * @private
+   */
+  tracking.ColorTracker.prototype.trackColor_ = function(pixels, width, height, color) {
+    var colorFn = tracking.ColorTracker.knownColors_[color];
+    var currGroup = new Int32Array(pixels.length >> 2);
+    var currGroupSize;
+    var currI;
+    var currJ;
+    var currW;
+    var marked = new Int8Array(pixels.length);
+    var minGroupSize = this.getMinGroupSize();
+    var neighboursW = this.getNeighboursForWidth_(width);
+    var queue = new Int32Array(pixels.length);
+    var queuePosition;
+    var results = [];
+    var w = -4;
+
+    if (!colorFn) {
+      return results;
+    }
+
+    for (var i = 0; i < height; i++) {
+      for (var j = 0; j < width; j++) {
+        w += 4;
+
+        if (marked[w]) {
+          continue;
+        }
+
+        currGroupSize = 0;
+
+        queuePosition = -1;
+        queue[++queuePosition] = w;
+        queue[++queuePosition] = i;
+        queue[++queuePosition] = j;
+
+        marked[w] = 1;
+
+        while (queuePosition >= 0) {
+          currJ = queue[queuePosition--];
+          currI = queue[queuePosition--];
+          currW = queue[queuePosition--];
+
+          if (colorFn(pixels[currW], pixels[currW + 1], pixels[currW + 2], pixels[currW + 3], currW, currI, currJ)) {
+            currGroup[currGroupSize++] = currJ;
+            currGroup[currGroupSize++] = currI;
+
+            for (var k = 0; k < neighboursW.length; k++) {
+              var otherW = currW + neighboursW[k];
+              var otherI = currI + neighboursI[k];
+              var otherJ = currJ + neighboursJ[k];
+              if (!marked[otherW] && otherI >= 0 && otherI < height && otherJ >= 0 && otherJ < width) {
+                queue[++queuePosition] = otherW;
+                queue[++queuePosition] = otherI;
+                queue[++queuePosition] = otherJ;
+
+                marked[otherW] = 1;
+              }
+            }
+          }
+        }
+
+        if (currGroupSize >= minGroupSize) {
+          var data = this.calculateDimensions_(currGroup, currGroupSize);
+          if (data) {
+            data.color = color;
+            results.push(data);
+          }
+        }
+      }
+    }
+
+    return this.mergeRectangles_(results);
+  };
+
+  // Default colors
+  //===================
+
+  tracking.ColorTracker.registerColor('cyan', function(r, g, b) {
+    var thresholdGreen = 50,
+      thresholdBlue = 70,
+      dx = r - 0,
+      dy = g - 255,
+      dz = b - 255;
+
+    if ((g - r) >= thresholdGreen && (b - r) >= thresholdBlue) {
+      return true;
+    }
+    return dx * dx + dy * dy + dz * dz < 6400;
+  });
+
+  tracking.ColorTracker.registerColor('magenta', function(r, g, b) {
+    var threshold = 50,
+      dx = r - 255,
+      dy = g - 0,
+      dz = b - 255;
+
+    if ((r - g) >= threshold && (b - g) >= threshold) {
+      return true;
+    }
+    return dx * dx + dy * dy + dz * dz < 19600;
+  });
+
+  tracking.ColorTracker.registerColor('yellow', function(r, g, b) {
+    var threshold = 50,
+      dx = r - 255,
+      dy = g - 255,
+      dz = b - 0;
+
+    if ((r - b) >= threshold && (g - b) >= threshold) {
+      return true;
+    }
+    return dx * dx + dy * dy + dz * dz < 10000;
+  });
+
+
+  // Caching neighbour i/j offset values.
+  //=====================================
+  var neighboursI = new Int32Array([-1, -1, 0, 1, 1, 1, 0, -1]);
+  var neighboursJ = new Int32Array([0, 1, 1, 1, 0, -1, -1, -1]);
+}());
+
+(function() {
+  /**
+   * ObjectTracker utility.
+   * @constructor
+   * @param {string|Array.<string|Array.<number>>} opt_classifiers Optional
+   *     object classifiers to track.
+   * @extends {tracking.Tracker}
+   */
+  tracking.ObjectTracker = function(opt_classifiers) {
+    tracking.ObjectTracker.base(this, 'constructor');
+
+    if (opt_classifiers) {
+      if (!Array.isArray(opt_classifiers)) {
+        opt_classifiers = [opt_classifiers];
+      }
+
+      if (Array.isArray(opt_classifiers)) {
+        opt_classifiers.forEach(function(classifier, i) {
+          if (typeof classifier === 'string') {
+            opt_classifiers[i] = tracking.ViolaJones.classifiers[classifier];
+          }
+          if (!opt_classifiers[i]) {
+            throw new Error('Object classifier not valid, try `new tracking.ObjectTracker("face")`.');
+          }
+        });
+      }
+    }
+
+    this.setClassifiers(opt_classifiers);
+  };
+
+  tracking.inherits(tracking.ObjectTracker, tracking.Tracker);
+
+  /**
+   * Specifies the edges density of a block in order to decide whether to skip
+   * it or not.
+   * @default 0.2
+   * @type {number}
+   */
+  tracking.ObjectTracker.prototype.edgesDensity = 0.2;
+
+  /**
+   * Specifies the initial scale to start the feature block scaling.
+   * @default 1.0
+   * @type {number}
+   */
+  tracking.ObjectTracker.prototype.initialScale = 1.0;
+
+  /**
+   * Specifies the scale factor to scale the feature block.
+   * @default 1.25
+   * @type {number}
+   */
+  tracking.ObjectTracker.prototype.scaleFactor = 1.25;
+
+  /**
+   * Specifies the block step size.
+   * @default 1.5
+   * @type {number}
+   */
+  tracking.ObjectTracker.prototype.stepSize = 1.5;
+
+  /**
+   * Gets the tracker HAAR classifiers.
+   * @return {TypedArray.<number>}
+   */
+  tracking.ObjectTracker.prototype.getClassifiers = function() {
+    return this.classifiers;
+  };
+
+  /**
+   * Gets the edges density value.
+   * @return {number}
+   */
+  tracking.ObjectTracker.prototype.getEdgesDensity = function() {
+    return this.edgesDensity;
+  };
+
+  /**
+   * Gets the initial scale to start the feature block scaling.
+   * @return {number}
+   */
+  tracking.ObjectTracker.prototype.getInitialScale = function() {
+    return this.initialScale;
+  };
+
+  /**
+   * Gets the scale factor to scale the feature block.
+   * @return {number}
+   */
+  tracking.ObjectTracker.prototype.getScaleFactor = function() {
+    return this.scaleFactor;
+  };
+
+  /**
+   * Gets the block step size.
+   * @return {number}
+   */
+  tracking.ObjectTracker.prototype.getStepSize = function() {
+    return this.stepSize;
+  };
+
+  /**
+   * Tracks the `Video` frames. This method is called for each video frame in
+   * order to emit `track` event.
+   * @param {Uint8ClampedArray} pixels The pixels data to track.
+   * @param {number} width The pixels canvas width.
+   * @param {number} height The pixels canvas height.
+   */
+  tracking.ObjectTracker.prototype.track = function(pixels, width, height) {
+    var self = this;
+    var classifiers = this.getClassifiers();
+
+    if (!classifiers) {
+      throw new Error('Object classifier not specified, try `new tracking.ObjectTracker("face")`.');
+    }
+
+    var results = [];
+
+    classifiers.forEach(function(classifier) {
+      results = results.concat(tracking.ViolaJones.detect(pixels, width, height, self.getInitialScale(), self.getScaleFactor(), self.getStepSize(), self.getEdgesDensity(), classifier));
+    });
+
+    this.emit('track', {
+      data: results
+    });
+  };
+
+  /**
+   * Sets the tracker HAAR classifiers.
+   * @param {TypedArray.<number>} classifiers
+   */
+  tracking.ObjectTracker.prototype.setClassifiers = function(classifiers) {
+    this.classifiers = classifiers;
+  };
+
+  /**
+   * Sets the edges density.
+   * @param {number} edgesDensity
+   */
+  tracking.ObjectTracker.prototype.setEdgesDensity = function(edgesDensity) {
+    this.edgesDensity = edgesDensity;
+  };
+
+  /**
+   * Sets the initial scale to start the block scaling.
+   * @param {number} initialScale
+   */
+  tracking.ObjectTracker.prototype.setInitialScale = function(initialScale) {
+    this.initialScale = initialScale;
+  };
+
+  /**
+   * Sets the scale factor to scale the feature block.
+   * @param {number} scaleFactor
+   */
+  tracking.ObjectTracker.prototype.setScaleFactor = function(scaleFactor) {
+    this.scaleFactor = scaleFactor;
+  };
+
+  /**
+   * Sets the block step size.
+   * @param {number} stepSize
+   */
+  tracking.ObjectTracker.prototype.setStepSize = function(stepSize) {
+    this.stepSize = stepSize;
+  };
+
+}());
+
+(function() {
+
+
+  tracking.LandmarksTracker = function() {
+    tracking.LandmarksTracker.base(this, 'constructor');
+  }
+
+  tracking.inherits(tracking.LandmarksTracker, tracking.ObjectTracker);
+
+  tracking.LandmarksTracker.prototype.track = function(pixels, width, height) {
+	 
+    var image = {
+      'data': pixels,
+      'width': width,
+      'height': height
+    };
+
+    var classifier = tracking.ViolaJones.classifiers['face'];
+
+    var faces = tracking.ViolaJones.detect(pixels, width, height, 
+      this.getInitialScale(), this.getScaleFactor(), this.getStepSize(), 
+      this.getEdgesDensity(), classifier);
+
+    var landmarks = tracking.LBF.align(pixels, width, height, faces);
+
+    this.emit('track', {
+      'data': {
+        'faces' : faces,
+        'landmarks' : landmarks
+      }
+    });
+
+  }
+
+}());
+
+(function() {
+
+  tracking.LBF = {};
+
+  /**
+   * LBF Regressor utility.
+   * @constructor
+   */
+  tracking.LBF.Regressor = function(maxNumStages){
+    this.maxNumStages = maxNumStages;
+
+    this.rfs = new Array(maxNumStages);
+    this.models = new Array(maxNumStages);
+    for(var i=0; i < maxNumStages; i++){
+      this.rfs[i] = new tracking.LBF.RandomForest(i);
+      this.models[i] = tracking.LBF.RegressorData[i].models;
+    }
+
+    this.meanShape = tracking.LBF.LandmarksData;
+  }
+
+  /**
+   * Predicts the position of the landmarks based on the bounding box of the face.
+   * @param {pixels} pixels The grayscale pixels in a linear array.
+   * @param {number} width Width of the image.
+   * @param {number} height Height of the image.
+   * @param {object} boudingBox Bounding box of the face to be aligned.
+   * @return {matrix} A matrix with each landmark position in a row [x,y].
+   */
+  tracking.LBF.Regressor.prototype.predict = function(pixels, width, height, boundingBox) {
+
+    var images = [];
+    var currentShapes = [];
+    var boundingBoxes = [];
+
+    var meanShapeClone = tracking.Matrix.clone(this.meanShape);
+
+    images.push({
+      'data': pixels,
+      'width': width,
+      'height': height
+    });
+    boundingBoxes.push(boundingBox);
+
+    currentShapes.push(tracking.LBF.projectShapeToBoundingBox_(meanShapeClone, boundingBox));
+
+    for(var stage = 0; stage < this.maxNumStages; stage++){
+      var binaryFeatures = tracking.LBF.Regressor.deriveBinaryFeat(this.rfs[stage], images, currentShapes, boundingBoxes, meanShapeClone);
+      this.applyGlobalPrediction(binaryFeatures, this.models[stage], currentShapes, boundingBoxes);
+    }
+
+    return currentShapes[0];
+  };
+
+  /**
+   * Multiplies the binary features of the landmarks with the regression matrix
+   * to obtain the displacement for each landmark. Then applies this displacement
+   * into the landmarks shape.
+   * @param {object} binaryFeatures The binary features for the landmarks.
+   * @param {object} models The regressor models.
+   * @param {matrix} currentShapes The landmarks shapes.
+   * @param {array} boudingBoxes The bounding boxes of the faces.
+   */
+  tracking.LBF.Regressor.prototype.applyGlobalPrediction = function(binaryFeatures, models, currentShapes, 
+    boundingBoxes){
+
+    var residual = currentShapes[0].length * 2;
+
+    var rotation = [];
+    var deltashape = new Array(residual/2);
+    for(var i=0; i < residual/2; i++){
+      deltashape[i] = [0.0, 0.0];
+    }
+
+    for(var i=0; i < currentShapes.length; i++){
+      for(var j=0; j < residual; j++){
+        var tmp = 0;
+        for(var lx=0, idx=0; (idx = binaryFeatures[i][lx].index) != -1; lx++){
+          if(idx <= models[j].nr_feature){
+            tmp += models[j].data[(idx - 1)] * binaryFeatures[i][lx].value;
+          }
+        }
+        if(j < residual/2){
+          deltashape[j][0] = tmp;
+        }else{
+          deltashape[j - residual/2][1] = tmp;
+        }
+      }
+
+      var res = tracking.LBF.similarityTransform_(tracking.LBF.unprojectShapeToBoundingBox_(currentShapes[i], boundingBoxes[i]), this.meanShape);
+      var rotation = tracking.Matrix.transpose(res[0]);
+
+      var s = tracking.LBF.unprojectShapeToBoundingBox_(currentShapes[i], boundingBoxes[i]);
+      s = tracking.Matrix.add(s, deltashape);
+
+      currentShapes[i] = tracking.LBF.projectShapeToBoundingBox_(s, boundingBoxes[i]);
+
+    }
+  };
+
+  /**
+   * Derives the binary features from the image for each landmark. 
+   * @param {object} forest The random forest to search for the best binary feature match.
+   * @param {array} images The images with pixels in a grayscale linear array.
+   * @param {array} currentShapes The current landmarks shape.
+   * @param {array} boudingBoxes The bounding boxes of the faces.
+   * @param {matrix} meanShape The mean shape of the current landmarks set.
+   * @return {array} The binary features extracted from the image and matched with the
+   *     training data.
+   * @static
+   */
+  tracking.LBF.Regressor.deriveBinaryFeat = function(forest, images, currentShapes, boundingBoxes, meanShape){
+
+    var binaryFeatures = new Array(images.length);
+    for(var i=0; i < images.length; i++){
+      var t = forest.maxNumTrees * forest.landmarkNum + 1;
+      binaryFeatures[i] = new Array(t);
+      for(var j=0; j < t; j++){
+        binaryFeatures[i][j] = {};
+      }
+    }
+
+    var leafnodesPerTree = 1 << (forest.maxDepth - 1);
+
+    for(var i=0; i < images.length; i++){
+
+      var projectedShape = tracking.LBF.unprojectShapeToBoundingBox_(currentShapes[i], boundingBoxes[i]);
+      var transform = tracking.LBF.similarityTransform_(projectedShape, meanShape);
+      
+      for(var j=0; j < forest.landmarkNum; j++){
+        for(var k=0; k < forest.maxNumTrees; k++){
+
+          var binaryCode = tracking.LBF.Regressor.getCodeFromTree(forest.rfs[j][k], images[i], 
+                              currentShapes[i], boundingBoxes[i], transform[0], transform[1]);
+
+          var index = j*forest.maxNumTrees + k;
+          binaryFeatures[i][index].index = leafnodesPerTree * index + binaryCode;
+          binaryFeatures[i][index].value = 1;
+
+        }
+      }
+      binaryFeatures[i][forest.landmarkNum * forest.maxNumTrees].index = -1;
+      binaryFeatures[i][forest.landmarkNum * forest.maxNumTrees].value = -1;
+    }
+    return binaryFeatures;
+
+  }
+
+  /**
+   * Gets the binary code for a specific tree in a random forest. For each landmark,
+   * the position from two pre-defined points are recovered from the training data
+   * and then the intensity of the pixels corresponding to these points is extracted 
+   * from the image and used to traverse the trees in the random forest. At the end,
+   * the ending nodes will be represented by 1, and the remaining nodes by 0.
+   * 
+   * +--------------------------- Random Forest -----------------------------+ 
+   * | Ø = Ending leaf                                                       |
+   * |                                                                       |
+   * |       O             O             O             O             O       |
+   * |     /   \         /   \         /   \         /   \         /   \     |
+   * |    O     O       O     O       O     O       O     O       O     O    |
+   * |   / \   / \     / \   / \     / \   / \     / \   / \     / \   / \   |
+   * |  Ø   O O   O   O   O Ø   O   O   Ø O   O   O   O Ø   O   O   O O   Ø  |
+   * |  1   0 0   0   0   0 1   0   0   1 0   0   0   0 1   0   0   0 0   1  |
+   * +-----------------------------------------------------------------------+
+   * Final binary code for this landmark: 10000010010000100001
+   *
+   * @param {object} forest The tree to be analyzed.
+   * @param {array} image The image with pixels in a grayscale linear array.
+   * @param {matrix} shape The current landmarks shape.
+   * @param {object} boudingBoxes The bounding box of the face.
+   * @param {matrix} rotation The rotation matrix used to transform the projected landmarks
+   *     into the mean shape.
+   * @param {number} scale The scale factor used to transform the projected landmarks
+   *     into the mean shape.
+   * @return {number} The binary code extracted from the tree.
+   * @static
+   */
+  tracking.LBF.Regressor.getCodeFromTree = function(tree, image, shape, boundingBox, rotation, scale){
+    var current = 0;
+    var bincode = 0;
+
+    while(true){
+      
+      var x1 = Math.cos(tree.nodes[current].feats[0]) * tree.nodes[current].feats[2] * tree.maxRadioRadius * boundingBox.width;
+      var y1 = Math.sin(tree.nodes[current].feats[0]) * tree.nodes[current].feats[2] * tree.maxRadioRadius * boundingBox.height;
+      var x2 = Math.cos(tree.nodes[current].feats[1]) * tree.nodes[current].feats[3] * tree.maxRadioRadius * boundingBox.width;
+      var y2 = Math.sin(tree.nodes[current].feats[1]) * tree.nodes[current].feats[3] * tree.maxRadioRadius * boundingBox.height;
+
+      var project_x1 = rotation[0][0] * x1 + rotation[0][1] * y1;
+      var project_y1 = rotation[1][0] * x1 + rotation[1][1] * y1;
+
+      var real_x1 = Math.floor(project_x1 + shape[tree.landmarkID][0]);
+      var real_y1 = Math.floor(project_y1 + shape[tree.landmarkID][1]);
+      real_x1 = Math.max(0.0, Math.min(real_x1, image.height - 1.0));
+      real_y1 = Math.max(0.0, Math.min(real_y1, image.width - 1.0));
+
+      var project_x2 = rotation[0][0] * x2 + rotation[0][1] * y2;
+      var project_y2 = rotation[1][0] * x2 + rotation[1][1] * y2;
+
+      var real_x2 = Math.floor(project_x2 + shape[tree.landmarkID][0]);
+      var real_y2 = Math.floor(project_y2 + shape[tree.landmarkID][1]);
+      real_x2 = Math.max(0.0, Math.min(real_x2, image.height - 1.0));
+      real_y2 = Math.max(0.0, Math.min(real_y2, image.width - 1.0));
+      var pdf = Math.floor(image.data[real_y1*image.width + real_x1]) - 
+          Math.floor(image.data[real_y2 * image.width +real_x2]);
+
+      if(pdf < tree.nodes[current].thresh){
+        current = tree.nodes[current].cnodes[0];
+      }else{
+        current = tree.nodes[current].cnodes[1];
+      }
+
+      if (tree.nodes[current].is_leafnode == 1) {
+        bincode = 1;
+        for (var i=0; i < tree.leafnodes.length; i++) {
+          if (tree.leafnodes[i] == current) {
+            return bincode;
+          }
+          bincode++;
+        }
+        return bincode;
+      }
+
+    }
+
+    return bincode;
+  }
+
+}());
+(function() {
+  /**
+   * Face Alignment via Regressing Local Binary Features (LBF)
+   * This approach has two components: a set of local binary features and
+   * a locality principle for learning those features.
+   * The locality principle is used to guide the learning of a set of highly
+   * discriminative local binary features for each landmark independently.
+   * The obtained local binary features are used to learn a linear regression
+   * that later will be used to guide the landmarks in the alignment phase.
+   * 
+   * @authors: VoxarLabs Team (http://cin.ufpe.br/~voxarlabs)
+   *           Lucas Figueiredo <lsf@cin.ufpe.br>, Thiago Menezes <tmc2@cin.ufpe.br>,
+   *           Thiago Domingues <tald@cin.ufpe.br>, Rafael Roberto <rar3@cin.ufpe.br>,
+   *           Thulio Araujo <tlsa@cin.ufpe.br>, Joao Victor <jvfl@cin.ufpe.br>,
+   *           Tomer Simis <tls@cin.ufpe.br>)
+   */
+  
+  /**
+   * Holds the maximum number of stages that will be used in the alignment algorithm.
+   * Each stage contains a different set of random forests and retrieves the binary
+   * code from a more "specialized" (i.e. smaller) region around the landmarks.
+   * @type {number}
+   * @static
+   */
+  tracking.LBF.maxNumStages = 4;
+
+  /**
+   * Holds the regressor that will be responsible for extracting the local features from 
+   * the image and guide the landmarks using the training data.
+   * @type {object}
+   * @protected
+   * @static
+   */
+  tracking.LBF.regressor_ = null; 
+  
+  /**
+   * Generates a set of landmarks for a set of faces
+   * @param {pixels} pixels The pixels in a linear [r,g,b,a,...] array.
+   * @param {number} width The image width.
+   * @param {number} height The image height.
+   * @param {array} faces The list of faces detected in the image
+   * @return {array} The aligned landmarks, each set of landmarks corresponding
+   *     to a specific face.
+   * @static
+   */
+  tracking.LBF.align = function(pixels, width, height, faces){
+
+    if(tracking.LBF.regressor_ == null){
+      tracking.LBF.regressor_ = new tracking.LBF.Regressor(
+        tracking.LBF.maxNumStages
+      );
+    }
+
+    pixels = tracking.Image.grayscale(pixels, width, height, false);
+
+    pixels = tracking.Image.equalizeHist(pixels, width, height);
+
+    var shapes = new Array(faces.length);
+
+    for(var i in faces){
+
+      faces[i].height = faces[i].width;
+
+      var boundingBox = {};
+      boundingBox.startX = faces[i].x;
+      boundingBox.startY = faces[i].y;
+      boundingBox.width = faces[i].width;
+      boundingBox.height = faces[i].height;
+
+      shapes[i] = tracking.LBF.regressor_.predict(pixels, width, height, boundingBox);
+    }
+
+    return shapes;
+  }
+
+  /**
+   * Unprojects the landmarks shape from the bounding box.
+   * @param {matrix} shape The landmarks shape.
+   * @param {matrix} boudingBox The bounding box.
+   * @return {matrix} The landmarks shape projected into the bounding box.
+   * @static
+   * @protected
+   */
+  tracking.LBF.unprojectShapeToBoundingBox_ = function(shape, boundingBox){
+    var temp = new Array(shape.length);
+    for(var i=0; i < shape.length; i++){
+      temp[i] = [
+        (shape[i][0] - boundingBox.startX) / boundingBox.width,
+        (shape[i][1] - boundingBox.startY) / boundingBox.height
+      ];
+    }
+    return temp;
+  }
+
+  /**
+   * Projects the landmarks shape into the bounding box. The landmarks shape has
+   * normalized coordinates, so it is necessary to map these coordinates into
+   * the bounding box coordinates.
+   * @param {matrix} shape The landmarks shape.
+   * @param {matrix} boudingBox The bounding box.
+   * @return {matrix} The landmarks shape.
+   * @static
+   * @protected
+   */
+  tracking.LBF.projectShapeToBoundingBox_ = function(shape, boundingBox){
+    var temp = new Array(shape.length);
+    for(var i=0; i < shape.length; i++){
+      temp[i] = [
+        shape[i][0] * boundingBox.width + boundingBox.startX,
+        shape[i][1] * boundingBox.height + boundingBox.startY
+      ];
+    }
+    return temp;
+  }
+
+  /**
+   * Calculates the rotation and scale necessary to transform shape1 into shape2.
+   * @param {matrix} shape1 The shape to be transformed.
+   * @param {matrix} shape2 The shape to be transformed in.
+   * @return {[matrix, scalar]} The rotation matrix and scale that applied to shape1
+   *     results in shape2.
+   * @static
+   * @protected
+   */
+  tracking.LBF.similarityTransform_ = function(shape1, shape2){
+
+    var center1 = [0,0];
+    var center2 = [0,0];
+    for (var i = 0; i < shape1.length; i++) {
+      center1[0] += shape1[i][0];
+      center1[1] += shape1[i][1];
+      center2[0] += shape2[i][0];
+      center2[1] += shape2[i][1];
+    }
+    center1[0] /= shape1.length;
+    center1[1] /= shape1.length;
+    center2[0] /= shape2.length;
+    center2[1] /= shape2.length;
+
+    var temp1 = tracking.Matrix.clone(shape1);
+    var temp2 = tracking.Matrix.clone(shape2);
+    for(var i=0; i < shape1.length; i++){
+      temp1[i][0] -= center1[0];
+      temp1[i][1] -= center1[1];
+      temp2[i][0] -= center2[0];
+      temp2[i][1] -= center2[1];
+    }
+
+    var covariance1, covariance2;
+    var mean1, mean2;
+
+    var t = tracking.Matrix.calcCovarMatrix(temp1);
+    covariance1 = t[0];
+    mean1 = t[1];
+
+    t = tracking.Matrix.calcCovarMatrix(temp2);
+    covariance2 = t[0];
+    mean2 = t[1];
+
+    var s1 = Math.sqrt(tracking.Matrix.norm(covariance1));
+    var s2 = Math.sqrt(tracking.Matrix.norm(covariance2));
+
+    var scale = s1/s2;
+    temp1 = tracking.Matrix.mulScalar(1.0/s1, temp1);
+    temp2 = tracking.Matrix.mulScalar(1.0/s2, temp2);
+
+    var num = 0, den = 0;
+    for (var i = 0; i < shape1.length; i++) {
+      num = num + temp1[i][1] * temp2[i][0] - temp1[i][0] * temp2[i][1];
+      den = den + temp1[i][0] * temp2[i][0] + temp1[i][1] * temp2[i][1];
+    }
+
+    var norm = Math.sqrt(num*num + den*den);
+    var sin_theta = num/norm;
+    var cos_theta = den/norm;
+    var rotation = [
+      [cos_theta, -sin_theta],
+      [sin_theta, cos_theta]
+    ];
+
+    return [rotation, scale];
+  }
+
+  /**
+   * LBF Random Forest data structure.
+   * @static
+   * @constructor
+   */
+  tracking.LBF.RandomForest = function(forestIndex){
+    this.maxNumTrees = tracking.LBF.RegressorData[forestIndex].max_numtrees;
+    this.landmarkNum = tracking.LBF.RegressorData[forestIndex].num_landmark;
+    this.maxDepth = tracking.LBF.RegressorData[forestIndex].max_depth;
+    this.stages = tracking.LBF.RegressorData[forestIndex].stages; 
+
+    this.rfs = new Array(this.landmarkNum);
+    for(var i=0; i < this.landmarkNum; i++){
+      this.rfs[i] = new Array(this.maxNumTrees);
+      for(var j=0; j < this.maxNumTrees; j++){
+        this.rfs[i][j] = new tracking.LBF.Tree(forestIndex, i, j);
+      }
+    }
+  }
+
+  /**
+   * LBF Tree data structure.
+   * @static
+   * @constructor
+   */
+  tracking.LBF.Tree = function(forestIndex, landmarkIndex, treeIndex){
+    var data = tracking.LBF.RegressorData[forestIndex].landmarks[landmarkIndex][treeIndex];
+    this.maxDepth = data.max_depth;
+    this.maxNumNodes = data.max_numnodes;
+    this.nodes = data.nodes;
+    this.landmarkID = data.landmark_id;
+    this.numLeafnodes = data.num_leafnodes;
+    this.numNodes = data.num_nodes;
+    this.maxNumFeats = data.max_numfeats;
+    this.maxRadioRadius = data.max_radio_radius;
+    this.leafnodes = data.id_leafnodes;
+  }
+
+}());

Algunos archivos no se mostraron porque demasiados archivos cambiaron en este cambio